SE453796B - Fast, terapeutisk komposition vars berarbasmaterial utgores av hydroxypropylmetylcellulosa samt ev natriumkarboximetylcellulosa - Google Patents
Fast, terapeutisk komposition vars berarbasmaterial utgores av hydroxypropylmetylcellulosa samt ev natriumkarboximetylcellulosaInfo
- Publication number
- SE453796B SE453796B SE8207167A SE8207167A SE453796B SE 453796 B SE453796 B SE 453796B SE 8207167 A SE8207167 A SE 8207167A SE 8207167 A SE8207167 A SE 8207167A SE 453796 B SE453796 B SE 453796B
- Authority
- SE
- Sweden
- Prior art keywords
- weight
- tablets
- drugs
- tablet
- minutes
- Prior art date
Links
- -1 HYDROXYPROPYLMETHYL Chemical class 0.000 title claims description 34
- 239000000203 mixture Substances 0.000 title claims description 21
- 239000000463 material Substances 0.000 title claims description 7
- 230000001225 therapeutic effect Effects 0.000 title description 4
- 239000011734 sodium Substances 0.000 title description 2
- 229910052708 sodium Inorganic materials 0.000 title description 2
- 229940079593 drug Drugs 0.000 claims description 56
- 239000003814 drug Substances 0.000 claims description 56
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 claims description 35
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 claims description 35
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 claims description 31
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 claims description 31
- 239000004615 ingredient Substances 0.000 claims description 22
- 239000004480 active ingredient Substances 0.000 claims description 7
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 6
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 6
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 5
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 5
- 239000000829 suppository Substances 0.000 claims description 5
- 238000004090 dissolution Methods 0.000 claims description 4
- 210000000936 intestine Anatomy 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 3
- 239000006187 pill Substances 0.000 claims description 3
- 239000008280 blood Substances 0.000 claims description 2
- 210000004369 blood Anatomy 0.000 claims description 2
- 201000010099 disease Diseases 0.000 claims description 2
- 230000005923 long-lasting effect Effects 0.000 claims description 2
- 230000003187 abdominal effect Effects 0.000 claims 1
- 239000002552 dosage form Substances 0.000 claims 1
- 230000001575 pathological effect Effects 0.000 claims 1
- 230000009885 systemic effect Effects 0.000 claims 1
- 239000003826 tablet Substances 0.000 description 84
- 229920003091 Methocel™ Polymers 0.000 description 19
- 229920000642 polymer Polymers 0.000 description 13
- 239000007788 liquid Substances 0.000 description 9
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000003708 ampul Substances 0.000 description 7
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 7
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
- 230000006835 compression Effects 0.000 description 6
- 238000007906 compression Methods 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 229910052808 lithium carbonate Inorganic materials 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000932 sedative agent Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 4
- 229960001138 acetylsalicylic acid Drugs 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 238000004049 embossing Methods 0.000 description 4
- MOYKHGMNXAOIAT-JGWLITMVSA-N isosorbide dinitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O[N+](=O)[O-])CO[C@@H]21 MOYKHGMNXAOIAT-JGWLITMVSA-N 0.000 description 4
- 229960000201 isosorbide dinitrate Drugs 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 239000005060 rubber Substances 0.000 description 4
- 229940125723 sedative agent Drugs 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 3
- 239000001856 Ethyl cellulose Substances 0.000 description 3
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 3
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- 229930003268 Vitamin C Natural products 0.000 description 3
- 239000003146 anticoagulant agent Substances 0.000 description 3
- 229940127219 anticoagulant drug Drugs 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 229920001249 ethyl cellulose Polymers 0.000 description 3
- 235000019325 ethyl cellulose Nutrition 0.000 description 3
- 239000003172 expectorant agent Substances 0.000 description 3
- 230000003419 expectorant effect Effects 0.000 description 3
- 229940066493 expectorants Drugs 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 229960003711 glyceryl trinitrate Drugs 0.000 description 3
- 239000008141 laxative Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 229940057948 magnesium stearate Drugs 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 238000004080 punching Methods 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 230000002459 sustained effect Effects 0.000 description 3
- 239000003071 vasodilator agent Substances 0.000 description 3
- 235000019154 vitamin C Nutrition 0.000 description 3
- 239000011718 vitamin C Substances 0.000 description 3
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- 208000035473 Communicable disease Diseases 0.000 description 2
- 206010011224 Cough Diseases 0.000 description 2
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 2
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 2
- 229920003102 Methocel™ E4M Polymers 0.000 description 2
- 208000019695 Migraine disease Diseases 0.000 description 2
- 206010028813 Nausea Diseases 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 239000000006 Nitroglycerin Substances 0.000 description 2
- BRUQQQPBMZOVGD-XFKAJCMBSA-N Oxycodone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(OC)C2=C5[C@@]13CCN4C BRUQQQPBMZOVGD-XFKAJCMBSA-N 0.000 description 2
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 2
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000003570 air Substances 0.000 description 2
- 238000007605 air drying Methods 0.000 description 2
- 229940069428 antacid Drugs 0.000 description 2
- 239000003159 antacid agent Substances 0.000 description 2
- 230000002921 anti-spasmodic effect Effects 0.000 description 2
- 239000003793 antidiarrheal agent Substances 0.000 description 2
- 239000000739 antihistaminic agent Substances 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 229940127088 antihypertensive drug Drugs 0.000 description 2
- 229940124575 antispasmodic agent Drugs 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 229920003086 cellulose ether Polymers 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 210000004392 genitalia Anatomy 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 230000000147 hypnotic effect Effects 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 229940125722 laxative agent Drugs 0.000 description 2
- INHCSSUBVCNVSK-UHFFFAOYSA-L lithium sulfate Chemical compound [Li+].[Li+].[O-]S([O-])(=O)=O INHCSSUBVCNVSK-UHFFFAOYSA-L 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 230000008693 nausea Effects 0.000 description 2
- 230000002232 neuromuscular Effects 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 229960002085 oxycodone Drugs 0.000 description 2
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 description 2
- DHHVAGZRUROJKS-UHFFFAOYSA-N phentermine Chemical compound CC(C)(N)CC1=CC=CC=C1 DHHVAGZRUROJKS-UHFFFAOYSA-N 0.000 description 2
- 230000000506 psychotropic effect Effects 0.000 description 2
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 description 2
- 239000000021 stimulant Substances 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- 229940116269 uric acid Drugs 0.000 description 2
- 229940124549 vasodilator Drugs 0.000 description 2
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 description 2
- 229930003231 vitamin Natural products 0.000 description 2
- 235000013343 vitamin Nutrition 0.000 description 2
- 229940088594 vitamin Drugs 0.000 description 2
- 239000011782 vitamin Substances 0.000 description 2
- GVJHHUAWPYXKBD-IEOSBIPESA-N α-tocopherol Chemical compound OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-IEOSBIPESA-N 0.000 description 2
- DBGIVFWFUFKIQN-UHFFFAOYSA-N (+-)-Fenfluramine Chemical compound CCNC(C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-UHFFFAOYSA-N 0.000 description 1
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- AKNNEGZIBPJZJG-MSOLQXFVSA-N (-)-noscapine Chemical compound CN1CCC2=CC=3OCOC=3C(OC)=C2[C@@H]1[C@@H]1C2=CC=C(OC)C(OC)=C2C(=O)O1 AKNNEGZIBPJZJG-MSOLQXFVSA-N 0.000 description 1
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 description 1
- ZGSZBVAEVPSPFM-HYTSPMEMSA-N (4r,4ar,7s,7ar,12bs)-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol;(2r,3r)-2,3-dihydroxybutanedioic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.C([C@H]1[C@H](N(CC[C@@]112)C)C3)C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC ZGSZBVAEVPSPFM-HYTSPMEMSA-N 0.000 description 1
- DKSZLDSPXIWGFO-BLOJGBSASA-N (4r,4ar,7s,7ar,12bs)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol;phosphoric acid;hydrate Chemical compound O.OP(O)(O)=O.OP(O)(O)=O.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC DKSZLDSPXIWGFO-BLOJGBSASA-N 0.000 description 1
- BCXHDORHMMZBBZ-DORFAMGDSA-N (4r,4ar,7s,7ar,12bs)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol;sulfuric acid Chemical compound OS(O)(=O)=O.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC BCXHDORHMMZBBZ-DORFAMGDSA-N 0.000 description 1
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 1
- 229930182837 (R)-adrenaline Natural products 0.000 description 1
- ZHNFLHYOFXQIOW-AHSOWCEXSA-N (s)-[(2r,4s,5r)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid;dihydrate Chemical compound O.O.OS(O)(=O)=O.C([C@H]([C@H](C1)C=C)C2)CN1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21.C([C@H]([C@H](C1)C=C)C2)CN1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 ZHNFLHYOFXQIOW-AHSOWCEXSA-N 0.000 description 1
- CVHXQHIJOULCNQ-UHFFFAOYSA-N 1,3-dinitrooxypropan-2-yl nitrate;1-nitropropane-1,2,3-triol Chemical compound OCC(O)C(O)[N+]([O-])=O.[O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O CVHXQHIJOULCNQ-UHFFFAOYSA-N 0.000 description 1
- SEVKYLYIYIKRSW-UHFFFAOYSA-N 1-phenylpropan-2-ylazanium;chloride Chemical compound Cl.CC(N)CC1=CC=CC=C1 SEVKYLYIYIKRSW-UHFFFAOYSA-N 0.000 description 1
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 1
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 1
- MEAPRSDUXBHXGD-UHFFFAOYSA-N 3-chloro-n-(4-propan-2-ylphenyl)propanamide Chemical compound CC(C)C1=CC=C(NC(=O)CCCl)C=C1 MEAPRSDUXBHXGD-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- 229930008281 A03AD01 - Papaverine Natural products 0.000 description 1
- 229930000680 A04AD01 - Scopolamine Natural products 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000020925 Bipolar disease Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000000059 Dyspnea Diseases 0.000 description 1
- 206010013975 Dyspnoeas Diseases 0.000 description 1
- UIOFUWFRIANQPC-JKIFEVAISA-N Floxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(F)C=CC=C1Cl UIOFUWFRIANQPC-JKIFEVAISA-N 0.000 description 1
- PLDUPXSUYLZYBN-UHFFFAOYSA-N Fluphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 PLDUPXSUYLZYBN-UHFFFAOYSA-N 0.000 description 1
- 102000051325 Glucagon Human genes 0.000 description 1
- 108060003199 Glucagon Proteins 0.000 description 1
- HSRJKNPTNIJEKV-UHFFFAOYSA-N Guaifenesin Chemical compound COC1=CC=CC=C1OCC(O)CO HSRJKNPTNIJEKV-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- STECJAGHUSJQJN-GAUPFVANSA-N Hyoscine Natural products C1([C@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-GAUPFVANSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 208000013016 Hypoglycemia Diseases 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- DHUZAAUGHUHIDS-ONEGZZNKSA-N Isomyristicin Chemical compound COC1=CC(\C=C\C)=CC2=C1OCO2 DHUZAAUGHUHIDS-ONEGZZNKSA-N 0.000 description 1
- PWWVAXIEGOYWEE-UHFFFAOYSA-N Isophenergan Chemical compound C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 PWWVAXIEGOYWEE-UHFFFAOYSA-N 0.000 description 1
- MKXZASYAUGDDCJ-SZMVWBNQSA-N LSM-2525 Chemical compound C1CCC[C@H]2[C@@]3([H])N(C)CC[C@]21C1=CC(OC)=CC=C1C3 MKXZASYAUGDDCJ-SZMVWBNQSA-N 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- ROAIXOJGRFKICW-UHFFFAOYSA-N Methenamine hippurate Chemical compound C1N(C2)CN3CN1CN2C3.OC(=O)CNC(=O)C1=CC=CC=C1 ROAIXOJGRFKICW-UHFFFAOYSA-N 0.000 description 1
- 229920003095 Methocel™ K15M Polymers 0.000 description 1
- 229920003094 Methocel™ K4M Polymers 0.000 description 1
- DUGOZIWVEXMGBE-UHFFFAOYSA-N Methylphenidate Chemical compound C=1C=CC=CC=1C(C(=O)OC)C1CCCCN1 DUGOZIWVEXMGBE-UHFFFAOYSA-N 0.000 description 1
- STECJAGHUSJQJN-UHFFFAOYSA-N N-Methyl-scopolamin Natural products C1C(C2C3O2)N(C)C3CC1OC(=O)C(CO)C1=CC=CC=C1 STECJAGHUSJQJN-UHFFFAOYSA-N 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 description 1
- KNAHARQHSZJURB-UHFFFAOYSA-N Propylthiouracile Chemical compound CCCC1=CC(=O)NC(=S)N1 KNAHARQHSZJURB-UHFFFAOYSA-N 0.000 description 1
- 102000007327 Protamines Human genes 0.000 description 1
- 108010007568 Protamines Proteins 0.000 description 1
- GBFLZEXEOZUWRN-VKHMYHEASA-N S-carboxymethyl-L-cysteine Chemical compound OC(=O)[C@@H](N)CSCC(O)=O GBFLZEXEOZUWRN-VKHMYHEASA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UZMAPBJVXOGOFT-UHFFFAOYSA-N Syringetin Natural products COC1=C(O)C(OC)=CC(C2=C(C(=O)C3=C(O)C=C(O)C=C3O2)O)=C1 UZMAPBJVXOGOFT-UHFFFAOYSA-N 0.000 description 1
- SEQDDYPDSLOBDC-UHFFFAOYSA-N Temazepam Chemical compound N=1C(O)C(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 SEQDDYPDSLOBDC-UHFFFAOYSA-N 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 description 1
- KLBQZWRITKRQQV-UHFFFAOYSA-N Thioridazine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2N1CCC1CCCCN1C KLBQZWRITKRQQV-UHFFFAOYSA-N 0.000 description 1
- 208000024799 Thyroid disease Diseases 0.000 description 1
- AUYYCJSJGJYCDS-LBPRGKRZSA-N Thyrolar Chemical compound IC1=CC(C[C@H](N)C(O)=O)=CC(I)=C1OC1=CC=C(O)C(I)=C1 AUYYCJSJGJYCDS-LBPRGKRZSA-N 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- FNYLWPVRPXGIIP-UHFFFAOYSA-N Triamterene Chemical compound NC1=NC2=NC(N)=NC(N)=C2N=C1C1=CC=CC=C1 FNYLWPVRPXGIIP-UHFFFAOYSA-N 0.000 description 1
- SEQKRHFRPICQDD-UHFFFAOYSA-N Tricine Natural products OCC(CO)(CO)[NH2+]CC([O-])=O SEQKRHFRPICQDD-UHFFFAOYSA-N 0.000 description 1
- 239000007997 Tricine buffer Substances 0.000 description 1
- 206010046996 Varicose vein Diseases 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- 241000234314 Zingiber Species 0.000 description 1
- 235000006886 Zingiber officinale Nutrition 0.000 description 1
- MKFFGUZYVNDHIH-UHFFFAOYSA-N [2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium;sulfate Chemical compound OS(O)(=O)=O.CC(C)NCC(O)C1=CC(O)=CC(O)=C1.CC(C)NCC(O)C1=CC(O)=CC(O)=C1 MKFFGUZYVNDHIH-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 230000007488 abnormal function Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 1
- OFCNXPDARWKPPY-UHFFFAOYSA-N allopurinol Chemical compound OC1=NC=NC2=C1C=NN2 OFCNXPDARWKPPY-UHFFFAOYSA-N 0.000 description 1
- 229960003459 allopurinol Drugs 0.000 description 1
- 229940087168 alpha tocopherol Drugs 0.000 description 1
- AKNNEGZIBPJZJG-UHFFFAOYSA-N alpha-noscapine Natural products CN1CCC2=CC=3OCOC=3C(OC)=C2C1C1C2=CC=C(OC)C(OC)=C2C(=O)O1 AKNNEGZIBPJZJG-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 229960003556 aminophylline Drugs 0.000 description 1
- FQPFAHBPWDRTLU-UHFFFAOYSA-N aminophylline Chemical compound NCCN.O=C1N(C)C(=O)N(C)C2=C1NC=N2.O=C1N(C)C(=O)N(C)C2=C1NC=N2 FQPFAHBPWDRTLU-UHFFFAOYSA-N 0.000 description 1
- PYHRZPFZZDCOPH-UHFFFAOYSA-N amphetamine sulfate Chemical compound OS(O)(=O)=O.CC(N)CC1=CC=CC=C1.CC(N)CC1=CC=CC=C1 PYHRZPFZZDCOPH-UHFFFAOYSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 230000001195 anabolic effect Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 230000001142 anti-diarrhea Effects 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 229940124599 anti-inflammatory drug Drugs 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 239000000924 antiasthmatic agent Substances 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229940125714 antidiarrheal agent Drugs 0.000 description 1
- 239000000729 antidote Substances 0.000 description 1
- 229940075522 antidotes Drugs 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 239000003200 antithyroid agent Substances 0.000 description 1
- 229940043671 antithyroid preparations Drugs 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 229940124584 antitussives Drugs 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 208000028683 bipolar I disease Diseases 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 229960004895 bretylium tosylate Drugs 0.000 description 1
- KVWNWTZZBKCOPM-UHFFFAOYSA-M bretylium tosylate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CC[N+](C)(C)CC1=CC=CC=C1Br KVWNWTZZBKCOPM-UHFFFAOYSA-M 0.000 description 1
- LHMHCLYDBQOYTO-UHFFFAOYSA-N bromofluoromethane Chemical compound FCBr LHMHCLYDBQOYTO-UHFFFAOYSA-N 0.000 description 1
- RMRJXGBAOAMLHD-IHFGGWKQSA-N buprenorphine Chemical compound C([C@]12[C@H]3OC=4C(O)=CC=C(C2=4)C[C@@H]2[C@]11CC[C@]3([C@H](C1)[C@](C)(O)C(C)(C)C)OC)CN2CC1CC1 RMRJXGBAOAMLHD-IHFGGWKQSA-N 0.000 description 1
- 229960001736 buprenorphine Drugs 0.000 description 1
- 239000004227 calcium gluconate Substances 0.000 description 1
- 229960004494 calcium gluconate Drugs 0.000 description 1
- 235000013927 calcium gluconate Nutrition 0.000 description 1
- NEEHYRZPVYRGPP-UHFFFAOYSA-L calcium;2,3,4,5,6-pentahydroxyhexanoate Chemical compound [Ca+2].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O NEEHYRZPVYRGPP-UHFFFAOYSA-L 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229960001927 cetylpyridinium chloride Drugs 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 229960003260 chlorhexidine Drugs 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 229960001076 chlorpromazine Drugs 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 description 1
- 229960004415 codeine phosphate Drugs 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 229960003710 dantrolene sodium Drugs 0.000 description 1
- LTWQNYPDAUSXBC-CDJGKPBYSA-L dantrolene sodium hemiheptahydrate Chemical compound O.O.O.O.O.O.O.[Na+].[Na+].C1=CC([N+](=O)[O-])=CC=C1C(O1)=CC=C1\C=N\N1C(=O)[N-]C(=O)C1.C1=CC([N+](=O)[O-])=CC=C1C(O1)=CC=C1\C=N\N1C(=O)[N-]C(=O)C1 LTWQNYPDAUSXBC-CDJGKPBYSA-L 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 229960003914 desipramine Drugs 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 229960001985 dextromethorphan Drugs 0.000 description 1
- NIJJYAXOARWZEE-UHFFFAOYSA-N di-n-propyl-acetic acid Natural products CCCC(C(O)=O)CCC NIJJYAXOARWZEE-UHFFFAOYSA-N 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- 229960001259 diclofenac Drugs 0.000 description 1
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 description 1
- CURUTKGFNZGFSE-UHFFFAOYSA-N dicyclomine Chemical compound C1CCCCC1C1(C(=O)OCCN(CC)CC)CCCCC1 CURUTKGFNZGFSE-UHFFFAOYSA-N 0.000 description 1
- 229960002777 dicycloverine Drugs 0.000 description 1
- KCFYHBSOLOXZIF-UHFFFAOYSA-N dihydrochrysin Natural products COC1=C(O)C(OC)=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2)=C1 KCFYHBSOLOXZIF-UHFFFAOYSA-N 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- 229960000520 diphenhydramine Drugs 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 229960004192 diphenoxylate Drugs 0.000 description 1
- HYPPXZBJBPSRLK-UHFFFAOYSA-N diphenoxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1CCC(C#N)(C=1C=CC=CC=1)C1=CC=CC=C1 HYPPXZBJBPSRLK-UHFFFAOYSA-N 0.000 description 1
- 229960000879 diphenylpyraline Drugs 0.000 description 1
- OWQUZNMMYNAXSL-UHFFFAOYSA-N diphenylpyraline Chemical compound C1CN(C)CCC1OC(C=1C=CC=CC=1)C1=CC=CC=C1 OWQUZNMMYNAXSL-UHFFFAOYSA-N 0.000 description 1
- 229960001066 disopyramide Drugs 0.000 description 1
- UVTNFZQICZKOEM-UHFFFAOYSA-N disopyramide Chemical compound C=1C=CC=NC=1C(C(N)=O)(CCN(C(C)C)C(C)C)C1=CC=CC=C1 UVTNFZQICZKOEM-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 description 1
- DLNKOYKMWOXYQA-UHFFFAOYSA-N dl-pseudophenylpropanolamine Natural products CC(N)C(O)C1=CC=CC=C1 DLNKOYKMWOXYQA-UHFFFAOYSA-N 0.000 description 1
- ODQWQRRAPPTVAG-GZTJUZNOSA-N doxepin Chemical compound C1OC2=CC=CC=C2C(=C/CCN(C)C)/C2=CC=CC=C21 ODQWQRRAPPTVAG-GZTJUZNOSA-N 0.000 description 1
- 229960005426 doxepin Drugs 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 229960005139 epinephrine Drugs 0.000 description 1
- OFKDAAIKGIBASY-VFGNJEKYSA-N ergotamine Chemical compound C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2C(C3=CC=CC4=NC=C([C]34)C2)=C1)C)C1=CC=CC=C1 OFKDAAIKGIBASY-VFGNJEKYSA-N 0.000 description 1
- 229960004943 ergotamine Drugs 0.000 description 1
- XCGSFFUVFURLIX-UHFFFAOYSA-N ergotaminine Natural products C1=C(C=2C=CC=C3NC=C(C=23)C2)C2N(C)CC1C(=O)NC(C(N12)=O)(C)OC1(O)C1CCCN1C(=O)C2CC1=CC=CC=C1 XCGSFFUVFURLIX-UHFFFAOYSA-N 0.000 description 1
- 229960003276 erythromycin Drugs 0.000 description 1
- 230000000913 erythropoietic effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000013265 extended release Methods 0.000 description 1
- 229960001877 fenfluramine hydrochloride Drugs 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229960004273 floxacillin Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229960002390 flurbiprofen Drugs 0.000 description 1
- SYTBZMRGLBWNTM-UHFFFAOYSA-N flurbiprofen Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=CC=CC=C1 SYTBZMRGLBWNTM-UHFFFAOYSA-N 0.000 description 1
- 239000011724 folic acid Substances 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 235000019152 folic acid Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 235000008397 ginger Nutrition 0.000 description 1
- 229960004666 glucagon Drugs 0.000 description 1
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 1
- 229960002146 guaifenesin Drugs 0.000 description 1
- 229960002096 guanethidine monosulfate Drugs 0.000 description 1
- YUFWAVFNITUSHI-UHFFFAOYSA-N guanethidine monosulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.NC(=N)NCCN1CCCCCCC1 YUFWAVFNITUSHI-UHFFFAOYSA-N 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 230000002607 hemopoietic effect Effects 0.000 description 1
- 230000010224 hepatic metabolism Effects 0.000 description 1
- UXNFIJPHRQEWRQ-UHFFFAOYSA-N hexamethylenetetramine mandelate salt Chemical compound C1N(C2)CN3CN1CN2C3.OC(=O)C(O)C1=CC=CC=C1 UXNFIJPHRQEWRQ-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229960002474 hydralazine Drugs 0.000 description 1
- 229960002003 hydrochlorothiazide Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 201000001421 hyperglycemia Diseases 0.000 description 1
- 239000003326 hypnotic agent Substances 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 1
- 229960004801 imipramine Drugs 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 229940039009 isoproterenol Drugs 0.000 description 1
- 230000002475 laxative effect Effects 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- HYYBABOKPJLUIN-UHFFFAOYSA-N mefenamic acid Chemical compound CC1=CC=CC(NC=2C(=CC=CC=2)C(O)=O)=C1C HYYBABOKPJLUIN-UHFFFAOYSA-N 0.000 description 1
- 229960003464 mefenamic acid Drugs 0.000 description 1
- 229960001344 methylphenidate Drugs 0.000 description 1
- 229960004503 metoclopramide Drugs 0.000 description 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 description 1
- 229960000210 nalidixic acid Drugs 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- PLPRGLOFPNJOTN-UHFFFAOYSA-N narcotine Natural products COc1ccc2C(OC(=O)c2c1OC)C3Cc4c(CN3C)cc5OCOc5c4OC PLPRGLOFPNJOTN-UHFFFAOYSA-N 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 239000003176 neuroleptic agent Substances 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960001454 nitrazepam Drugs 0.000 description 1
- KJONHKAYOJNZEC-UHFFFAOYSA-N nitrazepam Chemical compound C12=CC([N+](=O)[O-])=CC=C2NC(=O)CN=C1C1=CC=CC=C1 KJONHKAYOJNZEC-UHFFFAOYSA-N 0.000 description 1
- 229960004708 noscapine Drugs 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- 229960001834 oxprenolol hydrochloride Drugs 0.000 description 1
- 229960001789 papaverine Drugs 0.000 description 1
- 229960005489 paracetamol Drugs 0.000 description 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 description 1
- OQGYMIIFOSJQSF-DTOXXUQYSA-N pentazocine hcl Chemical compound Cl.C1C2=CC=C(O)C=C2[C@@]2(C)[C@@H](C)[C@@H]1N(CC=C(C)C)CC2 OQGYMIIFOSJQSF-DTOXXUQYSA-N 0.000 description 1
- 229960003809 pentazocine hydrochloride Drugs 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000810 peripheral vasodilating agent Substances 0.000 description 1
- 229960002116 peripheral vasodilator Drugs 0.000 description 1
- 229960000482 pethidine Drugs 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229960003562 phentermine Drugs 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- DLNKOYKMWOXYQA-APPZFPTMSA-N phenylpropanolamine Chemical compound C[C@@H](N)[C@H](O)C1=CC=CC=C1 DLNKOYKMWOXYQA-APPZFPTMSA-N 0.000 description 1
- 229960000395 phenylpropanolamine Drugs 0.000 description 1
- 229960002790 phenytoin sodium Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 229960004618 prednisone Drugs 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 229960000244 procainamide Drugs 0.000 description 1
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229960005439 propantheline bromide Drugs 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229960004604 propranolol hydrochloride Drugs 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol hydrochloride Natural products C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- 229960002662 propylthiouracil Drugs 0.000 description 1
- 229940048914 protamine Drugs 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000001047 pyretic effect Effects 0.000 description 1
- 235000008160 pyridoxine Nutrition 0.000 description 1
- 239000011677 pyridoxine Substances 0.000 description 1
- XHKUDCCTVQUHJQ-LCYSNFERSA-N quinidine D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 XHKUDCCTVQUHJQ-LCYSNFERSA-N 0.000 description 1
- 229960002454 quinidine gluconate Drugs 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229960001634 ritodrine Drugs 0.000 description 1
- 229960002052 salbutamol Drugs 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- STECJAGHUSJQJN-FWXGHANASA-N scopolamine Chemical compound C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-FWXGHANASA-N 0.000 description 1
- 229960002646 scopolamine Drugs 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 208000013220 shortness of breath Diseases 0.000 description 1
- 229940084026 sodium valproate Drugs 0.000 description 1
- AEQFSUDEHCCHBT-UHFFFAOYSA-M sodium valproate Chemical compound [Na+].CCCC(C([O-])=O)CCC AEQFSUDEHCCHBT-UHFFFAOYSA-M 0.000 description 1
- FJPYVLNWWICYDW-UHFFFAOYSA-M sodium;5,5-diphenylimidazolidin-1-ide-2,4-dione Chemical compound [Na+].O=C1[N-]C(=O)NC1(C=1C=CC=CC=1)C1=CC=CC=C1 FJPYVLNWWICYDW-UHFFFAOYSA-M 0.000 description 1
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 description 1
- 229960002256 spironolactone Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 229940114926 stearate Drugs 0.000 description 1
- MBGGBVCUIVRRBF-UHFFFAOYSA-N sulfinpyrazone Chemical compound O=C1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)C(=O)C1CCS(=O)C1=CC=CC=C1 MBGGBVCUIVRRBF-UHFFFAOYSA-N 0.000 description 1
- 229960003329 sulfinpyrazone Drugs 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 229960003188 temazepam Drugs 0.000 description 1
- KFVSLSTULZVNPG-UHFFFAOYSA-N terbutaline sulfate Chemical compound [O-]S([O-])(=O)=O.CC(C)(C)[NH2+]CC(O)C1=CC(O)=CC(O)=C1.CC(C)(C)[NH2+]CC(O)C1=CC(O)=CC(O)=C1 KFVSLSTULZVNPG-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- IJAAJNPGRSCJKT-UHFFFAOYSA-N tetraaluminum;trisilicate Chemical compound [Al+3].[Al+3].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IJAAJNPGRSCJKT-UHFFFAOYSA-N 0.000 description 1
- 229960002180 tetracycline Drugs 0.000 description 1
- 229930101283 tetracycline Natural products 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical class 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 229960003495 thiamine Drugs 0.000 description 1
- 235000019157 thiamine Nutrition 0.000 description 1
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 description 1
- 239000011721 thiamine Substances 0.000 description 1
- 229960002784 thioridazine Drugs 0.000 description 1
- 210000001685 thyroid gland Anatomy 0.000 description 1
- 229940034208 thyroxine Drugs 0.000 description 1
- XUIIKFGFIJCVMT-UHFFFAOYSA-N thyroxine-binding globulin Natural products IC1=CC(CC([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-UHFFFAOYSA-N 0.000 description 1
- 229960000984 tocofersolan Drugs 0.000 description 1
- 229960005371 tolbutamide Drugs 0.000 description 1
- 229960001288 triamterene Drugs 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 229940035722 triiodothyronine Drugs 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 208000027185 varicose disease Diseases 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 229960001722 verapamil Drugs 0.000 description 1
- 229960002726 vincamine Drugs 0.000 description 1
- 229940011671 vitamin b6 Drugs 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 235000004835 α-tocopherol Nutrition 0.000 description 1
- 239000002076 α-tocopherol Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/205—Polysaccharides, e.g. alginate, gums; Cyclodextrin
- A61K9/2054—Cellulose; Cellulose derivatives, e.g. hydroxypropyl methylcellulose
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/332,348 US4369172A (en) | 1981-12-18 | 1981-12-18 | Prolonged release therapeutic compositions based on hydroxypropylmethylcellulose |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8207167D0 SE8207167D0 (sv) | 1982-12-15 |
| SE8207167L SE8207167L (sv) | 1983-06-19 |
| SE453796B true SE453796B (sv) | 1988-03-07 |
Family
ID=23297834
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8207167A SE453796B (sv) | 1981-12-18 | 1982-12-15 | Fast, terapeutisk komposition vars berarbasmaterial utgores av hydroxypropylmetylcellulosa samt ev natriumkarboximetylcellulosa |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4369172A (enExample) |
| JP (1) | JPS58110513A (enExample) |
| AR (1) | AR228699A1 (enExample) |
| BE (1) | BE895391A (enExample) |
| CA (1) | CA1195929A (enExample) |
| CH (1) | CH641670A5 (enExample) |
| DE (1) | DE3246492C2 (enExample) |
| DK (1) | DK160076C (enExample) |
| ES (1) | ES8402155A1 (enExample) |
| FR (1) | FR2518409B1 (enExample) |
| GB (1) | GB2111386A (enExample) |
| IL (1) | IL67497A (enExample) |
| IT (1) | IT1164472B (enExample) |
| MX (1) | MX160316A (enExample) |
| NL (1) | NL190472C (enExample) |
| SE (1) | SE453796B (enExample) |
| ZA (1) | ZA829267B (enExample) |
Families Citing this family (344)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0086627B1 (en) * | 1982-02-12 | 1985-08-28 | Unitika Ltd. | Anti-cancer device |
| US4389393A (en) * | 1982-03-26 | 1983-06-21 | Forest Laboratories, Inc. | Sustained release therapeutic compositions based on high molecular weight hydroxypropylmethylcellulose |
| DE3435325A1 (de) * | 1983-04-09 | 1986-04-17 | Nikken Chemicals Co., Ltd., Tokio/Tokyo | Langzeitwirkende theophyllin-tablette und verfahren zu deren herstellung |
| US4591500A (en) * | 1983-04-25 | 1986-05-27 | Microencapsulation S.A. | Tablet having the shape of a capsule, process and device for its preparation |
| JPH0662404B2 (ja) * | 1983-06-14 | 1994-08-17 | シンテックス・ファーマシユーテイカルズ・インターナシヨナル・リミテツド | 制御放出性ナプロキセンおよびナプロキセンナトリウム錠 |
| US4571333A (en) * | 1983-06-14 | 1986-02-18 | Syntex (U.S.A.) Inc. | Controlled release naproxen and naproxen sodium tablets |
| IL72381A (en) * | 1983-07-20 | 1988-03-31 | Sanofi Sa | Pharmaceutical composition based on valproic acid |
| JPS6038322A (ja) * | 1983-08-11 | 1985-02-27 | Fujisawa Pharmaceut Co Ltd | ジヒドロピリジンa物質含有易溶性固形製剤 |
| US4680323A (en) * | 1983-12-01 | 1987-07-14 | Hans Lowey | Method and composition for the preparation of controlled long-acting pharmaceuticals for oral administration |
| FR2556965B1 (fr) * | 1983-12-21 | 1986-08-22 | Rhone Poulenc Sante | Nouvelle forme galenique du ketoprofene a liberation controlee |
| GB8403360D0 (en) * | 1984-02-08 | 1984-03-14 | Erba Farmitalia | Pharmaceutical compositions |
| CH666406A5 (de) * | 1984-02-29 | 1988-07-29 | Sandoz Ag | Verfahren zur herstellung von mikrokapseln, welche bromokriptinmesylat als pharmakologischen wirkstoff enthalten. |
| GB2154874B (en) * | 1984-02-29 | 1987-11-04 | Sandoz Ltd | Bromoscriptine compositions |
| US4795327A (en) * | 1984-03-26 | 1989-01-03 | Forest Laboratories, Inc. | Controlled release solid drug dosage forms based on mixtures of water soluble nonionic cellulose ethers and anionic surfactants |
| US4540566A (en) * | 1984-04-02 | 1985-09-10 | Forest Laboratories, Inc. | Prolonged release drug dosage forms based on modified low viscosity grade hydroxypropylmethylcellulose |
| GB8414220D0 (en) * | 1984-06-04 | 1984-07-11 | Sterwin Ag | Medicaments in unit dose form |
| US4532244A (en) * | 1984-09-06 | 1985-07-30 | Innes Margaret N | Method of treating migraine headaches |
| US4695464A (en) * | 1984-10-09 | 1987-09-22 | The Dow Chemical Company | Sustained release dosage form based on highly plasticized cellulose ether gels |
| AU592065B2 (en) * | 1984-10-09 | 1990-01-04 | Dow Chemical Company, The | Sustained release dosage form based on highly plasticized cellulose ether gels |
| US4678516A (en) * | 1984-10-09 | 1987-07-07 | The Dow Chemical Company | Sustained release dosage form based on highly plasticized cellulose ether gels |
| US4639458A (en) * | 1985-01-22 | 1987-01-27 | Merck & Co., Inc. | Tablet and formulation |
| AT388101B (de) * | 1985-02-05 | 1989-05-10 | Sandoz Ag | Verfahren zur herstellung einer pharmazeutischen zusammensetzung zur oralen verabreichung mit kontrollierter wirkstofffreisetzung |
| HU195729B (en) * | 1985-02-05 | 1988-07-28 | Sandoz Ag | Process for producing pharmaceutical compositions containing 9,10-dihydro-ergot-alkaloides |
| AU598751B2 (en) * | 1985-02-07 | 1990-07-05 | Novartis Ag | Pharmaceutical formulations with controlled release of the active substance |
| US4695591A (en) * | 1985-03-29 | 1987-09-22 | Schering Corporation | Controlled release dosage forms comprising hydroxypropylmethylcellulose |
| US4657757A (en) * | 1985-03-29 | 1987-04-14 | Schering Corporation | Controlled release dosage form comprising acetaminophen, pseudoephedrine sulfate and dexbrompheniramine maleate |
| US4601894A (en) * | 1985-03-29 | 1986-07-22 | Schering Corporation | Controlled release dosage form comprising acetaminophen, pseudoephedrine sulfate and dexbrompheniramine maleate |
| US4885173A (en) * | 1985-05-01 | 1989-12-05 | University Of Utah | Methods and compositions for noninvasive dose-to-effect administration of drugs with cardiovascular or renal vascular activities |
| EP0227814A1 (en) * | 1985-07-02 | 1987-07-08 | The Upjohn Company | Therapeutic formulations with bimodal release characteristics |
| GB8518301D0 (en) * | 1985-07-19 | 1985-08-29 | Fujisawa Pharmaceutical Co | Hydrodynamically explosive systems |
| NL194822C (nl) * | 1985-10-01 | 2003-04-03 | Novartis Ag | Preparaat voor orale toediening met geregelde afgifte en werkwijze voor de bereiding ervan. |
| GB2181053B (en) * | 1985-10-01 | 1990-05-23 | Sandoz Ltd | Pharmaceutical formulations with controlled release of the active substance |
| IT1187750B (it) * | 1985-10-15 | 1987-12-23 | Eurand Spa | Procedimento per la preparazione di compresse,anche a rilascio prolungato,di iscsorbide-5-mononitrato stabilizzato e formulazioni cosi' ottenute |
| US4734285A (en) * | 1985-10-28 | 1988-03-29 | The Dow Chemical Company | Sustained release compositions |
| US4704285A (en) * | 1985-11-18 | 1987-11-03 | The Dow Chemical Company | Sustained release compositions comprising hydroxypropyl cellulose ethers |
| IE63321B1 (en) * | 1986-02-03 | 1995-04-05 | Elan Corp Plc | Drug delivery system |
| GB2186485B (en) * | 1986-02-13 | 1988-09-07 | Ethical Pharma Ltd | Slow release formulation |
| IT1191674B (it) * | 1986-03-07 | 1988-03-23 | Eurand Spa | Formulazioni per la preparazione di farmaci a rilascio prolungato adatte alla somministrazione per via orale |
| US4662880A (en) * | 1986-03-14 | 1987-05-05 | Alza Corporation | Pseudoephedrine, brompheniramine therapy |
| GB8608080D0 (en) * | 1986-04-02 | 1986-05-08 | Fujisawa Pharmaceutical Co | Solid dispersion composition |
| US4855143A (en) * | 1986-04-04 | 1989-08-08 | Hans Lowey | Method of preparing controlled long-acting pharmaceutical formulations in unit dosage form having uniform and comparable bioavailability characteristics |
| US4775535A (en) * | 1986-04-04 | 1988-10-04 | Hans Lowey | Method of preparing controlled long-acting pharmaceutical formulations in unit dosage form having uniform and comparable bioavailability characteristics |
| US4780320A (en) * | 1986-04-29 | 1988-10-25 | Pharmetrix Corp. | Controlled release drug delivery system for the periodontal pocket |
| JPS62286925A (ja) * | 1986-06-06 | 1987-12-12 | Terumo Corp | 水酸化アルミニウムゲルを含有する外用薬組成物 |
| DE3750145T2 (de) * | 1986-06-10 | 1994-11-03 | Euro Celtique Sa | Zusammensetzung mit kontrollierter Freisetzung von Dihydrocodein. |
| US4832957A (en) * | 1987-12-11 | 1989-05-23 | Merck & Co., Inc. | Controlled release combination of carbidopa/levodopa |
| NZ220599A (en) * | 1986-06-16 | 1990-10-26 | Merck & Co Inc | Controlled release oral dosage formulation of carbidopa and levodopa |
| JPS6310702A (ja) * | 1986-07-01 | 1988-01-18 | Ube Ind Ltd | 徐放化製剤の製造方法 |
| US4859467A (en) * | 1986-09-25 | 1989-08-22 | Colgate-Palmotive Company | Sustained release fluoride composition |
| US4861590A (en) * | 1986-09-25 | 1989-08-29 | Colgate-Palmolive Company | Sustained release fluoride and calcium composition |
| US4851233A (en) * | 1986-10-06 | 1989-07-25 | Warner-Lambert Company | Sustained release formulations |
| DE3639073A1 (de) * | 1986-11-14 | 1988-05-26 | Klinge Co Chem Pharm Fab | Feste arzneizubereitungen und verfahren zu ihrer herstellung |
| US4752470A (en) * | 1986-11-24 | 1988-06-21 | Mehta Atul M | Controlled release indomethacin |
| US4822629A (en) * | 1986-12-12 | 1989-04-18 | Norwich Eaton Pharmaceuticals, Inc. | Azumolene dosage form |
| US4869908A (en) * | 1987-01-09 | 1989-09-26 | K.V. Pharmaceutical Co. | Fibre formulations |
| US5015479A (en) * | 1987-02-02 | 1991-05-14 | Seamus Mulligan | Sustained release capsule or tablet formulation comprising a pharmaceutically acceptable dihydropyridine |
| US4851232A (en) * | 1987-02-13 | 1989-07-25 | Alza Corporation | Drug delivery system with means for obtaining desirable in vivo release rate pattern |
| US4915952A (en) * | 1987-02-27 | 1990-04-10 | Alza Corporation | Composition comprising drug, HPC, HPMC and PEO |
| US4810502A (en) * | 1987-02-27 | 1989-03-07 | Alza Corporation | Pseudoephedrine brompheniramine therapy |
| US5023076A (en) * | 1987-02-27 | 1991-06-11 | Alza Corporation | Lamina comprising carboxyvinyl polymer |
| ES2061623T3 (es) * | 1987-03-02 | 1994-12-16 | Brocades Pharma Bv | Procedimiento para la obtencion de una composicion farmaceutica y un granulado farmaceutico. |
| US4789549A (en) * | 1987-03-09 | 1988-12-06 | Warner-Lambert Company | Sustained release dosage forms |
| US4786503A (en) * | 1987-04-06 | 1988-11-22 | Alza Corporation | Dosage form comprising parallel lamine |
| US5500228A (en) * | 1987-05-26 | 1996-03-19 | American Cyanamid Company | Phase separation-microencapsulated pharmaceuticals compositions useful for alleviating dental disease |
| US6645504B1 (en) * | 1987-06-24 | 2003-11-11 | Autoimmune Inc. | Bystander suppression of type I diabetes by oral administration of glucagon |
| EP0297866A3 (en) * | 1987-07-01 | 1989-12-13 | The Boots Company PLC | Therapeutic agents |
| FR2618073B1 (fr) * | 1987-07-16 | 1990-09-07 | Pf Medicament | Comprimes de type a matrice hydrophile a base de salbutamol et leur procede de preparation |
| IE60311B1 (en) * | 1987-09-24 | 1994-06-29 | American Home Prod | Sustained release etodolac |
| US4837030A (en) * | 1987-10-06 | 1989-06-06 | American Cyanamid Company | Novel controlled release formulations of tetracycline compounds |
| US4871731A (en) * | 1987-10-07 | 1989-10-03 | Marion Laboratories, Inc. | Captopril and diltiazem composition and the like |
| IE64726B1 (en) * | 1987-11-20 | 1995-08-23 | Elan Corp Plc | Pharmaceutical formulations for preventing drug tolerance |
| US4983398A (en) * | 1987-12-21 | 1991-01-08 | Forest Laboratories, Inc. | Sustained release drug dosage forms containing hydroxypropylmethylcellulose and alkali metal carboxylates |
| GB8802391D0 (en) * | 1988-02-03 | 1988-03-02 | Ddsa Pharmaceuticals Ltd | Medicinal formulations |
| US4931285A (en) * | 1988-04-28 | 1990-06-05 | Alza Corporation | Aqueous based pharmaceutical coating composition for dosage forms |
| US5024842A (en) * | 1988-04-28 | 1991-06-18 | Alza Corporation | Annealed coats |
| US5160743A (en) * | 1988-04-28 | 1992-11-03 | Alza Corporation | Annealed composition for pharmaceutically acceptable drug |
| US5096714A (en) * | 1988-06-28 | 1992-03-17 | Hauser-Kuhrts, Inc. | Prolonged release drug tablet formulations |
| IT1229203B (it) * | 1989-03-22 | 1991-07-25 | Bioresearch Spa | Impiego di acido 5 metiltetraidrofolico, di acido 5 formiltetraidrofolico e dei loro sali farmaceuticamente accettabili per la preparazione di composizioni farmaceutiche in forma a rilascio controllato attive nella terapia dei disturbi mentali organici e composizioni farmaceutiche relative. |
| US5268181A (en) * | 1989-04-13 | 1993-12-07 | Upsher-Smith Laboratories, Inc. | Method of using niacin to control nocturnal cholesterol synthesis |
| US5126145A (en) * | 1989-04-13 | 1992-06-30 | Upsher Smith Laboratories Inc | Controlled release tablet containing water soluble medicament |
| GB8913889D0 (en) * | 1989-06-16 | 1989-08-02 | May & Baker Ltd | New compositions of matter |
| DE69023654T2 (de) * | 1989-08-25 | 1996-04-18 | Bioglan Ireland R & D Ltd | Pharmazeutische zusammensetzung und einnahmevorrichtung dafür. |
| US5198228A (en) * | 1989-09-14 | 1993-03-30 | Hoechst-Roussel Pharmaceuticals Inc. | Direct dry compressible acetaminophen tablet |
| US5037658A (en) * | 1989-09-14 | 1991-08-06 | Hoechst-Roussel Pharmaceuticals, Inc. | Direct dry compressible acetaminophen composition |
| US5130140A (en) * | 1989-09-14 | 1992-07-14 | Hoeschst-Roussel Pharmaceuticals Inc. | Method of making direct dry compressible acetaminophen composition |
| US5476668A (en) * | 1990-08-24 | 1995-12-19 | Shin-Etsu Chemical Co., Ltd. | Base for film-coating pharmaceuticals and method for preparing same |
| SE9003904D0 (sv) * | 1990-12-07 | 1990-12-07 | Astra Ab | Method for the manufacture of a pharmaceutical dosage form |
| US5223248A (en) * | 1991-02-11 | 1993-06-29 | The Research Foundation Of State University Of New York | Non-antibacterial tetracycline compositions possessing antiplaque properties |
| US5770588A (en) * | 1991-02-11 | 1998-06-23 | The Research Foundation Of State University Of New York | Non-antibacterial tetracycline compositions of the prevention and treatment of root caries |
| US5204116A (en) * | 1991-05-01 | 1993-04-20 | Alza Corporation | Dosage form providing immediate therapy followed by prolonged therapy |
| CA2067975C (en) * | 1991-05-20 | 2003-01-14 | Cynthia M. Blase | Buffered matrix aspirin tablet |
| US5407686A (en) * | 1991-11-27 | 1995-04-18 | Sidmak Laboratories, Inc. | Sustained release composition for oral administration of active ingredient |
| US5266331A (en) * | 1991-11-27 | 1993-11-30 | Euroceltique, S.A. | Controlled release oxycodone compositions |
| NL9102142A (nl) | 1991-12-20 | 1993-07-16 | Dagra Pharma Bv | Zetpillen met vertraagde afgifte en werkwijze voor de bereiding daarvan. |
| DK0550108T3 (da) * | 1991-12-30 | 1999-01-04 | Akzo Nobel Nv | Thyreoaktiv sammensætning med langvarig frigivelse |
| US5700485A (en) | 1992-09-10 | 1997-12-23 | Children's Medical Center Corporation | Prolonged nerve blockade by the combination of local anesthetic and glucocorticoid |
| US5922340A (en) * | 1992-09-10 | 1999-07-13 | Children's Medical Center Corporation | High load formulations and methods for providing prolonged local anesthesia |
| EP0659073B1 (en) * | 1992-09-10 | 2001-12-19 | Children's Medical Center Corporation | Biodegradable polymer matrices for sustained delivery of local anesthetic agents |
| US20080075781A1 (en) * | 1992-11-25 | 2008-03-27 | Purdue Pharma Lp | Controlled release oxycodone compositions |
| IL119660A (en) | 1993-05-10 | 2002-09-12 | Euro Celtique Sa | Controlled release formulation comprising tramadol |
| US6440457B1 (en) * | 1993-05-27 | 2002-08-27 | Alza Corporation | Method of administering antidepressant dosage form |
| CA2163121A1 (en) * | 1993-06-14 | 1994-12-22 | Paul Marie Victor Gilis | Extended release, film-coated tablet of astemizole and pseudoephedrine |
| US20070275062A1 (en) * | 1993-06-18 | 2007-11-29 | Benjamin Oshlack | Controlled release oxycodone compositions |
| US6080428A (en) | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US20060263428A1 (en) * | 1993-09-20 | 2006-11-23 | Eugenio Cefali | Methods for treating hyperlipidemia with intermediate release nicotinic acid compositions having unique biopharmaceutical characteristics |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US6676967B1 (en) * | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6129930A (en) * | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
| US5484607A (en) * | 1993-10-13 | 1996-01-16 | Horacek; H. Joseph | Extended release clonidine formulation |
| EP0724441A1 (en) * | 1993-10-19 | 1996-08-07 | The Procter & Gamble Company | Picosulphate dosage form |
| US5451409A (en) * | 1993-11-22 | 1995-09-19 | Rencher; William F. | Sustained release matrix system using hydroxyethyl cellulose and hydroxypropyl cellulose polymer blends |
| US5891471A (en) | 1993-11-23 | 1999-04-06 | Euro-Celtique, S.A. | Pharmaceutical multiparticulates |
| KR100354702B1 (ko) | 1993-11-23 | 2002-12-28 | 유로-셀티크 소시에떼 아노뉨 | 약학조성물의제조방법및서방형조성물 |
| HUT71408A (en) * | 1994-01-14 | 1995-11-28 | Egyt Gyogyszervegyeszeti Gyar | Pharmaceutical compositions containing papaverine for use to treatment of diseases related to glutamaterg neurotransmission |
| US5843480A (en) | 1994-03-14 | 1998-12-01 | Euro-Celtique, S.A. | Controlled release diamorphine formulation |
| US5478572A (en) * | 1994-09-06 | 1995-12-26 | Bristol-Myers Squibb Co. | Gepirone dosage form |
| US6239172B1 (en) * | 1997-04-10 | 2001-05-29 | Nitrosystems, Inc. | Formulations for treating disease and methods of using same |
| US20110196039A9 (en) * | 1994-10-05 | 2011-08-11 | Kaesemeyer Wayne H | Controlled release arginine formulations |
| US5968983A (en) * | 1994-10-05 | 1999-10-19 | Nitrosystems, Inc | Method and formulation for treating vascular disease |
| US6425881B1 (en) * | 1994-10-05 | 2002-07-30 | Nitrosystems, Inc. | Therapeutic mixture useful in inhibiting lesion formation after vascular injury |
| GB9422154D0 (en) | 1994-11-03 | 1994-12-21 | Euro Celtique Sa | Pharmaceutical compositions and method of producing the same |
| US5965161A (en) | 1994-11-04 | 1999-10-12 | Euro-Celtique, S.A. | Extruded multi-particulates |
| US5728402A (en) * | 1994-11-16 | 1998-03-17 | Andrx Pharmaceuticals Inc. | Controlled release formulation of captopril or a prodrug of captopril |
| US6103263A (en) * | 1994-11-17 | 2000-08-15 | Andrx Pharmaceuticals, Inc. | Delayed pulse release hydrogel matrix tablet |
| US5558879A (en) * | 1995-04-28 | 1996-09-24 | Andrx Pharmaceuticals, Inc. | Controlled release formulation for water soluble drugs in which a passageway is formed in situ |
| US5736159A (en) * | 1995-04-28 | 1998-04-07 | Andrx Pharmaceuticals, Inc. | Controlled release formulation for water insoluble drugs in which a passageway is formed in situ |
| EP0778768B1 (en) | 1995-06-09 | 2004-05-26 | Euroceltique S.A. | Formulations and methods for providing prolonged local anesthesia |
| US5614207A (en) * | 1995-06-30 | 1997-03-25 | Mcneil-Ppc, Inc. | Dry mouth lozenge |
| WO1997004752A1 (en) * | 1995-07-26 | 1997-02-13 | Duramed Pharmaceuticals, Inc. | Pharmaceutical compositions of conjugated estrogens and methods for their use |
| US5955105A (en) * | 1995-11-14 | 1999-09-21 | Knoll Pharmaceutical Company | Stabilized thyroid hormone preparations and methods of making same |
| PE57198A1 (es) * | 1996-03-25 | 1998-10-10 | American Home Prod | Formula de liberacion prolongada |
| US6274171B1 (en) | 1996-03-25 | 2001-08-14 | American Home Products Corporation | Extended release formulation of venlafaxine hydrochloride |
| US20060068002A1 (en) * | 1996-03-25 | 2006-03-30 | Wyeth | Extended release formulation |
| US20030215507A1 (en) * | 1996-03-25 | 2003-11-20 | Wyeth | Extended release formulation |
| US5948437A (en) * | 1996-05-23 | 1999-09-07 | Zeneca Limited | Pharmaceutical compositions using thiazepine |
| US8071128B2 (en) | 1996-06-14 | 2011-12-06 | Kyowa Hakko Kirin Co., Ltd. | Intrabuccally rapidly disintegrating tablet and a production method of the tablets |
| AU733867B2 (en) | 1996-06-24 | 2001-05-31 | Euro-Celtique S.A. | Methods for providing safe local anesthesia |
| US6046187A (en) * | 1996-09-16 | 2000-04-04 | Children's Medical Center Corporation | Formulations and methods for providing prolonged local anesthesia |
| AU7888298A (en) * | 1997-01-03 | 1998-07-31 | Elan Corporation, Plc | Sustained release cisapride minitablet formulation |
| US6004932A (en) * | 1997-03-06 | 1999-12-21 | Iowa State University Research Foundation, Inc. | Use of glucagon as a metabolic conditioner for dairy cows and other ruminants |
| US7179486B1 (en) | 1997-04-01 | 2007-02-20 | Nostrum Pharmaceuticals, Inc. | Process for preparing sustained release tablets |
| CA2216215A1 (en) * | 1997-04-05 | 1998-10-05 | Isa Odidi | Controlled release formulations using intelligent polymers having opposing wettability characteristics of hydrophobicity and hydrophilicity |
| US6010718A (en) * | 1997-04-11 | 2000-01-04 | Abbott Laboratories | Extended release formulations of erythromycin derivatives |
| US6551616B1 (en) * | 1997-04-11 | 2003-04-22 | Abbott Laboratories | Extended release formulations of erythromycin derivatives |
| US20050064033A1 (en) * | 1997-04-11 | 2005-03-24 | Notario Gerard F. | Extended release formulations of erythromycin derivatives |
| US6210710B1 (en) | 1997-04-28 | 2001-04-03 | Hercules Incorporated | Sustained release polymer blend for pharmaceutical applications |
| JP2000511941A (ja) | 1997-07-02 | 2000-09-12 | ユーロ−セルティーク エス.エイ. | 関節間隙および身体間隙における持効性麻酔 |
| US5895663A (en) * | 1997-07-31 | 1999-04-20 | L. Perrigo Company | Pseudoephedrine hydrochloride extended-release tablets |
| IN186245B (enExample) | 1997-09-19 | 2001-07-14 | Ranbaxy Lab Ltd | |
| ZA989356B (en) * | 1997-10-16 | 1998-11-16 | Isis Pharma Gmbh | Pharmaceutical preparations |
| US5948440A (en) * | 1997-12-17 | 1999-09-07 | Ranbaxy Laboratories Limited | Modified release matrix formulation of cefaclor and cephalexin |
| NZ506202A (en) | 1998-03-19 | 2003-10-31 | Bristol Myers Squibb Co | Biphasic controlled release delivery system for high solubility pharmaceuticals and method |
| US6099859A (en) | 1998-03-20 | 2000-08-08 | Andrx Pharmaceuticals, Inc. | Controlled release oral tablet having a unitary core |
| US20030118645A1 (en) * | 1998-04-29 | 2003-06-26 | Pather S. Indiran | Pharmaceutical compositions for rectal and vaginal administration |
| US6043259A (en) * | 1998-07-09 | 2000-03-28 | Medicure Inc. | Treatment of cardiovascular and related pathologies |
| US6524620B2 (en) | 1998-07-20 | 2003-02-25 | Andrx Pharmaceuticals, Inc. | Diltiazem controlled release formulation and method of manufacture |
| US6106862A (en) * | 1998-08-13 | 2000-08-22 | Andrx Corporation | Once daily analgesic tablet |
| US6214381B1 (en) | 1998-09-08 | 2001-04-10 | Effcon, Inc. | Methazolamide composition and method of use |
| DE19842753A1 (de) * | 1998-09-18 | 2000-03-23 | Bayer Ag | Agitationsunabhängige pharmazeutische Retardzubereitungen und Verfahren zu ihrer Herstellung |
| US20020169145A1 (en) * | 1998-10-14 | 2002-11-14 | Rajen Shah | Sustained release pharmaceutical composition and method of releasing pharmaceutically active agent |
| NZ512288A (en) | 1998-12-11 | 2003-09-26 | Nostrum Pharmaceuticals Inc | Sustained release tablet containing hydrocolloid and cellulose ether |
| US6528090B2 (en) | 1998-12-18 | 2003-03-04 | Abbott Laboratories | Controlled release formulation of divalproex sodium |
| US6511678B2 (en) | 1998-12-18 | 2003-01-28 | Abbott Laboratories | Controlled release formulation of divalproex sodium |
| US6419953B1 (en) | 1998-12-18 | 2002-07-16 | Abbott Laboratories | Controlled release formulation of divalproex sodium |
| US20020025341A1 (en) * | 1998-12-18 | 2002-02-28 | Yihong Qiu | Controlled release formulation of divalproex sodium |
| US6713086B2 (en) | 1998-12-18 | 2004-03-30 | Abbott Laboratories | Controlled release formulation of divalproex sodium |
| US6150410A (en) * | 1999-02-04 | 2000-11-21 | Abbott Laboratories | pH independent extended release pharmaceutical formulation |
| BR0008857A (pt) | 1999-03-08 | 2001-12-18 | Medicure Inc | Análogos de piridoxal para distúrbios da vitaminab-6 |
| DE19918325A1 (de) | 1999-04-22 | 2000-10-26 | Euro Celtique Sa | Verfahren zur Herstellung von Arzneiformen mit regulierter Wirkstofffreisetzung mittels Extrusion |
| EP1196171A2 (en) * | 1999-07-13 | 2002-04-17 | Medicure Inc. | Use of pyridoxin derivatives for the treatment of diabetes and related complications |
| WO2001013901A2 (en) * | 1999-08-20 | 2001-03-01 | Ferrosan A/S | A pharmaceutical delivery system for vitamin c and vitamin e and use of a combination of vitamin c and e for preventing or treating conditions involving oxidative stress |
| WO2001013900A2 (en) * | 1999-08-24 | 2001-03-01 | Medicure International Inc. | Compositions for the treatment of cardiovascular diseases containing pyridoxal compounds and cardiovascular compounds |
| US7771746B2 (en) * | 1999-12-03 | 2010-08-10 | Polichem Sa | Methods for making sustained-release pharmaceutical compositions of ergot alkaloids having improved bioavailability and compositions thereof |
| US20050037073A1 (en) * | 2000-01-13 | 2005-02-17 | Alpharx Inc. | Solid self-emulsifying dosage form for improved delivery of poorly soluble hydrophobic compounds and the process for preparation thereof |
| US6627223B2 (en) | 2000-02-11 | 2003-09-30 | Eurand Pharmaceuticals Ltd. | Timed pulsatile drug delivery systems |
| US6544555B2 (en) * | 2000-02-24 | 2003-04-08 | Advancis Pharmaceutical Corp. | Antibiotic product, use and formulation thereof |
| US6565882B2 (en) * | 2000-02-24 | 2003-05-20 | Advancis Pharmaceutical Corp | Antibiotic composition with inhibitor |
| US7442689B2 (en) * | 2000-02-29 | 2008-10-28 | Medicure International Inc. | Cardioprotective phosphonates and malonates |
| EP1268498B1 (en) | 2000-02-29 | 2005-04-13 | Medicure International Inc. | Cardioprotective phosphonates |
| AU784840B2 (en) | 2000-03-28 | 2006-07-06 | Medicure International Inc. | Treatment of cerebrovascular disease |
| US6635277B2 (en) | 2000-04-12 | 2003-10-21 | Wockhardt Limited | Composition for pulsatile delivery of diltiazem and process of manufacture |
| US6242003B1 (en) | 2000-04-13 | 2001-06-05 | Novartis Ag | Organic compounds |
| AR030557A1 (es) * | 2000-04-14 | 2003-08-27 | Jagotec Ag | Una tableta en multicapa de liberacion controlada y metodo de tratamiento |
| US7838032B2 (en) * | 2000-04-28 | 2010-11-23 | Reckitt Benckiser Inc. | Sustained release of guaifenesin |
| US8012504B2 (en) * | 2000-04-28 | 2011-09-06 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US6372252B1 (en) | 2000-04-28 | 2002-04-16 | Adams Laboratories, Inc. | Guaifenesin sustained release formulation and tablets |
| US7985420B2 (en) * | 2000-04-28 | 2011-07-26 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US6955821B2 (en) * | 2000-04-28 | 2005-10-18 | Adams Laboratories, Inc. | Sustained release formulations of guaifenesin and additional drug ingredients |
| DE10031043A1 (de) * | 2000-06-26 | 2002-02-14 | Bayer Ag | Retardzubereitungen von Chinolonantibiotika und Verfahren zu ihrer Herstellung |
| US6548519B1 (en) | 2001-07-06 | 2003-04-15 | Medicure International Inc. | Pyridoxine and pyridoxal analogues: novel uses |
| US6897228B2 (en) * | 2000-07-07 | 2005-05-24 | Medicure International Inc. | Pyridoxine and pyridoxal analogues: new uses |
| WO2002004421A2 (en) | 2000-07-07 | 2002-01-17 | Medicure International Inc. | Pyridoxine and pyridoxal analogues: cardiovascular therapeutics |
| US20020068078A1 (en) * | 2000-10-13 | 2002-06-06 | Rudnic Edward M. | Antifungal product, use and formulation thereof |
| US6541014B2 (en) * | 2000-10-13 | 2003-04-01 | Advancis Pharmaceutical Corp. | Antiviral product, use and formulation thereof |
| AU2002220248A1 (en) * | 2000-11-06 | 2002-05-15 | Andrx Pharmaceuticals, Inc. | Once a day antihistamine and decongestant formulation |
| US20040097472A1 (en) * | 2000-11-14 | 2004-05-20 | West Simon Michael | Complexes of phosphate derivatives |
| AUPR549901A0 (en) | 2001-06-06 | 2001-07-12 | Vital Health Sciences Pty Ltd | Topical formulation containing tocopheryl phosphates |
| WO2002051402A1 (en) * | 2000-12-22 | 2002-07-04 | Abbott Laboratories | Controlled release formulation of divalproex sodium |
| EP1363602A4 (en) * | 2001-01-25 | 2006-01-11 | Euro Celtique Sa | LOCAL ANESTHESIA, AND METHOD OF USE |
| US20020103110A1 (en) * | 2001-01-26 | 2002-08-01 | Spitzer A. Robert | System and method for rectal administration of medication for treatment of migraines |
| MXPA03007337A (es) * | 2001-02-15 | 2005-03-07 | King Pharmaceuticals Inc | Composicion farmaceutica y de hormona tiroidea estabilizada y metodo de preparacion de la misma. |
| US20030224047A1 (en) * | 2001-02-15 | 2003-12-04 | Franz G. Andrew | Levothyroxine compositions and methods |
| US6555581B1 (en) | 2001-02-15 | 2003-04-29 | Jones Pharma, Inc. | Levothyroxine compositions and methods |
| US20030032675A1 (en) * | 2001-02-15 | 2003-02-13 | Franz G. Andrew | Manufacture of thyroid hormone tablets having consistent active moiety amounts |
| US20020197314A1 (en) * | 2001-02-23 | 2002-12-26 | Rudnic Edward M. | Anti-fungal composition |
| US20040121988A1 (en) * | 2001-03-28 | 2004-06-24 | Medicure International Inc. | Treatment of cerebrovascular disease |
| US20060127474A1 (en) * | 2001-04-11 | 2006-06-15 | Oskar Kalb | Pharmaceutical compositions comprising fluvastatin |
| UA81224C2 (uk) * | 2001-05-02 | 2007-12-25 | Euro Celtic S A | Дозована форма оксикодону та її застосування |
| GB0118300D0 (en) * | 2001-07-26 | 2001-09-19 | Cortendo Ab | Formulations |
| US8008345B2 (en) * | 2001-07-27 | 2011-08-30 | Vital Health Sciences Pty. Ltd. | Dermal therapy using phosphate derivatives of electron transfer agents |
| US20030198667A1 (en) * | 2001-08-10 | 2003-10-23 | Franz Andrew G. | Methods of producing dispersible pharmaceutical compositions |
| US20030180353A1 (en) * | 2001-08-10 | 2003-09-25 | Franz G. Andrew | Stabilized pharmaceutical compositions |
| US20030190349A1 (en) * | 2001-08-10 | 2003-10-09 | Franz G. Andrew | Methods of stabilizing pharmaceutical compositions |
| US20030195253A1 (en) * | 2001-08-14 | 2003-10-16 | Franz G. Andrew | Unadsorbed levothyroxine pharmaceutical compositions, methods of making and methods of administration |
| US20030203967A1 (en) * | 2001-08-14 | 2003-10-30 | Franz G. Andrew | Levothyroxine compositions having unique Tmax properties |
| US7101569B2 (en) | 2001-08-14 | 2006-09-05 | Franz G Andrew | Methods of administering levothyroxine pharmaceutical compositions |
| US20030198672A1 (en) * | 2001-08-14 | 2003-10-23 | Franz G. Andrew | Levothyroxine compositions having unique triidothyronine plasma AUC properties |
| US20030199587A1 (en) * | 2001-08-14 | 2003-10-23 | Franz G. Andrew | Levothyroxine compositions having unique Cmax properties |
| US20030199586A1 (en) * | 2001-08-14 | 2003-10-23 | Franz G. Andrew | Unique levothyroxine aqueous materials |
| US9358214B2 (en) * | 2001-10-04 | 2016-06-07 | Adare Pharmaceuticals, Inc. | Timed, sustained release systems for propranolol |
| US20030175337A1 (en) * | 2001-10-29 | 2003-09-18 | Franz G. Andrew | Levothyroxine compositions having unique triiodothyronine Tmax properties |
| CN1604772A (zh) * | 2001-12-13 | 2005-04-06 | 生命健康科学有限公司 | 化合物的透皮转运 |
| CA2470636A1 (en) * | 2001-12-20 | 2003-07-03 | Pharmacia Corporation | Zero-order sustained released dosage forms and method of making the same |
| US20030162769A1 (en) * | 2002-02-26 | 2003-08-28 | Easterling W. Jerry | Composition and method for treating vulvodynia |
| US20050176782A1 (en) * | 2002-02-26 | 2005-08-11 | Easterling W. J. | Medicament and method for treating vulodynia |
| EP1513503A1 (en) * | 2002-06-07 | 2005-03-16 | Ranbaxy Laboratories Limited | Extended release formulation of divalproex sodium |
| AU2003245504A1 (en) * | 2002-06-14 | 2003-12-31 | Andrx Corporation | Pharmaceutical compositions for drugs having ph-dependentsolubility |
| US20040005359A1 (en) * | 2002-06-27 | 2004-01-08 | Cheng Xiu Xiu | Controlled release oral dosage form |
| US20040029959A1 (en) * | 2002-08-08 | 2004-02-12 | John Devane | Isosorbide mononitrate compositions and methods of their use |
| AU2002950713A0 (en) * | 2002-08-09 | 2002-09-12 | Vital Health Sciences Pty Ltd | Carrier |
| US20060134193A1 (en) * | 2002-09-24 | 2006-06-22 | Pieter De Haan | Method to improve pharmaceutical tablets having a matrix of cellulose ether |
| US20040086566A1 (en) * | 2002-11-04 | 2004-05-06 | Alpharma, Inc. | Waxy matrix dosage forms |
| US8092831B2 (en) * | 2002-11-08 | 2012-01-10 | Andrx Pharmaceuticals, Llc | Antihistamine and decongestant system |
| US8367111B2 (en) | 2002-12-31 | 2013-02-05 | Aptalis Pharmatech, Inc. | Extended release dosage forms of propranolol hydrochloride |
| KR20050086954A (ko) * | 2003-01-17 | 2005-08-30 | 바이탈 헬스 사이언시즈 피티와이 리미티드 | 항증식성 화합물 |
| SE0302947D0 (sv) * | 2003-01-24 | 2003-11-07 | Magle Ab | A composition material for transmucosal delivery |
| US20040156893A1 (en) * | 2003-02-11 | 2004-08-12 | Irwin Klein | Method for treating hypothyroidism |
| US20040186077A1 (en) * | 2003-03-17 | 2004-09-23 | Medicure International Inc. | Novel heteroaryl phosphonates as cardioprotective agents |
| AU2003901815A0 (en) * | 2003-04-15 | 2003-05-01 | Vital Health Sciences Pty Ltd | Phosphate derivatives |
| US20040265323A1 (en) * | 2003-05-16 | 2004-12-30 | Mccormick Beth A. | Compositions comprising pathogen elicited epithelial chemoattractant (eicosanoid hepoxilin A3), inhibitors thereof and methods of use thereof |
| US20040241234A1 (en) * | 2003-06-02 | 2004-12-02 | Alpharma, Inc. | Controlled release press-coated formulations of water-soluble active agents |
| US7063862B2 (en) * | 2003-06-03 | 2006-06-20 | Biokey, Inc. | Pharmaceutical composition and method for treating |
| CA2673334C (en) * | 2003-06-16 | 2013-11-12 | Andrx Pharmaceuticals, Llc | Oral extended-release composition |
| CA2533178C (en) * | 2003-07-21 | 2014-03-11 | Advancis Pharmaceutical Corporation | Antibiotic product, use and formulation thereof |
| JP2006528185A (ja) * | 2003-07-21 | 2006-12-14 | アドバンシス ファーマスーティカル コーポレイション | 抗生物質製剤、その使用法及び作成方法 |
| JP2006528190A (ja) * | 2003-07-21 | 2006-12-14 | アドバンシス ファーマスーティカル コーポレイション | 抗生物質製剤、その使用法及び作成方法 |
| WO2005016311A1 (en) * | 2003-08-11 | 2005-02-24 | Advancis Pharmaceutical Corporation | Robust pellet |
| AU2004264356B2 (en) | 2003-08-12 | 2011-01-27 | Shionogi, Inc. | Antibiotic product, use and formulation thereof |
| US8246996B2 (en) * | 2003-08-29 | 2012-08-21 | Shionogi Inc. | Antibiotic product, use and formulation thereof |
| US8460710B2 (en) * | 2003-09-15 | 2013-06-11 | Shionogi, Inc. | Antibiotic product, use and formulation thereof |
| CA2550983C (en) * | 2003-12-24 | 2013-09-17 | Advancis Pharmaceutical Corporation | Enhanced absorption of modified release dosage forms |
| EP1718621A4 (en) | 2004-01-30 | 2009-08-19 | Univ Johns Hopkins | NITROXYL PREPARATION COMPOUNDS APPLICATION METHOD |
| ATE495730T1 (de) * | 2004-03-03 | 2011-02-15 | Vital Health Sciences Pty Ltd | Alkaloid-formulierungen |
| EP1765336A4 (en) | 2004-06-25 | 2010-03-10 | Univ Johns Hopkins | ANGIOGENESIS INHIBITORS |
| US8715727B2 (en) * | 2004-07-02 | 2014-05-06 | Shionogi Inc. | Tablet for pulsed delivery |
| CN101014357A (zh) * | 2004-07-07 | 2007-08-08 | 麦迪库瑞国际公司 | 利用血小板聚集药物的组合疗法 |
| US20070060549A1 (en) * | 2004-08-10 | 2007-03-15 | Friesen Albert D | Combination therapies employing ace inhibitors and uses thereof for the treatment of diabetic disorders |
| US8747895B2 (en) * | 2004-09-13 | 2014-06-10 | Aptalis Pharmatech, Inc. | Orally disintegrating tablets of atomoxetine |
| US20060068004A1 (en) * | 2004-09-28 | 2006-03-30 | Aum Nutrapharm Inc. | Buccal delivery of sea cucumber tablets |
| US9884014B2 (en) | 2004-10-12 | 2018-02-06 | Adare Pharmaceuticals, Inc. | Taste-masked pharmaceutical compositions |
| NZ709754A (en) | 2004-10-21 | 2017-02-24 | Adare Pharmaceuticals Inc | Taste-masked pharmaceutical compositions with gastrosoluble pore-formers |
| EP1817288A4 (en) * | 2004-10-28 | 2009-08-26 | Medicure Int Inc | DUAL ANTIPLÄTTCHEN / ANTIKOAGULANS PYRIDOXINANALOGE |
| US20060094749A1 (en) * | 2004-10-28 | 2006-05-04 | Medicure International Inc. | Substituted pyridoxines as anti-platelet agents |
| US7459468B2 (en) * | 2004-10-28 | 2008-12-02 | Medicure International, Inc. | Aryl sulfonic pyridoxines as antiplatelet agents |
| US20060105038A1 (en) * | 2004-11-12 | 2006-05-18 | Eurand Pharmaceuticals Limited | Taste-masked pharmaceutical compositions prepared by coacervation |
| US20060183724A1 (en) * | 2005-02-03 | 2006-08-17 | Diliberti Charles E | Compositions of unconjugated estrogens and methods for their use |
| MX2007010492A (es) * | 2005-03-03 | 2007-11-08 | Vital Health Sciences Pty Ltd | Compuestos que tienen propiedades anticancer. |
| US9161918B2 (en) | 2005-05-02 | 2015-10-20 | Adare Pharmaceuticals, Inc. | Timed, pulsatile release systems |
| US9168216B2 (en) * | 2005-06-17 | 2015-10-27 | Vital Health Sciences Pty. Ltd. | Carrier comprising one or more di and/or mono-(electron transfer agent) phosphate derivatives or complexes thereof |
| US7544373B2 (en) * | 2007-04-02 | 2009-06-09 | Medicis Pharmaceutical Corporation | Minocycline oral dosage forms for the treatment of acne |
| US8722650B1 (en) | 2005-06-24 | 2014-05-13 | Medicis Pharmaceutical Corporation | Extended-release minocycline dosage forms |
| US7541347B2 (en) | 2007-04-02 | 2009-06-02 | Medicis Pharmaceutical Coropration | Minocycline oral dosage forms for the treatment of acne |
| US8252776B2 (en) | 2007-04-02 | 2012-08-28 | Medicis Pharmaceutical Corporation | Minocycline oral dosage forms for the treatment of acne |
| US20080242642A1 (en) * | 2007-04-02 | 2008-10-02 | Medicis Pharmaceutical Corporation | Minocycline oral dosage forms for the treatment of acne |
| US20080241235A1 (en) * | 2007-04-02 | 2008-10-02 | Medicis Pharmaceutical Corporation | Minocycline oral dosage forms for the treatment of acne |
| US7919483B2 (en) * | 2005-06-24 | 2011-04-05 | Medicis Pharmaceutical Corporation | Method for the treatment of acne |
| WO2007016361A2 (en) | 2005-07-29 | 2007-02-08 | Concert Pharmaceuticals Inc. | Novel pharmaceutical compounds |
| AU2006275679B2 (en) * | 2005-07-29 | 2012-04-12 | Government Of The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Use of Chk2 kinase inhibitors for cancer treatment |
| AU2006317440A1 (en) * | 2005-11-28 | 2007-05-31 | Medicure International Inc. | Selected dosage for the treatment of cardiovascular and related pathologies |
| US8357394B2 (en) | 2005-12-08 | 2013-01-22 | Shionogi Inc. | Compositions and methods for improved efficacy of penicillin-type antibiotics |
| US8778924B2 (en) * | 2006-12-04 | 2014-07-15 | Shionogi Inc. | Modified release amoxicillin products |
| WO2007070981A1 (en) * | 2005-12-23 | 2007-06-28 | Vital Health Sciences Pty Ltd | Compounds having cytokine modulating properties |
| US20070160667A1 (en) * | 2006-01-11 | 2007-07-12 | Nava Shterman | Controlled release formulation of divalproex sodium |
| ES2317450T3 (es) | 2006-01-11 | 2009-04-16 | Teva Pharmaceutical Industries Ltd. | Formulacion de liberacion controlada de acido valproico y sus derivados. |
| US8299052B2 (en) * | 2006-05-05 | 2012-10-30 | Shionogi Inc. | Pharmaceutical compositions and methods for improved bacterial eradication |
| EP2029114B1 (en) * | 2006-06-01 | 2014-09-24 | Merck Sharp & Dohme Corp. | Pharmaceutical compositions for sustained release of phenylephrine |
| US20070281017A1 (en) * | 2006-06-06 | 2007-12-06 | Endo Pharmaceuticals Inc., A Delaware Corporation | Sustained release oxycodone composition with acrylic polymer and metal hydroxide |
| US7538652B2 (en) * | 2006-08-29 | 2009-05-26 | International Business Machines Corporation | Electrical component tuned by conductive layer deletion |
| WO2008032208A2 (en) * | 2006-09-11 | 2008-03-20 | Aurobindo Pharma Limited | Extended release formulation of an antiepileptic agent |
| US20080081067A1 (en) * | 2006-10-03 | 2008-04-03 | Gupta Manishkumar | Sustained release pharmaceutical compositions of venlafaxine and process for preparation thereof |
| US20080220064A1 (en) * | 2006-12-06 | 2008-09-11 | Ramesh Ketkar Anant | Extended release matrix formulations of morphine |
| WO2008073388A2 (en) * | 2006-12-11 | 2008-06-19 | Mutual Pharmaceutical Company, Inc. | Alfuzosin formulations, methods of making and methods of use |
| EP2120578B1 (en) | 2007-01-19 | 2014-11-19 | Xcovery, INC. | Kinase inhibitor compounds |
| WO2008102235A1 (en) * | 2007-02-20 | 2008-08-28 | Aurobindo Pharma Limited | Controlled release formulations of alfuzosin |
| US20080241197A1 (en) * | 2007-04-02 | 2008-10-02 | Medicis Pharmaceutical Corporation | Minocycline dosage forms for the treatment of acne |
| US20080287418A1 (en) * | 2007-05-16 | 2008-11-20 | Astrazeneca Ab | Extended Release Compositions and Methods for Their Manufacture |
| MX2009013384A (es) * | 2007-06-08 | 2010-01-25 | Addrenex Pharmaceuticals Inc | Formulacion de liberacion extendida, y metodo para tratar disregulacion adrenergica. |
| US20100172991A1 (en) * | 2007-06-08 | 2010-07-08 | Henry Joseph Horacek | Extended Release Formulation and Methods of Treating Adrenergic Dysregulation |
| KR100836960B1 (ko) * | 2007-09-07 | 2008-06-10 | 주식회사 서울제약 | 새로운 나이아신 제어방출형 제제 |
| CN102098917B (zh) | 2008-06-19 | 2016-03-16 | 艾科睿控股公司 | 作为激酶抑制剂化合物的取代的哒嗪羧酰胺化合物 |
| WO2010017310A1 (en) | 2008-08-06 | 2010-02-11 | Medicis Pharmaceutical Corporation | Method for the treatment of acne and certain dosage forms thereof |
| ES2641471T3 (es) | 2008-10-06 | 2017-11-10 | The Johns Hopkins University | Compuestos de quinolina como inhibidores de la angiogénesis, metionina aminopeptidasa humana, y SirT1, y procedimientos de tratamiento de trastornos |
| US20100233259A1 (en) * | 2008-12-12 | 2010-09-16 | Pascal Grenier | Dosage form of ropinirole |
| WO2011015953A2 (en) * | 2009-08-04 | 2011-02-10 | Haren Treasurer | Greater utility with thyroid hormone |
| ES2753141T3 (es) | 2009-11-03 | 2020-04-07 | Lupin Ltd | Formulación de liberación modificada de lacosamida |
| RU2563623C2 (ru) | 2009-12-02 | 2015-09-20 | Апталис Фарма Лимитед | Микрокапсулы фексофенадина и содержащие их композиции |
| US10071030B2 (en) | 2010-02-05 | 2018-09-11 | Phosphagenics Limited | Carrier comprising non-neutralised tocopheryl phosphate |
| US8652511B2 (en) | 2010-03-30 | 2014-02-18 | Phosphagenics Limited | Transdermal delivery patch |
| EP2625176B1 (en) | 2010-10-08 | 2016-08-17 | Xcovery Holding Company LLC | Substitututed 6-amino-pyridazin-3-yl-carboxamide compounds as protein kinase modulators |
| PL2665477T3 (pl) | 2011-01-20 | 2016-05-31 | Bionevia Pharmaceuticals Inc | Kompozycje epalrestatu lub jego pochodnej o zmodyfikowanym uwalnianiu i sposoby ich stosowania |
| EP2685992A4 (en) | 2011-03-15 | 2014-09-10 | Phosphagenics Ltd | AMINOCHINOLINE AS A KINASEHEMMER |
| US9561241B1 (en) | 2011-06-28 | 2017-02-07 | Medicis Pharmaceutical Corporation | Gastroretentive dosage forms for minocycline |
| JP6702855B2 (ja) | 2013-04-07 | 2020-06-03 | ザ・ブロード・インスティテュート・インコーポレイテッド | 個別化された新生物ワクチンの組成物及び方法 |
| KR101751631B1 (ko) * | 2013-05-31 | 2017-06-27 | 히사미쓰 세이야꾸 가부시키가이샤 | 구강 첩부제 |
| WO2015077717A1 (en) | 2013-11-25 | 2015-05-28 | The Broad Institute Inc. | Compositions and methods for diagnosing, evaluating and treating cancer by means of the dna methylation status |
| WO2015085147A1 (en) | 2013-12-05 | 2015-06-11 | The Broad Institute Inc. | Polymorphic gene typing and somatic change detection using sequencing data |
| ITMI20132065A1 (it) * | 2013-12-11 | 2015-06-12 | Farmatron Ltd | Sistemi terapeutici a rilascio modificato per la somministrazione orale di curcumina nel trattamento delle malattie intestinali |
| BR112016014410A2 (pt) | 2013-12-20 | 2018-02-20 | The Broad Institute Inc. | terapia de combinação com vacina de neoantígeno |
| GB201506755D0 (en) | 2015-04-21 | 2015-06-03 | Reckitt Benckiser Llc | Novel pharmaceutical formulation |
| CA2902911C (en) | 2014-10-31 | 2017-06-27 | Purdue Pharma | Methods and compositions particularly for treatment of attention deficit disorder |
| EP3234193B1 (en) | 2014-12-19 | 2020-07-15 | Massachusetts Institute of Technology | Molecular biomarkers for cancer immunotherapy |
| EP3234130B1 (en) | 2014-12-19 | 2020-11-25 | The Broad Institute, Inc. | Methods for profiling the t-cell- receptor repertoire |
| BR112017024797A2 (pt) | 2015-05-20 | 2018-08-07 | The Broad Institute Inc. | neoantígenos partilhados |
| CA3001337C (en) | 2015-10-09 | 2023-12-12 | Reckitt Benckiser Llc | Pharmaceutical formulation |
| CN108601732A (zh) | 2015-12-09 | 2018-09-28 | 磷肌酸有限公司 | 药物制剂 |
| AU2016381366A1 (en) | 2015-12-30 | 2018-06-28 | Adamas Pharmaceuticals, Inc. | Methods and compositions for the treatment of seizure-related disorders |
| US20190346442A1 (en) | 2016-04-18 | 2019-11-14 | The Broad Institute, Inc. | Improved hla epitope prediction |
| CA3039178A1 (en) | 2016-10-03 | 2018-04-12 | TLL Pharmaceutical, LLC | Novel jak1 selective inhibitors and uses thereof |
| US20190330260A1 (en) | 2016-12-21 | 2019-10-31 | Avecho Biotechnology Limited | Process |
| US11549149B2 (en) | 2017-01-24 | 2023-01-10 | The Broad Institute, Inc. | Compositions and methods for detecting a mutant variant of a polynucleotide |
| US9980946B1 (en) | 2017-01-25 | 2018-05-29 | Effcon Laboratories, Inc. | Extended release methazolamide formulation |
| US10695309B2 (en) | 2017-03-31 | 2020-06-30 | Western New England University | Sustained-release liothyronine formulations, method of preparation and method of use thereof |
| EP3788147A1 (en) | 2018-05-04 | 2021-03-10 | Tollys | Tlr3 ligands that activate both epithelial and myeloid cells |
| WO2020072700A1 (en) | 2018-10-02 | 2020-04-09 | Dana-Farber Cancer Institute, Inc. | Hla single allele lines |
| US10722473B2 (en) | 2018-11-19 | 2020-07-28 | Purdue Pharma L.P. | Methods and compositions particularly for treatment of attention deficit disorder |
| US20220062394A1 (en) | 2018-12-17 | 2022-03-03 | The Broad Institute, Inc. | Methods for identifying neoantigens |
| WO2021007579A1 (en) * | 2019-07-11 | 2021-01-14 | Stenco,Llc | Biodegradable material |
| US12394502B2 (en) | 2019-10-02 | 2025-08-19 | The General Hospital Corporation | Method for predicting HLA-binding peptides using protein structural features |
| CN116249774A (zh) | 2020-05-26 | 2023-06-09 | 迪奥尼斯治疗公司 | 核酸人工微型蛋白质组文库 |
| WO2022189861A1 (en) | 2021-03-08 | 2022-09-15 | Tollys | Carbohydrate conjugates of tlr3 ligands and uses thereof |
| WO2023016321A1 (zh) | 2021-08-10 | 2023-02-16 | 贝达药业股份有限公司 | 恩沙替尼或其盐在治疗携带met 14外显子跳跃突变的疾病中的用途 |
| WO2023076733A1 (en) | 2021-11-01 | 2023-05-04 | Dana-Farber Cancer Institute, Inc. | Biologically selected nucleic acid artificial mini-proteome libraries |
| WO2025126109A1 (en) | 2023-12-15 | 2025-06-19 | Ensem Therapeutics, Inc. | Anilino-pyrazole derivatives, compositions and methods thereof |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2887440A (en) * | 1957-08-12 | 1959-05-19 | Dow Chemical Co | Enteric coating |
| BE587330A (enExample) * | 1959-04-13 | 1900-01-01 | ||
| US3065143A (en) * | 1960-04-19 | 1962-11-20 | Richardson Merrell Inc | Sustained release tablet |
| GB1171691A (en) * | 1967-02-24 | 1969-11-26 | Forest Laboratories | Lond-Acting Oral Carrier |
| US3870790A (en) * | 1970-01-22 | 1975-03-11 | Forest Laboratories | Solid pharmaceutical formulations containing hydroxypropyl methyl cellulose |
| US3852421A (en) * | 1970-03-23 | 1974-12-03 | Shinetsu Chemical Co | Excipient and shaped medicaments prepared therewith |
| CA1018456A (en) * | 1972-06-26 | 1977-10-04 | Hans Lowey | Prolonged release lozenges |
| US3839319A (en) * | 1973-01-26 | 1974-10-01 | Dow Chemical Co | Hydroxypropyl methylcellulose ethers and method of preparation |
| JPS5163927A (en) * | 1974-11-28 | 1976-06-02 | Shinetsu Chemical Co | Ketsugoseiryokonajozaihokaizaino seizohoho |
| US4167558A (en) * | 1976-02-13 | 1979-09-11 | Hoffmann-La Roche Inc. | Novel sustained release tablet formulations |
| YU43437B (en) * | 1976-05-05 | 1989-08-31 | Lowey Hans | Process for obtaining tablets containing an active component with long lasting effect |
| GB1593261A (en) * | 1976-07-23 | 1981-07-15 | Inveresk Res Int | Controlled release suppository |
| JPS5562012A (en) * | 1978-11-06 | 1980-05-10 | Teijin Ltd | Slow-releasing preparation |
| US4226849A (en) * | 1979-06-14 | 1980-10-07 | Forest Laboratories Inc. | Sustained release therapeutic compositions |
| US4259314A (en) * | 1979-12-10 | 1981-03-31 | Hans Lowey | Method and composition for the preparation of controlled long-acting pharmaceuticals |
-
1981
- 1981-12-18 US US06/332,348 patent/US4369172A/en not_active Expired - Lifetime
-
1982
- 1982-12-03 AR AR291504A patent/AR228699A1/es active
- 1982-12-14 MX MX195610A patent/MX160316A/es unknown
- 1982-12-15 SE SE8207167A patent/SE453796B/sv not_active IP Right Cessation
- 1982-12-15 CH CH730582A patent/CH641670A5/fr not_active IP Right Cessation
- 1982-12-16 IT IT12690/82A patent/IT1164472B/it active
- 1982-12-16 JP JP57221055A patent/JPS58110513A/ja active Granted
- 1982-12-16 DE DE3246492A patent/DE3246492C2/de not_active Expired
- 1982-12-16 GB GB08235858A patent/GB2111386A/en not_active Expired - Lifetime
- 1982-12-16 IL IL67497A patent/IL67497A/xx not_active IP Right Cessation
- 1982-12-16 FR FR8221109A patent/FR2518409B1/fr not_active Expired
- 1982-12-17 BE BE0/209760A patent/BE895391A/fr not_active IP Right Cessation
- 1982-12-17 CA CA000417978A patent/CA1195929A/en not_active Expired
- 1982-12-17 ZA ZA829267A patent/ZA829267B/xx unknown
- 1982-12-17 ES ES518321A patent/ES8402155A1/es not_active Expired
- 1982-12-17 NL NLAANVRAGE8204893,A patent/NL190472C/xx not_active IP Right Cessation
- 1982-12-17 DK DK560782A patent/DK160076C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2518409A1 (fr) | 1983-06-24 |
| CA1195929A (en) | 1985-10-29 |
| DE3246492C2 (de) | 1985-12-19 |
| SE8207167L (sv) | 1983-06-19 |
| IL67497A (en) | 1986-02-28 |
| GB2111386B (enExample) | |
| CH641670A5 (fr) | 1984-03-15 |
| DE3246492A1 (de) | 1983-06-30 |
| GB2111386A (en) | 1983-07-06 |
| MX160316A (es) | 1990-02-01 |
| NL190472C (nl) | 1994-03-16 |
| IL67497A0 (en) | 1983-05-15 |
| SE8207167D0 (sv) | 1982-12-15 |
| BE895391A (fr) | 1983-04-15 |
| JPH059413B2 (enExample) | 1993-02-04 |
| JPS58110513A (ja) | 1983-07-01 |
| IT8212690A0 (it) | 1982-12-16 |
| ES518321A0 (es) | 1984-01-16 |
| NL190472B (nl) | 1993-10-18 |
| ZA829267B (en) | 1983-08-31 |
| FR2518409B1 (fr) | 1986-02-21 |
| US4369172A (en) | 1983-01-18 |
| DK560782A (da) | 1983-06-19 |
| DK160076B (da) | 1991-01-28 |
| NL8204893A (nl) | 1983-07-18 |
| AR228699A1 (es) | 1983-03-30 |
| IT1164472B (it) | 1987-04-08 |
| DK160076C (da) | 1991-06-24 |
| ES8402155A1 (es) | 1984-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE453796B (sv) | Fast, terapeutisk komposition vars berarbasmaterial utgores av hydroxypropylmetylcellulosa samt ev natriumkarboximetylcellulosa | |
| US4695591A (en) | Controlled release dosage forms comprising hydroxypropylmethylcellulose | |
| US5451409A (en) | Sustained release matrix system using hydroxyethyl cellulose and hydroxypropyl cellulose polymer blends | |
| US6419954B1 (en) | Tablets and methods for modified release of hydrophilic and other active agents | |
| EP0234670B1 (en) | Sustained-release pharmaceutical formulation containing xanthan gum | |
| SE453797B (sv) | Terapeutisk, solid enhetsdoseringsform med forlengt utlosningsmonster vars berarmaterial innehaller hydroxypropylmetylcellulosa med hog molekyler vikt | |
| US20110071137A1 (en) | Process for preparing sustained release tablets | |
| JP4744142B2 (ja) | ラモトリギンを含む徐放性処方 | |
| US20170007543A1 (en) | Sustained release of guaifenesin | |
| HUP0203334A2 (hu) | Közvetlen kompresszióval előállított polimer tabletta magok | |
| JPH09500910A (ja) | パラセタモール及びドンペリドンのフィルムコーティング錠 | |
| US7985420B2 (en) | Sustained release of guaifenesin combination drugs | |
| JP6636532B2 (ja) | 含プレガバリン経口用徐放性三重錠剤 | |
| JP2008536922A (ja) | オランザピンの医薬用経口崩壊錠 | |
| RU2666996C1 (ru) | Гастроретентивные фармацевтические композиции для перорального введения | |
| HU206268B (en) | Process for producing solid oral forms comprising iphosphamide as active ingredient | |
| WO2006103551A1 (en) | Controlled release formulations of oxycodone | |
| JP3884056B1 (ja) | 口腔内速崩錠の製造方法 | |
| CN111346066A (zh) | 含吡拉西坦的缓释制剂 | |
| JPWO1993006821A1 (ja) | 徐放性錠剤 | |
| BR112018017331A2 (pt) | comprimido de camada tripla com liberação controlada, altamente dilatável, contendo pregabalina | |
| WO2006025029A2 (en) | Extended release composition of divalproex |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8207167-1 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |