SE437007B - Transportband - Google Patents
TransportbandInfo
- Publication number
- SE437007B SE437007B SE7802072A SE7802072A SE437007B SE 437007 B SE437007 B SE 437007B SE 7802072 A SE7802072 A SE 7802072A SE 7802072 A SE7802072 A SE 7802072A SE 437007 B SE437007 B SE 437007B
- Authority
- SE
- Sweden
- Prior art keywords
- links
- central
- belt
- rods
- elements
- Prior art date
Links
- 230000001419 dependent effect Effects 0.000 claims 2
- 230000007423 decrease Effects 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 230000003014 reinforcing effect Effects 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- LTINZAODLRIQIX-FBXRGJNPSA-N cefpodoxime proxetil Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC)C(=O)OC(C)OC(=O)OC(C)C)C(=O)C(=N/OC)\C1=CSC(N)=N1 LTINZAODLRIQIX-FBXRGJNPSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65G—TRANSPORT OR STORAGE DEVICES, e.g. CONVEYORS FOR LOADING OR TIPPING, SHOP CONVEYOR SYSTEMS OR PNEUMATIC TUBE CONVEYORS
- B65G17/00—Conveyors having an endless traction element, e.g. a chain, transmitting movement to a continuous or substantially-continuous load-carrying surface or to a series of individual load-carriers; Endless-chain conveyors in which the chains form the load-carrying surface
- B65G17/06—Conveyors having an endless traction element, e.g. a chain, transmitting movement to a continuous or substantially-continuous load-carrying surface or to a series of individual load-carriers; Endless-chain conveyors in which the chains form the load-carrying surface having a load-carrying surface formed by a series of interconnected, e.g. longitudinal, links, plates, or platforms
- B65G17/063—Conveyors having an endless traction element, e.g. a chain, transmitting movement to a continuous or substantially-continuous load-carrying surface or to a series of individual load-carriers; Endless-chain conveyors in which the chains form the load-carrying surface having a load-carrying surface formed by a series of interconnected, e.g. longitudinal, links, plates, or platforms the load carrying surface being formed by profiles, rods, bars, rollers or the like attached to more than one traction element
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65G—TRANSPORT OR STORAGE DEVICES, e.g. CONVEYORS FOR LOADING OR TIPPING, SHOP CONVEYOR SYSTEMS OR PNEUMATIC TUBE CONVEYORS
- B65G2201/00—Indexing codes relating to handling devices, e.g. conveyors, characterised by the type of product or load being conveyed or handled
- B65G2201/02—Articles
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65G—TRANSPORT OR STORAGE DEVICES, e.g. CONVEYORS FOR LOADING OR TIPPING, SHOP CONVEYOR SYSTEMS OR PNEUMATIC TUBE CONVEYORS
- B65G2207/00—Indexing codes relating to constructional details, configuration and additional features of a handling device, e.g. Conveyors
- B65G2207/24—Helical or spiral conveying path
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Belt Conveyors (AREA)
- Structure Of Belt Conveyors (AREA)
- Chain Conveyers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/771,850 US4078655A (en) | 1977-02-25 | 1977-02-25 | Small radius conveyor belt and conveying system |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7802072L SE7802072L (sv) | 1978-08-26 |
| SE437007B true SE437007B (sv) | 1985-02-04 |
Family
ID=25093132
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7802072A SE437007B (sv) | 1977-02-25 | 1978-02-22 | Transportband |
| SE8302920A SE443127B (sv) | 1977-02-25 | 1983-05-24 | Transportor med en i huvudsak rak bandel och en i sidled krokt bandel |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8302920A SE443127B (sv) | 1977-02-25 | 1983-05-24 | Transportor med en i huvudsak rak bandel och en i sidled krokt bandel |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4078655A (enExample) |
| JP (1) | JPS53133877A (enExample) |
| AU (1) | AU520714B2 (enExample) |
| BE (1) | BE864285A (enExample) |
| CA (1) | CA1065786A (enExample) |
| DE (1) | DE2808052C2 (enExample) |
| FR (1) | FR2381694A1 (enExample) |
| GB (1) | GB1596807A (enExample) |
| IT (1) | IT1092788B (enExample) |
| SE (2) | SE437007B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995016627A1 (en) * | 1993-12-17 | 1995-06-22 | Frigoscandia Food Process Systems Ab | Belt conveyor |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5742886Y2 (enExample) * | 1978-10-25 | 1982-09-21 | ||
| US4448301A (en) * | 1980-08-04 | 1984-05-15 | Alger David W | Conveyor system with frictionally driven conveyor belt |
| SE437008B (sv) * | 1982-11-26 | 1985-02-04 | Frigoscandia Contracting Ab | Transportband |
| GB2174349A (en) * | 1985-05-03 | 1986-11-05 | Tweedy Of Burnley Ltd | Carriers for use in conveyors |
| US4846339A (en) * | 1987-03-11 | 1989-07-11 | Ashworth Bros., Inc. | Flat wire conveyor with differential pitch |
| CA1296671C (en) * | 1987-08-10 | 1992-03-03 | Gerald C. Roinestad | Conveyor belt and system with a non-collapsing inside edge |
| AU609853B2 (en) * | 1987-08-10 | 1991-05-09 | Ashworth Bros., Inc. | Conveyor belt and system with a non-collapsing inside edge |
| US4940133A (en) * | 1987-08-10 | 1990-07-10 | Ashworth Bros., Inc. | Conveyor belt and system with a non-collapsing inside edge |
| US4951807A (en) * | 1987-08-10 | 1990-08-28 | Ashworth Bros., Inc. | Non-collapsing inside edge conveyor belt with dual pitch links |
| US4867301A (en) * | 1987-08-10 | 1989-09-19 | Ashworth Bros., Inc. | Conveyor belt and system for single direction lateral curved travel |
| US5141102A (en) * | 1987-08-10 | 1992-08-25 | Ashworth Bros., Inc. | Conveyor belt and system with a non-collapsing inside edge |
| US4932925A (en) * | 1988-03-21 | 1990-06-12 | Ashworth Bros., Inc. | Link having a work-hardened area |
| DE8811682U1 (de) * | 1988-09-15 | 1988-10-27 | S-Way AG, Herisau | Vorrichtung zum Fördern von Gegenständen |
| US4893708A (en) * | 1988-09-20 | 1990-01-16 | Northfield Equipment And Manufacturing Co., Inc. | Conveyor for freezing food packages |
| US5139150A (en) * | 1988-11-10 | 1992-08-18 | The Boeing Company | Article sorting apparatus and method |
| US4940128A (en) * | 1988-11-10 | 1990-07-10 | The Boeing Company | Article orientation system and method |
| US4933074A (en) * | 1988-11-10 | 1990-06-12 | The Boeing Company | Article singulating system and method |
| US4923067A (en) * | 1988-11-10 | 1990-05-08 | The Boeing Company | Automated drill sorting system and method |
| US4934517A (en) * | 1988-11-14 | 1990-06-19 | The Laitram Corporation | Horizontal flexing conveyor belt |
| DE8900158U1 (de) * | 1989-01-09 | 1989-04-06 | Jonge Poerink B.V., Borne | Förderband |
| US5033071A (en) * | 1989-02-24 | 1991-07-16 | The Boeing Company | Material composition analyzer and method |
| US4981208A (en) * | 1990-02-16 | 1991-01-01 | The Cambridge Wire Cloth Company | Magnetic drive spiral conveyor system |
| DE4015118A1 (de) * | 1990-05-11 | 1991-11-14 | Jonge Poerink Bv | Foerderband |
| DE4024277A1 (de) * | 1990-07-31 | 1992-02-06 | Hetran Maschinen Vertriebs Gmb | Vorrichtung zum bewegen stangenfoermigen gutes in richtung seiner laengsachse |
| US5141099A (en) * | 1990-09-25 | 1992-08-25 | Liquid Carbonic Corporation | Belt overlay apparatus |
| US5139135A (en) * | 1991-02-19 | 1992-08-18 | Guy Irwin | Reduced radius spiral conveyor with plastic belts |
| US5174439A (en) * | 1991-07-03 | 1992-12-29 | Cambridge Wire Cloth Company | Modular plastic turn belt conveyor system, module, belt and drive therefor |
| US5183149A (en) * | 1991-09-11 | 1993-02-02 | Frigoscandia Food Process Systems Ab | Belt conveyor system |
| US5398521A (en) * | 1991-09-12 | 1995-03-21 | Baron; David L. | Commercial freezer |
| JPH0743044Y2 (ja) * | 1991-10-22 | 1995-10-04 | 大和製罐株式会社 | 缶体表面処理装置における缶体搬送用コンベアベルト |
| US5247810A (en) * | 1992-07-14 | 1993-09-28 | Liquid Carbonic Corporation | Freezer conveyor |
| US5271491A (en) * | 1993-02-18 | 1993-12-21 | Guy Irwin | Bi-directional short radius turn conveyor belt |
| US5350056A (en) * | 1993-06-16 | 1994-09-27 | Cambridge, Inc. | Self-supporting conveyor belt with wire-formed spacers |
| US5423416A (en) * | 1993-09-03 | 1995-06-13 | Ashworth Brothers, Inc. | Conveyor belts with spiral overlay |
| DE69510423T2 (de) * | 1994-04-15 | 2000-02-24 | Jorgen Draebel | Förderkette mit einer tragfläche aufgebaut aus kettengliedern quer zur längsrichtung dieser förderkette |
| US5501319A (en) * | 1994-06-21 | 1996-03-26 | Ashworth Bros., Inc. | Conveyor belt with asymmetric edge links |
| US5622252A (en) * | 1995-03-31 | 1997-04-22 | Ashworth Bros., Inc. | Reduced radius conveyor belt |
| US5566817A (en) * | 1995-05-31 | 1996-10-22 | Meeker; William A. | Conveyor belt |
| AU7362696A (en) * | 1995-09-19 | 1997-04-28 | Pillsbury Company, The | Broiler apparatus |
| US5954187A (en) * | 1996-01-22 | 1999-09-21 | Cambridge, Inc. | Conveyor rod in side link connection |
| US5921379A (en) * | 1996-01-23 | 1999-07-13 | The Laitram Corporation | Modular conveyor belt suitable for following straight or curved paths |
| US5934448A (en) * | 1996-06-10 | 1999-08-10 | Cambridge, Inc. | Wire conveyor belt with tension transfer |
| US5906270A (en) * | 1996-08-16 | 1999-05-25 | Faulkner; William G. | Tight turning radius conveyor belt |
| US5829578A (en) * | 1996-09-06 | 1998-11-03 | Frigoscandia Equipment Ab | Conveyer belt |
| US5803232A (en) * | 1996-09-06 | 1998-09-08 | Frigoscandia Equipment Ab | Conveyor belt |
| USD420777S (en) * | 1996-11-07 | 2000-02-15 | Maskinfabrikken Baeltix A/S | Chain link module for a conveyor belt |
| US6202833B1 (en) * | 1997-02-20 | 2001-03-20 | Wire Belt Company Of America | Conveyor belt with variable spacing |
| US5954188A (en) * | 1997-06-12 | 1999-09-21 | Ashworth Bros., Inc. | Conveyor belt |
| US6129205A (en) * | 1998-12-09 | 2000-10-10 | Ashworth Bros. Inc. | Variable loop count conveyor belt |
| NL1010842C2 (nl) * | 1998-12-18 | 2000-06-20 | Kaak Johan H B | Inrichting voor het transporteren van voorwerpen. |
| US6354432B1 (en) * | 1999-06-18 | 2002-03-12 | Cambridge, Inc. | Conveyor belt and method of making the same |
| US6360882B1 (en) * | 1999-06-18 | 2002-03-26 | Cambridge, Inc. | Conveyor belt and method of making the same |
| US6523677B1 (en) | 2000-11-15 | 2003-02-25 | Tarpaulin.Com, Inc. | Low tension dual helical conveyor system |
| US6796420B2 (en) * | 2001-10-23 | 2004-09-28 | Richard K. Byrne | Self-stacking conveyor belt and method |
| DK1498367T3 (da) * | 2003-07-17 | 2007-04-10 | Ashworth Jonge Poerink Bv | Led til forbindelse af stænger på et transportbånd, som i en spiral er viklet på en dreven, transportbånd og transportsystem med sådanne forbindelsesled |
| DE102004021262A1 (de) * | 2004-04-30 | 2005-11-17 | Sander Hansen A/S | Pasteur mit Förderband |
| US7070043B1 (en) * | 2005-06-08 | 2006-07-04 | Laitram, L.L.C. | Modular plastic conveyor belt suitable for tight turns |
| ITMI20061395A1 (it) * | 2006-07-18 | 2008-01-19 | Tecno Pool Spa | Nastro trasportatore di un convogliatore a catena con maglie di trascinamento innovative. |
| US7735637B2 (en) | 2007-01-11 | 2010-06-15 | Ashworth Bros., Inc. | Buttonless conveyor belt |
| NL1033263C2 (nl) * | 2007-01-22 | 2008-07-23 | Stork Titan Bv | Behandelingsinrichting voor het met geconditioneerde lucht behandelen van voedselproducten. |
| NL2001852C2 (en) * | 2007-07-27 | 2009-05-07 | Fmc Foodtech Ab | Conveyor calls. |
| ITMI20080345A1 (it) * | 2008-02-29 | 2009-09-01 | Regina Catene Calibrate Spa | "tappeto trasportatore con mezzi di guida per percorsi curvilinei e moduli per esso" |
| BRPI0916081B1 (pt) * | 2008-11-07 | 2019-05-21 | Laitram, L.L.C. | Módulo de esteira transportadora e esteira transportadora modular |
| EP2848560B1 (en) | 2010-07-12 | 2016-10-05 | Laitram, L.L.C. | Positive-drive spiral conveyor |
| US8926463B1 (en) | 2010-09-13 | 2015-01-06 | Tarpaulin.Com, Inc. | Drive mechanism for a cage in a spiral conveyor belt system |
| EP3381841B1 (en) * | 2011-12-06 | 2022-02-23 | Ashworth Brothers, Inc. | Conveyor belt with alignment features |
| US8844713B2 (en) | 2012-03-06 | 2014-09-30 | Ashworth Bros., Inc. | Conveyor belt link with wear resistance features |
| US8985318B2 (en) * | 2012-05-15 | 2015-03-24 | Ashworth Bros., Inc. | Conveyor belt with composite link |
| US8899409B2 (en) | 2012-06-13 | 2014-12-02 | Ashworth Bros., Inc. | Conveyor belt link having wear resistant portion |
| US9150359B2 (en) | 2012-08-17 | 2015-10-06 | Ashworth Bros., Inc. | Link member having a curved bearing surface |
| USD712158S1 (en) * | 2013-09-17 | 2014-09-02 | Cambridge International Inc. | Mesh panel |
| ITMI20131978A1 (it) * | 2013-11-27 | 2015-05-28 | Costacurta S P A Vico | Nastro di trasporto a raggio ridotto e relativa maglia |
| USD719359S1 (en) * | 2014-01-24 | 2014-12-16 | Cambridge International, Inc. | Mesh panel |
| USD739110S1 (en) | 2014-06-09 | 2015-09-15 | Cambridge International Inc. | Mesh panel |
| DK3369681T3 (da) * | 2017-03-03 | 2021-03-15 | Cambridge Int Inc | Fremføringsbånd med direkte randdrev |
| US10507978B2 (en) | 2017-10-28 | 2019-12-17 | Rabbit Designs LLC | Radius and variable width conveyor belt |
| EP3966135A4 (en) | 2019-05-08 | 2023-01-18 | Cambridge International, Inc. | DIRECT DRIVE SPIRAL CONVEYOR SYSTEMS AND PROCESSES |
| US11571100B2 (en) | 2019-06-28 | 2023-02-07 | Lg Electronics Inc | Intelligent robot cleaner |
| EP4021829A4 (en) | 2019-08-29 | 2023-11-22 | Cambridge International, Inc. | ACTIVE DIRECT DRIVE SPIRAL CONVEYOR BELT SYSTEMS AND METHODS |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL76794C (enExample) * | 1900-01-01 | |||
| DE883122C (de) * | 1951-03-06 | 1953-07-16 | Konrad Grebe | Vorrichtung zum Antreiben von Foerderbaendern oder Foerderbandabschnitten |
| GB738806A (en) * | 1952-08-15 | 1955-10-19 | Johannes Ravestein | Improvements in or relating to conveying apparatus comprising an endless conveyor belt |
| DE932959C (de) * | 1952-08-15 | 1955-09-12 | Johannes Ravestein | Foerdervorrichtung |
| US2778480A (en) * | 1955-01-27 | 1957-01-22 | Donald A Dobbins | Conveyor element |
| GB958807A (en) * | 1961-07-21 | 1964-05-27 | British Wedge Wire Company Ltd | Improvements in or relating to endless conveyors |
| US3225898A (en) * | 1964-02-26 | 1965-12-28 | Ashworth Bros Inc | Collapsible conveyor belt |
| US3261451A (en) * | 1964-06-29 | 1966-07-19 | Ashworth Bros Inc | Flat wire conveyor belt having tapered pin slots |
| US3225901A (en) * | 1964-09-30 | 1965-12-28 | Dahlman Mfg & Sales Inc | Draper chain structure |
| GB1090630A (en) * | 1965-02-15 | 1967-11-08 | Ashworth Bros Inc | Conveyor system |
| US3333678A (en) * | 1966-03-16 | 1967-08-01 | Ashworth Bros Inc | Cover plate for conveyor belt |
| US3348659A (en) * | 1967-04-19 | 1967-10-24 | Ashworth Bros Inc | Conveyor system |
| US3467239A (en) * | 1967-09-05 | 1969-09-16 | Ashworth Bros Inc | Central link collapsible conveyor belt |
| US3439795A (en) * | 1967-12-01 | 1969-04-22 | Ashworth Bros Inc | Flat wire conveyor belt having slotted bar links |
| US3536183A (en) * | 1967-12-15 | 1970-10-27 | Gen Host Corp | Chain belt conveyor system |
| US3664487A (en) * | 1969-05-23 | 1972-05-23 | Carl H Ballenger | Endless helical conveyer and belt |
| US3651924A (en) * | 1970-06-15 | 1972-03-28 | Fmc Corp | Dual bend conveyor |
| USRE27690E (en) | 1970-07-29 | 1973-07-03 | Flat wire conveyor belt having slotted bar links | |
| JPS5128789Y2 (enExample) * | 1971-01-16 | 1976-07-20 | ||
| DE2109830A1 (de) * | 1971-03-02 | 1972-09-21 | Schliemann, Horst, 3501 Zierenberg | Gefiechtsgliederkurvenband |
| SE381241B (sv) * | 1973-03-07 | 1975-12-01 | Frigoscandia Contracting Ab | Transportanordning med ett endlost transportband vilket er anordnat att till en del av sin lengd folja en bana bestaende av ett antal over varandra belegna skruvformigt forlopande varv |
| US3854575A (en) * | 1973-10-30 | 1974-12-17 | J Fraioli | Conveyor belt system |
| US3920117A (en) * | 1974-04-23 | 1975-11-18 | Ashworth Bros Inc | Wire conveyor belt |
| US3991876A (en) * | 1975-04-25 | 1976-11-16 | Schmidt Sr Jacob | Sanitary linkage connection means for food products processing conveyor |
-
1977
- 1977-02-25 US US05/771,850 patent/US4078655A/en not_active Expired - Lifetime
-
1978
- 1978-02-17 GB GB6389/78A patent/GB1596807A/en not_active Expired
- 1978-02-17 AU AU33378/78A patent/AU520714B2/en not_active Expired
- 1978-02-22 SE SE7802072A patent/SE437007B/sv unknown
- 1978-02-22 IT IT20530/78A patent/IT1092788B/it active
- 1978-02-23 CA CA297,608A patent/CA1065786A/en not_active Expired
- 1978-02-24 DE DE2808052A patent/DE2808052C2/de not_active Expired
- 1978-02-24 BE BE185447A patent/BE864285A/xx not_active IP Right Cessation
- 1978-02-24 JP JP2082478A patent/JPS53133877A/ja active Granted
- 1978-02-27 FR FR7805552A patent/FR2381694A1/fr active Granted
-
1983
- 1983-05-24 SE SE8302920A patent/SE443127B/sv unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995016627A1 (en) * | 1993-12-17 | 1995-06-22 | Frigoscandia Food Process Systems Ab | Belt conveyor |
Also Published As
| Publication number | Publication date |
|---|---|
| SE8302920D0 (sv) | 1983-05-24 |
| IT1092788B (it) | 1985-07-12 |
| AU520714B2 (en) | 1982-02-25 |
| SE7802072L (sv) | 1978-08-26 |
| BE864285A (fr) | 1978-06-16 |
| DE2808052A1 (de) | 1978-11-16 |
| SE8302920L (sv) | 1983-05-24 |
| DE2808052C2 (de) | 1987-02-26 |
| AU3337878A (en) | 1979-08-23 |
| JPS53133877A (en) | 1978-11-22 |
| SE443127B (sv) | 1986-02-17 |
| FR2381694A1 (fr) | 1978-09-22 |
| GB1596807A (en) | 1981-09-03 |
| JPS6154682B2 (enExample) | 1986-11-25 |
| IT7820530A0 (it) | 1978-02-22 |
| FR2381694B1 (enExample) | 1984-10-12 |
| CA1065786A (en) | 1979-11-06 |
| US4078655A (en) | 1978-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE437007B (sv) | Transportband | |
| US4036352A (en) | Endless conveyor | |
| CA1076985A (en) | Belt conveyors | |
| US5501319A (en) | Conveyor belt with asymmetric edge links | |
| EP0668838B1 (de) | Taschenförderer | |
| DE69010902T2 (de) | Diagonale reifenkette. | |
| US4809844A (en) | Tubular belt conveyor | |
| DE3247625C2 (de) | Spannvorrichtung für Kratzböden o.ä. Transportböden an landwirtschaftlichen Fahrzeugen und Maschinen | |
| DE2550723B2 (de) | Endlos umlaufendes, in vertikale Ebene umlenkbares flexibles Förderband | |
| DE3413528A1 (de) | Vorrichtung fuer die frachtbefoerderung auf lastkraftwagen | |
| DE2633475A1 (de) | Endloser foerderer | |
| CS207746B2 (en) | Belt conveyer | |
| EP0110864B1 (de) | Bandspeicher, insbesondere für Blechbänder | |
| DE470084C (de) | Hoehenfoerderer mit Rollenfuehrung fuer die gelenkig mit den endlosen Ketten verbundenen Mitnehmerrechen | |
| DE3442978A1 (de) | Stueckgutfoerderer | |
| EP0268846A2 (de) | Bandförderer für Linienführungen mit Abbiegungen in horizontaler, vertikaler und sphärischer Richtung | |
| AT206355B (de) | Kabelbandförderer | |
| AT205917B (de) | Kabelbandförderer | |
| DE2625428C3 (de) | Fördervorrichtung für zylindrische Körper | |
| DE640297C (de) | Mitnehmerfoerderer, insbesondere fuer den Schraegbau | |
| GB2213791A (en) | A tubular belt conveyor | |
| AT236290B (de) | Fördervorrichtung | |
| EP1528017A1 (de) | Transporteinrichtung für Hohlkörper | |
| DE2123334C3 (de) | Fördersystem mit einem mit einem endlosen flachen, längs einer endlosen Bahn geführten, um Kurven verbiegbaren Förderband | |
| DE2253713A1 (de) | Verfahren und vorrichtung zur veredlungsbehandlung von garn |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7802072-4 Format of ref document f/p: F |