HU214159B - 4-Benzoil-izoxazol-származékok, eljárás előállításukra, ezeket tartalmazó herbicid készítmények és eljárás gyomok irtására - Google Patents
4-Benzoil-izoxazol-származékok, eljárás előállításukra, ezeket tartalmazó herbicid készítmények és eljárás gyomok irtására Download PDFInfo
- Publication number
- HU214159B HU214159B HU9400298A HU9400298A HU214159B HU 214159 B HU214159 B HU 214159B HU 9400298 A HU9400298 A HU 9400298A HU 9400298 A HU9400298 A HU 9400298A HU 214159 B HU214159 B HU 214159B
- Authority
- HU
- Hungary
- Prior art keywords
- benzoyl
- cyclopropylisoxazole
- bromo
- isoxazole
- cyclopropyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 17
- FGGUUGIYSOGQED-UHFFFAOYSA-N 1,2-oxazol-4-yl(phenyl)methanone Chemical class C=1C=CC=CC=1C(=O)C=1C=NOC=1 FGGUUGIYSOGQED-UHFFFAOYSA-N 0.000 title claims abstract description 12
- 241000196324 Embryophyta Species 0.000 title claims description 42
- 239000004009 herbicide Substances 0.000 title abstract description 7
- 239000000203 mixture Substances 0.000 claims abstract description 85
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 33
- 230000002363 herbicidal effect Effects 0.000 claims abstract description 31
- 125000005843 halogen group Chemical group 0.000 claims abstract description 14
- 238000002360 preparation method Methods 0.000 claims abstract description 14
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 11
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 125000001424 substituent group Chemical group 0.000 claims abstract description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 165
- 150000001875 compounds Chemical class 0.000 claims description 119
- -1 methylsulphenyl Chemical group 0.000 claims description 94
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 239000003085 diluting agent Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 239000004094 surface-active agent Substances 0.000 claims description 14
- 239000004480 active ingredient Substances 0.000 claims description 12
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 239000000843 powder Substances 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 8
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000012141 concentrate Substances 0.000 claims description 6
- 239000008187 granular material Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- BFINATOFIPGXQG-UHFFFAOYSA-N [4-chloro-2-methoxy-3-(methylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound COC1=C(CS(C)(=O)=O)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 BFINATOFIPGXQG-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 4
- 239000004550 soluble concentrate Substances 0.000 claims description 4
- NHOUUXFUGAXHGH-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfonylmethyl)phenyl]methanone Chemical compound CCS(=O)(=O)CC1=C(Cl)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 NHOUUXFUGAXHGH-UHFFFAOYSA-N 0.000 claims description 3
- BVMBBJJZGDJOIO-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(methylsulfonylmethyl)phenyl]methanone Chemical compound CS(=O)(=O)CC1=C(Cl)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 BVMBBJJZGDJOIO-UHFFFAOYSA-N 0.000 claims description 3
- FEDKTIYCLWZBCV-UHFFFAOYSA-N [3-chloro-4-methylsulfonyl-2-(methylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)(=O)CC1=C(Cl)C(S(C)(=O)=O)=CC=C1C(=O)C1=C(C2CC2)ON=C1 FEDKTIYCLWZBCV-UHFFFAOYSA-N 0.000 claims description 3
- CEEJBEAKOFBYDL-UHFFFAOYSA-N ethyl 4-[3-bromo-2-(methylsulfanylmethyl)benzoyl]-5-cyclopropyl-1,2-oxazole-3-carboxylate Chemical compound C=1C=CC(Br)=C(CSC)C=1C(=O)C=1C(C(=O)OCC)=NOC=1C1CC1 CEEJBEAKOFBYDL-UHFFFAOYSA-N 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 239000004546 suspension concentrate Substances 0.000 claims description 3
- 239000004563 wettable powder Substances 0.000 claims description 3
- VKFZHGSRTXNKFW-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2,4-dichloro-3-(methylsulfinylmethyl)phenyl]methanone Chemical compound CS(=O)CC1=C(Cl)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1Cl VKFZHGSRTXNKFW-UHFFFAOYSA-N 0.000 claims description 2
- BRVWORRRKUEZMY-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2,4-dichloro-3-(methylsulfonylmethyl)phenyl]methanone Chemical compound CS(=O)(=O)CC1=C(Cl)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1Cl BRVWORRRKUEZMY-UHFFFAOYSA-N 0.000 claims description 2
- CKEZORGILUGFBH-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(ethylsulfinylmethyl)phenyl]methanone Chemical compound CCS(=O)CC1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 CKEZORGILUGFBH-UHFFFAOYSA-N 0.000 claims description 2
- RQFUVKRFEOWSGI-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(methylsulfinylmethyl)-4-(trifluoromethyl)phenyl]methanone Chemical compound CS(=O)CC1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 RQFUVKRFEOWSGI-UHFFFAOYSA-N 0.000 claims description 2
- QIZBANYXVZFBJN-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-fluoro-4-(methylsulfanylmethyl)phenyl]methanone Chemical compound FC1=CC(CSC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 QIZBANYXVZFBJN-UHFFFAOYSA-N 0.000 claims description 2
- VCNROQTVUAIAOX-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-methoxy-4-(methylsulfanylmethyl)phenyl]methanone Chemical compound COC1=CC(CSC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 VCNROQTVUAIAOX-UHFFFAOYSA-N 0.000 claims description 2
- JUVIUGLNJSUNOZ-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-methoxy-4-(methylsulfonylmethyl)phenyl]methanone Chemical compound COC1=CC(CS(C)(=O)=O)=CC=C1C(=O)C1=C(C2CC2)ON=C1 JUVIUGLNJSUNOZ-UHFFFAOYSA-N 0.000 claims description 2
- ZCUDZDFBIXPCDH-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-methylsulfanyl-4-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSC1=CC(CSC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 ZCUDZDFBIXPCDH-UHFFFAOYSA-N 0.000 claims description 2
- CBWZKIVXPZNHBT-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-methylsulfanyl-4-(methylsulfinylmethyl)phenyl]methanone Chemical compound CSC1=CC(CS(C)=O)=CC=C1C(=O)C1=C(C2CC2)ON=C1 CBWZKIVXPZNHBT-UHFFFAOYSA-N 0.000 claims description 2
- NWZPFBLNRLCPKM-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(methylsulfinylmethyl)phenyl]methanone Chemical compound CS(=O)CC1=C(Cl)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 NWZPFBLNRLCPKM-UHFFFAOYSA-N 0.000 claims description 2
- KWAJJBCCVVBCJH-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3-fluoro-4-methoxy-2-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSCC1=C(F)C(OC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 KWAJJBCCVVBCJH-UHFFFAOYSA-N 0.000 claims description 2
- YZUDVSHRWQNMIY-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[4-fluoro-2-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSCC1=CC(F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 YZUDVSHRWQNMIY-UHFFFAOYSA-N 0.000 claims description 2
- GSODTUKQEWOQOL-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(methylsulfonylmethyl)phenyl]methanone Chemical compound CS(=O)(=O)CC1=CC(S(C)(=O)=O)=CC=C1C(=O)C1=C(C2CC2)ON=C1 GSODTUKQEWOQOL-UHFFFAOYSA-N 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 2
- MACPHHSYJNWLJN-UHFFFAOYSA-N [3-chloro-4-methylsulfanyl-2-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)CC1=C(Cl)C(SC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 MACPHHSYJNWLJN-UHFFFAOYSA-N 0.000 claims description 2
- NMNVOWQNVXOQNU-UHFFFAOYSA-N [4-bromo-2-(ethylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CCS(=O)(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 NMNVOWQNVXOQNU-UHFFFAOYSA-N 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- NQHYVXVSWZDNJF-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-(2-ethylsulfonylphenyl)methanone Chemical compound CCS(=O)(=O)C1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 NQHYVXVSWZDNJF-UHFFFAOYSA-N 0.000 claims 1
- LFKAGAZTDFHXOL-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-(2-fluoro-4-methylsulfonylphenyl)methanone Chemical compound FC1=CC(S(=O)(=O)C)=CC=C1C(=O)C1=C(C2CC2)ON=C1 LFKAGAZTDFHXOL-UHFFFAOYSA-N 0.000 claims 1
- XMLNNHWXNRUCAK-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-(2-methylsulfinylphenyl)methanone Chemical compound CS(=O)C1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 XMLNNHWXNRUCAK-UHFFFAOYSA-N 0.000 claims 1
- BYAVHRWZBRDXEX-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-(2-methylsulfonylphenyl)methanone Chemical compound CS(=O)(=O)C1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 BYAVHRWZBRDXEX-UHFFFAOYSA-N 0.000 claims 1
- UOQSMIMLYKOOCL-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(ethylsulfanylmethyl)phenyl]methanone Chemical compound CCSCC1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 UOQSMIMLYKOOCL-UHFFFAOYSA-N 0.000 claims 1
- ANFRBZVGOZVFFJ-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfinylmethyl)phenyl]methanone Chemical compound CCS(=O)CC1=C(Cl)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 ANFRBZVGOZVFFJ-UHFFFAOYSA-N 0.000 claims 1
- QAMIVYJIGYCDLR-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[4-methylsulfanyl-2-(methylsulfinylmethyl)phenyl]methanone Chemical compound CS(=O)CC1=CC(SC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 QAMIVYJIGYCDLR-UHFFFAOYSA-N 0.000 claims 1
- XBYZOHTXPQOOJM-UHFFFAOYSA-N 1,2-oxazol-3-yl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C=1C=CON=1 XBYZOHTXPQOOJM-UHFFFAOYSA-N 0.000 claims 1
- KCVDJBYIFFDBRR-UHFFFAOYSA-N CCOC(=O)C1=NOC(=C1C(=O)C2=C(C=C(C=C2)Br)SC)C3CC3 Chemical compound CCOC(=O)C1=NOC(=C1C(=O)C2=C(C=C(C=C2)Br)SC)C3CC3 KCVDJBYIFFDBRR-UHFFFAOYSA-N 0.000 claims 1
- CPRKUXLSJMVCPD-UHFFFAOYSA-N [2-bromo-4-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound BrC1=CC(CSC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 CPRKUXLSJMVCPD-UHFFFAOYSA-N 0.000 claims 1
- JKOBDHYLVWIYPE-UHFFFAOYSA-N [4-bromo-2-(ethylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CCS(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 JKOBDHYLVWIYPE-UHFFFAOYSA-N 0.000 claims 1
- OLLFPMMXEDRCMW-UHFFFAOYSA-N [4-chloro-2-methoxy-3-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound COC1=C(CSC)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OLLFPMMXEDRCMW-UHFFFAOYSA-N 0.000 claims 1
- LJAULVCDKUHSIO-UHFFFAOYSA-N [4-chloro-3-fluoro-2-(methylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound ClC1=C(C(=C(C(=O)C=2C=NOC=2C2CC2)C=C1)CS(=O)(=O)C)F LJAULVCDKUHSIO-UHFFFAOYSA-N 0.000 claims 1
- DUCAANLKSGIXKY-UHFFFAOYSA-N ethyl 4-(4-bromo-2-methylsulfinylbenzoyl)-5-cyclopropyl-1,2-oxazole-3-carboxylate Chemical compound CCOC(=O)C1=NOC(=C1C(=O)C2=C(C=C(C=C2)Br)S(=O)C)C3CC3 DUCAANLKSGIXKY-UHFFFAOYSA-N 0.000 claims 1
- BAGXJUDJBXAQNO-UHFFFAOYSA-N ethyl 4-(4-bromo-2-methylsulfonylbenzoyl)-5-cyclopropyl-1,2-oxazole-3-carboxylate Chemical compound C=1C=C(Br)C=C(S(C)(=O)=O)C=1C(=O)C=1C(C(=O)OCC)=NOC=1C1CC1 BAGXJUDJBXAQNO-UHFFFAOYSA-N 0.000 claims 1
- OYIKARCXOQLFHF-UHFFFAOYSA-N isoxaflutole Chemical compound CS(=O)(=O)C1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OYIKARCXOQLFHF-UHFFFAOYSA-N 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 47
- 125000001309 chloro group Chemical group Cl* 0.000 description 40
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 28
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- 239000007787 solid Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 14
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 14
- 235000019341 magnesium sulphate Nutrition 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- 239000012442 inert solvent Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000002689 soil Substances 0.000 description 9
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 8
- 229940125904 compound 1 Drugs 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000012272 crop production Methods 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 235000008504 concentrate Nutrition 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 4
- 244000237956 Amaranthus retroflexus Species 0.000 description 4
- 244000058871 Echinochloa crus-galli Species 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 235000011999 Panicum crusgalli Nutrition 0.000 description 4
- 240000003461 Setaria viridis Species 0.000 description 4
- 235000002248 Setaria viridis Nutrition 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- SGFACFBLUAWICV-UHFFFAOYSA-N methyl 4-bromo-2-(bromomethyl)benzoate Chemical compound COC(=O)C1=CC=C(Br)C=C1CBr SGFACFBLUAWICV-UHFFFAOYSA-N 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 230000000361 pesticidal effect Effects 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- LVSZVEDQGDOCBQ-UHFFFAOYSA-N 1,3-oxazol-4-yl(phenyl)methanone Chemical class C(C1=CC=CC=C1)(=O)C=1N=COC1 LVSZVEDQGDOCBQ-UHFFFAOYSA-N 0.000 description 3
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 240000006995 Abutilon theophrasti Species 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- 241000207890 Ipomoea purpurea Species 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 244000067505 Xanthium strumarium Species 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 3
- 239000002250 absorbent Substances 0.000 description 3
- 230000002745 absorbent Effects 0.000 description 3
- 230000006978 adaptation Effects 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 230000012447 hatching Effects 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- HVCFCNAITDHQFX-UHFFFAOYSA-N 1-cyclopropylethanone Chemical compound CC(=O)C1CC1 HVCFCNAITDHQFX-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 235000008427 Brassica arvensis Nutrition 0.000 description 2
- 244000024671 Brassica kaber Species 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 241001355178 Setaria faberi Species 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- ZFWQNMRTYJXQQW-UHFFFAOYSA-N [3-chloro-4-methylsulfanyl-2-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=C(Cl)C(SC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 ZFWQNMRTYJXQQW-UHFFFAOYSA-N 0.000 description 2
- SZDKGSQKOZBBSL-UHFFFAOYSA-N [4-bromo-2-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 SZDKGSQKOZBBSL-UHFFFAOYSA-N 0.000 description 2
- SIMACDMCZBJRHO-UHFFFAOYSA-N [4-bromo-2-(methylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 SIMACDMCZBJRHO-UHFFFAOYSA-N 0.000 description 2
- NKSQGFUGEKUDSL-UHFFFAOYSA-N [4-chloro-2-methylsulfanyl-3-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=C(Cl)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1SC NKSQGFUGEKUDSL-UHFFFAOYSA-N 0.000 description 2
