SE435837B - 4-amino-3-kinolinkarboxylsyror och estrar derav med antisekretorisk och anti-ulceros aktivitet - Google Patents
4-amino-3-kinolinkarboxylsyror och estrar derav med antisekretorisk och anti-ulceros aktivitetInfo
- Publication number
- SE435837B SE435837B SE8002292A SE8002292A SE435837B SE 435837 B SE435837 B SE 435837B SE 8002292 A SE8002292 A SE 8002292A SE 8002292 A SE8002292 A SE 8002292A SE 435837 B SE435837 B SE 435837B
- Authority
- SE
- Sweden
- Prior art keywords
- ethyl
- amino
- lower alkyl
- methoxy
- quinolinecarboxylate
- Prior art date
Links
- UEFKMJWKPVAVND-UHFFFAOYSA-N 4-aminoquinoline-3-carboxylic acid Chemical class C1=CC=C2C(N)=C(C(O)=O)C=NC2=C1 UEFKMJWKPVAVND-UHFFFAOYSA-N 0.000 title claims description 8
- 230000000694 effects Effects 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 45
- -1 cyano, hydroxy, carbamoyl Chemical group 0.000 claims description 42
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 25
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- 208000008469 Peptic Ulcer Diseases 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 230000028327 secretion Effects 0.000 claims description 8
- 230000002496 gastric effect Effects 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 210000004211 gastric acid Anatomy 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- CRJUJZNGVQRIJL-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate Chemical group CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C CRJUJZNGVQRIJL-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 230000001105 regulatory effect Effects 0.000 claims description 3
- DXCCJYWRCAJAGW-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate;hydrochloride Chemical group Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C DXCCJYWRCAJAGW-UHFFFAOYSA-N 0.000 claims description 2
- 101150009274 nhr-1 gene Proteins 0.000 claims description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims 1
- NWIMAIDOFIQPMM-UHFFFAOYSA-N ethyl 4-(2-ethoxyanilino)-8-methoxyquinoline-3-carboxylate Chemical group CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1OCC NWIMAIDOFIQPMM-UHFFFAOYSA-N 0.000 claims 1
- KRIDZTDGIKDFGO-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1OC KRIDZTDGIKDFGO-UHFFFAOYSA-N 0.000 claims 1
- SSIABRIIJOPUTM-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylsulfanylanilino)quinoline-3-carboxylate Chemical group CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1SC SSIABRIIJOPUTM-UHFFFAOYSA-N 0.000 claims 1
- LOPISVUVHAYYRS-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylsulfanylanilino)quinoline-3-carboxylate;hydrochloride Chemical group Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1SC LOPISVUVHAYYRS-UHFFFAOYSA-N 0.000 claims 1
- MYINBRFPVSYSLM-UHFFFAOYSA-N ethyl 8-methoxy-4-[2-(trifluoromethyl)anilino]quinoline-3-carboxylate Chemical group CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(F)(F)F MYINBRFPVSYSLM-UHFFFAOYSA-N 0.000 claims 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 239000002674 ointment Substances 0.000 claims 1
- 239000008196 pharmacological composition Substances 0.000 claims 1
- 238000002360 preparation method Methods 0.000 description 77
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 22
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 19
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- UNMTVPUUJFYTOJ-UHFFFAOYSA-N ethyl 4-chloro-8-ethoxyquinoline-3-carboxylate Chemical compound CCOC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 UNMTVPUUJFYTOJ-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 7
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 241000124008 Mammalia Species 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 239000011575 calcium Substances 0.000 description 6
- DWXQUAHMZWZXHP-UHFFFAOYSA-N ethyl 4-chloroquinoline-3-carboxylate Chemical class C1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 DWXQUAHMZWZXHP-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000010452 phosphate Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000000767 anti-ulcer Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- IJDXCOWIANNOTC-UHFFFAOYSA-N ethyl 4-chloro-5,8-dimethoxyquinoline-3-carboxylate Chemical compound COC1=CC=C(OC)C2=C(Cl)C(C(=O)OCC)=CN=C21 IJDXCOWIANNOTC-UHFFFAOYSA-N 0.000 description 3
- CIGIGQHDHKBPAZ-UHFFFAOYSA-N ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate Chemical compound FC(F)(F)C1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 CIGIGQHDHKBPAZ-UHFFFAOYSA-N 0.000 description 3
- BBOZDELEERNECG-UHFFFAOYSA-N ethyl 4-chloro-8-methoxyquinoline-3-carboxylate Chemical compound COC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 BBOZDELEERNECG-UHFFFAOYSA-N 0.000 description 3
- VWVPBLLIVVAAPY-UHFFFAOYSA-N ethyl 4-chloro-8-phenylquinoline-3-carboxylate Chemical compound C=1C=CC2=C(Cl)C(C(=O)OCC)=CN=C2C=1C1=CC=CC=C1 VWVPBLLIVVAAPY-UHFFFAOYSA-N 0.000 description 3
- 235000003599 food sweetener Nutrition 0.000 description 3
- 229960001340 histamine Drugs 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000003765 sweetening agent Substances 0.000 description 3
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 2
- YKOLZVXSPGIIBJ-UHFFFAOYSA-N 2-Isopropylaniline Chemical compound CC(C)C1=CC=CC=C1N YKOLZVXSPGIIBJ-UHFFFAOYSA-N 0.000 description 2
- SBRYFUVVWOMLLP-UHFFFAOYSA-N 2-azaniumyl-4-methoxy-4-oxobutanoate Chemical compound COC(=O)CC(N)C(O)=O SBRYFUVVWOMLLP-UHFFFAOYSA-N 0.000 description 2
- WBRPQQSADOCKCH-UHFFFAOYSA-N 2-methylsulfanylaniline Chemical compound CSC1=CC=CC=C1N WBRPQQSADOCKCH-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000282465 Canis Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 108010012944 Tetragastrin Proteins 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000000728 ammonium alginate Substances 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 230000001262 anti-secretory effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- DIOLOCSXUMYFJN-UHFFFAOYSA-N calcium;azane Chemical compound N.[Ca+2] DIOLOCSXUMYFJN-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- HINLPSGAVZPTIW-UHFFFAOYSA-N ethyl 4,8-dichloroquinoline-3-carboxylate Chemical compound ClC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 HINLPSGAVZPTIW-UHFFFAOYSA-N 0.000 description 2
- QOCJKSWVYYUBSD-UHFFFAOYSA-N ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate Chemical compound CC1=CC(C)=CC2=C(Cl)C(C(=O)OCC)=CN=C21 QOCJKSWVYYUBSD-UHFFFAOYSA-N 0.000 description 2
- MHOFAUCLSGVKOH-UHFFFAOYSA-N ethyl 4-chloro-8-cyanoquinoline-3-carboxylate Chemical compound N#CC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 MHOFAUCLSGVKOH-UHFFFAOYSA-N 0.000 description 2
- NHWYSFNHIYGQNG-UHFFFAOYSA-N ethyl 4-chloro-8-methoxy-5-methylquinoline-3-carboxylate Chemical compound COC1=CC=C(C)C2=C(Cl)C(C(=O)OCC)=CN=C21 NHWYSFNHIYGQNG-UHFFFAOYSA-N 0.000 description 2
- PGGVUZUNDXCMSS-UHFFFAOYSA-N ethyl 4-chloro-8-methylquinoline-3-carboxylate Chemical compound CC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 PGGVUZUNDXCMSS-UHFFFAOYSA-N 0.000 description 2
- PTGKZGLBFDWBKY-UHFFFAOYSA-N ethyl 4-chloro-8-methylsulfanylquinoline-3-carboxylate Chemical compound CSC1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 PTGKZGLBFDWBKY-UHFFFAOYSA-N 0.000 description 2
- YBEOYBKKSWUSBR-UHFFFAOYSA-N ethyl 4-oxo-1h-quinoline-3-carboxylate Chemical class C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 YBEOYBKKSWUSBR-UHFFFAOYSA-N 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- GTDQGKWDWVUKTI-UHFFFAOYSA-N o-aminoacetophenone Chemical compound CC(=O)C1=CC=CC=C1N GTDQGKWDWVUKTI-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 208000011906 peptic ulcer disease Diseases 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- RGYLYUZOGHTBRF-BIHRQFPBSA-N tetragastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C2=CC=CC=C2NC=1)CCSC)C(N)=O)C1=CC=CC=C1 RGYLYUZOGHTBRF-BIHRQFPBSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 230000036269 ulceration Effects 0.000 description 2
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 1
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical compound COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 1
- YTLYLLTVENPWFT-UPHRSURJSA-N (Z)-3-aminoacrylic acid Chemical compound N\C=C/C(O)=O YTLYLLTVENPWFT-UPHRSURJSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N 1-propanol Substances CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- VVAKEQGKZNKUSU-UHFFFAOYSA-N 2,3-dimethylaniline Chemical compound CC1=CC=CC(N)=C1C VVAKEQGKZNKUSU-UHFFFAOYSA-N 0.000 description 1
- VBLXCTYLWZJBKA-UHFFFAOYSA-N 2-(trifluoromethyl)aniline Chemical compound NC1=CC=CC=C1C(F)(F)F VBLXCTYLWZJBKA-UHFFFAOYSA-N 0.000 description 1
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- WFNLHDJJZSJARK-UHFFFAOYSA-N 2-chloro-6-methylaniline Chemical compound CC1=CC=CC(Cl)=C1N WFNLHDJJZSJARK-UHFFFAOYSA-N 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- HJXIRCMNJLIHQR-UHFFFAOYSA-N 2-n,2-n-dimethylbenzene-1,2-diamine Chemical compound CN(C)C1=CC=CC=C1N HJXIRCMNJLIHQR-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- FDMFUZHCIRHGRG-UHFFFAOYSA-N 3,3,3-trifluoroprop-1-ene Chemical group FC(F)(F)C=C FDMFUZHCIRHGRG-UHFFFAOYSA-N 0.000 description 1
- HJSCQRDGGJZGJH-UHFFFAOYSA-N 4-chloroquinoline-3-carboxylic acid Chemical class C1=CC=CC2=C(Cl)C(C(=O)O)=CN=C21 HJSCQRDGGJZGJH-UHFFFAOYSA-N 0.000 description 1
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 1
- BASNAOYNNASHFC-UHFFFAOYSA-N 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylic acid Chemical compound OC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C BASNAOYNNASHFC-UHFFFAOYSA-N 0.000 description 1
- CSFTWNYYKHEIRE-UHFFFAOYSA-N 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C CSFTWNYYKHEIRE-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 101100231508 Caenorhabditis elegans ceh-5 gene Proteins 0.000 description 1
- 101100048447 Caenorhabditis elegans unc-4 gene Proteins 0.000 description 1
- QVSGXIKORIKQFE-UHFFFAOYSA-N Cl.NC1=NC2=CC=CC=C2C=C1C(=O)O Chemical compound Cl.NC1=NC2=CC=CC=C2C=C1C(=O)O QVSGXIKORIKQFE-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 241001274216 Naso Species 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009858 acid secretion Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 235000010407 ammonium alginate Nutrition 0.000 description 1
- KPGABFJTMYCRHJ-YZOKENDUSA-N ammonium alginate Chemical compound [NH4+].[NH4+].O1[C@@H](C([O-])=O)[C@@H](OC)[C@H](O)[C@H](O)[C@@H]1O[C@@H]1[C@@H](C([O-])=O)O[C@@H](O)[C@@H](O)[C@H]1O KPGABFJTMYCRHJ-YZOKENDUSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000010868 animal carcass Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000000648 calcium alginate Substances 0.000 description 1
- 235000010410 calcium alginate Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- FDSGHYHRLSWSLQ-UHFFFAOYSA-N dichloromethane;propan-2-one Chemical compound ClCCl.CC(C)=O FDSGHYHRLSWSLQ-UHFFFAOYSA-N 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical class CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- OYJXTOVLKZDGFK-UHFFFAOYSA-N ethanol;2-propan-2-yloxypropane Chemical compound CCO.CC(C)OC(C)C OYJXTOVLKZDGFK-UHFFFAOYSA-N 0.000 description 1
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
- WZSFHLLAUDLBGE-UHFFFAOYSA-N ethyl 4-(2,3-dimethylanilino)-8-methoxyquinoline-3-carboxylate sulfuric acid Chemical compound S(=O)(=O)(O)O.COC=1C=CC=C2C(=C(C=NC12)C(=O)OCC)NC1=C(C(=CC=C1)C)C WZSFHLLAUDLBGE-UHFFFAOYSA-N 0.000 description 1
- JVSKAUIBUCQZAR-UHFFFAOYSA-N ethyl 4-(2,6-dimethylanilino)-8-methoxyquinoline-3-carboxylate;hydrobromide Chemical compound Br.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=C(C)C=CC=C1C JVSKAUIBUCQZAR-UHFFFAOYSA-N 0.000 description 1
- GMKXWJUQDZTZQH-UHFFFAOYSA-N ethyl 4-(2-acetylanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(C)=O GMKXWJUQDZTZQH-UHFFFAOYSA-N 0.000 description 1
- RRZNSQNUZMCXSU-UHFFFAOYSA-N ethyl 4-(2-chloro-5-methoxyanilino)-8-methoxyquinoline-3-carboxylate;hydrobromide Chemical compound Br.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC(OC)=CC=C1Cl RRZNSQNUZMCXSU-UHFFFAOYSA-N 0.000 description 1
- WDLHYKPECRHGNX-UHFFFAOYSA-N ethyl 4-(2-chloroanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1Cl WDLHYKPECRHGNX-UHFFFAOYSA-N 0.000 description 1
- YAOBOADHYPAZSA-UHFFFAOYSA-N ethyl 4-(2-chloroanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C=CC=CC2=C1NC1=CC=CC=C1Cl YAOBOADHYPAZSA-UHFFFAOYSA-N 0.000 description 1
- SQJKQVCDNMSUBK-UHFFFAOYSA-N ethyl 4-(2-cyanoanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C#N SQJKQVCDNMSUBK-UHFFFAOYSA-N 0.000 description 1
- ZGIIOSQVHPDWCS-UHFFFAOYSA-N ethyl 4-(2-fluoroanilino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1F ZGIIOSQVHPDWCS-UHFFFAOYSA-N 0.000 description 1
- BCZGGRHBMFVMAL-UHFFFAOYSA-N ethyl 4-(2-methoxyanilino)-8-methylsulfanylquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(SC)=CC=CC2=C1NC1=CC=CC=C1OC BCZGGRHBMFVMAL-UHFFFAOYSA-N 0.000 description 1
- SUDISUGACXXEQH-UHFFFAOYSA-N ethyl 4-(2-methylanilino)-8-methylsulfanylquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(SC)=CC=CC2=C1NC1=CC=CC=C1C SUDISUGACXXEQH-UHFFFAOYSA-N 0.000 description 1
- QVSYNWHRVQHXTG-UHFFFAOYSA-N ethyl 4-(2-methylanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C=CC=CC2=C1NC1=CC=CC=C1C QVSYNWHRVQHXTG-UHFFFAOYSA-N 0.000 description 1
- PQEYVEBSBHVATP-UHFFFAOYSA-N ethyl 4-(4-methoxy-2-methylanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C=CC=CC2=C1NC1=CC=C(OC)C=C1C PQEYVEBSBHVATP-UHFFFAOYSA-N 0.000 description 1
- GJPCPHDRHGPWFU-UHFFFAOYSA-N ethyl 4-(butylamino)-8-methoxyquinoline-3-carboxylate;hydrochloride Chemical compound Cl.C1=CC=C2C(NCCCC)=C(C(=O)OCC)C=NC2=C1OC GJPCPHDRHGPWFU-UHFFFAOYSA-N 0.000 description 1
- DEFVNVNONGGPJR-UHFFFAOYSA-N ethyl 4-anilino-6,8-dimethylquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(C)=CC(C)=CC2=C1NC1=CC=CC=C1 DEFVNVNONGGPJR-UHFFFAOYSA-N 0.000 description 1
- TZRPUJLDSWTXFE-UHFFFAOYSA-N ethyl 4-anilino-6-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C=CC(OC)=CC2=C1NC1=CC=CC=C1 TZRPUJLDSWTXFE-UHFFFAOYSA-N 0.000 description 1
- YMSKONPFQZCVPL-UHFFFAOYSA-N ethyl 4-anilino-8-methoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1 YMSKONPFQZCVPL-UHFFFAOYSA-N 0.000 description 1
- BUMPCCSOZQXYIC-UHFFFAOYSA-N ethyl 4-anilino-8-phenylquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(C=3C=CC=CC=3)=CC=CC2=C1NC1=CC=CC=C1 BUMPCCSOZQXYIC-UHFFFAOYSA-N 0.000 description 1
- FFHWOJGPOPFTAW-UHFFFAOYSA-N ethyl 4-anilinoquinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C=CC=CC2=C1NC1=CC=CC=C1 FFHWOJGPOPFTAW-UHFFFAOYSA-N 0.000 description 1
- ZCSSSFWAKZGPFB-UHFFFAOYSA-N ethyl 4-anilinoquinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C=CC=CC2=C1NC1=CC=CC=C1 ZCSSSFWAKZGPFB-UHFFFAOYSA-N 0.000 description 1
- QURGQUFEJWWDRF-UHFFFAOYSA-N ethyl 4-chloro-6-methoxyquinoline-3-carboxylate Chemical compound C1=CC(OC)=CC2=C(Cl)C(C(=O)OCC)=CN=C21 QURGQUFEJWWDRF-UHFFFAOYSA-N 0.000 description 1
- JLVNAMDYLDOJGR-UHFFFAOYSA-N ethyl 4-chloro-8-(dimethylamino)quinoline-3-carboxylate Chemical compound CN(C)C1=CC=CC2=C(Cl)C(C(=O)OCC)=CN=C21 JLVNAMDYLDOJGR-UHFFFAOYSA-N 0.000 description 1
- IRKHEJCWIWBURM-UHFFFAOYSA-N ethyl 4-oxo-8-phenyl-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1C1=CC=CC=C1 IRKHEJCWIWBURM-UHFFFAOYSA-N 0.000 description 1
- ZFOVQQHLWOBEKQ-UHFFFAOYSA-N ethyl 5,8-dimethoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC(OC)=C2C(=O)C(C(=O)OCC)=CNC2=C1OC ZFOVQQHLWOBEKQ-UHFFFAOYSA-N 0.000 description 1
- AKBJMLWAUZEZSK-UHFFFAOYSA-N ethyl 6,8-dimethyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=C(C)C=C2C(=O)C(C(=O)OCC)=CNC2=C1C AKBJMLWAUZEZSK-UHFFFAOYSA-N 0.000 description 1
- VNGGYIBIGOOVNP-UHFFFAOYSA-N ethyl 6-methoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=C(OC)C=C2C(=O)C(C(=O)OCC)=CNC2=C1 VNGGYIBIGOOVNP-UHFFFAOYSA-N 0.000 description 1
- GWLDDWJZROMBRD-UHFFFAOYSA-N ethyl 7-methoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound COC1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 GWLDDWJZROMBRD-UHFFFAOYSA-N 0.000 description 1
- ULHHZGBLUSMTHM-UHFFFAOYSA-N ethyl 8-(dimethylamino)-4-(2-methylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(N(C)C)=CC=CC2=C1NC1=CC=CC=C1C ULHHZGBLUSMTHM-UHFFFAOYSA-N 0.000 description 1
- YJTVQXSFSKEYMR-UHFFFAOYSA-N ethyl 8-(dimethylamino)-4-oxo-1h-quinoline-3-carboxylate Chemical compound CN(C)C1=CC=CC2=C(O)C(C(=O)OCC)=CN=C21 YJTVQXSFSKEYMR-UHFFFAOYSA-N 0.000 description 1
- BIVZERGXYOKECF-UHFFFAOYSA-N ethyl 8-chloro-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(Cl)=CC=CC2=C1NC1=CC=CC=C1OC BIVZERGXYOKECF-UHFFFAOYSA-N 0.000 description 1
- OFPIUBQWPDRNCD-UHFFFAOYSA-N ethyl 8-chloro-4-(2-methylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(Cl)=CC=CC2=C1NC1=CC=CC=C1C OFPIUBQWPDRNCD-UHFFFAOYSA-N 0.000 description 1
- CVTZGJPEFPRNNB-UHFFFAOYSA-N ethyl 8-chloro-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1Cl CVTZGJPEFPRNNB-UHFFFAOYSA-N 0.000 description 1
- IKJKGARQIWIJNI-UHFFFAOYSA-N ethyl 8-cyano-4-(2-methylanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(C#N)=CC=CC2=C1NC1=CC=CC=C1C IKJKGARQIWIJNI-UHFFFAOYSA-N 0.000 description 1
- IOXBKBFKCYONPW-UHFFFAOYSA-N ethyl 8-cyano-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1C#N IOXBKBFKCYONPW-UHFFFAOYSA-N 0.000 description 1
- LTPVJDPFDLGLRT-UHFFFAOYSA-N ethyl 8-ethoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OCC)=CC=CC2=C1NC1=CC=CC=C1OC LTPVJDPFDLGLRT-UHFFFAOYSA-N 0.000 description 1
- TWGHZFJRCAQPRL-UHFFFAOYSA-N ethyl 8-ethoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1OCC TWGHZFJRCAQPRL-UHFFFAOYSA-N 0.000 description 1
- MJNAFZWEKGYYQT-UHFFFAOYSA-N ethyl 8-methoxy-4-(1-phenylethylamino)quinoline-3-carboxylate;hydrate Chemical compound O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC(C)C1=CC=CC=C1 MJNAFZWEKGYYQT-UHFFFAOYSA-N 0.000 description 1
- NXUSNIUACDUXQM-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methoxyanilino)-5-methylquinoline-3-carboxylate;dihydrochloride Chemical compound Cl.Cl.CCOC(=O)C1=CN=C2C(OC)=CC=C(C)C2=C1NC1=CC=CC=C1OC NXUSNIUACDUXQM-UHFFFAOYSA-N 0.000 description 1
- GWABEZHJVSPHNE-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1OC GWABEZHJVSPHNE-UHFFFAOYSA-N 0.000 description 1
- MGXKVCVQJWYAOB-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate;phosphoric acid Chemical compound OP(O)(O)=O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C MGXKVCVQJWYAOB-UHFFFAOYSA-N 0.000 description 1
- GWRHIGMXHHRFEC-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-methylanilino)quinoline-3-carboxylate;sulfuric acid Chemical compound OS(O)(=O)=O.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C GWRHIGMXHHRFEC-UHFFFAOYSA-N 0.000 description 1
- ZLEIPGHLPPITMX-UHFFFAOYSA-N ethyl 8-methoxy-4-(2-nitroanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1[N+]([O-])=O ZLEIPGHLPPITMX-UHFFFAOYSA-N 0.000 description 1
- GQUGXNGXNZMBKS-UHFFFAOYSA-N ethyl 8-methoxy-4-(3-methylanilino)quinoline-3-carboxylate;hydrate;hydrochloride Chemical compound O.Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC(C)=C1 GQUGXNGXNZMBKS-UHFFFAOYSA-N 0.000 description 1
- JUOFWQZLZCOSPM-UHFFFAOYSA-N ethyl 8-methoxy-4-(4-methylanilino)quinoline-3-carboxylate;hydrate;hydrochloride Chemical compound O.Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=C(C)C=C1 JUOFWQZLZCOSPM-UHFFFAOYSA-N 0.000 description 1
- WTSHTUPDVKVIMP-UHFFFAOYSA-N ethyl 8-methoxy-4-[2-(trifluoromethyl)anilino]quinoline-3-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CN=C2C(OC)=CC=CC2=C1NC1=CC=CC=C1C(F)(F)F WTSHTUPDVKVIMP-UHFFFAOYSA-N 0.000 description 1
- HCYNWEIHLHVPEW-UHFFFAOYSA-N ethyl 8-methoxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1OC HCYNWEIHLHVPEW-UHFFFAOYSA-N 0.000 description 1
- NPHTWWPHPYENDB-UHFFFAOYSA-N ethyl 8-methoxy-5-methyl-4-(2-methylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(OC)=CC=C(C)C2=C1NC1=CC=CC=C1C NPHTWWPHPYENDB-UHFFFAOYSA-N 0.000 description 1
- HYUYDOCMASKUMM-UHFFFAOYSA-N ethyl 8-methyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1C HYUYDOCMASKUMM-UHFFFAOYSA-N 0.000 description 1
- MOYXAWSNAWARCE-UHFFFAOYSA-N ethyl 8-methylsulfanyl-4-(2-methylsulfanylanilino)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CN=C2C(SC)=CC=CC2=C1NC1=CC=CC=C1SC MOYXAWSNAWARCE-UHFFFAOYSA-N 0.000 description 1
- CJSYBLGRYMXUTM-UHFFFAOYSA-N ethyl 8-methylsulfanyl-4-oxo-1h-quinoline-3-carboxylate Chemical compound CSC1=CC=CC2=C(O)C(C(=O)OCC)=CN=C21 CJSYBLGRYMXUTM-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NZWOPGCLSHLLPA-UHFFFAOYSA-N methacholine Chemical compound C[N+](C)(C)CC(C)OC(C)=O NZWOPGCLSHLLPA-UHFFFAOYSA-N 0.000 description 1
- 229960002329 methacholine Drugs 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 102220168432 rs750420022 Human genes 0.000 description 1
- 210000004706 scrotum Anatomy 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2398179A | 1979-03-26 | 1979-03-26 | |
| US06/127,153 US4343804A (en) | 1979-03-26 | 1980-03-04 | 4-Amino-3-quinolinecarboxylic acids and esters-antisecretory anti-ulcer compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8002292L SE8002292L (sv) | 1980-09-27 |
| SE435837B true SE435837B (sv) | 1984-10-22 |
Family
ID=26697875
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8002292A SE435837B (sv) | 1979-03-26 | 1980-03-25 | 4-amino-3-kinolinkarboxylsyror och estrar derav med antisekretorisk och anti-ulceros aktivitet |
Country Status (31)
| Country | Link |
|---|---|
| US (1) | US4343804A (index.php) |
| JP (1) | JPH02117663A (index.php) |
| AR (1) | AR230268A1 (index.php) |
| AT (1) | AT372373B (index.php) |
| AU (1) | AU528388B2 (index.php) |
| BR (1) | BR8001779A (index.php) |
| CA (1) | CA1147338A (index.php) |
| CH (1) | CH644105A5 (index.php) |
| DE (1) | DE3011490A1 (index.php) |
| DK (1) | DK156056C (index.php) |
| EG (1) | EG15009A (index.php) |
| ES (1) | ES489887A0 (index.php) |
| FI (1) | FI77452C (index.php) |
| FR (1) | FR2452485B1 (index.php) |
| GB (1) | GB2047244B (index.php) |
| GR (1) | GR68006B (index.php) |
| HK (1) | HK67983A (index.php) |
| IE (1) | IE49577B1 (index.php) |
| IL (1) | IL59628A (index.php) |
| IN (1) | IN151446B (index.php) |
| IT (1) | IT1133079B (index.php) |
| MX (1) | MX6264E (index.php) |
| NL (1) | NL8001752A (index.php) |
| NO (1) | NO153927C (index.php) |
| NZ (1) | NZ193252A (index.php) |
| PH (1) | PH16416A (index.php) |
| PL (1) | PL125030B1 (index.php) |
| PT (1) | PT71008B (index.php) |
| SE (1) | SE435837B (index.php) |
| SG (1) | SG33683G (index.php) |
| YU (1) | YU41702B (index.php) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8610981D0 (en) * | 1986-05-06 | 1986-06-11 | Ici America Inc | Quinoline amides |
| GB8621425D0 (en) * | 1986-09-05 | 1986-10-15 | Smith Kline French Lab | Compounds |
| GB8804444D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804447D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804448D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804443D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804445D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| GB8804446D0 (en) * | 1988-02-25 | 1988-03-23 | Smithkline Beckman Intercredit | Compounds |
| US5432182A (en) * | 1989-02-23 | 1995-07-11 | Smithkline Beecham Intercredit B.V. | Compounds substituted quinoline derivatives |
| CA2011086A1 (en) * | 1989-03-17 | 1990-09-17 | Karl-Heinz Geiss | 2-alkyl-4-arylmethylaminoquinolines, the use thereof and drugs prepared therefrom |
| DE3917233A1 (de) * | 1989-05-26 | 1990-11-29 | Basf Ag | 8-substituierte 4-(heterocyclylmethylamino)-chinoline, ihre verwendung und daraus hergestellte arzneimittel |
| GB8918265D0 (en) * | 1989-08-10 | 1989-09-20 | Smithkline Beckman Intercredit | Compounds |
| US5362743A (en) * | 1993-03-09 | 1994-11-08 | Pfizer Inc. | Aminoquinoline derivatives |
| US5556863A (en) * | 1993-06-11 | 1996-09-17 | Astra Aktiebolag | Compound for gastric acid secretion inhibition |
| IS4164A (is) * | 1993-06-11 | 1994-12-12 | Ab Astra | Efnasambönd sem hindra flæði magasýru |
| SG52229A1 (en) * | 1993-08-10 | 1998-09-28 | Black James Foundation | Gastrin and cck receptor ligands |
| US5650415A (en) * | 1995-06-07 | 1997-07-22 | Sugen, Inc. | Quinoline compounds |
| KR0169813B1 (ko) * | 1995-07-12 | 1999-01-15 | 김종인 | 4-아미노-3-아실나프티리딘 유도체 |
| US5760041A (en) * | 1996-02-05 | 1998-06-02 | American Cyanamid Company | 4-aminoquinazoline EGFR Inhibitors |
| US6875769B2 (en) * | 1996-05-23 | 2005-04-05 | Pfizer Inc. | Substituted6,6-hetero-bicyclicderivatives |
| US5929080A (en) * | 1997-05-06 | 1999-07-27 | American Cyanamid Company | Method of treating polycystic kidney disease |
| US6251912B1 (en) | 1997-08-01 | 2001-06-26 | American Cyanamid Company | Substituted quinazoline derivatives |
| US6323209B1 (en) | 1997-11-06 | 2001-11-27 | American Cyanamid Company | Method of treating or inhibiting colonic polyps |
| EP1950201A1 (en) | 1998-09-29 | 2008-07-30 | Wyeth Holdings Corporation | Substituted 3-cyanoquinolines as protein tyrosine kinases inhibitors |
| WO2001047891A1 (en) * | 1999-12-28 | 2001-07-05 | Eisai Co., Ltd. | Heterocyclic compounds having sulfonamide groups |
| US6521618B2 (en) | 2000-03-28 | 2003-02-18 | Wyeth | 3-cyanoquinolines, 3-cyano-1,6-naphthyridines, and 3-cyano-1,7-naphthyridines as protein kinase inhibitors |
| US6576644B2 (en) * | 2000-09-06 | 2003-06-10 | Bristol-Myers Squibb Co. | Quinoline inhibitors of cGMP phosphodiesterase |
| UA80393C2 (uk) | 2000-12-07 | 2007-09-25 | Алтана Фарма Аг | Фармацевтична композиція, яка містить інгібітор фде 4, диспергований в матриці |
| MY140561A (en) | 2002-02-20 | 2009-12-31 | Nycomed Gmbh | Dosage form containing pde 4 inhibitor as active ingredient |
| CN102558155A (zh) | 2003-01-14 | 2012-07-11 | 阿伦纳药品公司 | 作为代谢调节剂的芳基和杂芳基衍生物及其所涉及的疾病如糖尿病和高血糖症的预防和治疗 |
| BRPI0406427B8 (pt) | 2003-03-10 | 2021-05-25 | Astrazeneca Ab | processo para a preparação de roflumilast |
| AU2004257267B2 (en) * | 2003-07-14 | 2009-12-03 | Arena Pharmaceuticals,Inc | Fused-aryl and heteroaryl derivatives as modulators of metabolism and the prophylaxis and treatment of disorders related thereto |
| WO2006097456A1 (en) * | 2005-03-16 | 2006-09-21 | Nycomed Gmbh | Taste masked dosage form containing roflumilast |
| WO2011022216A1 (en) * | 2009-08-17 | 2011-02-24 | High Point Pharmaceuticals, Llc | Substituted pyridine derivatives, pharmaceutical compositions, and methods of use to treat oxidative stress |
| EP4148045A1 (en) | 2010-01-27 | 2023-03-15 | Arena Pharmaceuticals, Inc. | Intermediate compounds for the preparation of (r)-2-(7-(4-cyclopentyl-3- (trifluoromethyl)benzyloxy)-1,2,3,4-tetrahydrocyclopenta[b] indol-3-yl)acetic acid and salts thereof |
| EA201390421A1 (ru) | 2010-09-22 | 2013-09-30 | Арена Фармасьютикалз, Инк. | Модуляторы рецептора gpr119 и лечение связанных с ним нарушений |
| EP4445956A3 (en) | 2015-01-06 | 2024-12-04 | Arena Pharmaceuticals, Inc. | Compound for use in treating conditions related to the s1p1 receptor |
| PL3310760T3 (pl) | 2015-06-22 | 2023-03-06 | Arena Pharmaceuticals, Inc. | Krystaliczna sól L-argininy kwasu (R)-2-(7-(4-cyklopentylo-3-(trifluorometylo)benzyloksy)- 1,2,3,4-tetrahydrocyklo-penta[b]indol-3-ilo)octowego do zastosowania w zaburzeniach związanych z receptorem S1P1 |
| PT3538512T (pt) * | 2016-11-11 | 2021-08-16 | Bayer Animal Health Gmbh | Novos derivados de quinolina-3-carboxamida anti-helmínticos |
| CN110520124A (zh) | 2017-02-16 | 2019-11-29 | 艾尼纳制药公司 | 用于治疗原发性胆汁性胆管炎的化合物和方法 |
| EP3700527A4 (en) * | 2017-10-25 | 2021-03-10 | Children's Medical Center Corporation | PAPD5 INHIBITORS AND METHOD OF USING THEM |
| ES2945559T3 (es) | 2018-05-09 | 2023-07-04 | Bayer Animal Health Gmbh | Derivados de quinolina antihelmínticos |
| CA3102136A1 (en) | 2018-06-06 | 2019-12-12 | Arena Pharmaceuticals, Inc. | Methods of treating conditions related to the s1p1 receptor |
| US12486234B2 (en) | 2019-04-24 | 2025-12-02 | Children's Medical Center Corporation | PAPD5 inhibitors and methods of use thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3470186A (en) * | 1967-06-02 | 1969-09-30 | American Cyanamid Co | Substituted 4-anilino-3-quinolinecarboxylic acids and esters |
| JPS4838712A (index.php) * | 1971-09-18 | 1973-06-07 |
-
1980
- 1980-03-04 US US06/127,153 patent/US4343804A/en not_active Expired - Lifetime
- 1980-03-14 IL IL59628A patent/IL59628A/xx unknown
- 1980-03-22 GR GR61513A patent/GR68006B/el unknown
- 1980-03-24 AT AT0156480A patent/AT372373B/de not_active IP Right Cessation
- 1980-03-24 MX MX808722U patent/MX6264E/es unknown
- 1980-03-24 FI FI800910A patent/FI77452C/fi not_active IP Right Cessation
- 1980-03-24 IE IE605/80A patent/IE49577B1/en unknown
- 1980-03-24 FR FR8006516A patent/FR2452485B1/fr not_active Expired
- 1980-03-25 GB GB8009991A patent/GB2047244B/en not_active Expired
- 1980-03-25 PH PH23804A patent/PH16416A/en unknown
- 1980-03-25 BR BR8001779A patent/BR8001779A/pt unknown
- 1980-03-25 IN IN345/CAL/80A patent/IN151446B/en unknown
- 1980-03-25 NZ NZ193252A patent/NZ193252A/en unknown
- 1980-03-25 NL NL8001752A patent/NL8001752A/nl not_active Application Discontinuation
- 1980-03-25 PT PT71008A patent/PT71008B/pt unknown
- 1980-03-25 DK DK128380A patent/DK156056C/da not_active IP Right Cessation
- 1980-03-25 ES ES489887A patent/ES489887A0/es active Granted
- 1980-03-25 DE DE19803011490 patent/DE3011490A1/de active Granted
- 1980-03-25 PL PL1980222993A patent/PL125030B1/pl unknown
- 1980-03-25 CH CH234080A patent/CH644105A5/fr not_active IP Right Cessation
- 1980-03-25 EG EG80174A patent/EG15009A/xx active
- 1980-03-25 NO NO800858A patent/NO153927C/no unknown
- 1980-03-25 SE SE8002292A patent/SE435837B/sv not_active IP Right Cessation
- 1980-03-26 AU AU56848/80A patent/AU528388B2/en not_active Ceased
- 1980-03-26 YU YU844/80A patent/YU41702B/xx unknown
- 1980-03-26 IT IT67465/80A patent/IT1133079B/it active
- 1980-03-26 CA CA000348417A patent/CA1147338A/en not_active Expired
- 1980-03-26 AR AR280455A patent/AR230268A1/es active
-
1983
- 1983-06-13 SG SG336/83A patent/SG33683G/en unknown
- 1983-12-15 HK HK679/83A patent/HK67983A/xx unknown
-
1989
- 1989-09-26 JP JP1250369A patent/JPH02117663A/ja active Pending
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE435837B (sv) | 4-amino-3-kinolinkarboxylsyror och estrar derav med antisekretorisk och anti-ulceros aktivitet | |
| DE3486043T2 (de) | Chinolinzwischenprodukte fuer die synthese von 1h-imidazo(4,5-c)chinolinen und 1h-imidazo(4,5-c)chinolin-4-aminen. | |
| AU682381B2 (en) | Amidine derivatives with nitric oxide synthetase activities | |
| DE2740588A1 (de) | Imidazo- eckige klammer auf 1,2-a eckige klammer zu -chinolin-2-carbon- saeuren und deren derivate sowie pharmazeutische zubereitungen, die diese verbindungen enthalten | |
| NZ188770A (en) | Thiazolinylguanidine derivatives and pharmaceutical compositions | |
| DE3216843C2 (de) | 3-Thiomethyl-pyridin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| JPS5989671A (ja) | 2,5−ピペラジンジオン誘導体 | |
| PL128998B1 (en) | Process for preparing novel 2-amino-3-benzoylphenylacetamides and their derivatives | |
| US4246260A (en) | Substituted omicron-phenylenediamine derivatives, process for their preparation and their use as medicaments | |
| HU192318B (en) | Process for preparing pyrimido/2,1-b/benzothiazole derivatives and pharmaceutical compositions containing such compounds as active substances | |
| PL115380B1 (en) | Process for preparing novel derivatives of nitropyrrole | |
| CA1051436A (en) | 4-amino-amphetamine derivatives | |
| KR840000768B1 (ko) | 4-아미노-3-퀴놀린카복실산 및 에스테르의 제조방법 | |
| GB1592453A (en) | Aminoalkyl esters of carbarimidothioic acid and compositions having immunosuppressant activity | |
| Orth et al. | Cyclized Substituted Thioureas I. Preparation of Some 3-Substituted 1, 2, 3, 4-Tetrahydroquinazoline-2-thiones and Their Intermediates | |
| SK278791B6 (sk) | Izochinolínové deriváty, spôsob ich výroby a farma | |
| CA1161757A (en) | 4-amino-3-quinolinecarboxylic acids and esters- antisecretory, anti-ulcer compounds | |
| EP0001266B1 (en) | Substituted 2-aminomethylphenyl sulfamates, process for preparing, and pharmaceutical compositions containing the same | |
| DE3245950A1 (de) | Verfahren zur herstellung substituierter pyridine | |
| DE69310186T2 (de) | 1,2-dihydro-2-oxo-3-aminochinoxalin derivate, ihre verwendung als heilmittel | |
| CS228531B2 (en) | Method for the production of phenylpiperazine derivates | |
| NO794064L (no) | Fremgangsmaate for fremstilling av fysiologisk aktive pyrazolo(1,5-c) kinazolin-derivater | |
| GB2040931A (en) | 1 - substituted - 3 - arylthio - 4 - hydroxypyrrolidines | |
| DE3121137A1 (de) | Neue pyridazino(4,5-b)indole, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen, zwischenprodukte und deren herstellung" | |
| CS216527B2 (cs) | Způsob výroby 4-amino-3-chinolinkarboxylových kyselin a jejich esterů |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8002292-4 Effective date: 19921005 Format of ref document f/p: F |