NO118548B - - Google Patents
Download PDFInfo
- Publication number
- NO118548B NO118548B NO155188A NO15518864A NO118548B NO 118548 B NO118548 B NO 118548B NO 155188 A NO155188 A NO 155188A NO 15518864 A NO15518864 A NO 15518864A NO 118548 B NO118548 B NO 118548B
- Authority
- NO
- Norway
- Prior art keywords
- benzenesulfonyl
- ethyl
- urea
- melting point
- benzamido
- Prior art date
Links
- -1 phenyl- Chemical group 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 150000002430 hydrocarbons Chemical group 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 4
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- JGHDVROWMPBQSR-UHFFFAOYSA-N 4-chloro-n-(oxomethylidene)benzenesulfonamide Chemical class ClC1=CC=C(S(=O)(=O)N=C=O)C=C1 JGHDVROWMPBQSR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000006622 cycloheptylmethyl group Chemical group 0.000 claims description 2
- 125000006623 cyclooctylmethyl group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 2
- 210000000988 bone and bone Anatomy 0.000 claims 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 120
- 238000002844 melting Methods 0.000 description 71
- 230000008018 melting Effects 0.000 description 71
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- 239000004202 carbamide Substances 0.000 description 26
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 239000008280 blood Substances 0.000 description 15
- 210000004369 blood Anatomy 0.000 description 15
- 235000019441 ethanol Nutrition 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000155 melt Substances 0.000 description 8
- 241000283973 Oryctolagus cuniculus Species 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 235000013877 carbamide Nutrition 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940072033 potash Drugs 0.000 description 3
- 235000015320 potassium carbonate Nutrition 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical compound OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- VAHXTSLNKKBSLN-UHFFFAOYSA-N N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]methyl]-2-phenoxyacetamide Chemical compound O(C1=CC=CC=C1)CC(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 VAHXTSLNKKBSLN-UHFFFAOYSA-N 0.000 description 2
- YPFHWRDYUCUQBV-UHFFFAOYSA-N N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]methyl]benzamide Chemical compound O=C(NC1CCCCC1)NS(=O)(=O)C1=CC=C(CNC(=O)C2=CC=CC=C2)C=C1 YPFHWRDYUCUQBV-UHFFFAOYSA-N 0.000 description 2
- 229940100389 Sulfonylurea Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- AOCYHPQXGJBAQQ-UHFFFAOYSA-N ethyl n-sulfonylcarbamate Chemical class CCOC(=O)N=S(=O)=O AOCYHPQXGJBAQQ-UHFFFAOYSA-N 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 2
- BWXNOASWVJVBJO-UHFFFAOYSA-N (4-ethylcyclohexyl)urea Chemical compound CCC1CCC(NC(N)=O)CC1 BWXNOASWVJVBJO-UHFFFAOYSA-N 0.000 description 1
- HJQDOIANPPHDCA-UHFFFAOYSA-N 2-phenoxy-n-[(4-sulfamoylphenyl)methyl]acetamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CNC(=O)COC1=CC=CC=C1 HJQDOIANPPHDCA-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 1
- IKQCKANHUYSABG-UHFFFAOYSA-N 4-ethylcyclohexan-1-amine Chemical compound CCC1CCC(N)CC1 IKQCKANHUYSABG-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- IKNCTIZYJGMNSN-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NCC1CCCCCC1 Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NCC1CCCCCC1 IKNCTIZYJGMNSN-UHFFFAOYSA-N 0.000 description 1
- BIRLFSITWMLJPT-UHFFFAOYSA-N CC(=O)NC(OC1=CC=CC=C1)C1=CC=C(C=C1)S(N)(=O)=O Chemical compound CC(=O)NC(OC1=CC=CC=C1)C1=CC=C(C=C1)S(N)(=O)=O BIRLFSITWMLJPT-UHFFFAOYSA-N 0.000 description 1
- VTSPTVAHPMQKCY-UHFFFAOYSA-N CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2 Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2 VTSPTVAHPMQKCY-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- JBFCVDQHMFKQHD-UHFFFAOYSA-N N-[[4-(carbamoylsulfamoyl)phenyl]-phenoxymethyl]acetamide Chemical compound O(C1=CC=CC=C1)C(C1=CC=C(C=C1)S(=O)(=O)NC(=O)N)NC(C)=O JBFCVDQHMFKQHD-UHFFFAOYSA-N 0.000 description 1
- GMEFOPJZNHXLPW-UHFFFAOYSA-N N-[[4-(cyclooctylcarbamoylsulfamoyl)phenyl]methyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCCCC1 GMEFOPJZNHXLPW-UHFFFAOYSA-N 0.000 description 1
- DQNHNVJSWPPXFY-UHFFFAOYSA-N N-cyclooctylurea Chemical compound NC(=O)NC1CCCCCCC1 DQNHNVJSWPPXFY-UHFFFAOYSA-N 0.000 description 1
- PCZUTUVYABZNQH-UHFFFAOYSA-N O(C1=CC=CC=C1)C(C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1)NC(C)=O Chemical compound O(C1=CC=CC=C1)C(C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1)NC(C)=O PCZUTUVYABZNQH-UHFFFAOYSA-N 0.000 description 1
- MGARVAJDEAOJRA-UHFFFAOYSA-N O=C(C1=CC=CC=C1)NCC(C=C1)=CC=C1S(NC(NCCC1CCCCCC1)=O)(=O)=O Chemical compound O=C(C1=CC=CC=C1)NCC(C=C1)=CC=C1S(NC(NCCC1CCCCCC1)=O)(=O)=O MGARVAJDEAOJRA-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- ZPHQBFRCXUIIAZ-UHFFFAOYSA-N benzene;hydrochloride Chemical compound Cl.C1=CC=CC=C1 ZPHQBFRCXUIIAZ-UHFFFAOYSA-N 0.000 description 1
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001714 carbamic acid halides Chemical class 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XDMMMGGRRNTWML-UHFFFAOYSA-N cyclohexylazanium;acetate Chemical compound CC(O)=O.NC1CCCCC1 XDMMMGGRRNTWML-UHFFFAOYSA-N 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- KQRWMAQZSHMONP-UHFFFAOYSA-N ethyl N-(4-benzamido-2-methylphenyl)sulfonyl-N-methylcarbamate Chemical compound C(C1=CC=CC=C1)(=O)NC1=CC(=C(C=C1)S(=O)(=O)N(C(=O)OCC)C)C KQRWMAQZSHMONP-UHFFFAOYSA-N 0.000 description 1
- SBUCAYGEYMPTEJ-UHFFFAOYSA-N ethyl N-[4-(benzamidomethyl)phenyl]sulfonyl-N-methylcarbamate Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)N(C(=O)OCC)C SBUCAYGEYMPTEJ-UHFFFAOYSA-N 0.000 description 1
- HPMXAMOEWBOJDV-UHFFFAOYSA-N ethyl N-methyl-N-[4-[[(2-phenoxyacetyl)amino]methyl]phenyl]sulfonylcarbamate Chemical compound O(C1=CC=CC=C1)CC(=O)NCC1=CC=C(C=C1)S(=O)(=O)N(C(=O)OCC)C HPMXAMOEWBOJDV-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 230000010030 glucose lowering effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003538 oral antidiabetic agent Substances 0.000 description 1
- 150000007524 organic acids Chemical group 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical class C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- RPIXOLUIHUFDOY-UHFFFAOYSA-N thian-4-amine Chemical compound NC1CCSCC1 RPIXOLUIHUFDOY-UHFFFAOYSA-N 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/64—Sulfonylureas, e.g. glibenclamide, tolbutamide, chlorpropamide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/59—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/18—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/22—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO16030165A NO118550B (da) | 1963-10-19 | 1965-11-02 | |
| NO16030665A NO118555B (da) | 1963-10-19 | 1965-11-02 | |
| NO16030765A NO118556B (da) | 1963-10-19 | 1965-11-02 | |
| NO16030265A NO118551B (da) | 1963-10-19 | 1965-11-02 | |
| NO16030365A NO118552B (da) | 1963-10-19 | 1965-11-02 | |
| NO16030465A NO118553B (da) | 1963-10-19 | 1965-11-02 | |
| NO16030565A NO118554B (da) | 1963-10-19 | 1965-11-02 |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF41042A DE1185180B (de) | 1963-10-19 | 1963-10-19 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DEF0042062 | 1964-02-20 | ||
| DEF0042933 | 1964-05-21 | ||
| DEF0043268 | 1964-06-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118548B true NO118548B (da) | 1970-01-12 |
Family
ID=27436911
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO155188A NO118548B (da) | 1963-10-19 | 1964-10-17 |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3426067A (da) |
| AT (5) | AT261627B (da) |
| BE (1) | BE654561A (da) |
| CH (1) | CH529115A (da) |
| CY (1) | CY436A (da) |
| DE (1) | DE1185180B (da) |
| DK (7) | DK119052B (da) |
| ES (1) | ES312472A1 (da) |
| FI (1) | FI44597B (da) |
| FR (2) | FR1473834A (da) |
| GB (1) | GB1080705A (da) |
| IL (1) | IL22259A (da) |
| IS (1) | IS765B6 (da) |
| IT (1) | IT1061504B (da) |
| LU (1) | LU47099A1 (da) |
| MC (1) | MC488A1 (da) |
| MY (1) | MY6800113A (da) |
| NL (1) | NL6412137A (da) |
| NO (1) | NO118548B (da) |
| OA (1) | OA01367A (da) |
| SE (8) | SE311151B (da) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DE1493672C3 (de) * | 1964-08-01 | 1974-05-02 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DE1443905C3 (de) * | 1964-10-30 | 1979-03-15 | Hoechst Ag, 6000 Frankfurt | benzolsulfonyl] -N'-cyclohexylharnstoff, Verfahren zu seiner Herstellung und seine Verwendung |
| DE1518816C3 (de) * | 1965-03-24 | 1975-05-22 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
| US4066639A (en) * | 1965-05-06 | 1978-01-03 | Hoechst Aktiengesellschaft | Benzene-sulfonyl semicarbazides and process for preparing them |
| DE1518895C3 (de) * | 1965-12-02 | 1978-12-07 | Hoechst Ag, 6000 Frankfurt | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung |
| US3454635A (en) * | 1965-07-27 | 1969-07-08 | Hoechst Ag | Benzenesulfonyl-ureas and process for their manufacture |
| DE1244174C2 (de) * | 1965-09-10 | 1968-01-18 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| US3932503A (en) * | 1966-05-28 | 1976-01-13 | Hoechst Aktiengesellschaft | Benzenesulfonyl ureas |
| US3932658A (en) * | 1969-02-25 | 1976-01-13 | Hoechst Aktiengesellschaft | Composition and method for lower blood sugar containing N-[4-(β-<2-methoxy-5-chloro-benzamido>-ethyl)-benzenesulfonyl]-N'-cyclopentyl-urea |
| NL138933B (nl) * | 1969-03-26 | 1973-05-15 | Erba Carlo Spa | Werkwijze voor het bereiden van benzeensulfonylureumderivaten met bloedsuikerspiegelverlagende werking. |
| BE754454A (fr) * | 1969-08-06 | 1971-02-05 | Bayer Ag | Nouveaux composes hypoglycemiques du type d'arylsulfonylurees et d'arylsulfonylsemicarbazides contenant des groupes carbonamide |
| ES384463A1 (es) * | 1970-09-23 | 1973-10-01 | Uriach & Cia Sa J | Procedimiento para la obtencion de n-4 - (beta-o-anisamido etil) - bencenosulfonil - n'ciclopentilcarbamida. |
| US3957866A (en) * | 1970-09-23 | 1976-05-18 | J. Uriach & Cia S.A. | Cyclopentyl carbamide derivative and process for its production |
| US4072758A (en) * | 1970-09-23 | 1978-02-07 | J. Uriach Y Cia, S.A. | Compositions and methods for effecting glucoreduction |
| BE791638A (fr) * | 1971-11-20 | 1973-05-21 | Hoechst Ag | Sulfonyl-urees, leur procede de preparation et leurs applications |
| DE2230543A1 (de) * | 1972-06-22 | 1974-01-17 | Hoechst Ag | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung |
| US4067998A (en) * | 1974-02-11 | 1978-01-10 | The Dow Chemical Company | 2-((3,5-Di-tert-butylphenyl)thio) alkanoic acids and derivatives |
| DE2413514C3 (de) * | 1974-03-21 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | N-Acylaminoathylbenzolsulfonyl-N'-methylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung |
| AU528362B2 (en) * | 1978-06-22 | 1983-04-28 | Societe D:Etudes De Produits Chimiques | Phenoxy isobutyramides |
| DE3211934A1 (de) * | 1982-03-31 | 1983-10-13 | Hoechst Ag, 6230 Frankfurt | Salicylsaeurederivate, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung |
| US4916163A (en) * | 1985-06-04 | 1990-04-10 | The Upjohn Company | Spray-dried lactose formulation of micronized glyburide |
| DK0612724T3 (da) * | 1993-02-23 | 1997-06-16 | Hoechst Ag | Substituerede benzensulfonylurinstoffer og -thiourinstoffer, fremgangsmåde til deres fremstilling og deres anvendelse som farmaceutika |
| HU226462B1 (en) * | 1995-02-17 | 2008-12-29 | Hoechst Ag | Substituted benzol-sulfonyl-ureas and -thioureas, process for producing them, pharmaceutical compositions containing them, and their use |
| IL141414A0 (en) * | 1998-09-10 | 2002-03-10 | Aventis Pharma Gmbh | Use of benzenesulfonyl (thio) ureas for the treatment and prophylaxis of dysfunctions of the autonomous nervous system and use of benzenesulfonyl (thio) ureas in combination with beta-receptor blockers |
| DE19923086A1 (de) | 1999-05-20 | 2000-11-23 | Aventis Pharma Gmbh | Cinnamoylaminoalkyl-substituierte Benzolsulfonamidderivate, Verfahren zu ihrer Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| US20010036479A1 (en) | 2000-01-14 | 2001-11-01 | Gillian Cave | Glyburide composition |
| DE10054482A1 (de) | 2000-11-03 | 2002-05-08 | Aventis Pharma Gmbh | Heteroarylacryloylaminoalkyl-substituierte Benzolsulfonamidderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| DE10054481A1 (de) | 2000-11-03 | 2002-05-08 | Aventis Pharma Gmbh | Acylaminoalkyl-substituierte Benzolsulfonamidderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| US6911457B2 (en) * | 2002-04-11 | 2005-06-28 | Carbomer, Inc. | Diabetes imaging probes |
| US20060201981A1 (en) * | 2003-06-30 | 2006-09-14 | Meyer Dean E | Clip support member for golf bag |
| KR101478933B1 (ko) * | 2004-12-28 | 2015-01-02 | 키넥스 파마슈티컬즈, 엘엘씨 | 세포 증식 질환의 치료를 위한 조성물 및 방법 |
| CA2611376C (en) * | 2005-06-13 | 2013-09-10 | Merck Sharp & Dohme Limited | Therapeutic agents |
| WO2010048287A2 (en) | 2008-10-22 | 2010-04-29 | University Of Pittsburgh-Of The Commonwealth System Of Higher Education | Radioprotective agents |
| WO2012079164A1 (en) * | 2010-12-16 | 2012-06-21 | The Governing Council Of The University Of Toronto | Activators of cylindrical proteases |
| US11840543B2 (en) | 2017-05-24 | 2023-12-12 | The University Of Queensland | Compounds and uses |
| CN112979571B (zh) * | 2021-02-24 | 2023-01-31 | 中国药科大学 | 一类akr1c3选择性抑制剂及其制备方法与用途 |
| EP4341246A1 (en) * | 2021-05-17 | 2024-03-27 | The United States of America, as represented by The Secretary, Department of Health and Human Services | A facile and odor-free approach to convert sulfonyl urea derivatives to chalcogenide sulfonyl urea derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL218580A (da) * | 1960-04-28 | |||
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
-
1963
- 1963-10-19 DE DEF41042A patent/DE1185180B/de active Pending
-
1964
- 1964-10-07 LU LU47099A patent/LU47099A1/xx unknown
- 1964-10-13 US US403641A patent/US3426067A/en not_active Expired - Lifetime
- 1964-10-14 DK DK506164AA patent/DK119052B/da unknown
- 1964-10-14 IL IL22259A patent/IL22259A/xx unknown
- 1964-10-16 IS IS1424A patent/IS765B6/is unknown
- 1964-10-16 AT AT881464A patent/AT261627B/de active
- 1964-10-16 CH CH1347664A patent/CH529115A/de not_active IP Right Cessation
- 1964-10-16 AT AT115167A patent/AT262309B/de active
- 1964-10-16 AT AT115067A patent/AT262308B/de active
- 1964-10-16 SE SE12459/64A patent/SE311151B/xx unknown
- 1964-10-16 AT AT01149/67A patent/AT278027B/de not_active IP Right Cessation
- 1964-10-16 AT AT114867A patent/AT267541B/de active
- 1964-10-17 NO NO155188A patent/NO118548B/no unknown
- 1964-10-19 BE BE654561A patent/BE654561A/xx unknown
- 1964-10-19 FR FR991866A patent/FR1473834A/fr not_active Expired
- 1964-10-19 MC MC515A patent/MC488A1/xx unknown
- 1964-10-19 GB GB42547/64A patent/GB1080705A/en not_active Expired
- 1964-10-19 IT IT22418/64A patent/IT1061504B/it active
- 1964-10-19 FI FI2196/64A patent/FI44597B/fi active
- 1964-10-19 NL NL6412137A patent/NL6412137A/xx unknown
- 1964-12-31 OA OA51813A patent/OA01367A/xx unknown
-
1965
- 1965-01-18 FR FR2351A patent/FR4316M/fr not_active Expired
- 1965-04-30 ES ES0312472A patent/ES312472A1/es not_active Expired
- 1965-10-22 DK DK541665AA patent/DK119455B/da unknown
- 1965-10-22 DK DK541765AA patent/DK120742B/da unknown
- 1965-10-22 DK DK541565AA patent/DK120741B/da unknown
- 1965-10-22 DK DK541865AA patent/DK119105B/da unknown
- 1965-10-22 DK DK542065AA patent/DK120588B/da unknown
- 1965-10-22 DK DK541965AA patent/DK120534B/da unknown
-
1966
- 1966-11-24 SE SE16075/66A patent/SE334604B/xx unknown
- 1966-11-24 SE SE16077/66A patent/SE334606B/xx unknown
- 1966-11-24 SE SE16079/66A patent/SE334608B/xx unknown
- 1966-11-24 SE SE16074/66A patent/SE334603B/xx unknown
- 1966-11-24 SE SE16076/66A patent/SE334605B/xx unknown
- 1966-11-24 SE SE16078/66A patent/SE334607B/xx unknown
-
1968
- 1968-02-27 SE SE02494/68A patent/SE334621B/xx unknown
- 1968-03-22 CY CY43668A patent/CY436A/xx unknown
- 1968-08-09 US US766008*A patent/US3507961A/en not_active Expired - Lifetime
- 1968-12-31 MY MY1968113A patent/MY6800113A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO118548B (da) | ||
| NO155188B (no) | Bevegelig fottrinn for et kjoeretoey. | |
| NO159136B (no) | Truseinnlegg. | |
| NO159166B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive benzoazepinderivater. | |
| IE50635B1 (en) | Sulfonyl ureas,process for their manufacture,pharmaceutical formulations containing them and their use | |
| CA2543602A1 (en) | Triazole compounds and uses related thereto | |
| NO159754B (no) | Fremgangsmaate for bestemmelse av karsinoembryonalt antigen (cea). | |
| NO145805B (no) | Tannhjulsdrev. | |
| NO151837B (no) | Anordning ved fagverk for bruk under bygging av bygninger og andre konstruksjoner | |
| NO160305B (no) | Elektrode som omfatter en elektrokatalysator. | |
| NO163432B (no) | Fremgangsmaate for fremstilling av frisk ost. | |
| US3860619A (en) | Sulphonylurea derivatives | |
| JPH0952876A (ja) | ４−スルホニル−または４−スルフィニルベンゾイルグアニジン誘導体 | |
| UA44237C2 (uk) | Арилбензоїлгуанідини, спосіб їх отримання, фармацевтична композиція | |
| NO159998B (no) | Analogifremgangsmaate ved fremstilling av et nytt terapeutisk aktivtsulfonamidderivat. | |
| NO171182B (no) | Vandig geldannende blanding egnet for selektiv permeabilitetsmodifikasjon av underjordiske lag ved hydrokarbonutvinning | |
| NO163506B (no) | Montering av senkbar tildekning ved lysarmatur. | |
| US3449346A (en) | Benzenesulfonyl ureas | |
| NO117362B (da) | ||
| US3546234A (en) | Benzene-sulfonyl-semicarbazides | |
| NO165846B (no) | Vinylkloridmateriale, samt fremgangsmaate for fremstillingav et slikt. | |
| NO122920B (da) | ||
| NO122923B (da) | ||
| US3709908A (en) | Benzenesulfonyl ureas having hypoglycemic activity | |
| US3435116A (en) | The treatment of diabetes mellitus with benzenesulfonyl ureas |