- 150000000475 acetylene derivatives Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- ISXSFOPKZQZDAO-UHFFFAOYSA-N formaldehyde;sodium Chemical compound [Na].O=C ISXSFOPKZQZDAO-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 235000014666 liquid concentrate Nutrition 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000006263 metalation reaction Methods 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 230000008121 plant development Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 244000062645 predators Species 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- POSHNVRHOGSUCM-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2,4-dichloro-3-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSCC1=C(Cl)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1Cl POSHNVRHOGSUCM-UHFFFAOYSA-N 0.000 description 1
- USNASDSPDDYDOL-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(ethylsulfonylmethyl)phenyl]methanone Chemical compound CCS(=O)(=O)CC1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 USNASDSPDDYDOL-UHFFFAOYSA-N 0.000 description 1
- GJJSWPAKRBZOBD-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(methylsulfanylmethyl)-4-(trifluoromethyl)phenyl]methanone Chemical compound CSCC1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 GJJSWPAKRBZOBD-UHFFFAOYSA-N 0.000 description 1
- BELPKTFWNFMPCF-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSCC1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 BELPKTFWNFMPCF-UHFFFAOYSA-N 0.000 description 1
- SSNDMCBJMFOKEF-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(methylsulfonylmethyl)-4-(trifluoromethyl)phenyl]methanone Chemical compound CS(=O)(=O)CC1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 SSNDMCBJMFOKEF-UHFFFAOYSA-N 0.000 description 1
- JMVLJHWFJDMIAG-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-(methylsulfonylmethyl)phenyl]methanone Chemical compound CS(=O)(=O)CC1=CC=CC=C1C(=O)C1=C(C2CC2)ON=C1 JMVLJHWFJDMIAG-UHFFFAOYSA-N 0.000 description 1
- MHOQIIVEGRRGAU-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-fluoro-4-(methylsulfonylmethyl)phenyl]methanone Chemical compound FC1=CC(CS(=O)(=O)C)=CC=C1C(=O)C1=C(C2CC2)ON=C1 MHOQIIVEGRRGAU-UHFFFAOYSA-N 0.000 description 1
- BEQSHYBCAWQHCY-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone Chemical compound CCSCC1=C(Cl)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 BEQSHYBCAWQHCY-UHFFFAOYSA-N 0.000 description 1
- XBILGPKRCCTZSD-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSCC1=C(Cl)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 XBILGPKRCCTZSD-UHFFFAOYSA-N 0.000 description 1
- ZUPQDGTWDUZGOA-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3-fluoro-4-methoxy-2-(methylsulfonylmethyl)phenyl]methanone Chemical compound CS(=O)(=O)CC1=C(F)C(OC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 ZUPQDGTWDUZGOA-UHFFFAOYSA-N 0.000 description 1
- IOZWDNCMKVUSPG-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[4-methylsulfanyl-2-(methylsulfanylmethyl)phenyl]methanone Chemical compound CSCC1=CC(SC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 IOZWDNCMKVUSPG-UHFFFAOYSA-N 0.000 description 1
- MTQKMPGBALVEDL-ZPCKWCKBSA-N (z,12r)-12-hydroxy-2-sulfooctadec-9-enoic acid Chemical compound CCCCCC[C@@H](O)C\C=C/CCCCCCC(C(O)=O)S(O)(=O)=O MTQKMPGBALVEDL-ZPCKWCKBSA-N 0.000 description 1
- DMEDNTFWIHCBRK-UHFFFAOYSA-N 1,3-dichloro-2-methylbenzene Chemical compound CC1=C(Cl)C=CC=C1Cl DMEDNTFWIHCBRK-UHFFFAOYSA-N 0.000 description 1
- RYMMNSVHOKXTNN-UHFFFAOYSA-N 1,3-dichloro-5-methyl-benzene Natural products CC1=CC(Cl)=CC(Cl)=C1 RYMMNSVHOKXTNN-UHFFFAOYSA-N 0.000 description 1
- BDLCSODBACKBBK-UHFFFAOYSA-N 1-(2,4-dichloro-3-methylphenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C(C)=C1Cl BDLCSODBACKBBK-UHFFFAOYSA-N 0.000 description 1
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- KYAATGSGTLPBHN-UHFFFAOYSA-N 2,4-dichloro-3-methylbenzoic acid Chemical compound CC1=C(Cl)C=CC(C(O)=O)=C1Cl KYAATGSGTLPBHN-UHFFFAOYSA-N 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- VPHHJAOJUJHJKD-UHFFFAOYSA-N 3,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Cl)=C1 VPHHJAOJUJHJKD-UHFFFAOYSA-N 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- DFRAKBCRUYUFNT-UHFFFAOYSA-N 3,8-dicyclohexyl-2,4,7,9-tetrahydro-[1,3]oxazino[5,6-h][1,3]benzoxazine Chemical compound C1CCCCC1N1CC(C=CC2=C3OCN(C2)C2CCCCC2)=C3OC1 DFRAKBCRUYUFNT-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- OHRZDEYWKWKTSA-UHFFFAOYSA-N 4-chloro-3-(ethylsulfanylmethyl)-2-methylsulfanylbenzoyl chloride Chemical compound CCSCC1=C(Cl)C=CC(C(Cl)=O)=C1SC OHRZDEYWKWKTSA-UHFFFAOYSA-N 0.000 description 1
- QPIBHIXKUQKNFP-UHFFFAOYSA-N 4-chloro-3-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(F)=C1 QPIBHIXKUQKNFP-UHFFFAOYSA-N 0.000 description 1
- VKLKXFOZNHEBSW-UHFFFAOYSA-N 5-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide Chemical compound O1CCN(CC1)C1=CC=C(C(=O)NC=2C=C(COC=3C=NC=C(C(=O)N)C=3)C=CC=2)C=C1 VKLKXFOZNHEBSW-UHFFFAOYSA-N 0.000 description 1
- XVRIEWDDMODMGA-UHFFFAOYSA-N 5-chloropentan-2-one Chemical compound CC(=O)CCCCl XVRIEWDDMODMGA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000010662 Bidens pilosa Nutrition 0.000 description 1
- 244000104272 Bidens pilosa Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- HRRQVLDOFGXDRN-UHFFFAOYSA-N CC(C)S(=O)CC1=C(C=CC(=C1)Br)C(=O)C2=C(ON=C2)C3CC3 Chemical compound CC(C)S(=O)CC1=C(C=CC(=C1)Br)C(=O)C2=C(ON=C2)C3CC3 HRRQVLDOFGXDRN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 239000005494 Chlorotoluron Substances 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 235000001950 Elaeis guineensis Nutrition 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000010624 Medicago sativa Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000007230 Sorghum bicolor Nutrition 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- HKOPOVKCYGPJPE-UHFFFAOYSA-N [2-bromo-4-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound BrC1=CC(CS(=O)C)=CC=C1C(=O)C1=C(C2CC2)ON=C1 HKOPOVKCYGPJPE-UHFFFAOYSA-N 0.000 description 1
- DVGFUGQIKQRANF-UHFFFAOYSA-N [2-chloro-4-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound ClC1=CC(CSC)=CC=C1C(=O)C1=C(C2CC2)ON=C1 DVGFUGQIKQRANF-UHFFFAOYSA-N 0.000 description 1
- NBAIZRLRQLOXEL-UHFFFAOYSA-N [2-chloro-4-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound ClC1=CC(CS(=O)C)=CC=C1C(=O)C1=C(C2CC2)ON=C1 NBAIZRLRQLOXEL-UHFFFAOYSA-N 0.000 description 1
- LDPYWLLLZCSIGM-UHFFFAOYSA-N [3-bromo-2-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=C(Br)C=CC=C1C(=O)C1=C(C2CC2)ON=C1 LDPYWLLLZCSIGM-UHFFFAOYSA-N 0.000 description 1
- IYRQRPYWOIPXMD-UHFFFAOYSA-N [3-bromo-2-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)CC1=C(Br)C=CC=C1C(=O)C1=C(C2CC2)ON=C1 IYRQRPYWOIPXMD-UHFFFAOYSA-N 0.000 description 1
- YSZKCEZZBRECGB-UHFFFAOYSA-N [3-bromo-2-(methylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)(=O)CC1=C(Br)C=CC=C1C(=O)C1=C(C2CC2)ON=C1 YSZKCEZZBRECGB-UHFFFAOYSA-N 0.000 description 1
- FDTUXSXTKYVKHW-UHFFFAOYSA-N [3-bromo-4-chloro-2-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=C(Br)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 FDTUXSXTKYVKHW-UHFFFAOYSA-N 0.000 description 1
- VZOUDJUQNMFNPW-UHFFFAOYSA-N [4-bromo-2-(ethylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CCSCC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 VZOUDJUQNMFNPW-UHFFFAOYSA-N 0.000 description 1
- PWJBIKGCZAYWGQ-UHFFFAOYSA-N [4-bromo-2-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 PWJBIKGCZAYWGQ-UHFFFAOYSA-N 0.000 description 1
- IGKAJXLWXNMHCW-UHFFFAOYSA-N [4-bromo-2-(phenylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C=1C=CC=CC=1SCC1=CC(Br)=CC=C1C(=O)C=1C=NOC=1C1CC1 IGKAJXLWXNMHCW-UHFFFAOYSA-N 0.000 description 1
- ITKADROZLAHODH-UHFFFAOYSA-N [4-bromo-2-(prop-1-enylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CC=CS(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 ITKADROZLAHODH-UHFFFAOYSA-N 0.000 description 1
- NZIWHWZNEGQTAT-UHFFFAOYSA-N [4-bromo-2-(prop-2-enylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C=CCS(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 NZIWHWZNEGQTAT-UHFFFAOYSA-N 0.000 description 1
- XMMALNQQXTYYLE-UHFFFAOYSA-N [4-bromo-2-(prop-2-enylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C=CCS(=O)(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 XMMALNQQXTYYLE-UHFFFAOYSA-N 0.000 description 1
- JHPYKPDYYLECCM-UHFFFAOYSA-N [4-bromo-2-(propylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CCCSCC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 JHPYKPDYYLECCM-UHFFFAOYSA-N 0.000 description 1
- GOYWWTCYJKDBGU-UHFFFAOYSA-N [4-bromo-2-(propylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CCCS(=O)(=O)CC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 GOYWWTCYJKDBGU-UHFFFAOYSA-N 0.000 description 1
- GKOCWCNWWGIHSD-UHFFFAOYSA-N [4-bromo-2-(tert-butylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CC(C)(C)SCC1=CC(Br)=CC=C1C(=O)C1=C(C2CC2)ON=C1 GKOCWCNWWGIHSD-UHFFFAOYSA-N 0.000 description 1
- GIQFFCIORWWTJF-UHFFFAOYSA-N [4-chloro-2-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)CC1=CC(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 GIQFFCIORWWTJF-UHFFFAOYSA-N 0.000 description 1
- MOMFVSVWEOWMNK-UHFFFAOYSA-N [4-chloro-2-(methylsulfonylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)(=O)CC1=CC(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 MOMFVSVWEOWMNK-UHFFFAOYSA-N 0.000 description 1
- ZBIUEUHFPGFMEC-UHFFFAOYSA-N [4-chloro-3-(ethylsulfanylmethyl)-2-methylsulfanylphenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CCSCC1=C(Cl)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1SC ZBIUEUHFPGFMEC-UHFFFAOYSA-N 0.000 description 1
- BVZGQYLDISTEJR-UHFFFAOYSA-N [4-chloro-3-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(Cl)C(CSC)=CC(C(=O)C2=C(ON=C2)C2CC2)=C1 BVZGQYLDISTEJR-UHFFFAOYSA-N 0.000 description 1
- FIGQIZXINVAKEZ-UHFFFAOYSA-N [4-chloro-3-fluoro-2-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=C(F)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 FIGQIZXINVAKEZ-UHFFFAOYSA-N 0.000 description 1
- OFPBYURDFYQECK-UHFFFAOYSA-N [4-chloro-3-fluoro-2-(methylsulfinylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)CC1=C(F)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OFPBYURDFYQECK-UHFFFAOYSA-N 0.000 description 1
- OJVQENKMUWATBX-UHFFFAOYSA-N [4-chloro-3-methylsulfanyl-2-(methylsulfanylmethyl)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CSCC1=C(SC)C(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OJVQENKMUWATBX-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000011111 cardboard Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125844 compound 46 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000007590 electrostatic spraying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- UXOLDCOJRAMLTQ-UTCJRWHESA-N ethyl (2z)-2-chloro-2-hydroxyiminoacetate Chemical compound CCOC(=O)C(\Cl)=N\O UXOLDCOJRAMLTQ-UTCJRWHESA-N 0.000 description 1
- UWJIPHNMKAWAEJ-UHFFFAOYSA-N ethyl 2-(bromomethyl)-3,4-dichlorobenzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C(Cl)=C1CBr UWJIPHNMKAWAEJ-UHFFFAOYSA-N 0.000 description 1
- FCMORLMTGFYBMJ-UHFFFAOYSA-N ethyl 3,4-dichloro-2-methylbenzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C(Cl)=C1C FCMORLMTGFYBMJ-UHFFFAOYSA-N 0.000 description 1
- LYPOBLWUCCCLTJ-UHFFFAOYSA-N ethyl 3-amino-4-chloro-2-(methylsulfanylmethyl)benzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C(N)=C1CSC LYPOBLWUCCCLTJ-UHFFFAOYSA-N 0.000 description 1
- PIWWNKRTDAMKEF-UHFFFAOYSA-N ethyl 3-amino-4-chloro-2-methylbenzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C(N)=C1C PIWWNKRTDAMKEF-UHFFFAOYSA-N 0.000 description 1
- PZWBBVLRCWNTDT-UHFFFAOYSA-N ethyl 3-amino-4-chlorobenzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C(N)=C1 PZWBBVLRCWNTDT-UHFFFAOYSA-N 0.000 description 1
- ISZDEZLLBGJTTF-UHFFFAOYSA-N ethyl 3-bromo-2-methylbenzoate Chemical compound CCOC(=O)C1=CC=CC(Br)=C1C ISZDEZLLBGJTTF-UHFFFAOYSA-N 0.000 description 1
- WKOFEYJLYIZHEI-UHFFFAOYSA-N ethyl 3-bromo-4-chloro-2-methylbenzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C(Br)=C1C WKOFEYJLYIZHEI-UHFFFAOYSA-N 0.000 description 1
- KEUROZYVNMIWKN-UHFFFAOYSA-N ethyl 4-[3-bromo-2-(methylsulfonylmethyl)benzoyl]-5-cyclopropyl-1,2-oxazole-3-carboxylate Chemical compound C=1C=CC(Br)=C(CS(C)(=O)=O)C=1C(=O)C=1C(C(=O)OCC)=NOC=1C1CC1 KEUROZYVNMIWKN-UHFFFAOYSA-N 0.000 description 1
- VALJLQPMMYTXBW-UHFFFAOYSA-N ethyl 4-[4-bromo-2-(methylsulfanylmethyl)benzoyl]-5-cyclopropyl-1,2-oxazole-3-carboxylate Chemical compound C=1C=C(Br)C=C(CSC)C=1C(=O)C=1C(C(=O)OCC)=NOC=1C1CC1 VALJLQPMMYTXBW-UHFFFAOYSA-N 0.000 description 1
- PCVXGKLHVDJCRW-UHFFFAOYSA-N ethyl 4-[4-bromo-2-(methylsulfonylmethyl)benzoyl]-5-cyclopropyl-1,2-oxazole-3-carboxylate Chemical compound C=1C=C(Br)C=C(CS(C)(=O)=O)C=1C(=O)C=1C(C(=O)OCC)=NOC=1C1CC1 PCVXGKLHVDJCRW-UHFFFAOYSA-N 0.000 description 1
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical class CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- RBNIGDFIUWJJEV-UHFFFAOYSA-N methyl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-UHFFFAOYSA-N 0.000 description 1
- FXUCZTPNPZEZID-UHFFFAOYSA-N methyl 2-fluoro-4-(methylsulfanylmethyl)benzoate Chemical compound COC(=O)C1=CC=C(CSC)C=C1F FXUCZTPNPZEZID-UHFFFAOYSA-N 0.000 description 1
- UNIBAYKYNUGRTL-UHFFFAOYSA-N methyl 3,4-dichloro-2-(methylsulfanylmethyl)benzoate Chemical compound COC(=O)C1=CC=C(Cl)C(Cl)=C1CSC UNIBAYKYNUGRTL-UHFFFAOYSA-N 0.000 description 1
- KATQQXZAUWKHNH-UHFFFAOYSA-N methyl 4-chloro-3-(ethylsulfanylmethyl)-2-fluorobenzoate Chemical compound CCSCC1=C(Cl)C=CC(C(=O)OC)=C1F KATQQXZAUWKHNH-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- JAMNHZBIQDNHMM-UHFFFAOYSA-N pivalonitrile Chemical compound CC(C)(C)C#N JAMNHZBIQDNHMM-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXPRGLWJJQBWRS-UHFFFAOYSA-N tert-butyl 3-cyclopropyl-3-oxopropanoate Chemical compound CC(C)(C)OC(=O)CC(=O)C1CC1 CXPRGLWJJQBWRS-UHFFFAOYSA-N 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- UQFSVBXCNGCBBW-UHFFFAOYSA-M tetraethylammonium iodide Chemical compound [I-].CC[N+](CC)(CC)CC UQFSVBXCNGCBBW-UHFFFAOYSA-M 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB939302049A GB9302049D0 (en) | 1993-02-03 | 1993-02-03 | Compositions of new matter |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU9400298D0 HU9400298D0 (en) | 1994-05-30 |
| HUT72166A HUT72166A (en) | 1996-03-28 |
| HU214159B true HU214159B (hu) | 1998-01-28 |
Family
ID=10729728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9400298A HU214159B (hu) | 1993-02-03 | 1994-02-02 | 4-Benzoil-izoxazol-származékok, eljárás előállításukra, ezeket tartalmazó herbicid készítmények és eljárás gyomok irtására |
Country Status (36)
| Country | Link |
|---|---|
| US (1) | US5374606A (OSRAM) |
| EP (1) | EP0609798B1 (OSRAM) |
| JP (1) | JP3297185B2 (OSRAM) |
| KR (1) | KR100313724B1 (OSRAM) |
| CN (1) | CN1039229C (OSRAM) |
| AP (1) | AP432A (OSRAM) |
| AT (1) | ATE225338T1 (OSRAM) |
| AU (1) | AU670155B2 (OSRAM) |
| BG (1) | BG62207B1 (OSRAM) |
| BR (1) | BR9400234A (OSRAM) |
| CA (1) | CA2114696C (OSRAM) |
| CZ (1) | CZ287416B6 (OSRAM) |
| DE (1) | DE69431450T2 (OSRAM) |
| DK (1) | DK0609798T3 (OSRAM) |
| EG (1) | EG20523A (OSRAM) |
| ES (1) | ES2180549T3 (OSRAM) |
| FI (1) | FI940482A7 (OSRAM) |
| GB (1) | GB9302049D0 (OSRAM) |
| HR (1) | HRP940054A2 (OSRAM) |
| HU (1) | HU214159B (OSRAM) |
| IL (1) | IL108451A (OSRAM) |
| MA (1) | MA23102A1 (OSRAM) |
| MY (1) | MY110536A (OSRAM) |
| NZ (1) | NZ250806A (OSRAM) |
| PH (1) | PH30125A (OSRAM) |
| PL (1) | PL178627B1 (OSRAM) |
| RO (1) | RO112725B1 (OSRAM) |
| RU (1) | RU2124505C1 (OSRAM) |
| SI (1) | SI9400057A (OSRAM) |
| SK (1) | SK281356B6 (OSRAM) |
| TR (1) | TR27580A (OSRAM) |
| TW (1) | TW243404B (OSRAM) |
| VN (1) | VN279A1 (OSRAM) |
| YU (1) | YU5294A (OSRAM) |
| ZA (1) | ZA94451B (OSRAM) |
| ZW (1) | ZW1094A1 (OSRAM) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9302072D0 (en) * | 1993-02-03 | 1993-03-24 | Rhone Poulenc Agriculture | New compositions of matter |
| WO1995022904A1 (en) * | 1994-02-25 | 1995-08-31 | Rhone Poulenc Agrochimie | Pesticidal method |
| US5552367A (en) * | 1994-11-18 | 1996-09-03 | Rhone-Poulenc Agriculture Ltd. | Synergistic herbicidal compositions comprising 4-benzoylisoxazole and dinitroaniline herbicides |
| US5627131A (en) * | 1995-01-09 | 1997-05-06 | Zeneca Limited | Herbicidal compositions of 4-benzoylisoxazole and antidotes therefor |
| WO1996025413A1 (fr) * | 1995-02-15 | 1996-08-22 | Idemitsu Kosan Co., Ltd. | Derives d'isoxazole |
| ZA9610348B (en) * | 1995-12-20 | 1997-07-11 | Rhone Poulenc Agriculture | Herbicidal compositions |
| BR9707173A (pt) | 1996-02-01 | 1999-04-06 | Rhone Poulenc Agrochimie | Processo para a preparação de um composto e composto |
| GB9603127D0 (en) * | 1996-02-15 | 1996-04-17 | Rhone Poulenc Agriculture | New process for preparing intermediates |
| ATE212017T1 (de) * | 1996-02-16 | 2002-02-15 | Aventis Cropscience Sa | Zwischenprodukte für pestizide |
| DE19614858A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide heterocyclisch substituierte Benzoylisothiazole |
| DE19614856A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide heterocyclisch anellierte Benzoylisothiazole |
| DE19614859A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide Benzoylisothiazole |
| US6297198B1 (en) | 1996-05-14 | 2001-10-02 | Syngenta Participations Ag | Isoxazole derivatives and their use as herbicides |
| US20030041357A1 (en) * | 1996-11-07 | 2003-02-27 | Zeneca Limited | Herbicide resistant plants |
| GB9714305D0 (en) * | 1997-07-07 | 1997-09-10 | Rhone Poulenc Agrochimie | Chemical process |
| US5863865A (en) * | 1997-10-28 | 1999-01-26 | Zeneca Limited | Herbicidal 4-benzoylisoxazoles derivatives |
| US6069115A (en) * | 1997-11-12 | 2000-05-30 | Rhone-Poulenc Agrochimie | Method of controlling weeds in transgenic crops |
| DK1100789T3 (da) | 1998-07-24 | 2005-05-23 | Bayer Cropscience Ag | Substituerede benzoylcyclohexandioner |
| US6369276B1 (en) | 1998-11-19 | 2002-04-09 | Eagleview Technologies, Inc. | Catalyst structure for ketone production and method of making and using the same |
| US6392099B1 (en) | 1998-11-19 | 2002-05-21 | Eagleview Technologies, Inc. | Method and apparatus for the preparation of ketones |
| DE19920791A1 (de) | 1999-05-06 | 2000-11-09 | Bayer Ag | Substituierte Benzoylisoxazole |
| DE19946853A1 (de) | 1999-09-30 | 2001-04-05 | Bayer Ag | Substituierte Arylketone |
| BR0107624A (pt) | 2000-01-17 | 2002-11-12 | Bayer Ag | Arilcetonas substituìdas |
| DE10037149A1 (de) * | 2000-07-29 | 2002-02-07 | Bayer Ag | Substituierte Arylketone |
| US6545185B1 (en) | 2001-03-29 | 2003-04-08 | Eagleview Technologies, Inc. | Preparation of ketones from aldehydes |
| DE10136449A1 (de) * | 2001-05-09 | 2002-11-14 | Bayer Ag | Substituierte Arylketone |
| CA2449187A1 (en) * | 2001-05-09 | 2002-11-14 | Bayer Cropscience Ag | Substituted arylketones |
| DE10206792A1 (de) | 2002-02-19 | 2003-08-28 | Bayer Cropscience Ag | Substituierte Arylketone |
| DE10209645A1 (de) * | 2002-03-05 | 2003-09-18 | Bayer Cropscience Ag | Substituierte Arylketone |
| DE10341534A1 (de) * | 2003-09-09 | 2005-03-31 | Bayer Chemicals Ag | Difluoralkylaromaten |
| CN101730592B (zh) | 2007-04-05 | 2013-07-03 | 美特索矿物公司 | 破碎机及其控制方法 |
| JP6084988B2 (ja) | 2012-02-21 | 2017-02-22 | バイエル・インテレクチュアル・プロパティ・ゲゼルシャフト・ミット・ベシュレンクテル・ハフツングBayer Intellectual Property GmbH | 除草剤スルフィンイミドイル−およびスルホンイミドイルベンゾイル誘導体 |
| WO2013152039A1 (en) * | 2012-04-02 | 2013-10-10 | The Trustees Of Columbia University In The City Of New York | Compounds, compositions, and methods for modulating ferroptosis and treating excitotoxic disorders |
| RU2538601C2 (ru) * | 2012-12-20 | 2015-01-10 | Федеральное государственное бюджетное учреждение науки Институт нефтехимии и катализа Российской академии наук | Способ получения [n-(трет-бутилсульфанилметил)-бензиланилин щавелевокислый] сульфата меди пентагидрата и его применение в качестве водорастворимого средства для борьбы с почвенной и поверхностно-семенной инфекцией |
| AU2020209871B2 (en) | 2019-01-14 | 2025-07-17 | Bayer Aktiengesellschaft | Herbicidal substituted n-tetrazolyl aryl carboxamides |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8920519D0 (en) * | 1989-09-11 | 1989-10-25 | Rhone Poulenc Ltd | New compositions of matter |
| GB9025469D0 (en) * | 1990-11-22 | 1991-01-09 | Rhone Poulenc Agriculture | New compositions of matter |
| GB9017539D0 (en) * | 1990-08-10 | 1990-09-26 | Rhone Poulenc Agriculture | New compositions of matter |
| IL102674A (en) * | 1991-08-05 | 1996-11-14 | Rhone Poulenc Agriculture | 4-Benzoyl isoxazole derivatives process for their preparation and herbicidal compositions containing them |
| GB9116834D0 (en) * | 1991-08-05 | 1991-09-18 | Rhone Poulenc Agriculture | Compositions of new matter |
-
1993
- 1993-02-03 GB GB939302049A patent/GB9302049D0/en active Pending
-
1994
- 1994-01-21 ZA ZA94451A patent/ZA94451B/xx unknown
- 1994-01-26 PH PH47666A patent/PH30125A/en unknown
- 1994-01-27 IL IL108451A patent/IL108451A/en not_active IP Right Cessation
- 1994-01-28 BR BR9400234A patent/BR9400234A/pt not_active IP Right Cessation
- 1994-01-31 AT AT94101365T patent/ATE225338T1/de not_active IP Right Cessation
- 1994-01-31 VN VNS-689/94A patent/VN279A1/vi unknown
- 1994-01-31 DK DK94101365T patent/DK0609798T3/da active
- 1994-01-31 MY MYPI94000240A patent/MY110536A/en unknown
- 1994-01-31 DE DE69431450T patent/DE69431450T2/de not_active Expired - Fee Related
- 1994-01-31 ES ES94101365T patent/ES2180549T3/es not_active Expired - Lifetime
- 1994-01-31 EP EP94101365A patent/EP0609798B1/en not_active Expired - Lifetime
- 1994-02-01 SK SK107-94A patent/SK281356B6/sk unknown
- 1994-02-01 RU RU94002996A patent/RU2124505C1/ru not_active IP Right Cessation
- 1994-02-01 EG EG6394A patent/EG20523A/xx active
- 1994-02-01 CZ CZ1994220A patent/CZ287416B6/cs not_active IP Right Cessation
- 1994-02-01 HR HR9302049.3A patent/HRP940054A2/xx not_active Application Discontinuation
- 1994-02-01 MA MA23408A patent/MA23102A1/fr unknown
- 1994-02-01 CA CA002114696A patent/CA2114696C/en not_active Expired - Fee Related
- 1994-02-02 HU HU9400298A patent/HU214159B/hu not_active IP Right Cessation
- 1994-02-02 FI FI940482A patent/FI940482A7/fi unknown
- 1994-02-02 TR TR00085/94A patent/TR27580A/xx unknown
- 1994-02-02 BG BG98436A patent/BG62207B1/bg unknown
- 1994-02-02 KR KR1019940001904A patent/KR100313724B1/ko not_active Expired - Fee Related
- 1994-02-02 NZ NZ250806A patent/NZ250806A/en unknown
- 1994-02-02 ZW ZW1094A patent/ZW1094A1/xx unknown
- 1994-02-02 PL PL94302119A patent/PL178627B1/pl not_active IP Right Cessation
- 1994-02-02 YU YU5294A patent/YU5294A/sh unknown
- 1994-02-02 RO RO94-00158A patent/RO112725B1/ro unknown
- 1994-02-02 AU AU54861/94A patent/AU670155B2/en not_active Ceased
- 1994-02-03 SI SI9400057A patent/SI9400057A/sl unknown
- 1994-02-03 CN CN94101760A patent/CN1039229C/zh not_active Expired - Fee Related
- 1994-02-03 AP APAP/P/1994/000617A patent/AP432A/en active
- 1994-02-03 US US08/191,550 patent/US5374606A/en not_active Expired - Lifetime
- 1994-02-03 JP JP03179794A patent/JP3297185B2/ja not_active Expired - Fee Related
- 1994-02-16 TW TW083101221A patent/TW243404B/zh active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU214159B (hu) | 4-Benzoil-izoxazol-származékok, eljárás előállításukra, ezeket tartalmazó herbicid készítmények és eljárás gyomok irtására | |
| JP3310039B2 (ja) | 除草剤 | |
| JP3078661B2 (ja) | 新規な除草剤 | |
| RU2060251C1 (ru) | Производные 5-арилизоксазола, способы их получения, гербицидная композиция и способ подавления сорняков в локусе | |
| KR100422924B1 (ko) | 제초제 | |
| FI111249B (fi) | Uusia herbisidejä, niitä sisältävä koostumus, menetelmä niiden valmistamiseksi sekä menetelmä rikkaruohojen kasvun säätelemiseksi | |
| US5371063A (en) | Herbicidal 4-benzoylisoxazoles | |
| BG97963A (bg) | Хербициди | |
| US6323155B1 (en) | 4-benzoyl isoxazoles derivatives and their use as herbicides | |
| RU2104273C1 (ru) | Производное 4-бензоилизоксазола, способ его получения, гербицидная композиция на его основе и способ борьбы с ростом сорняков | |
| HUT76522A (en) | 4-benzoylisoxazole derivatives, intermediates, preparation and use thereof, herbicide compositions containing these compounds as active ingredients | |
| AU716198B2 (en) | 1,3-oxazin-4-one derivatives as herbicides | |
| WO1995025105A1 (en) | Isoxazole derivatives and their use as herbicides | |
| KR20000010565A (ko) | 제초제로서 1,3-옥사진-4-온 유도체, 그 제조 방법및 중간물 | |
| MXPA98004665A (en) | Derivatives of 1,3-oxazin-4-ona as herbici |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |