SE447824B - Forfarande for framstellning av 7-acylindolin-2-oner - Google Patents
Forfarande for framstellning av 7-acylindolin-2-onerInfo
- Publication number
- SE447824B SE447824B SE8001009A SE8001009A SE447824B SE 447824 B SE447824 B SE 447824B SE 8001009 A SE8001009 A SE 8001009A SE 8001009 A SE8001009 A SE 8001009A SE 447824 B SE447824 B SE 447824B
- Authority
- SE
- Sweden
- Prior art keywords
- formula
- give
- prepared
- acylindoline
- lower alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 14
- APGQYYFHBPQPTL-UHFFFAOYSA-N 7-benzoyl-1,3-dihydroindol-2-one Chemical compound C=1C=CC=2CC(=O)NC=2C=1C(=O)C1=CC=CC=C1 APGQYYFHBPQPTL-UHFFFAOYSA-N 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 238000010992 reflux Methods 0.000 claims description 11
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 10
- FIAMTEUKWUNTSP-UHFFFAOYSA-N 1h-indol-7-yl(phenyl)methanone Chemical compound C=1C=CC=2C=CNC=2C=1C(=O)C1=CC=CC=C1 FIAMTEUKWUNTSP-UHFFFAOYSA-N 0.000 claims description 9
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- ZZOVZJBWXVZVLN-UHFFFAOYSA-N 2,3-dihydro-1h-indol-7-yl(phenyl)methanone Chemical compound C=1C=CC=2CCNC=2C=1C(=O)C1=CC=CC=C1 ZZOVZJBWXVZVLN-UHFFFAOYSA-N 0.000 claims description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims description 6
- 230000002140 halogenating effect Effects 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 6
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000006356 dehydrogenation reaction Methods 0.000 claims description 5
- 238000005658 halogenation reaction Methods 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 150000002825 nitriles Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 230000010933 acylation Effects 0.000 claims description 3
- 238000005917 acylation reaction Methods 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000000243 solution Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 10
- 150000002475 indoles Chemical class 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 4
- -1 indolyl ester Chemical class 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- LIYBKYYMGXDDRN-UHFFFAOYSA-N (3-chloro-1h-indol-7-yl)-phenylmethanone Chemical compound C1=CC=C2C(Cl)=CNC2=C1C(=O)C1=CC=CC=C1 LIYBKYYMGXDDRN-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000026030 halogenation Effects 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- AYUWVERWZCNJPS-UHFFFAOYSA-N 2-(2-acetamido-3-benzoylphenyl)acetic acid Chemical compound CC(=O)NC1=C(CC(O)=O)C=CC=C1C(=O)C1=CC=CC=C1 AYUWVERWZCNJPS-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- SOYCMDCMZDHQFP-UHFFFAOYSA-N amfenac Chemical class NC1=C(CC(O)=O)C=CC=C1C(=O)C1=CC=CC=C1 SOYCMDCMZDHQFP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229960001701 chloroform Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- SGQRIUSTBMAYKH-UHFFFAOYSA-N ethyl 2-(2-acetamido-3-benzoylphenyl)acetate Chemical compound CCOC(=O)CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1NC(C)=O SGQRIUSTBMAYKH-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 150000005623 oxindoles Chemical class 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- KXWGUUILSLIFQZ-UHFFFAOYSA-N (3-bromo-1h-indol-7-yl)-phenylmethanone Chemical compound C1=CC=C2C(Br)=CNC2=C1C(=O)C1=CC=CC=C1 KXWGUUILSLIFQZ-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- MHNAXLAGKSOPBH-UHFFFAOYSA-N 1-amino-3h-indol-2-one Chemical compound C1=CC=C2N(N)C(=O)CC2=C1 MHNAXLAGKSOPBH-UHFFFAOYSA-N 0.000 description 1
- QTERVOZQCNPERI-UHFFFAOYSA-N 1h-indole;phosphoric acid Chemical compound OP(O)(O)=O.C1=CC=C2NC=CC2=C1 QTERVOZQCNPERI-UHFFFAOYSA-N 0.000 description 1
- DTZPSICQSXOXQQ-UHFFFAOYSA-N 2-(2,3-dihydroindol-1-yl)benzonitrile Chemical compound N#CC1=CC=CC=C1N1C2=CC=CC=C2CC1 DTZPSICQSXOXQQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- GSEZYWGNEACOIW-UHFFFAOYSA-N bis(2-aminophenyl)methanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1N GSEZYWGNEACOIW-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- VOFWRWSXQNBWCE-UHFFFAOYSA-N dichloromethane;1h-indol-7-yl(phenyl)methanone Chemical compound ClCCl.C=1C=CC=2C=CNC=2C=1C(=O)C1=CC=CC=C1 VOFWRWSXQNBWCE-UHFFFAOYSA-N 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002476 indolines Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BMNDJWSIKZECMH-UHFFFAOYSA-N nitrosyl bromide Chemical compound BrN=O BMNDJWSIKZECMH-UHFFFAOYSA-N 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/34—Oxygen atoms in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/40—Nitrogen atoms, not forming part of a nitro radical, e.g. isatin semicarbazone
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/012,698 US4221716A (en) | 1979-02-16 | 1979-02-16 | Intermediate and process for the preparation of 7-acylindolin-2-ones |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8001009L SE8001009L (sv) | 1980-08-17 |
| SE447824B true SE447824B (sv) | 1986-12-15 |
Family
ID=21756265
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8001009A SE447824B (sv) | 1979-02-16 | 1980-02-08 | Forfarande for framstellning av 7-acylindolin-2-oner |
| SE8405430A SE8405430D0 (sv) | 1979-02-16 | 1984-10-30 | 7-acylindolforeningar, lempade som mellanprodukter vid synteser av 7-acylindolin-2-oner |
| SE8405429A SE451720B (sv) | 1979-02-16 | 1984-10-30 | Forfarande for framstellning av 7-acylindolin-2-oner |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8405430A SE8405430D0 (sv) | 1979-02-16 | 1984-10-30 | 7-acylindolforeningar, lempade som mellanprodukter vid synteser av 7-acylindolin-2-oner |
| SE8405429A SE451720B (sv) | 1979-02-16 | 1984-10-30 | Forfarande for framstellning av 7-acylindolin-2-oner |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4221716A (mo) |
| JP (2) | JPS55111464A (mo) |
| KR (1) | KR840001211B1 (mo) |
| AT (2) | AT375914B (mo) |
| AU (2) | AU538598B2 (mo) |
| BE (1) | BE881632A (mo) |
| CA (1) | CA1128529A (mo) |
| CH (1) | CH648828A5 (mo) |
| DE (1) | DE3005709A1 (mo) |
| DK (1) | DK157850C (mo) |
| ES (2) | ES8103040A1 (mo) |
| FI (1) | FI75805C (mo) |
| FR (1) | FR2449083A1 (mo) |
| GB (2) | GB2098208B (mo) |
| IE (1) | IE49384B1 (mo) |
| IL (1) | IL59143A (mo) |
| IT (1) | IT1128362B (mo) |
| MX (1) | MX6151E (mo) |
| NL (1) | NL190283C (mo) |
| NO (2) | NO154837C (mo) |
| NZ (1) | NZ192886A (mo) |
| PH (1) | PH15317A (mo) |
| SE (3) | SE447824B (mo) |
| ZA (1) | ZA80889B (mo) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4016580A (en) * | 1975-04-21 | 1977-04-05 | Polaroid Corporation | Folding viewfinding and flash mounting assembly |
| IN163263B (mo) * | 1984-02-07 | 1988-08-27 | Pfizer | |
| US4569942A (en) * | 1984-05-04 | 1986-02-11 | Pfizer Inc. | N,3-Disubstituted 2-oxindole-1-carboxamides as analgesic and antiinflammatory agents |
| US4690943A (en) * | 1984-09-19 | 1987-09-01 | Pfizer Inc. | Analgesic and antiinflammatory 1,3-diacyl-2-oxindole compounds |
| CH687764A5 (de) * | 1992-07-02 | 1997-02-14 | Lonza Ag Gampel Wallis Geschof | Verfahren zur Herstellung von 7-Acylindolen. |
| JP2004529110A (ja) | 2001-03-06 | 2004-09-24 | アストラゼネカ アクチボラグ | 脈管損傷活性を有するインドール誘導体 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3597503A (en) * | 1967-12-06 | 1971-08-03 | Hooker Chemical Corp | Cyclic phosphoroamidates and process for making same |
| US3975521A (en) * | 1969-06-30 | 1976-08-17 | Dow Corning Corporation | Prostate carcinoma treatment |
| NL90149C (mo) * | 1972-05-17 | |||
| US3897451A (en) * | 1973-04-27 | 1975-07-29 | Univ Ohio State Res Found | Synthesis of oxindoles from anilines and intermediates therein |
| US3975531A (en) * | 1973-10-02 | 1976-08-17 | A. H. Robins Company, Incorporated | 4-(5- And 7-)benzoylindolin-2-ones and pharmaceutical uses thereof |
| CH577461A5 (mo) * | 1975-08-13 | 1976-07-15 | Robins Co Inc A H | |
| AT339294B (de) * | 1975-12-22 | 1977-10-10 | Robins Co Inc A H | Verfahren zur herstellung von 4-(5- oder 7-)-benzoylindolin-2-onen |
-
1979
- 1979-02-16 US US06/012,698 patent/US4221716A/en not_active Expired - Lifetime
- 1979-12-17 JP JP16395179A patent/JPS55111464A/ja active Granted
-
1980
- 1980-01-16 IL IL59143A patent/IL59143A/xx unknown
- 1980-01-23 AU AU54873/80A patent/AU538598B2/en not_active Expired
- 1980-02-07 IE IE234/80A patent/IE49384B1/en not_active IP Right Cessation
- 1980-02-07 PH PH23614A patent/PH15317A/en unknown
- 1980-02-08 GB GB8212431A patent/GB2098208B/en not_active Expired
- 1980-02-08 GB GB8004314A patent/GB2042541B/en not_active Expired
- 1980-02-08 BE BE0/199332A patent/BE881632A/fr not_active IP Right Cessation
- 1980-02-08 SE SE8001009A patent/SE447824B/sv not_active IP Right Cessation
- 1980-02-13 MX MX808645U patent/MX6151E/es unknown
- 1980-02-14 NO NO800399A patent/NO154837C/no unknown
- 1980-02-14 AT AT0080080A patent/AT375914B/de not_active IP Right Cessation
- 1980-02-15 ES ES488622A patent/ES8103040A1/es not_active Expired
- 1980-02-15 CA CA345,708A patent/CA1128529A/en not_active Expired
- 1980-02-15 IT IT67232/80A patent/IT1128362B/it active
- 1980-02-15 NZ NZ192886A patent/NZ192886A/xx unknown
- 1980-02-15 NL NLAANVRAGE8000968,A patent/NL190283C/xx not_active IP Right Cessation
- 1980-02-15 ZA ZA00800889A patent/ZA80889B/xx unknown
- 1980-02-15 CH CH1273/80A patent/CH648828A5/fr not_active IP Right Cessation
- 1980-02-15 FI FI800464A patent/FI75805C/fi not_active IP Right Cessation
- 1980-02-15 FR FR8003417A patent/FR2449083A1/fr active Granted
- 1980-02-15 DE DE19803005709 patent/DE3005709A1/de active Granted
- 1980-02-15 DK DK067380A patent/DK157850C/da not_active IP Right Cessation
- 1980-02-15 KR KR1019800000617A patent/KR840001211B1/ko not_active Expired
- 1980-05-26 ES ES491847A patent/ES491847A0/es active Granted
-
1983
- 1983-08-08 AT AT0286983A patent/AT380235B/de not_active IP Right Cessation
-
1984
- 1984-06-12 AU AU29309/84A patent/AU564500B2/en not_active Expired
- 1984-10-30 SE SE8405430A patent/SE8405430D0/xx unknown
- 1984-10-30 SE SE8405429A patent/SE451720B/sv not_active IP Right Cessation
-
1986
- 1986-04-08 NO NO86861360A patent/NO166365C/no unknown
-
1989
- 1989-03-06 JP JP1053598A patent/JPH01265074A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4736043A (en) | Process for the preparation of indole derivatives | |
| KR910006325B1 (ko) | 4-비페닐일아세트산의 제조방법 | |
| SE447824B (sv) | Forfarande for framstellning av 7-acylindolin-2-oner | |
| IE65880B1 (en) | Process for the preparation of 2,6-dichlorodiphenylamino-acetic acid derivatives | |
| JPH0312058B2 (mo) | ||
| JP4173599B2 (ja) | 6−ヒドロキシ−2−オキソ−1,2,3,4−テトラヒドロキノリンの製造方法 | |
| WO2011004182A1 (en) | Intermediates and processes for the preparation of 4- (acetylamino) ) -3- [ (4-chloro-phenyl) thio] -2-methyl-1h-indole-1-acetic acid | |
| US4550165A (en) | Process for producing 1,2,5,6-tetrahydro-4H-pyrrolo-[3,2,1-ij]-quinolin-4-one | |
| HU187471B (en) | Process for preparing n-acyl-triptamine derivatives and pharmaceutical compositions containing them as active agents | |
| US3468900A (en) | Process for preparing isoxazole compounds | |
| US4595755A (en) | 5-halo-1,2,3-(1,2-dihydropyrrolo)-4-quinolones | |
| FI69838C (fi) | Foerfarande foer framstaellning av 1,2,3-tiadiazol-5-ylurinaemnen | |
| US4252723A (en) | Air oxidation of oxindoles to isatins | |
| EP0093590A1 (en) | Process for the preparation of sulfonylamino benzophenones | |
| US3210373A (en) | Preparation of 3-methyl-2-pyrrolidinones | |
| CA1083582A (en) | Process for the preparation of halogenomethylene- indoxyls | |
| US5596104A (en) | Preparation of 3,4,6-trifluorophthalic acid | |
| KR20010005843A (ko) | 2,6-디클로로-5-플루오로니코티노니트릴의 제조 방법 및 화합물 3-시아노-2-히드록시-5-플루오로피리드-6-온- 일나트륨염과 그의 토토머 | |
| GB1605064A (en) | Isatin process intermediates therefor and products obtained therefrom | |
| CA1262546A (en) | Quinolone intermediates for the preparation of 1,2,5, 6-tetrahydro-4h-pyrrolo¬3,2,1,ij|-quinoline-4- one | |
| SE454695B (sv) | Nya isoxazolderivat, forfarande for framstellning derav samt farmaceutisk komposition derav | |
| JPS62267267A (ja) | ピラゾ−ル誘導体およびその製造法 | |
| JPS5872561A (ja) | 1−置換インドリノン−2ユウドウタイノセイゾウホウ | |
| JPH0576942B2 (mo) | ||
| HU192651B (en) | Process for preparing optically active derivatives of 1-/3-chloro-propyl/3-oxo-1,2,3,5,6,11b-hexahydro-indolysino/8,7-b/indole |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8001009-3 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8001009-3 Format of ref document f/p: F |