IE68675B1 - Aminocoumaran derivatives their production and use - Google Patents
Aminocoumaran derivatives their production and useInfo
- Publication number
- IE68675B1 IE68675B1 IE372491A IE372491A IE68675B1 IE 68675 B1 IE68675 B1 IE 68675B1 IE 372491 A IE372491 A IE 372491A IE 372491 A IE372491 A IE 372491A IE 68675 B1 IE68675 B1 IE 68675B1
- Authority
- IE
- Ireland
- Prior art keywords
- amino
- group
- dihydrobenzofuran
- alkyl
- tetramethyl
- Prior art date
Links
- PMSFWAVZWVEZHA-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-amine Chemical class C1=CC=C2OC(N)CC2=C1 PMSFWAVZWVEZHA-UHFFFAOYSA-N 0.000 title abstract description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- 125000002252 acyl group Chemical group 0.000 claims abstract description 23
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 23
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 21
- 125000003118 aryl group Chemical group 0.000 claims abstract description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 17
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 12
- 125000003277 amino group Chemical group 0.000 claims abstract description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 7
- 208000026106 cerebrovascular disease Diseases 0.000 claims abstract description 5
- 125000002837 carbocyclic group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 242
- -1 aralkylsulfinyl Chemical group 0.000 claims description 75
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 56
- 125000000217 alkyl group Chemical group 0.000 claims description 45
- 238000006243 chemical reaction Methods 0.000 claims description 39
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical group C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 claims description 33
- 125000001424 substituent group Chemical group 0.000 claims description 27
- 229910052736 halogen Inorganic materials 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 22
- 230000015572 biosynthetic process Effects 0.000 claims description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims description 13
- 125000004414 alkyl thio group Chemical group 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000000304 alkynyl group Chemical group 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 8
- 125000005140 aralkylsulfonyl group Chemical group 0.000 claims description 7
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 7
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 7
- 125000005135 aryl sulfinyl group Chemical group 0.000 claims description 7
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 7
- 125000005110 aryl thio group Chemical group 0.000 claims description 7
- 125000004104 aryloxy group Chemical group 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 238000006722 reduction reaction Methods 0.000 claims description 7
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 230000002490 cerebral effect Effects 0.000 claims description 6
- 230000005764 inhibitory process Effects 0.000 claims description 6
- 238000007363 ring formation reaction Methods 0.000 claims description 6
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 5
- 230000002152 alkylating effect Effects 0.000 claims description 5
- 230000006378 damage Effects 0.000 claims description 5
- 238000010511 deprotection reaction Methods 0.000 claims description 5
- 208000035475 disorder Diseases 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 206010008190 Cerebrovascular accident Diseases 0.000 claims description 4
- 208000006011 Stroke Diseases 0.000 claims description 4
- 208000027418 Wounds and injury Diseases 0.000 claims description 4
- 208000014674 injury Diseases 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 230000009467 reduction Effects 0.000 claims description 4
- 125000006595 (C1-C3) alkylsulfinyl group Chemical group 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 206010008118 cerebral infarction Diseases 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- MZYWBBNJRNLBER-UHFFFAOYSA-N 2-[(dimethylamino)methyl]-2,4,6,7-tetramethyl-3h-1-benzofuran-5-amine Chemical compound CC1=C(C)C(N)=C(C)C2=C1OC(CN(C)C)(C)C2 MZYWBBNJRNLBER-UHFFFAOYSA-N 0.000 claims description 2
- 206010048962 Brain oedema Diseases 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 206010008111 Cerebral haemorrhage Diseases 0.000 claims description 2
- 206010008132 Cerebral thrombosis Diseases 0.000 claims description 2
- 201000001429 Intracranial Thrombosis Diseases 0.000 claims description 2
- 208000020339 Spinal injury Diseases 0.000 claims description 2
- 208000006752 brain edema Diseases 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 230000004970 emotional disturbance Effects 0.000 claims description 2
- 238000005984 hydrogenation reaction Methods 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims 4
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims 3
- 125000006594 (C1-C3) alkylsulfony group Chemical group 0.000 claims 2
- INMWNYMWBXAGKL-UHFFFAOYSA-N 2-(bromomethyl)-2,4,6,7-tetramethyl-3h-1-benzofuran-5-amine Chemical compound CC1=C(N)C(C)=C2CC(C)(CBr)OC2=C1C INMWNYMWBXAGKL-UHFFFAOYSA-N 0.000 claims 2
- 238000006482 condensation reaction Methods 0.000 claims 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 2
- LMFDBZWAXNOMNH-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-3h-1-benzofuran-5-amine Chemical compound NC1=C(C)C(C)=C2OC(C)(C)CC2=C1C LMFDBZWAXNOMNH-UHFFFAOYSA-N 0.000 claims 1
- MQMXANYESGUHFZ-UHFFFAOYSA-N 2,3,4,6,7-pentamethyl-2-(4-phenylpiperidin-1-yl)-3h-1-benzofuran-5-amine Chemical compound CC1C(C(=C(N)C(C)=C2C)C)=C2OC1(C)N(CC1)CCC1C1=CC=CC=C1 MQMXANYESGUHFZ-UHFFFAOYSA-N 0.000 claims 1
- BOGCOADXMALPIO-UHFFFAOYSA-N 2,4,6,7-tetramethyl-2-(phenylmethoxymethyl)-3h-1-benzofuran-5-amine Chemical compound C1C2=C(C)C(N)=C(C)C(C)=C2OC1(C)COCC1=CC=CC=C1 BOGCOADXMALPIO-UHFFFAOYSA-N 0.000 claims 1
- OFJJFTDZPRQPBY-UHFFFAOYSA-N 2,4,6,7-tetramethyl-2-[(4-phenylpiperidin-1-yl)methyl]-3h-1-benzofuran-5-amine Chemical compound C1C2=C(C)C(N)=C(C)C(C)=C2OC1(C)CN(CC1)CCC1C1=CC=CC=C1 OFJJFTDZPRQPBY-UHFFFAOYSA-N 0.000 claims 1
- YGBPWCHWOUYRMI-UHFFFAOYSA-N 2-(methoxymethyl)-2,4,6,7-tetramethyl-3h-1-benzofuran-5-amine Chemical compound CC1=C(C)C(N)=C(C)C2=C1OC(COC)(C)C2 YGBPWCHWOUYRMI-UHFFFAOYSA-N 0.000 claims 1
- MHYNVJVRWPXSMU-UHFFFAOYSA-N 2-[2-(4-fluorophenyl)ethyl]-2,4,6,7-tetramethyl-3h-1-benzofuran-5-amine Chemical compound C1C2=C(C)C(N)=C(C)C(C)=C2OC1(C)CCC1=CC=C(F)C=C1 MHYNVJVRWPXSMU-UHFFFAOYSA-N 0.000 claims 1
- BWCJVGMZEQDOMY-UHFFFAOYSA-N 2-methyl-2,3-dihydro-1-benzofuran Chemical compound C1=CC=C2OC(C)CC2=C1 BWCJVGMZEQDOMY-UHFFFAOYSA-N 0.000 claims 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 1
- 125000001054 5 membered carbocyclic group Chemical group 0.000 claims 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- OHMFKRBXMKYYFI-UHFFFAOYSA-N n,2,2,4,6,7-hexamethyl-3h-1-benzofuran-5-amine;hydrochloride Chemical compound Cl.CC1=C(C)C(NC)=C(C)C2=C1OC(C)(C)C2 OHMFKRBXMKYYFI-UHFFFAOYSA-N 0.000 claims 1
- 229940079593 drug Drugs 0.000 abstract description 17
- 239000003814 drug Substances 0.000 abstract description 17
- 201000010099 disease Diseases 0.000 abstract description 8
- 208000011775 arteriosclerosis disease Diseases 0.000 abstract description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 abstract description 3
- 208000019423 liver disease Diseases 0.000 abstract description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 115
- 101150041968 CDC13 gene Proteins 0.000 description 105
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 77
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 72
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 72
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 70
- 239000000243 solution Substances 0.000 description 68
- 239000000203 mixture Substances 0.000 description 67
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 60
- 239000011541 reaction mixture Substances 0.000 description 52
- 239000000047 product Substances 0.000 description 34
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 30
- 239000000741 silica gel Substances 0.000 description 30
- 229910002027 silica gel Inorganic materials 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 238000004440 column chromatography Methods 0.000 description 27
- 229940093499 ethyl acetate Drugs 0.000 description 24
- 235000019439 ethyl acetate Nutrition 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- AVGAIPMGSIOHFZ-UHFFFAOYSA-N dichloromethane;2-propan-2-yloxypropane Chemical compound ClCCl.CC(C)OC(C)C AVGAIPMGSIOHFZ-UHFFFAOYSA-N 0.000 description 22
- 239000013078 crystal Substances 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- OYJXTOVLKZDGFK-UHFFFAOYSA-N ethanol;2-propan-2-yloxypropane Chemical compound CCO.CC(C)OC(C)C OYJXTOVLKZDGFK-UHFFFAOYSA-N 0.000 description 17
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 238000005755 formation reaction Methods 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 12
- 230000002401 inhibitory effect Effects 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000012300 argon atmosphere Substances 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 125000004122 cyclic group Chemical group 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- MOTRZVVGCFFABN-UHFFFAOYSA-N hexane;2-propan-2-yloxypropane Chemical compound CCCCCC.CC(C)OC(C)C MOTRZVVGCFFABN-UHFFFAOYSA-N 0.000 description 5
- OGRAOKJKVGDSFR-UHFFFAOYSA-N 2,3,5-trimethylphenol Chemical compound CC1=CC(C)=C(C)C(O)=C1 OGRAOKJKVGDSFR-UHFFFAOYSA-N 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 4
- NMSCVRBXXWPFSK-UHFFFAOYSA-N 4-amino-2,3,5-trimethylphenol Chemical compound CC1=CC(O)=C(C)C(C)=C1N NMSCVRBXXWPFSK-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000003064 anti-oxidating effect Effects 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 125000006165 cyclic alkyl group Chemical group 0.000 description 4
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 239000012264 purified product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- BYDRTKVGBRTTIT-UHFFFAOYSA-N 2-methylprop-2-en-1-ol Chemical compound CC(=C)CO BYDRTKVGBRTTIT-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 208000006454 hepatitis Diseases 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 201000008383 nephritis Diseases 0.000 description 3
- 150000004965 peroxy acids Chemical class 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 2
- QWVZJSCRGZMJLO-UHFFFAOYSA-N 2-(2,4,6,7-tetramethyl-3h-1-benzofuran-2-yl)acetic acid Chemical compound CC1=CC(C)=C(C)C2=C1CC(C)(CC(O)=O)O2 QWVZJSCRGZMJLO-UHFFFAOYSA-N 0.000 description 2
- XLGBKYFIVQZUDL-UHFFFAOYSA-N 2-bromo-3-methoxy-1,4,5-trimethylbenzene Chemical compound COC1=C(C)C(C)=CC(C)=C1Br XLGBKYFIVQZUDL-UHFFFAOYSA-N 0.000 description 2
- QQOMQLYQAXGHSU-UHFFFAOYSA-N 236TMPh Natural products CC1=CC=C(C)C(O)=C1C QQOMQLYQAXGHSU-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 206010061216 Infarction Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 102000003960 Ligases Human genes 0.000 description 2
- 108090000364 Ligases Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 238000007239 Wittig reaction Methods 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 150000004808 allyl alcohols Chemical class 0.000 description 2
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 230000006399 behavior Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229960002089 ferrous chloride Drugs 0.000 description 2
- 230000002344 fibroplastic effect Effects 0.000 description 2
- 210000002216 heart Anatomy 0.000 description 2
- 231100000283 hepatitis Toxicity 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 230000007574 infarction Effects 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229960004488 linolenic acid Drugs 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- UXBCIARAVCLFEV-UHFFFAOYSA-N n,n-dimethyl-2-(2,4,6,7-tetramethyl-3h-1-benzofuran-2-yl)acetamide Chemical compound CC1=C(C)C=C(C)C2=C1OC(CC(=O)N(C)C)(C)C2 UXBCIARAVCLFEV-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000002000 scavenging effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FIEOTCVRSXCBDN-UHFFFAOYSA-N 1,2,5-trimethyl-3-(2-methylprop-2-enoxy)benzene Chemical compound CC(=C)COC1=CC(C)=CC(C)=C1C FIEOTCVRSXCBDN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ANUIFDOICZAJEL-UHFFFAOYSA-N 1-(2-methoxy-3,4,6-trimethylphenyl)-2-methyl-1-(4-pentylphenyl)propan-1-ol Chemical compound C1=CC(CCCCC)=CC=C1C(O)(C(C)C)C1=C(C)C=C(C)C(C)=C1OC ANUIFDOICZAJEL-UHFFFAOYSA-N 0.000 description 1
- BCNLCIJXXHUHFS-UHFFFAOYSA-N 1-(2-methoxy-3,4,6-trimethylphenyl)-2-methyl-1-(4-propan-2-ylphenyl)propan-1-ol Chemical compound COC1=C(C)C(C)=CC(C)=C1C(O)(C(C)C)C1=CC=C(C(C)C)C=C1 BCNLCIJXXHUHFS-UHFFFAOYSA-N 0.000 description 1
- XYKFFBIULMZJJL-UHFFFAOYSA-N 1-(2-methoxy-3,4,6-trimethylphenyl)-2-methyl-1-(4-propylphenyl)propan-1-ol Chemical compound C1=CC(CCC)=CC=C1C(O)(C(C)C)C1=C(C)C=C(C)C(C)=C1OC XYKFFBIULMZJJL-UHFFFAOYSA-N 0.000 description 1
- UJSFTKACQKPECG-UHFFFAOYSA-N 1-(4-fluorophenyl)-1-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpropan-1-ol Chemical compound COC1=C(C)C(C)=CC(C)=C1C(O)(C(C)C)C1=CC=C(F)C=C1 UJSFTKACQKPECG-UHFFFAOYSA-N 0.000 description 1
- BFWYTORDSFIVKP-VAEKSGALSA-N 15(S)-HPETE Chemical compound CCCCC[C@H](OO)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O BFWYTORDSFIVKP-VAEKSGALSA-N 0.000 description 1
- NFIKMTWAFREAPY-UHFFFAOYSA-N 2,2,3,3,4-pentamethylfuran Chemical compound CC=1C(C(OC=1)(C)C)(C)C NFIKMTWAFREAPY-UHFFFAOYSA-N 0.000 description 1
- CFSUAGJQCVRVIE-UHFFFAOYSA-N 2,2,3,3-tetramethyl-1-benzofuran Chemical compound C1=CC=C2C(C)(C)C(C)(C)OC2=C1 CFSUAGJQCVRVIE-UHFFFAOYSA-N 0.000 description 1
- FBZDTAFFACZTOH-UHFFFAOYSA-N 2,2,4,5,6-pentamethyl-3h-1-benzofuran Chemical compound CC1=C(C)C(C)=CC2=C1CC(C)(C)O2 FBZDTAFFACZTOH-UHFFFAOYSA-N 0.000 description 1
- WIRMVLYLMLAZRB-UHFFFAOYSA-N 2,2,4,5,6-pentamethyl-7-nitro-3h-1-benzofuran Chemical compound CC1=C(C)C(C)=C2CC(C)(C)OC2=C1[N+]([O-])=O WIRMVLYLMLAZRB-UHFFFAOYSA-N 0.000 description 1
- LWTJKYLZMBZIJB-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3h-1-benzofuran Chemical compound C1=CC(C)=CC=C1C1C(C)(C)OC2=C1C(C)=CC(C)=C2C LWTJKYLZMBZIJB-UHFFFAOYSA-N 0.000 description 1
- ZATFYQPAIDMFOV-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-3-(4-pentylphenyl)-3h-1-benzofuran Chemical compound C1=CC(CCCCC)=CC=C1C1C(C)(C)OC2=C1C(C)=CC(C)=C2C ZATFYQPAIDMFOV-UHFFFAOYSA-N 0.000 description 1
- LXOZRZRMNDAFCJ-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-3-(4-propan-2-ylphenyl)-3h-1-benzofuran Chemical compound C1=CC(C(C)C)=CC=C1C1C(C)(C)OC2=C1C(C)=CC(C)=C2C LXOZRZRMNDAFCJ-UHFFFAOYSA-N 0.000 description 1
- USLXSFMNZAGGJB-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-3-phenyl-3h-1-benzofuran Chemical compound C1=2C(C)=CC(C)=C(C)C=2OC(C)(C)C1C1=CC=CC=C1 USLXSFMNZAGGJB-UHFFFAOYSA-N 0.000 description 1
- YTVLAWLRJVKWCF-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-3h-1-benzofuran Chemical compound CC1=CC(C)=C(C)C2=C1CC(C)(C)O2 YTVLAWLRJVKWCF-UHFFFAOYSA-N 0.000 description 1
- YIXZGXNLVYLGHQ-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-n-(2-methylpropyl)-3h-1-benzofuran-5-amine;hydrochloride Chemical compound Cl.CC1=C(C)C(NCC(C)C)=C(C)C2=C1OC(C)(C)C2 YIXZGXNLVYLGHQ-UHFFFAOYSA-N 0.000 description 1
- FPPIRXIWABDCGV-UHFFFAOYSA-N 2,2,4,6,7-pentamethyl-n-propyl-3h-1-benzofuran-5-amine;hydrochloride Chemical compound Cl.CC1=C(C)C(NCCC)=C(C)C2=C1OC(C)(C)C2 FPPIRXIWABDCGV-UHFFFAOYSA-N 0.000 description 1
- YDJDPEUFHPCWIF-UHFFFAOYSA-N 2,2,6,7-tetramethyl-3h-1-benzofuran-4,5-diamine;hydrochloride Chemical compound Cl.NC1=C(C)C(C)=C2OC(C)(C)CC2=C1N YDJDPEUFHPCWIF-UHFFFAOYSA-N 0.000 description 1
- LKGHOOQBXDWIMR-UHFFFAOYSA-N 2,3,5-trimethyl-6-(2-methylprop-2-enyl)phenol Chemical compound CC(=C)CC1=C(C)C=C(C)C(C)=C1O LKGHOOQBXDWIMR-UHFFFAOYSA-N 0.000 description 1
- HZUSQMPUHPKFHX-UHFFFAOYSA-N 2-(2,4,6,7-tetramethyl-3h-1-benzofuran-2-yl)acetonitrile Chemical compound CC1=CC(C)=C(C)C2=C1CC(C)(CC#N)O2 HZUSQMPUHPKFHX-UHFFFAOYSA-N 0.000 description 1
- VMHRIUOGJHDDTF-UHFFFAOYSA-N 2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran 2-(2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)acetonitrile Chemical compound BrCC1(OC2=C(C1)C(=CC(=C2C)C)C)C.C(#N)CC2(OC1=C(C2)C(=CC(=C1C)C)C)C VMHRIUOGJHDDTF-UHFFFAOYSA-N 0.000 description 1
- VVPKRKIBOSPXFB-UHFFFAOYSA-N 2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran N,N-diethylethanamine Chemical compound C(C)N(CC)CC.BrCC1(OC2=C(C1)C(=CC(=C2C)C)C)C VVPKRKIBOSPXFB-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BSMGLVDZZMBWQB-UHFFFAOYSA-N 2-methyl-1-phenylpropan-1-one Chemical compound CC(C)C(=O)C1=CC=CC=C1 BSMGLVDZZMBWQB-UHFFFAOYSA-N 0.000 description 1
- LLNAMUJRIZIXHF-UHFFFAOYSA-N 2-methyl-3-phenylprop-2-en-1-ol Chemical compound OCC(C)=CC1=CC=CC=C1 LLNAMUJRIZIXHF-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- HKHNMZXUQNDDFL-UHFFFAOYSA-N 3-(2,2,4,6,7-pentamethyl-3h-1-benzofuran-3-yl)pyridine Chemical compound C1=2C(C)=CC(C)=C(C)C=2OC(C)(C)C1C1=CC=CN=C1 HKHNMZXUQNDDFL-UHFFFAOYSA-N 0.000 description 1
- SRSQRFFIBOYHKC-UHFFFAOYSA-N 3-(2-methoxy-3,4,6-trimethylphenyl)-2,4-dimethylpentan-3-ol Chemical compound COC1=C(C)C(C)=CC(C)=C1C(O)(C(C)C)C(C)C SRSQRFFIBOYHKC-UHFFFAOYSA-N 0.000 description 1
- LNPNSTIVANVWCF-UHFFFAOYSA-N 3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3h-1-benzofuran Chemical compound C1=2C(C)=CC(C)=C(C)C=2OC(C)(C)C1C1=CC=C(F)C=C1 LNPNSTIVANVWCF-UHFFFAOYSA-N 0.000 description 1
- OIDWSAFVPROJKM-UHFFFAOYSA-N 3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-5-nitro-3h-1-benzofuran Chemical compound C12=C(C)C([N+]([O-])=O)=C(C)C(C)=C2OC(C)(C)C1C1=CC=C(F)C=C1 OIDWSAFVPROJKM-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- WWLHKBYHEFJCRB-UHFFFAOYSA-N 3-[(5-formamido-2,4,6,7-tetramethyl-3h-1-benzofuran-2-yl)methylsulfanyl]propanoic acid Chemical compound CC1=C(NC=O)C(C)=C2CC(C)(CSCCC(O)=O)OC2=C1C WWLHKBYHEFJCRB-UHFFFAOYSA-N 0.000 description 1
- GCXYHNXXHFQJTI-UHFFFAOYSA-N 4-[(2,4,6,7-tetramethyl-3h-1-benzofuran-2-yl)methyl]morpholine Chemical compound C1C=2C(C)=CC(C)=C(C)C=2OC1(C)CN1CCOCC1 GCXYHNXXHFQJTI-UHFFFAOYSA-N 0.000 description 1
- HWWOCYZALIEUGX-UHFFFAOYSA-N 4-amino-2,3,5-trimethylphenol;hydrochloride Chemical compound Cl.CC1=CC(O)=C(C)C(C)=C1N HWWOCYZALIEUGX-UHFFFAOYSA-N 0.000 description 1
- JSWVCUXQICMATE-UHFFFAOYSA-N 4-amino-2,5-dimethylphenol Chemical compound CC1=CC(O)=C(C)C=C1N JSWVCUXQICMATE-UHFFFAOYSA-N 0.000 description 1
- GCWYXRHXGLFVFE-UHFFFAOYSA-N 4-hydroxy-2,6-dimethylaniline Chemical compound CC1=CC(O)=CC(C)=C1N GCWYXRHXGLFVFE-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- MVSCMLVMTAVMIT-UHFFFAOYSA-N 4-methyl-n-(2,2,4,6,7-pentamethyl-3h-1-benzofuran-5-yl)benzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(C(=C1C)C)=C(C)C2=C1OC(C)(C)C2 MVSCMLVMTAVMIT-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- RDEYORKJEDLLDB-DQVHGTJVSA-N 5-Hydroperoxyeicosatetraenoic acid Chemical compound CCCCCCCCCCC\C=C\C=C\C(\OO)=C\C=C\C(O)=O RDEYORKJEDLLDB-DQVHGTJVSA-N 0.000 description 1
- KGIJOOYOSFUGPC-MSFIICATSA-N 5-Hydroxyeicosatetraenoic acid Chemical compound CCCCCC=CCC=CCC=C\C=C\[C@@H](O)CCCC(O)=O KGIJOOYOSFUGPC-MSFIICATSA-N 0.000 description 1
- KGIJOOYOSFUGPC-XRXZHELTSA-N 5-hydroxyeicosatetraenoic acid Natural products CCCCCC=CCC=CCC=C\C=C\C(O)CCCC(O)=O KGIJOOYOSFUGPC-XRXZHELTSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- YZXBAPSDXZZRGB-DOFZRALJSA-M Arachidonate Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC([O-])=O YZXBAPSDXZZRGB-DOFZRALJSA-M 0.000 description 1
- 102000001381 Arachidonate 5-Lipoxygenase Human genes 0.000 description 1
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- MZGNDUQOYSGQFZ-UHFFFAOYSA-N C(=O)NC1=C(C(=C(C=C1C)OCC(=C)C)C)C.Cl Chemical compound C(=O)NC1=C(C(=C(C=C1C)OCC(=C)C)C)C.Cl MZGNDUQOYSGQFZ-UHFFFAOYSA-N 0.000 description 1
- BTPOBSPCOKMZHS-UHFFFAOYSA-N C(C(=O)O)(=O)O.CC1OC2=C(C1)C=CC=C2 Chemical compound C(C(=O)O)(=O)O.CC1OC2=C(C1)C=CC=C2 BTPOBSPCOKMZHS-UHFFFAOYSA-N 0.000 description 1
- JQCAIFBCLPPIKB-UHFFFAOYSA-N C(C)OC(C=CC1(OC2=C(C1)C(=C(C(=C2C)C)NC(C)=O)C)C)=O.Cl.C(C=C)(=O)O Chemical compound C(C)OC(C=CC1(OC2=C(C1)C(=C(C(=C2C)C)NC(C)=O)C)C)=O.Cl.C(C=C)(=O)O JQCAIFBCLPPIKB-UHFFFAOYSA-N 0.000 description 1
- CLPWYMVGVISOFC-UHFFFAOYSA-N CC1(OC2=C(C1)C(=C(C(=C2[N+](=O)[O-])C)C)C)C.Cl.NC2=C(C(=C(C=1CC(OC12)(C)C)C)C)C Chemical compound CC1(OC2=C(C1)C(=C(C(=C2[N+](=O)[O-])C)C)C)C.Cl.NC2=C(C(=C(C=1CC(OC12)(C)C)C)C)C CLPWYMVGVISOFC-UHFFFAOYSA-N 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- 206010053398 Clonic convulsion Diseases 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 102000010918 Cysteinyl leukotriene receptors Human genes 0.000 description 1
- 108050001116 Cysteinyl leukotriene receptors Proteins 0.000 description 1
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 206010016654 Fibrosis Diseases 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 241000282414 Homo sapiens Species 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 1
- 229930184725 Lipoxin Natural products 0.000 description 1
- 102000003820 Lipoxygenases Human genes 0.000 description 1
- 108090000128 Lipoxygenases Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- HTDSQIVCLBYKEV-UHFFFAOYSA-N N-[2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-yl]formamide N-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]formamide Chemical compound C(=O)NC1=C(C(=C(C(=C1C)CC(=C)C)O)C)C.BrCC1(OC2=C(C1)C(=C(C(=C2C)C)NC=O)C)C HTDSQIVCLBYKEV-UHFFFAOYSA-N 0.000 description 1
- KLCJUYUIGJIHDM-UHFFFAOYSA-N N-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]formamide N-[2,3,6-trimethyl-4-(2-methylprop-2-enoxy)phenyl]formamide Chemical compound C(=O)NC1=C(C(=C(C=C1C)OCC(=C)C)C)C.C(=O)NC1=C(C(=C(C(=C1C)CC(=C)C)O)C)C KLCJUYUIGJIHDM-UHFFFAOYSA-N 0.000 description 1
- 229910004878 Na2S2O4 Inorganic materials 0.000 description 1
- 206010028851 Necrosis Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- WTZDNVJBIUCTIT-UHFFFAOYSA-N S1C=NC2=C1C=CC=C2SCC1(OC2=C(C1)C(=C(C(=C2C)C)NC=O)C)C Chemical compound S1C=NC2=C1C=CC=C2SCC1(OC2=C(C1)C(=C(C(=C2C)C)NC=O)C)C WTZDNVJBIUCTIT-UHFFFAOYSA-N 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical compound [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 206010043994 Tonic convulsion Diseases 0.000 description 1
- 206010044565 Tremor Diseases 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- 229930003268 Vitamin C Natural products 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 231100000354 acute hepatitis Toxicity 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- JAZBEHYOTPTENJ-JLNKQSITSA-N all-cis-5,8,11,14,17-icosapentaenoic acid Chemical compound CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O JAZBEHYOTPTENJ-JLNKQSITSA-N 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000020661 alpha-linolenic acid Nutrition 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000001088 anti-asthma Effects 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 239000000924 antiasthmatic agent Substances 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 229940127217 antithrombotic drug Drugs 0.000 description 1
- 229940114078 arachidonate Drugs 0.000 description 1
- 229940114079 arachidonic acid Drugs 0.000 description 1
- 235000021342 arachidonic acid Nutrition 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- USFRYJRPHFMVBZ-UHFFFAOYSA-M benzyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=CC=CC=C1 USFRYJRPHFMVBZ-UHFFFAOYSA-M 0.000 description 1
- WVYBKVIVGZLWOS-UHFFFAOYSA-N benzyloxidanium;chloride Chemical compound Cl.OCC1=CC=CC=C1 WVYBKVIVGZLWOS-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 230000007882 cirrhosis Effects 0.000 description 1
- 208000019425 cirrhosis of liver Diseases 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960005135 eicosapentaenoic acid Drugs 0.000 description 1
- JAZBEHYOTPTENJ-UHFFFAOYSA-N eicosapentaenoic acid Natural products CCC=CCC=CCC=CCC=CCC=CCCCC(O)=O JAZBEHYOTPTENJ-UHFFFAOYSA-N 0.000 description 1
- 235000020673 eicosapentaenoic acid Nutrition 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- BAHGGFXGKJQKRI-UHFFFAOYSA-N ethyl 3-(5-formamido-2,4,6,7-tetramethyl-3h-1-benzofuran-2-yl)prop-2-enoate Chemical compound CC1=C(C)C(NC=O)=C(C)C2=C1OC(C=CC(=O)OCC)(C)C2 BAHGGFXGKJQKRI-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 201000001155 extrinsic allergic alveolitis Diseases 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- VZCCETWTMQHEPK-UHFFFAOYSA-N gamma-Linolensaeure Natural products CCCCCC=CCC=CCC=CCCCCC(O)=O VZCCETWTMQHEPK-UHFFFAOYSA-N 0.000 description 1
- VZCCETWTMQHEPK-QNEBEIHSSA-N gamma-linolenic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/CCCCC(O)=O VZCCETWTMQHEPK-QNEBEIHSSA-N 0.000 description 1
- 235000020664 gamma-linolenic acid Nutrition 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 229960002733 gamolenic acid Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000000413 hydrolysate Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 208000022098 hypersensitivity pneumonitis Diseases 0.000 description 1
- 230000007954 hypoxia Effects 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 208000023589 ischemic disease Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 150000002617 leukotrienes Chemical class 0.000 description 1
- 229960004232 linoleic acid Drugs 0.000 description 1
- 150000002639 lipoxins Chemical class 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 210000002464 muscle smooth vascular Anatomy 0.000 description 1
- 201000006938 muscular dystrophy Diseases 0.000 description 1
- ZEEAXYTXQWCUFD-UHFFFAOYSA-N n,n-dimethyl-4-(2,2,4,6,7-pentamethyl-3h-1-benzofuran-3-yl)aniline Chemical compound C1=CC(N(C)C)=CC=C1C1C(C)(C)OC2=C1C(C)=CC(C)=C2C ZEEAXYTXQWCUFD-UHFFFAOYSA-N 0.000 description 1
- YQGCXCAEXNOEHX-UHFFFAOYSA-N n-(2,2,4,6,7-pentamethyl-3h-1-benzofuran-5-yl)propanamide Chemical compound CC1=C(C)C(NC(=O)CC)=C(C)C2=C1OC(C)(C)C2 YQGCXCAEXNOEHX-UHFFFAOYSA-N 0.000 description 1
- MVWNANRVDJTUDO-UHFFFAOYSA-N n-(2,2,6,7-tetramethyl-4-nitro-3h-1-benzofuran-5-yl)acetamide Chemical compound CC(=O)NC1=C(C)C(C)=C2OC(C)(C)CC2=C1[N+]([O-])=O MVWNANRVDJTUDO-UHFFFAOYSA-N 0.000 description 1
- UDPLDVINZLCKMC-UHFFFAOYSA-N n-(2-formyl-2,4,6,7-tetramethyl-3h-1-benzofuran-5-yl)acetamide Chemical compound CC1=C(C)C(NC(=O)C)=C(C)C2=C1OC(C)(C=O)C2 UDPLDVINZLCKMC-UHFFFAOYSA-N 0.000 description 1
- WTDCXJOSFXVPNJ-UHFFFAOYSA-N n-(2-formyl-2,4,6,7-tetramethyl-3h-1-benzofuran-5-yl)formamide Chemical compound CC1=C(NC=O)C(C)=C2CC(C)(C=O)OC2=C1C WTDCXJOSFXVPNJ-UHFFFAOYSA-N 0.000 description 1
- GOFKUPUHFLPRKX-UHFFFAOYSA-N n-(4-hydroxy-2,3,6-trimethylphenyl)formamide Chemical compound CC1=CC(O)=C(C)C(C)=C1NC=O GOFKUPUHFLPRKX-UHFFFAOYSA-N 0.000 description 1
- JBGFEGSISUPAGK-UHFFFAOYSA-N n-(4-hydroxy-2,3-dimethylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(O)C(C)=C1C JBGFEGSISUPAGK-UHFFFAOYSA-N 0.000 description 1
- ZZGMQEZPGPGACB-UHFFFAOYSA-N n-(4-hydroxy-2,5-dimethylphenyl)acetamide Chemical compound CC(=O)NC1=CC(C)=C(O)C=C1C ZZGMQEZPGPGACB-UHFFFAOYSA-N 0.000 description 1
- LZRWKERTOJEOLN-UHFFFAOYSA-N n-(4-hydroxy-2,6-dimethylphenyl)formamide Chemical compound CC1=CC(O)=CC(C)=C1NC=O LZRWKERTOJEOLN-UHFFFAOYSA-N 0.000 description 1
- KYLUTDLTJKXXJE-UHFFFAOYSA-N n-[2,3,6-trimethyl-4-(2-methylprop-2-enoxy)phenyl]acetamide Chemical compound CC(=C)COC1=CC(C)=C(NC(C)=O)C(C)=C1C KYLUTDLTJKXXJE-UHFFFAOYSA-N 0.000 description 1
- WWVQLMMYCFFXTF-UHFFFAOYSA-N n-[2,3-dimethyl-4-(2-methylprop-2-enoxy)phenyl]acetamide Chemical compound CC(=C)COC1=CC=C(NC(C)=O)C(C)=C1C WWVQLMMYCFFXTF-UHFFFAOYSA-N 0.000 description 1
- YNZXUZWZNSHLQJ-UHFFFAOYSA-N n-[2,4,6,7-tetramethyl-2-(2-phenylethyl)-3h-1-benzofuran-5-yl]acetamide Chemical compound O1C=2C(C)=C(C)C(NC(=O)C)=C(C)C=2CC1(C)CCC1=CC=CC=C1 YNZXUZWZNSHLQJ-UHFFFAOYSA-N 0.000 description 1
- IAZZYLZDMKYIDC-QXMHVHEDSA-N n-[2,4,6,7-tetramethyl-2-[(z)-2-phenylethenyl]-3h-1-benzofuran-5-yl]acetamide Chemical compound O1C=2C(C)=C(C)C(NC(=O)C)=C(C)C=2CC1(C)\C=C/C1=CC=CC=C1 IAZZYLZDMKYIDC-QXMHVHEDSA-N 0.000 description 1
- UZFOGCQFWPWYDJ-UHFFFAOYSA-N n-[2,5-dimethyl-4-(2-methylprop-2-enoxy)phenyl]acetamide Chemical compound CC(=C)COC1=CC(C)=C(NC(C)=O)C=C1C UZFOGCQFWPWYDJ-UHFFFAOYSA-N 0.000 description 1
- MJLCPAFSSIGHRW-UHFFFAOYSA-N n-[2,6-dimethyl-4-(2-methylprop-2-enoxy)phenyl]formamide Chemical compound CC(=C)COC1=CC(C)=C(NC=O)C(C)=C1 MJLCPAFSSIGHRW-UHFFFAOYSA-N 0.000 description 1
- FKAZWIDZZQMQDP-UHFFFAOYSA-N n-[2-(benzylsulfanylmethyl)-2,4,6,7-tetramethyl-3h-1-benzofuran-5-yl]formamide Chemical compound C1C2=C(C)C(NC=O)=C(C)C(C)=C2OC1(C)CSCC1=CC=CC=C1 FKAZWIDZZQMQDP-UHFFFAOYSA-N 0.000 description 1
- IWWIDXXOUPYLSA-UHFFFAOYSA-N n-[2-(bromomethyl)-2,4,6,7-tetramethyl-3h-1-benzofuran-5-yl]formamide Chemical compound CC1=C(NC=O)C(C)=C2CC(C)(CBr)OC2=C1C IWWIDXXOUPYLSA-UHFFFAOYSA-N 0.000 description 1
- OGWGJZYBRMWIFN-KHPPLWFESA-N n-[2-[(z)-2-(4-fluorophenyl)ethenyl]-2,4,6,7-tetramethyl-3h-1-benzofuran-5-yl]acetamide Chemical compound O1C=2C(C)=C(C)C(NC(=O)C)=C(C)C=2CC1(C)\C=C/C1=CC=C(F)C=C1 OGWGJZYBRMWIFN-KHPPLWFESA-N 0.000 description 1
- XNBJKEPJYNQAAR-UHFFFAOYSA-N n-[2-[2-(4-fluorophenyl)ethyl]-2,4,6,7-tetramethyl-3h-1-benzofuran-5-yl]acetamide Chemical compound O1C=2C(C)=C(C)C(NC(=O)C)=C(C)C=2CC1(C)CCC1=CC=C(F)C=C1 XNBJKEPJYNQAAR-UHFFFAOYSA-N 0.000 description 1
- CSGQGTJWPKWDAG-UHFFFAOYSA-N n-[4-hydroxy-2,3,6-trimethyl-5-(2-methylprop-2-enyl)phenyl]acetamide Chemical compound CC(=C)CC1=C(C)C(NC(C)=O)=C(C)C(C)=C1O CSGQGTJWPKWDAG-UHFFFAOYSA-N 0.000 description 1
- MRQAQVIBZOSMFX-UHFFFAOYSA-N n-[4-hydroxy-2,5-dimethyl-3-(2-methylprop-2-enyl)phenyl]acetamide Chemical compound CC(=C)CC1=C(C)C(NC(C)=O)=CC(C)=C1O MRQAQVIBZOSMFX-UHFFFAOYSA-N 0.000 description 1
- UOQHDJUINUSCCG-UHFFFAOYSA-N n-[4-hydroxy-2,6-dimethyl-3,5-bis(2-methylprop-2-enyl)phenyl]formamide Chemical compound CC(=C)CC1=C(C)C(NC=O)=C(C)C(CC(C)=C)=C1O UOQHDJUINUSCCG-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001326 naphthylalkyl group Chemical group 0.000 description 1
- 125000005146 naphthylsulfonyl group Chemical group C1(=CC=CC2=CC=CC=C12)S(=O)(=O)* 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 210000002569 neuron Anatomy 0.000 description 1
- 201000001119 neuropathy Diseases 0.000 description 1
- 230000007823 neuropathy Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- BHXXDGNDIDLJKA-UHFFFAOYSA-N pentane;2-propan-2-yloxypropane Chemical compound CCCCC.CC(C)OC(C)C BHXXDGNDIDLJKA-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 208000033808 peripheral neuropathy Diseases 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000007348 radical reaction Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002330 subarachnoid space Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/24—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/25—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/80—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Pulmonology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
- Peptides Or Proteins (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrrole Compounds (AREA)
- Saccharide Compounds (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IE960087A IE70668B1 (en) | 1990-11-01 | 1991-10-24 | Intermediate compounds in the production of aminocoumaran derivatives |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP29865090 | 1990-11-01 | ||
| JP24566791 | 1991-09-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE913724A1 IE913724A1 (en) | 1992-05-22 |
| IE68675B1 true IE68675B1 (en) | 1996-07-10 |
Family
ID=26537343
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE372491A IE68675B1 (en) | 1990-11-01 | 1991-10-24 | Aminocoumaran derivatives their production and use |
Country Status (13)
| Country | Link |
|---|---|
| US (4) | US5376681A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0483772B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JP2672423B2 (cg-RX-API-DMAC10.html) |
| KR (1) | KR100202463B1 (cg-RX-API-DMAC10.html) |
| AT (1) | ATE127797T1 (cg-RX-API-DMAC10.html) |
| CA (1) | CA2054619C (cg-RX-API-DMAC10.html) |
| DE (1) | DE69112989T2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK0483772T3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES2077138T3 (cg-RX-API-DMAC10.html) |
| GR (1) | GR3017981T3 (cg-RX-API-DMAC10.html) |
| HU (2) | HUT60258A (cg-RX-API-DMAC10.html) |
| IE (1) | IE68675B1 (cg-RX-API-DMAC10.html) |
| TW (1) | TW199152B (cg-RX-API-DMAC10.html) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2098912A1 (en) * | 1990-12-28 | 1992-06-29 | Tatsuki Shiota | Benzoxa condensed ring compound, process for producing the same and pharmaceutical composition comprising the same |
| DK0635009T3 (da) * | 1992-04-06 | 1997-10-06 | Merrell Pharma Inc | Derivater af 2,3-dihydro-2,2,4,6,7-pentaalkyl-5-benzofuraner |
| US5721233A (en) * | 1992-04-06 | 1998-02-24 | Merrell Pharmaceuticals Inc. | Derivatives of 2,3-dihydro benzofuranols |
| JP3198395B2 (ja) | 1992-05-28 | 2001-08-13 | 武田薬品工業株式会社 | アミノクマラン誘導体 |
| TW334433B (en) * | 1992-12-09 | 1998-06-21 | Takeda Pharm Industry Co Ltd | Crystalline salt of (S)-(+)-5-amino-2,4,6,7-tetramethyl-2-(4-phenylpiperidinomethyl)-2,3-dihydrobenzo(b)furan dihydrochloride their production and use |
| EP0640609A1 (en) * | 1993-08-24 | 1995-03-01 | Ono Pharmaceutical Co., Ltd. | Fused phenol derivatives having inhibitory activity on TXA2 synthetase, and 5-lipoxygenase and scavenging activity on oxygen species |
| EP0653417B1 (de) * | 1993-11-11 | 1998-03-04 | BASF Aktiengesellschaft | P-Hydroxyanilinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Schadpilzen oder Schädlingen |
| ES2098849T3 (es) * | 1993-11-11 | 1997-05-01 | Basf Ag | Derivados de p-hidroxianilina, procedimientos para su obtencion y su empleo para la lucha contra los hongos dañinos o contra las pestes. |
| CN1100774C (zh) * | 1993-12-08 | 2003-02-05 | 阿尔康实验室公司 | 具有高效钙拮抗物和抗氧化剂活性的化合物及其用作细胞保护剂 |
| US6017953A (en) * | 1993-12-28 | 2000-01-25 | Allergan Sales, Inc. | Thromboxane ligands |
| US6743808B1 (en) | 1994-06-08 | 2004-06-01 | H. Lundbeck A/S | 4-aryl-1-(indanmethyl, dihydrobenzofuranmethyl or dihydrobenzothiophenemethyl) tetrahydropyridines or piperazines |
| IL114026A (en) * | 1994-06-08 | 1999-06-20 | Lundbeck & Co As H | 4-aryl-1-(indanmethyl dihydrobenzofuranmethyl or dihydrobenzo thiophenemethyl) piperidines tetrahydropyridines or piperazines and pharmaceutical compositions containing them |
| EP0813530A1 (en) * | 1995-03-10 | 1997-12-29 | Hoechst Marion Roussel, Inc. | Novel process for preparing 2,3-dihydro-benzofuranol derivatives |
| CN1076022C (zh) * | 1996-08-29 | 2001-12-12 | 武田药品工业株式会社 | 作为钠通道调节剂的环醚化合物 |
| ZA9711376B (en) | 1996-12-20 | 1998-07-21 | Lundbeck & Co As H | Indole or dihydroindole derivatives |
| WO1998055454A2 (en) | 1997-06-05 | 1998-12-10 | Takeda Chemical Industries, Ltd. | Benzofurans and benzothophenes as suppressors of neurodegeneration |
| JP2001522843A (ja) * | 1997-11-12 | 2001-11-20 | ダーウィン・ディスカバリー・リミテッド | Mmpおよびtnf抑制作用を有するヒドロキサム酸およびカルボン酸誘導体 |
| CN1131217C (zh) | 1998-07-31 | 2003-12-17 | 日本曹达株式会社 | 苯基吡咯化合物和其制备方法及抗高血脂药 |
| KR100660788B1 (ko) | 1998-12-04 | 2007-02-28 | 다케다 야쿠힌 고교 가부시키가이샤 | 벤조푸란 유도체, 그 제조법 및 용도 |
| SE9902267D0 (sv) * | 1999-06-16 | 1999-06-16 | Astra Ab | New compounds |
| DE19935692A1 (de) * | 1999-07-29 | 2001-02-01 | Merck Patent Gmbh | Nitrierung in einem statischen Mikromischer |
| WO2001014384A1 (en) * | 1999-08-20 | 2001-03-01 | Takeda Chemical Industries, Ltd. | Tricyclic dihydrobenzofuran derivatives, process for the preparation thereof and agents |
| JP4721494B2 (ja) * | 1999-08-20 | 2011-07-13 | 武田薬品工業株式会社 | 三環性ジヒドロフラン誘導体、その製造法及び剤 |
| EP1125905A1 (en) * | 2000-02-16 | 2001-08-22 | Pepscan Systems B.V. | Segment synthesis |
| EP1197755A1 (en) * | 2000-10-11 | 2002-04-17 | Pepscan Systems B.V. | Identification of protein binding sites |
| ATE414070T1 (de) * | 2000-12-28 | 2008-11-15 | Takeda Pharmaceutical | Verfahren zur herstellung von optisch aktiven 2,4-dihydrobenzofuranverbindungen |
| DE10115408A1 (de) | 2001-03-29 | 2002-10-02 | Bayer Ag | Benzofuran-Derivate |
| ATE406357T1 (de) * | 2001-07-13 | 2008-09-15 | Takeda Pharmaceutical | Verfahren zur herstellung von benzofuranderivaten |
| EP1452868A2 (en) * | 2003-02-27 | 2004-09-01 | Pepscan Systems B.V. | Method for selecting a candidate drug compound |
| ATE423109T1 (de) | 2003-04-14 | 2009-03-15 | Nippon Soda Co | Diaminderivat, herstellungsverfahren und antioxidations-arzneimittel |
| SI1637527T1 (sl) * | 2003-06-26 | 2013-07-31 | Takeda Pharmaceutical Company Limited | Modulator kanabinoidnega receptorja |
| AU2004260758B2 (en) | 2003-08-01 | 2007-06-07 | Nippon Soda Co., Ltd. | Phenylazole compounds, production process, and antioxidants |
| US7485711B2 (en) * | 2005-08-12 | 2009-02-03 | Mayo Foundation For Medical Education And Research | CYP19A1 polymorphisms |
| US20100172909A1 (en) * | 2005-10-24 | 2010-07-08 | Masahiro Nishibori | Cerebral edema suppressant |
| JP3882090B1 (ja) * | 2006-05-19 | 2007-02-14 | 国立大学法人 岡山大学 | 脳血管攣縮抑制剤 |
| DE102006062089A1 (de) | 2006-12-29 | 2008-07-03 | Febit Holding Gmbh | Verbesserte molekularbiologische Prozessanlage |
| DE102007018833A1 (de) | 2007-04-20 | 2008-10-23 | Febit Holding Gmbh | Verbesserte molekularbiologische Prozessanlage |
| CN102421767B (zh) | 2009-03-10 | 2014-06-18 | 武田药品工业株式会社 | 苯并呋喃衍生物 |
| JP2009215301A (ja) * | 2009-04-27 | 2009-09-24 | Morinaga Milk Ind Co Ltd | プロテアーゼ阻害剤 |
| US8563705B2 (en) | 2010-05-12 | 2013-10-22 | Mayo Foundation For Medical Education And Research | Ribonucleic acid binding motif protein 20 sequence variants |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3476760A (en) * | 1967-03-06 | 1969-11-04 | Smithkline Corp | Substituted piperidinoalkylthianaphthenes and benzofurans |
| US3686188A (en) * | 1970-06-30 | 1972-08-22 | Ciba Geigy Corp | N-benzofurylmethyl-arylalkyleneimines |
| CA1337429C (en) * | 1983-12-05 | 1995-10-24 | Guy Rosalia Eugene Van Lommen | Derivatives of 2,2'-iminobisethanol |
| CA1297877C (en) * | 1983-12-22 | 1992-03-24 | Daniel Lednicer | Benzofurancarboxamides useful as antiemetic or antipsychotic agents |
| US4888353A (en) * | 1986-02-28 | 1989-12-19 | Erbamont, Inc. | Carboxamides useful as antiemetic or antipsychotic agents |
| US5087638A (en) * | 1984-06-20 | 1992-02-11 | Merck Frosst Canada, Inc. | Benzofuran derivatives |
| CA1281325C (en) * | 1984-06-20 | 1991-03-12 | Patrice C. Belanger | Benzofuran derivatives |
| JPS6133183A (ja) * | 1984-07-25 | 1986-02-17 | Mitsubishi Chem Ind Ltd | 2,3−ジヒドロ−7−アミノベンゾフランの製造法 |
| US4772730A (en) * | 1985-04-19 | 1988-09-20 | Fmc Corporation | Tetrafluoro-2,3-dihydrobenzofurans |
| GB8515388D0 (en) * | 1985-06-18 | 1985-07-17 | Ici Plc | Heterocyclic compounds |
| US4772459A (en) * | 1986-09-09 | 1988-09-20 | Erbamont, Inc. | Method for controlling emesis caused by chemotherapeutic agents and antiemetic agents useful therein |
| DE3777366D1 (de) * | 1986-12-27 | 1992-04-16 | Takeda Chemical Industries Ltd | 2,3-dihydro-cumaron-derivate, ihre herstellung und verwendung. |
| US4873255A (en) * | 1987-02-04 | 1989-10-10 | Sankyo Company Limited | Thiazolidinone derivatives, their preparation and their use |
| GB8704572D0 (en) * | 1987-02-26 | 1987-04-01 | Lundbeck & Co As H | Organic compounds |
| JP2855341B2 (ja) * | 1988-06-10 | 1999-02-10 | 武田薬品工業株式会社 | 新規2―置換クマラン誘導体 |
| JP2855340B2 (ja) * | 1988-06-10 | 1999-02-10 | 武田薬品工業株式会社 | 2―置換クマラン誘導体 |
-
1991
- 1991-10-24 TW TW080108393A patent/TW199152B/zh active
- 1991-10-24 IE IE372491A patent/IE68675B1/en not_active IP Right Cessation
- 1991-10-29 DK DK91118448.9T patent/DK0483772T3/da active
- 1991-10-29 JP JP3282880A patent/JP2672423B2/ja not_active Expired - Fee Related
- 1991-10-29 ES ES91118448T patent/ES2077138T3/es not_active Expired - Lifetime
- 1991-10-29 EP EP91118448A patent/EP0483772B1/en not_active Expired - Lifetime
- 1991-10-29 AT AT91118448T patent/ATE127797T1/de active
- 1991-10-29 DE DE69112989T patent/DE69112989T2/de not_active Expired - Fee Related
- 1991-10-30 US US07/784,988 patent/US5376681A/en not_active Expired - Fee Related
- 1991-10-31 HU HU913436A patent/HUT60258A/hu unknown
- 1991-10-31 CA CA002054619A patent/CA2054619C/en not_active Expired - Fee Related
- 1991-11-01 KR KR1019910019416A patent/KR100202463B1/ko not_active Expired - Fee Related
-
1994
- 1994-09-14 US US08/305,717 patent/US5478844A/en not_active Expired - Fee Related
-
1995
- 1995-05-23 US US08/447,450 patent/US5594154A/en not_active Expired - Fee Related
- 1995-06-29 HU HU95P/P00528P patent/HU211480A9/hu unknown
- 1995-11-08 GR GR950403090T patent/GR3017981T3/el unknown
-
1996
- 1996-09-17 US US08/715,216 patent/US5770772A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| GR3017981T3 (en) | 1996-02-29 |
| CA2054619C (en) | 2003-06-10 |
| US5376681A (en) | 1994-12-27 |
| JPH05140142A (ja) | 1993-06-08 |
| US5770772A (en) | 1998-06-23 |
| HUT60258A (en) | 1992-08-28 |
| DE69112989T2 (de) | 1996-02-15 |
| DK0483772T3 (da) | 1996-01-22 |
| EP0483772A1 (en) | 1992-05-06 |
| ATE127797T1 (de) | 1995-09-15 |
| KR920009815A (ko) | 1992-06-25 |
| KR100202463B1 (ko) | 1999-06-15 |
| US5478844A (en) | 1995-12-26 |
| EP0483772B1 (en) | 1995-09-13 |
| HU913436D0 (en) | 1992-01-28 |
| HU211480A9 (en) | 1995-11-28 |
| TW199152B (cg-RX-API-DMAC10.html) | 1993-02-01 |
| JP2672423B2 (ja) | 1997-11-05 |
| IE913724A1 (en) | 1992-05-22 |
| US5594154A (en) | 1997-01-14 |
| ES2077138T3 (es) | 1995-11-16 |
| DE69112989D1 (de) | 1995-10-19 |
| CA2054619A1 (en) | 1992-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0483772B1 (en) | Aminocoumaran derivatives, their production and use | |
| EP0648767B1 (de) | Piperidine und Piperazine, die Wirkungen auf das z.n.s. Zeigen | |
| DE69115280T2 (de) | Indolderivate, die die leukotrienbiosynthese hemmen. | |
| EP0934311B1 (de) | Neue heterocyclylmethyl-substituierte pyrazolderivate und ihre verwendung in der behandlung von herz-kreislauf-erkrankungen | |
| US5116863A (en) | Dibenz[b,e]oxepin derivative and pharmaceutical compositions thereof | |
| US20030232860A1 (en) | Medicine comprising dicyanopyridine derivative | |
| EP0654024A1 (en) | 2-thioindoles (selenoindoles) and related disulfides (selenides) which inhibit protein tyrosine kinases and which have antitumor properties | |
| EP1339716A1 (de) | Neue lactam-substituierte pyrazolopyridinderivate | |
| SK282676B6 (sk) | Benzofuránové karboxamidy a tioamidy, farmaceutický prípravok s ich obsahom a ich použitie | |
| BG65925B1 (bg) | Заместени пиролопиридинонови производни полезни като инхибитори на фосфодиестераза | |
| CZ294697B6 (cs) | Derivát benzofuranu, způsob jeho přípravy a farmaceutický prostředek, který ho obsahuje | |
| US4727086A (en) | Certain anti-hypertensive 2,3-dihydrobenzofuran compounds | |
| KR100425281B1 (ko) | 항바이러스성 피리미딘다이온 유도체 및 그의 제조방법 | |
| JPS62149662A (ja) | N−含有複素環化合物 | |
| DE10237883A1 (de) | Substituierte Isoxazolderivate und ihre Verwendung in der Pharmazie | |
| US4322418A (en) | Substituted 1-(α-aminocarbonyl-benzyl)-3,4-dihydro-isoquinolines, compositions and use | |
| Zubkov et al. | An efficient approach to isoindolo [2, 1-b][2] benzazepines via intramolecular [4+ 2] cycloaddition of maleic anhydride to 4-α-furyl-4-N-benzylaminobut-1-enes | |
| RU2087473C1 (ru) | Производные аминокумарана или их соли, способы их получения, композиция для ингибирования образования липопероксида | |
| IE70668B1 (en) | Intermediate compounds in the production of aminocoumaran derivatives | |
| JP2887492B2 (ja) | 1,2―エタンジオール誘導体およびその塩 | |
| EP2036906A1 (de) | Azaindole als Inhibitoren der löslichen Adenylatzyklase | |
| NO301161B1 (no) | Aminocouromanderivater, deres anvendelse og farmasöytiske sammensetninger inneholdende disse | |
| DE10122895A1 (de) | Neue Lactam-substituierte Pyrazolopyridinderivate | |
| HK1141948A (en) | Benzimidazoles and pharmaceutical compositions thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |