HU200338B - Process for producing 4-square brackets open /bicyclic-heterocyclic/-methyl- and hetero square brackets closed-piperidines and pharmaceutical compositions comprising same - Google Patents
Process for producing 4-square brackets open /bicyclic-heterocyclic/-methyl- and hetero square brackets closed-piperidines and pharmaceutical compositions comprising same Download PDFInfo
- Publication number
- HU200338B HU200338B HU8561A HU6185A HU200338B HU 200338 B HU200338 B HU 200338B HU 8561 A HU8561 A HU 8561A HU 6185 A HU6185 A HU 6185A HU 200338 B HU200338 B HU 200338B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- methyl
- compound
- parts
- weight
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 27
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 11
- 125000002618 bicyclic heterocycle group Chemical group 0.000 title claims abstract description 5
- 125000005842 heteroatom Chemical group 0.000 title claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 286
- 150000001875 compounds Chemical class 0.000 claims abstract description 237
- 150000003839 salts Chemical class 0.000 claims abstract description 160
- 239000002253 acid Substances 0.000 claims abstract description 45
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 23
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 22
- 239000004480 active ingredient Substances 0.000 claims abstract description 17
- -1 dimethylaminocarbonyl Chemical group 0.000 claims description 193
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 62
- 239000002585 base Substances 0.000 claims description 60
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 42
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 36
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 30
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 28
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 28
- 239000002904 solvent Substances 0.000 claims description 26
- 125000001424 substituent group Chemical group 0.000 claims description 25
- 239000003054 catalyst Substances 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 239000001301 oxygen Substances 0.000 claims description 21
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 19
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- 239000011593 sulfur Substances 0.000 claims description 18
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 16
- 239000007858 starting material Substances 0.000 claims description 15
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 14
- 239000012442 inert solvent Substances 0.000 claims description 14
- 239000003153 chemical reaction reagent Substances 0.000 claims description 13
- 150000003053 piperidines Chemical class 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 10
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 9
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 9
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 8
- 238000007126 N-alkylation reaction Methods 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 150000002576 ketones Chemical class 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- 239000004202 carbamide Substances 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 238000005984 hydrogenation reaction Methods 0.000 claims description 6
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 6
- 230000002829 reductive effect Effects 0.000 claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 4
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 4
- 101150065749 Churc1 gene Proteins 0.000 claims description 4
- 102100038239 Protein Churchill Human genes 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- 150000001340 alkali metals Chemical group 0.000 claims description 3
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 239000000758 substrate Substances 0.000 claims description 3
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 claims description 2
- JMTMWFZXOIWTLX-UHFFFAOYSA-N 2-pyridin-2-yloxypyridine Chemical group C=1C=CC=NC=1OC1=CC=CC=N1 JMTMWFZXOIWTLX-UHFFFAOYSA-N 0.000 claims description 2
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 claims description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 150000002978 peroxides Chemical class 0.000 claims description 2
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 claims description 2
- 229920006324 polyoxymethylene Polymers 0.000 claims description 2
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 claims description 2
- 230000009466 transformation Effects 0.000 claims description 2
- 238000000844 transformation Methods 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims 2
- 150000001408 amides Chemical class 0.000 claims 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims 2
- 230000003301 hydrolyzing effect Effects 0.000 claims 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims 2
- 150000003556 thioamides Chemical class 0.000 claims 2
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 claims 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims 1
- 150000001351 alkyl iodides Chemical class 0.000 claims 1
- 230000002152 alkylating effect Effects 0.000 claims 1
- 230000006315 carbonylation Effects 0.000 claims 1
- 238000005810 carbonylation reaction Methods 0.000 claims 1
- 229940125904 compound 1 Drugs 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 238000005695 dehalogenation reaction Methods 0.000 claims 1
- 150000003948 formamides Chemical class 0.000 claims 1
- 235000019253 formic acid Nutrition 0.000 claims 1
- 150000002357 guanidines Chemical class 0.000 claims 1
- 125000001041 indolyl group Chemical group 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- 239000002609 medium Substances 0.000 claims 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 1
- 210000003205 muscle Anatomy 0.000 claims 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 125000003396 thiol group Chemical group [H]S* 0.000 claims 1
- 150000003585 thioureas Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 175
- 239000000043 antiallergic agent Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 226
- 239000000047 product Substances 0.000 description 155
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 146
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 134
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 125
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 111
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 99
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 94
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 76
- 238000003756 stirring Methods 0.000 description 71
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 67
- 239000000243 solution Substances 0.000 description 63
- 229960001701 chloroform Drugs 0.000 description 60
- 239000011541 reaction mixture Substances 0.000 description 59
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 53
- 239000000543 intermediate Substances 0.000 description 50
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 45
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 45
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 43
- 239000003480 eluent Substances 0.000 description 41
- 239000000284 extract Substances 0.000 description 41
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 38
- IDRUFHLMTBZQBT-NSCUHMNNSA-N 2-[(e)-prop-1-enyl]propanedioic acid Chemical compound C\C=C\C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-NSCUHMNNSA-N 0.000 description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 34
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 33
- 239000000706 filtrate Substances 0.000 description 29
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 26
- 238000010992 reflux Methods 0.000 description 25
- KBIWNQVZKHSHTI-UHFFFAOYSA-N 4-n,4-n-dimethylbenzene-1,4-diamine;oxalic acid Chemical compound OC(=O)C(O)=O.CN(C)C1=CC=C(N)C=C1 KBIWNQVZKHSHTI-UHFFFAOYSA-N 0.000 description 24
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Natural products OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 24
- 229920006395 saturated elastomer Polymers 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- 229910021529 ammonia Inorganic materials 0.000 description 23
- 238000002844 melting Methods 0.000 description 23
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 21
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 230000008018 melting Effects 0.000 description 19
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 18
- 239000000908 ammonium hydroxide Substances 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 18
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 18
- 241000700159 Rattus Species 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 16
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 15
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 15
- 238000010898 silica gel chromatography Methods 0.000 description 15
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 14
- 150000004682 monohydrates Chemical class 0.000 description 14
- 229910000029 sodium carbonate Inorganic materials 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 10
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 10
- 239000012312 sodium hydride Substances 0.000 description 10
- 229910000104 sodium hydride Inorganic materials 0.000 description 10
- 125000004149 thio group Chemical group *S* 0.000 description 10
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 235000011054 acetic acid Nutrition 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 150000008282 halocarbons Chemical class 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 8
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 210000002784 stomach Anatomy 0.000 description 7
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 239000000739 antihistaminic agent Substances 0.000 description 6
- 239000003420 antiserotonin agent Substances 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- 150000002430 hydrocarbons Chemical class 0.000 description 6
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- CZTAMADUQJSCPI-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 CZTAMADUQJSCPI-UHFFFAOYSA-N 0.000 description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 5
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 5
- 208000027418 Wounds and injury Diseases 0.000 description 5
- 229940082988 antihypertensives serotonin antagonists Drugs 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 208000014674 injury Diseases 0.000 description 5
- 230000001665 lethal effect Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 230000003389 potentiating effect Effects 0.000 description 5
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 4
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 4
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 4
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 4
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 229930192474 thiophene Natural products 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- SHRDIYCPQFJARI-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-piperidin-4-yloxybenzimidazole;dihydrochloride Chemical compound Cl.Cl.C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1OC1CCNCC1 SHRDIYCPQFJARI-UHFFFAOYSA-N 0.000 description 3
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 3
- PGXALMVNIRPELS-UHFFFAOYSA-N 2-chloro-1-[(4-fluorophenyl)methyl]benzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1Cl PGXALMVNIRPELS-UHFFFAOYSA-N 0.000 description 3
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 3
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 3
- 230000003902 lesion Effects 0.000 description 3
- 231100000518 lethal Toxicity 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- DRTZAIDVOGUYSP-UHFFFAOYSA-N pyridin-1-ium;chloride;hydrochloride Chemical compound Cl.Cl.C1=CC=NC=C1 DRTZAIDVOGUYSP-UHFFFAOYSA-N 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- QDVBKXJMLILLLB-UHFFFAOYSA-N 1,4'-bipiperidine Chemical compound C1CCCCN1C1CCNCC1 QDVBKXJMLILLLB-UHFFFAOYSA-N 0.000 description 2
- PMIAMRAWHYEPNH-UHFFFAOYSA-N 1-(2-chloroethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCCl)C=C1 PMIAMRAWHYEPNH-UHFFFAOYSA-N 0.000 description 2
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 2
- QNQHGYPOTYALRR-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]sulfanylbenzimidazole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(SC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 QNQHGYPOTYALRR-UHFFFAOYSA-N 0.000 description 2
- WYLNFJKRWQJRKS-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-piperidin-4-ylsulfanylbenzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1SC1CCNCC1 WYLNFJKRWQJRKS-UHFFFAOYSA-N 0.000 description 2
- IDJANXQTKNIMHT-UHFFFAOYSA-N 1-[(4-methylphenyl)methyl]-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound C1=CC(C)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCNCC1 IDJANXQTKNIMHT-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-SFIIULIVSA-N 1H-benzimidazole Chemical class C1=CC=C2N[11CH]=NC2=C1 HYZJCKYKOHLVJF-SFIIULIVSA-N 0.000 description 2
- SBQRYMGLABMVAQ-UHFFFAOYSA-N 2-(1,2-dihydroxypropyl)propanedioic acid Chemical compound CC(O)C(O)C(C(O)=O)C(O)=O SBQRYMGLABMVAQ-UHFFFAOYSA-N 0.000 description 2
- GBHAAUKHXCERKW-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-yl)acetic acid;hydrochloride Chemical compound Cl.C1CC(CC(=O)O)CCN1CC1=CC=CC=C1 GBHAAUKHXCERKW-UHFFFAOYSA-N 0.000 description 2
- XGYSYDGLRBQECF-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-(furan-3-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(CC2=COC=C2)C=1CC(CC1)CCN1CC1=CC=CC=C1 XGYSYDGLRBQECF-UHFFFAOYSA-N 0.000 description 2
- JUZCIOCUEPJGNV-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-(pyridin-3-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(CC=2C=NC=CC=2)C=1CC(CC1)CCN1CC1=CC=CC=C1 JUZCIOCUEPJGNV-UHFFFAOYSA-N 0.000 description 2
- KIPZHDJZBRRENP-UHFFFAOYSA-N 2-[4-[(1-phenylbenzimidazol-2-yl)methyl]piperidin-1-yl]ethanol Chemical compound C1CN(CCO)CCC1CC1=NC2=CC=CC=C2N1C1=CC=CC=C1 KIPZHDJZBRRENP-UHFFFAOYSA-N 0.000 description 2
- YZMIINLRZPQAHN-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]acetic acid Chemical compound C1CN(CC(=O)O)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 YZMIINLRZPQAHN-UHFFFAOYSA-N 0.000 description 2
- AYPSHJCKSDNETA-UHFFFAOYSA-N 2-chloro-1h-benzimidazole Chemical compound C1=CC=C2NC(Cl)=NC2=C1 AYPSHJCKSDNETA-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- IDRUFHLMTBZQBT-UHFFFAOYSA-N 2-prop-1-enylpropanedioic acid Chemical compound CC=CC(C(O)=O)C(O)=O IDRUFHLMTBZQBT-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- PFLYRWZUNONOBV-UHFFFAOYSA-N 3-(furan-2-ylmethyl)-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine Chemical compound N=1C2=CC=CN=C2N(CC=2OC=CC=2)C=1CC1CCNCC1 PFLYRWZUNONOBV-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- 244000208874 Althaea officinalis Species 0.000 description 2
- 235000006576 Althaea officinalis Nutrition 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 206010011703 Cyanosis Diseases 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- VXHXNVFTVBXXKL-UHFFFAOYSA-N O.Cl.Cl.C1CNCCC1CC1=NC2=CC(OC)=CC=C2N1CC1=CC=C(F)C=C1 Chemical compound O.Cl.Cl.C1CNCCC1CC1=NC2=CC(OC)=CC=C2N1CC1=CC=C(F)C=C1 VXHXNVFTVBXXKL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- LBMDYWGRRAFWEN-UHFFFAOYSA-N [4-[(1-methylbenzimidazol-2-yl)methyl]piperidin-1-yl]-phenylmethanone Chemical compound N=1C2=CC=CC=C2N(C)C=1CC(CC1)CCN1C(=O)C1=CC=CC=C1 LBMDYWGRRAFWEN-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- SEJJYFSKEXRWOZ-UHFFFAOYSA-N acetamide;piperidine Chemical compound CC(N)=O.C1CCNCC1 SEJJYFSKEXRWOZ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 210000005069 ears Anatomy 0.000 description 2
- IJQDDDLEPQQMFA-UHFFFAOYSA-N ethyl 4-[[1-(thiophen-2-ylmethyl)benzimidazol-2-yl]methyl]piperidine-1-carboxylate;hydrochloride Chemical compound Cl.C1CN(C(=O)OCC)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=CS1 IJQDDDLEPQQMFA-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000000762 glandular Effects 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 235000001035 marshmallow Nutrition 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229940100688 oral solution Drugs 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical class NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 229940076279 serotonin Drugs 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- FTLYMKDSHNWQKD-UHFFFAOYSA-N (2,4,5-trichlorophenyl)boronic acid Chemical compound OB(O)C1=CC(Cl)=C(Cl)C=C1Cl FTLYMKDSHNWQKD-UHFFFAOYSA-N 0.000 description 1
- QJPXLCQSAFQCBD-UHFFFAOYSA-M (3,3-diphenyloxolan-2-ylidene)-dimethylazanium;bromide Chemical compound [Br-].C[N+](C)=C1OCCC1(C=1C=CC=CC=1)C1=CC=CC=C1 QJPXLCQSAFQCBD-UHFFFAOYSA-M 0.000 description 1
- NRQHBNNTBIDSRK-YRNVUSSQSA-N (4e)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one Chemical compound C1=CC(OC)=CC=C1\C=C\1C(=O)OC(C)=N/1 NRQHBNNTBIDSRK-YRNVUSSQSA-N 0.000 description 1
- KPJZHOPZRAFDTN-ZRGWGRIASA-N (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)CC)C2)=C3C2=CN(C)C3=C1 KPJZHOPZRAFDTN-ZRGWGRIASA-N 0.000 description 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 1
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 1
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- PJQIBTFOXWGAEN-UHFFFAOYSA-N 1,2-dimethylbenzimidazole Chemical compound C1=CC=C2N(C)C(C)=NC2=C1 PJQIBTFOXWGAEN-UHFFFAOYSA-N 0.000 description 1
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 1
- DFFWYMMOMUTKOI-UHFFFAOYSA-N 1-(3-chloropropoxy)-4-fluorobenzene Chemical compound FC1=CC=C(OCCCCl)C=C1 DFFWYMMOMUTKOI-UHFFFAOYSA-N 0.000 description 1
- YZUGYBUVPMOLGT-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylpiperidin-4-ol Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(O)CC1 YZUGYBUVPMOLGT-UHFFFAOYSA-N 0.000 description 1
- QYSKIWPKKCCIEZ-UHFFFAOYSA-N 1-(piperidin-4-ylmethyl)benzimidazole Chemical compound C1=NC2=CC=CC=C2N1CC1CCNCC1 QYSKIWPKKCCIEZ-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- RGKWXKGPIATJCX-UHFFFAOYSA-N 1-[(2,6-dichlorophenyl)methyl]-2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazole Chemical compound C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2C(=CC=CC=2Cl)Cl)CC1 RGKWXKGPIATJCX-UHFFFAOYSA-N 0.000 description 1
- MOZDPOYGADIKAP-UHFFFAOYSA-N 1-[(2-fluorophenyl)methyl]-2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazole Chemical compound C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2C(=CC=CC=2)F)CC1 MOZDPOYGADIKAP-UHFFFAOYSA-N 0.000 description 1
- BSXKQIBNUYHLRO-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-(piperidin-4-ylmethyl)benzimidazol-5-ol Chemical compound C1CNCCC1CC1=NC2=CC(O)=CC=C2N1CC1=CC=C(F)C=C1 BSXKQIBNUYHLRO-UHFFFAOYSA-N 0.000 description 1
- MIIHEKGRLKXCNE-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCNCC1 MIIHEKGRLKXCNE-UHFFFAOYSA-N 0.000 description 1
- IYRBOISAFWRDLR-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CN=C2N=C1CC1CCNCC1 IYRBOISAFWRDLR-UHFFFAOYSA-N 0.000 description 1
- GWOJIWNHRLRUNH-ACQKZTSLSA-N 1-[(4-fluorophenyl)methyl]-2-[(3r,4r)-3-methylpiperidin-4-yl]oxybenzimidazole;dihydrochloride Chemical compound Cl.Cl.C[C@@H]1CNCC[C@H]1OC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 GWOJIWNHRLRUNH-ACQKZTSLSA-N 0.000 description 1
- OSRAKZTYNLUUTG-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-[[1-(2-pyridin-2-ylethyl)piperidin-4-yl]methyl]benzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCC=2N=CC=CC=2)CC1 OSRAKZTYNLUUTG-UHFFFAOYSA-N 0.000 description 1
- CNFQAJZFXGNXLA-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazole Chemical compound C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 CNFQAJZFXGNXLA-UHFFFAOYSA-N 0.000 description 1
- ZDWGCRBIRQJCEA-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-piperidin-4-ylsulfonylbenzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1S(=O)(=O)C1CCNCC1 ZDWGCRBIRQJCEA-UHFFFAOYSA-N 0.000 description 1
- JYFRRBLVMXNVMR-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-5-methoxycyclohexa-3,5-diene-1,2-diamine Chemical compound FC1=CC=C(C=C1)CC1(C(C=CC(=C1)OC)N)N JYFRRBLVMXNVMR-UHFFFAOYSA-N 0.000 description 1
- LKVUGEVJJZJYAU-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CN=C2N=C1 LKVUGEVJJZJYAU-UHFFFAOYSA-N 0.000 description 1
- XIBVNILZEXGMNS-UHFFFAOYSA-N 1-[(5-methylfuran-2-yl)methyl]-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound O1C(C)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCNCC1 XIBVNILZEXGMNS-UHFFFAOYSA-N 0.000 description 1
- SFDXLTOATHQSPM-UHFFFAOYSA-N 1-aminopyrimidin-4-one Chemical compound NN1C=CC(=O)N=C1 SFDXLTOATHQSPM-UHFFFAOYSA-N 0.000 description 1
- LLGDWYMFCCLVEO-UHFFFAOYSA-N 1-benzyl-2-(piperidin-4-ylmethyl)benzimidazole;hydrate Chemical compound O.N=1C2=CC=CC=C2N(CC=2C=CC=CC=2)C=1CC1CCNCC1 LLGDWYMFCCLVEO-UHFFFAOYSA-N 0.000 description 1
- HGFQUTFJGCHEGD-UHFFFAOYSA-N 1-benzyl-2-[(1-benzylpiperidin-4-yl)methyl]benzimidazole Chemical compound N=1C2=CC=CC=C2N(CC=2C=CC=CC=2)C=1CC(CC1)CCN1CC1=CC=CC=C1 HGFQUTFJGCHEGD-UHFFFAOYSA-N 0.000 description 1
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 description 1
- CRNCYCZFKVGPSI-UHFFFAOYSA-N 1-methyl-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(C)C=1CC1CCNCC1 CRNCYCZFKVGPSI-UHFFFAOYSA-N 0.000 description 1
- HJFUEWIECXZZFO-UHFFFAOYSA-N 1-phenyl-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(C=2C=CC=CC=2)C=1CC1CCNCC1 HJFUEWIECXZZFO-UHFFFAOYSA-N 0.000 description 1
- TXJUTRJFNRYTHH-UHFFFAOYSA-N 1h-3,1-benzoxazine-2,4-dione Chemical compound C1=CC=C2C(=O)OC(=O)NC2=C1 TXJUTRJFNRYTHH-UHFFFAOYSA-N 0.000 description 1
- IUMIJEMDHDWBBR-UHFFFAOYSA-N 1h-benzimidazole;hydrate;dihydrochloride Chemical compound O.Cl.Cl.C1=CC=C2NC=NC2=C1 IUMIJEMDHDWBBR-UHFFFAOYSA-N 0.000 description 1
- ZGFBTBZBNRFHRG-UHFFFAOYSA-N 2,4-bis(4-fluorophenyl)butanal Chemical compound C1=CC(F)=CC=C1CCC(C=O)C1=CC=C(F)C=C1 ZGFBTBZBNRFHRG-UHFFFAOYSA-N 0.000 description 1
- BTLKROSJMNFSQZ-UHFFFAOYSA-N 2,4-dichloro-6-methylpyrimidine Chemical compound CC1=CC(Cl)=NC(Cl)=N1 BTLKROSJMNFSQZ-UHFFFAOYSA-N 0.000 description 1
- ZKOHFVJCKMHYSL-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-yl)acetonitrile Chemical compound C1CC(CC#N)CCN1CC1=CC=CC=C1 ZKOHFVJCKMHYSL-UHFFFAOYSA-N 0.000 description 1
- WXMUZWVKOKUWJV-UHFFFAOYSA-N 2-(furan-2-ylmethyl)-1H-pyridine-2,3-diamine Chemical compound O1C(=CC=C1)CC1(NC=CC=C1N)N WXMUZWVKOKUWJV-UHFFFAOYSA-N 0.000 description 1
- KTDNXQLRLSPQOK-UHFFFAOYSA-N 2-(methylamino)benzamide Chemical compound CNC1=CC=CC=C1C(N)=O KTDNXQLRLSPQOK-UHFFFAOYSA-N 0.000 description 1
- QDMKURDIAFCTST-UHFFFAOYSA-N 2-(piperidin-4-ylmethyl)-1-(thiophen-2-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(CC=2SC=CC=2)C=1CC1CCNCC1 QDMKURDIAFCTST-UHFFFAOYSA-N 0.000 description 1
- VZDGZAMXJHVCFY-UHFFFAOYSA-N 2-(piperidin-4-ylmethyl)-3-(pyridin-2-ylmethyl)imidazo[4,5-b]pyridine Chemical compound N=1C2=CC=CN=C2N(CC=2N=CC=CC=2)C=1CC1CCNCC1 VZDGZAMXJHVCFY-UHFFFAOYSA-N 0.000 description 1
- AJKVQEKCUACUMD-UHFFFAOYSA-N 2-Acetylpyridine Chemical compound CC(=O)C1=CC=CC=N1 AJKVQEKCUACUMD-UHFFFAOYSA-N 0.000 description 1
- VOOPRZBQHPSSRX-UHFFFAOYSA-N 2-N-[(4-fluorophenyl)methyl]-3-methoxybenzene-1,2-diamine Chemical compound COC1=CC=CC(N)=C1NCC1=CC=C(F)C=C1 VOOPRZBQHPSSRX-UHFFFAOYSA-N 0.000 description 1
- SAABXBPRSFSUCE-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-(thiophen-2-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(CC=2SC=CC=2)C=1CC(CC1)CCN1CC1=CC=CC=C1 SAABXBPRSFSUCE-UHFFFAOYSA-N 0.000 description 1
- HLHFSFAVYOVENM-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-[(4-fluorophenyl)methyl]-5-methoxybenzimidazole Chemical compound C1CN(CC=2C=CC=CC=2)CCC1CC1=NC2=CC(OC)=CC=C2N1CC1=CC=C(F)C=C1 HLHFSFAVYOVENM-UHFFFAOYSA-N 0.000 description 1
- WJUPCXSIYBDCID-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-[(4-fluorophenyl)methyl]-6-methoxybenzimidazole Chemical compound C=1C=C(F)C=CC=1CN1C2=CC(OC)=CC=C2N=C1CC(CC1)CCN1CC1=CC=CC=C1 WJUPCXSIYBDCID-UHFFFAOYSA-N 0.000 description 1
- NPUILPCKMUMFTB-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-[(4-methoxyphenyl)methyl]benzimidazole Chemical compound C1=CC(OC)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CC=2C=CC=CC=2)CC1 NPUILPCKMUMFTB-UHFFFAOYSA-N 0.000 description 1
- LPHJLXZJEGMPMG-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-[(4-methylphenyl)methyl]benzimidazole Chemical compound C1=CC(C)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CC=2C=CC=CC=2)CC1 LPHJLXZJEGMPMG-UHFFFAOYSA-N 0.000 description 1
- RCMFETMXWCFPHZ-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-3-(furan-2-ylmethyl)imidazo[4,5-b]pyridine Chemical compound N=1C2=CC=CN=C2N(CC=2OC=CC=2)C=1CC(CC1)CCN1CC1=CC=CC=C1 RCMFETMXWCFPHZ-UHFFFAOYSA-N 0.000 description 1
- DUOHDZHINPIXGG-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridine Chemical compound C1=CC(F)=CC=C1CN1C2=NC=CC=C2N=C1CC1CCN(CC=2C=CC=CC=2)CC1 DUOHDZHINPIXGG-UHFFFAOYSA-N 0.000 description 1
- PHUDOFVKAXHWJD-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-3h-imidazo[4,5-c]pyridine Chemical compound N=1C2=CN=CC=C2NC=1CC(CC1)CCN1CC1=CC=CC=C1 PHUDOFVKAXHWJD-UHFFFAOYSA-N 0.000 description 1
- PVVJHMSKROBKAN-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-6-fluoro-1h-benzimidazole Chemical compound N=1C2=CC(F)=CC=C2NC=1CC(CC1)CCN1CC1=CC=CC=C1 PVVJHMSKROBKAN-UHFFFAOYSA-N 0.000 description 1
- IDRUFHLMTBZQBT-IHWYPQMZSA-N 2-[(Z)-prop-1-enyl]propanedioic acid Chemical compound C\C=C/C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-IHWYPQMZSA-N 0.000 description 1
- FHUVNAUXNAWXFE-UHFFFAOYSA-N 2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]sulfanyl-1h-benzimidazole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(SC=2NC3=CC=CC=C3N=2)CC1 FHUVNAUXNAWXFE-UHFFFAOYSA-N 0.000 description 1
- JVKRKMWZYMKVTQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical group C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JVKRKMWZYMKVTQ-UHFFFAOYSA-N 0.000 description 1
- SRVSANITKGHZCZ-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]acetamide Chemical compound C1CN(CC(=O)N)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 SRVSANITKGHZCZ-UHFFFAOYSA-N 0.000 description 1
- SBEWNQNSJGSBAE-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethanol;dihydrochloride Chemical compound Cl.Cl.C1CN(CCO)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 SBEWNQNSJGSBAE-UHFFFAOYSA-N 0.000 description 1
- XEITUHWUGXNXKM-UHFFFAOYSA-N 2-[4-[[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1CC1=NC2=CC=CN=C2N1CC1=CC=C(F)C=C1 XEITUHWUGXNXKM-UHFFFAOYSA-N 0.000 description 1
- IDGOKJYIOYABKD-UHFFFAOYSA-N 2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]-1-(2-phenylethyl)benzimidazole;hydrate;dihydrochloride Chemical compound O.Cl.Cl.C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)CCC=2C=CC=CC=2)CC1 IDGOKJYIOYABKD-UHFFFAOYSA-N 0.000 description 1
- ALDFXHFBMSOTML-UHFFFAOYSA-N 2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]-1h-benzimidazole Chemical compound C1=CC(OC)=CC=C1CCN1CCC(CC=2NC3=CC=CC=C3N=2)CC1 ALDFXHFBMSOTML-UHFFFAOYSA-N 0.000 description 1
- VXUSAQJKXJTGJA-UHFFFAOYSA-N 2-amino-n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]benzamide Chemical compound NC1=CC=CC=C1C(=O)NCCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 VXUSAQJKXJTGJA-UHFFFAOYSA-N 0.000 description 1
- ZUYVTRHDNJZYSB-UHFFFAOYSA-N 2-amino-n-[4-[4-[[1-(furan-2-ylmethyl)benzimidazol-2-yl]methyl]piperidin-1-yl]butyl]benzamide Chemical compound NC1=CC=CC=C1C(=O)NCCCCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2OC=CC=2)CC1 ZUYVTRHDNJZYSB-UHFFFAOYSA-N 0.000 description 1
- AOXRRUSFPQTGJI-UHFFFAOYSA-N 2-amino-n-[4-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]butyl]benzamide Chemical compound NC1=CC=CC=C1C(=O)NCCCCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 AOXRRUSFPQTGJI-UHFFFAOYSA-N 0.000 description 1
- JWYUFVNJZUSCSM-UHFFFAOYSA-N 2-aminobenzimidazole Chemical compound C1=CC=C2NC(N)=NC2=C1 JWYUFVNJZUSCSM-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 1
- KPHVJJMLGUIMBS-UHFFFAOYSA-N 2-chloro-n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-6-methylpyrimidin-4-amine Chemical compound ClC1=NC(C)=CC(NCCN2CCC(CC=3N(C4=CC=CC=C4N=3)CC=3C=CC(F)=CC=3)CC2)=N1 KPHVJJMLGUIMBS-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- GTJFCSACPCEZFG-UHFFFAOYSA-N 2-ethyl-2-prop-1-enylpropanedioic acid Chemical compound C(=CC)C(CC)(C(=O)O)C(=O)O GTJFCSACPCEZFG-UHFFFAOYSA-N 0.000 description 1
- WOJZNADRGUXMFB-UHFFFAOYSA-N 2-ethyl-4-hydroxypiperidine-1-carboxylic acid Chemical compound OC1CC(N(CC1)C(=O)O)CC WOJZNADRGUXMFB-UHFFFAOYSA-N 0.000 description 1
- MBKACHADOOBNCF-UHFFFAOYSA-N 2-ethyl-4-oxopiperidine-1-carboxylic acid Chemical compound CCC1CC(=O)CCN1C(O)=O MBKACHADOOBNCF-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- VYSRZETUSAOIMP-UHFFFAOYSA-N 2-furanacetic acid Chemical compound OC(=O)CC1=CC=CO1 VYSRZETUSAOIMP-UHFFFAOYSA-N 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- JDNTWHVOXJZDSN-UHFFFAOYSA-M 2-iodoacetate Chemical compound [O-]C(=O)CI JDNTWHVOXJZDSN-UHFFFAOYSA-M 0.000 description 1
- FIEYHAAMDAPVCH-UHFFFAOYSA-N 2-methyl-3H-quinazolin-4-one Natural products C1=CC=C2NC(C)=NC(=O)C2=C1 FIEYHAAMDAPVCH-UHFFFAOYSA-N 0.000 description 1
- CXCMHIHWZCWXQU-UHFFFAOYSA-N 2-methylpyridine-3,4-diamine Chemical compound CC1=NC=CC(N)=C1N CXCMHIHWZCWXQU-UHFFFAOYSA-N 0.000 description 1
- UNXVCQNTZLLICF-UHFFFAOYSA-N 2-nitro-n-(pyridin-3-ylmethyl)aniline Chemical compound [O-][N+](=O)C1=CC=CC=C1NCC1=CC=CN=C1 UNXVCQNTZLLICF-UHFFFAOYSA-N 0.000 description 1
- FHFJYPVTDZSRAS-UHFFFAOYSA-N 2-nitro-n-(thiophen-2-ylmethyl)aniline Chemical compound [O-][N+](=O)C1=CC=CC=C1NCC1=CC=CS1 FHFJYPVTDZSRAS-UHFFFAOYSA-N 0.000 description 1
- IYDUFJOXYMLYNM-UHFFFAOYSA-N 2-piperidin-1-ium-4-ylacetic acid;chloride Chemical compound [Cl-].OC(=O)CC1CC[NH2+]CC1 IYDUFJOXYMLYNM-UHFFFAOYSA-N 0.000 description 1
- VUMFRFIVUQTAPJ-UHFFFAOYSA-N 2-thiophen-2-ylethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=CS1 VUMFRFIVUQTAPJ-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- MFJXLODMXNVOMK-UHFFFAOYSA-N 3-[(4-fluorophenyl)methyl]-1h-benzimidazole-2-thione Chemical compound C1=CC(F)=CC=C1CN1C(=S)NC2=CC=CC=C21 MFJXLODMXNVOMK-UHFFFAOYSA-N 0.000 description 1
- FHLFOHCCEPYFFK-UHFFFAOYSA-N 3-bromo-n-propan-2-ylpropanamide Chemical compound CC(C)NC(=O)CCBr FHLFOHCCEPYFFK-UHFFFAOYSA-N 0.000 description 1
- IHBVNSPHKMCPST-UHFFFAOYSA-N 3-bromopropanoyl chloride Chemical compound ClC(=O)CCBr IHBVNSPHKMCPST-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- PFCHFHIRKBAQGU-UHFFFAOYSA-N 3-hexanone Chemical compound CCCC(=O)CC PFCHFHIRKBAQGU-UHFFFAOYSA-N 0.000 description 1
- ONKFTKZSASNPJY-UHFFFAOYSA-N 3-nitro-n-(pyridin-2-ylmethyl)pyridin-2-amine Chemical compound [O-][N+](=O)C1=CC=CN=C1NCC1=CC=CC=N1 ONKFTKZSASNPJY-UHFFFAOYSA-N 0.000 description 1
- PPAULTVPKLVLII-UHFFFAOYSA-N 4,5-diaminopyrimidine Chemical compound NC1=CN=CN=C1N PPAULTVPKLVLII-UHFFFAOYSA-N 0.000 description 1
- WINWBTFTKCIUQK-UHFFFAOYSA-N 4-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 WINWBTFTKCIUQK-UHFFFAOYSA-N 0.000 description 1
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 description 1
- PPJGWOQSSZLXHO-UHFFFAOYSA-N 4-[[2-(piperidin-4-ylmethyl)benzimidazol-1-yl]methyl]-1,3-thiazole;trihydrobromide Chemical compound Br.Br.Br.N=1C2=CC=CC=C2N(CC=2N=CSC=2)C=1CC1CCNCC1 PPJGWOQSSZLXHO-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- DALBEPKWEMSQJK-UHFFFAOYSA-N 4-chloro-n-[(4-fluorophenyl)methyl]-5-methoxy-2-nitroaniline Chemical compound C1=C(Cl)C(OC)=CC(NCC=2C=CC(F)=CC=2)=C1[N+]([O-])=O DALBEPKWEMSQJK-UHFFFAOYSA-N 0.000 description 1
- IRKRROKYCRSVRQ-UHFFFAOYSA-N 4-chloro-n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]phthalazin-1-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNC=2C3=CC=CC=C3C(Cl)=NN=2)CC1 IRKRROKYCRSVRQ-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XOPFQNAWQILLJH-UHFFFAOYSA-N 4-methoxy-2-nitro-n-(pyridin-2-ylmethyl)aniline Chemical compound [O-][N+](=O)C1=CC(OC)=CC=C1NCC1=CC=CC=N1 XOPFQNAWQILLJH-UHFFFAOYSA-N 0.000 description 1
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical class O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 1
- JVTDFBMRJMQHEX-UHFFFAOYSA-N 5-(2-bromoethoxy)-1-methyltetrazole Chemical compound CN1N=NN=C1OCCBr JVTDFBMRJMQHEX-UHFFFAOYSA-N 0.000 description 1
- AQIWTUYLQLQFOV-UHFFFAOYSA-N 5-chloro-n-[(4-fluorophenyl)methyl]-4-methoxy-2-nitroaniline Chemical compound C1=C(Cl)C(OC)=CC([N+]([O-])=O)=C1NCC1=CC=C(F)C=C1 AQIWTUYLQLQFOV-UHFFFAOYSA-N 0.000 description 1
- LSODVBSJEPWJKG-UHFFFAOYSA-N 6-(2-bromoethyl)-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;hydrobromide Chemical compound Br.CC1=C(CCBr)C(=O)N2C(C)=CSC2=N1 LSODVBSJEPWJKG-UHFFFAOYSA-N 0.000 description 1
- GJAQIJSYKGXEBM-UHFFFAOYSA-N 6-chloro-8,9-dimethylpurine Chemical compound N1=CN=C2N(C)C(C)=NC2=C1Cl GJAQIJSYKGXEBM-UHFFFAOYSA-N 0.000 description 1
- KJZYRUQLZCSBSC-UHFFFAOYSA-N 6-chloro-9-methyl-7h-purin-8-one Chemical compound N1=CN=C2N(C)C(O)=NC2=C1Cl KJZYRUQLZCSBSC-UHFFFAOYSA-N 0.000 description 1
- VGSDSWQWURECKH-UHFFFAOYSA-N 6-chloro-n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]pyridazin-3-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNC=2N=NC(Cl)=CC=2)CC1 VGSDSWQWURECKH-UHFFFAOYSA-N 0.000 description 1
- JPLBFZVHIRMSMJ-UHFFFAOYSA-N 6-methoxy-3-nitro-n-(pyridin-2-ylmethyl)pyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2N=CC=CC=2)=N1 JPLBFZVHIRMSMJ-UHFFFAOYSA-N 0.000 description 1
- XMCSHGFMCZMRDC-UHFFFAOYSA-N 7-(2-bromoethyl)-8-methyl-3,4-dihydro-2h-pyrimido[2,1-b][1,3]thiazin-6-one;hydrobromide Chemical compound Br.S1CCCN2C(=O)C(CCBr)=C(C)N=C21 XMCSHGFMCZMRDC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WGDBHXLDSQOLSN-UHFFFAOYSA-N 9-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-7h-purine-8-thione Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCN2C3=NC=NC=C3N=C2S)CC1 WGDBHXLDSQOLSN-UHFFFAOYSA-N 0.000 description 1
- 206010000060 Abdominal distension Diseases 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 240000000662 Anethum graveolens Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GZLYSDJGEXGQDO-UHFFFAOYSA-N C1=CC=CC2=NCNC=C21 Chemical compound C1=CC=CC2=NCNC=C21 GZLYSDJGEXGQDO-UHFFFAOYSA-N 0.000 description 1
- XKRCMBUSLODOAD-UHFFFAOYSA-N C1CN(CCC1CC2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F)CCN5CSC=C5 Chemical compound C1CN(CCC1CC2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F)CCN5CSC=C5 XKRCMBUSLODOAD-UHFFFAOYSA-N 0.000 description 1
- KVHDESGBAZJPCZ-UHFFFAOYSA-N C1CN(CCC1CC2=NC3=CC=CC=C3N2CC4=CSC=N4)C(=O)O Chemical compound C1CN(CCC1CC2=NC3=CC=CC=C3N2CC4=CSC=N4)C(=O)O KVHDESGBAZJPCZ-UHFFFAOYSA-N 0.000 description 1
- BBLZHLUQBIGBRN-UHFFFAOYSA-N C1CN(CCC1S(=O)(=O)C2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F)C(=O)O Chemical compound C1CN(CCC1S(=O)(=O)C2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F)C(=O)O BBLZHLUQBIGBRN-UHFFFAOYSA-N 0.000 description 1
- SLCPYDIGKYTCSU-UHFFFAOYSA-N COC1=CC=C(C(N1)(CC2=CC=CC=N2)N)N Chemical compound COC1=CC=C(C(N1)(CC2=CC=CC=N2)N)N SLCPYDIGKYTCSU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 206010009192 Circulatory collapse Diseases 0.000 description 1
- QGPZJNSVTZDPQL-UHFFFAOYSA-N Cl.Cl.C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)C2CCCCC2)CC1 Chemical compound Cl.Cl.C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)C2CCCCC2)CC1 QGPZJNSVTZDPQL-UHFFFAOYSA-N 0.000 description 1
- 206010010744 Conjunctivitis allergic Diseases 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 241000592718 Ibla Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- UEQUQVLFIPOEMF-UHFFFAOYSA-N Mianserin Chemical compound C1C2=CC=CC=C2N2CCN(C)CC2C2=CC=CC=C21 UEQUQVLFIPOEMF-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- JCMWSVNNSPUNER-UHFFFAOYSA-N N,O-dimethyltyramine Chemical compound CNCCC1=CC=C(OC)C=C1 JCMWSVNNSPUNER-UHFFFAOYSA-N 0.000 description 1
- 238000011887 Necropsy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KYUOLTCKUYUJAV-UHFFFAOYSA-N O.Cl.Cl.N1=CC=CC=C1 Chemical compound O.Cl.Cl.N1=CC=CC=C1 KYUOLTCKUYUJAV-UHFFFAOYSA-N 0.000 description 1
- ODRBIMZXRDKMBN-UHFFFAOYSA-N O.Cl.Cl.N1=CNC(C=C1)=O Chemical compound O.Cl.Cl.N1=CNC(C=C1)=O ODRBIMZXRDKMBN-UHFFFAOYSA-N 0.000 description 1
- 206010029897 Obsessive thoughts Diseases 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 1
- 206010052568 Urticaria chronic Diseases 0.000 description 1
- LOBIJWAJHDJYPN-UHFFFAOYSA-N [1-(4-methylphenyl)sulfonylpiperidin-4-yl] methanesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(OS(C)(=O)=O)CC1 LOBIJWAJHDJYPN-UHFFFAOYSA-N 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- 208000002205 allergic conjunctivitis Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- OYTKINVCDFNREN-UHFFFAOYSA-N amifampridine Chemical compound NC1=CC=NC=C1N OYTKINVCDFNREN-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000013011 aqueous formulation Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 208000024998 atopic conjunctivitis Diseases 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 208000024330 bloating Diseases 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 208000024376 chronic urticaria Diseases 0.000 description 1
- LXGJPDKYMJJWRB-IERUDJENSA-N cinanserin hydrochloride Chemical compound Cl.CN(C)CCCSC1=CC=CC=C1NC(=O)\C=C\C1=CC=CC=C1 LXGJPDKYMJJWRB-IERUDJENSA-N 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 229920002055 compound 48/80 Polymers 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001651 cyanato group Chemical group [*]OC#N 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 229960001140 cyproheptadine Drugs 0.000 description 1
- RAFNCPHFRHZCPS-UHFFFAOYSA-N di(imidazol-1-yl)methanethione Chemical compound C1=CN=CN1C(=S)N1C=CN=C1 RAFNCPHFRHZCPS-UHFFFAOYSA-N 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- CKQQMPJQZXIYMJ-UHFFFAOYSA-N dihydrate;dihydrochloride Chemical compound O.O.Cl.Cl CKQQMPJQZXIYMJ-UHFFFAOYSA-N 0.000 description 1
- IZCQDRVQVRENLX-UHFFFAOYSA-N dihydrate;trihydrochloride Chemical compound O.O.Cl.Cl.Cl IZCQDRVQVRENLX-UHFFFAOYSA-N 0.000 description 1
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 1
- 125000004311 dioxin-2-yl group Chemical group [H]C1=C([H])OC(*)=C([H])O1 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- LZNMXYXBVARHRL-UHFFFAOYSA-N ethyl 2-(1-benzylpiperidin-4-yl)acetate;hydrochloride Chemical compound Cl.C1CC(CC(=O)OCC)CCN1CC1=CC=CC=C1 LZNMXYXBVARHRL-UHFFFAOYSA-N 0.000 description 1
- XHFUVBWCMLLKOZ-UHFFFAOYSA-N ethyl 2-amino-1,3-thiazole-4-carboxylate Chemical compound CCOC(=O)C1=CSC(N)=N1 XHFUVBWCMLLKOZ-UHFFFAOYSA-N 0.000 description 1
- SRKHHAVOORPIJH-UHFFFAOYSA-N ethyl 4-[(1-methylbenzimidazol-2-yl)methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1CC1=NC2=CC=CC=C2N1C SRKHHAVOORPIJH-UHFFFAOYSA-N 0.000 description 1
- QABJNOSERNVHDY-UHFFFAOYSA-N ethyl 4-hydroxypiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(O)CC1 QABJNOSERNVHDY-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000027119 gastric acid secretion Effects 0.000 description 1
- 210000003736 gastrointestinal content Anatomy 0.000 description 1
- 230000007661 gastrointestinal function Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 230000002518 glial effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- JKXCZYCVHPKTPK-UHFFFAOYSA-N hydrate;trihydrochloride Chemical compound O.Cl.Cl.Cl JKXCZYCVHPKTPK-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- WZHJKEUHNJHDLS-QTGUNEKASA-N metergoline Chemical compound C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4N(C)C=C(C=34)C2)C1)C)NC(=O)OCC1=CC=CC=C1 WZHJKEUHNJHDLS-QTGUNEKASA-N 0.000 description 1
- 229960004650 metergoline Drugs 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- VPKDCDLSJZCGKE-UHFFFAOYSA-N methanediimine Chemical class N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UNXVHBOJSCWVCD-UHFFFAOYSA-N methyl 2-isothiocyanatobenzoate Chemical compound COC(=O)C1=CC=CC=C1N=C=S UNXVHBOJSCWVCD-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- ZIYVHBGGAOATLY-UHFFFAOYSA-N methylmalonic acid Chemical class OC(=O)C(C)C(O)=O ZIYVHBGGAOATLY-UHFFFAOYSA-N 0.000 description 1
- 229960001186 methysergide Drugs 0.000 description 1
- 229960003955 mianserin Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- MGCQZNBCJBRZDT-UHFFFAOYSA-N midodrine hydrochloride Chemical compound [H+].[Cl-].COC1=CC=C(OC)C(C(O)CNC(=O)CN)=C1 MGCQZNBCJBRZDT-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- VOKAHSJLXRNBJF-UHFFFAOYSA-N n'-methylbenzohydrazide Chemical compound CNNC(=O)C1=CC=CC=C1 VOKAHSJLXRNBJF-UHFFFAOYSA-N 0.000 description 1
- RJDWDKMDGAMUIT-UHFFFAOYSA-N n-(furan-2-ylmethyl)-4-methoxy-2-nitroaniline Chemical compound [O-][N+](=O)C1=CC(OC)=CC=C1NCC1=CC=CO1 RJDWDKMDGAMUIT-UHFFFAOYSA-N 0.000 description 1
- PLBIHRNOLHYOBU-UHFFFAOYSA-N n-(furan-2-ylmethyl)-5-methoxy-2-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2OC=CC=2)=C1 PLBIHRNOLHYOBU-UHFFFAOYSA-N 0.000 description 1
- YONDHNQJLWPUJY-UHFFFAOYSA-N n-(furan-2-ylmethyl)-6-methoxy-3-nitropyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2OC=CC=2)=N1 YONDHNQJLWPUJY-UHFFFAOYSA-N 0.000 description 1
- IRIZISNRAORPAW-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-2-methoxy-6-nitroaniline Chemical compound COC1=CC=CC([N+]([O-])=O)=C1NCC1=CC=C(F)C=C1 IRIZISNRAORPAW-UHFFFAOYSA-N 0.000 description 1
- VCITVZQXQXVEKR-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-3-methoxy-2-nitroaniline Chemical compound COC1=CC=CC(NCC=2C=CC(F)=CC=2)=C1[N+]([O-])=O VCITVZQXQXVEKR-UHFFFAOYSA-N 0.000 description 1
- STQSEWLCSLADTG-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-3-nitropyridin-2-amine Chemical compound [O-][N+](=O)C1=CC=CN=C1NCC1=CC=C(F)C=C1 STQSEWLCSLADTG-UHFFFAOYSA-N 0.000 description 1
- FHDSIVIBUQKOTJ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4,5-dimethoxy-2-nitroaniline Chemical compound C1=C(OC)C(OC)=CC(NCC=2C=CC(F)=CC=2)=C1[N+]([O-])=O FHDSIVIBUQKOTJ-UHFFFAOYSA-N 0.000 description 1
- HYUJUIVFNYHFPA-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4-methoxy-2-nitroaniline Chemical compound [O-][N+](=O)C1=CC(OC)=CC=C1NCC1=CC=C(F)C=C1 HYUJUIVFNYHFPA-UHFFFAOYSA-N 0.000 description 1
- YAACDZIKSHRIKU-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4-nitro-1-oxidopyridin-1-ium-3-amine Chemical compound [O-][N+](=O)C1=CC=[N+]([O-])C=C1NCC1=CC=C(F)C=C1 YAACDZIKSHRIKU-UHFFFAOYSA-N 0.000 description 1
- LLRJMQQFKMGUBC-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4-nitropyridin-3-amine Chemical compound [O-][N+](=O)C1=CC=NC=C1NCC1=CC=C(F)C=C1 LLRJMQQFKMGUBC-UHFFFAOYSA-N 0.000 description 1
- VHFFCDXROMHTOO-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-methoxy-2-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2C=CC(F)=CC=2)=C1 VHFFCDXROMHTOO-UHFFFAOYSA-N 0.000 description 1
- OCWYLVZUXCHTNO-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-6-methoxy-3-nitropyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2C=CC(F)=CC=2)=N1 OCWYLVZUXCHTNO-UHFFFAOYSA-N 0.000 description 1
- XVDHPQASEKWQQF-UHFFFAOYSA-N n-[(4-methoxyphenyl)methyl]-3-nitropyridin-2-amine Chemical compound C1=CC(OC)=CC=C1CNC1=NC=CC=C1[N+]([O-])=O XVDHPQASEKWQQF-UHFFFAOYSA-N 0.000 description 1
- JJIAYQOBGONBFJ-UHFFFAOYSA-N n-[(4-methylphenyl)methyl]-3-nitropyridin-2-amine Chemical compound C1=CC(C)=CC=C1CNC1=NC=CC=C1[N+]([O-])=O JJIAYQOBGONBFJ-UHFFFAOYSA-N 0.000 description 1
- QIBFGWUDQQXUHK-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-2-oxochromene-3-carboxamide Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNC(=O)C=2C(OC3=CC=CC=C3C=2)=O)CC1 QIBFGWUDQQXUHK-UHFFFAOYSA-N 0.000 description 1
- GYAYIJLOESHJMH-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(NCCN2CCC(CC=3N(C4=CC=CC=C4N=3)CC=3C=CC(F)=CC=3)CC2)=N1 GYAYIJLOESHJMH-UHFFFAOYSA-N 0.000 description 1
- NZHKXJBQHDSLTL-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]pyrimidin-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNC=2N=CC=CN=2)CC1 NZHKXJBQHDSLTL-UHFFFAOYSA-N 0.000 description 1
- PEHKHQLHMSVMDL-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]pyrimidin-4-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNC=2N=CN=CC=2)CC1 PEHKHQLHMSVMDL-UHFFFAOYSA-N 0.000 description 1
- GQHJIHPCOMYVRE-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]thiophene-3-carboxamide Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNC(=O)C2=CSC=C2)CC1 GQHJIHPCOMYVRE-UHFFFAOYSA-N 0.000 description 1
- UKZISJARVJCYJW-UHFFFAOYSA-N n-[2-[4-[[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]-1h-benzimidazol-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=NC=CC=C2N=C1CC1CCN(CCNC=2NC3=CC=CC=C3N=2)CC1 UKZISJARVJCYJW-UHFFFAOYSA-N 0.000 description 1
- FCJDQNPWUBKSLO-UHFFFAOYSA-N n-[2-[4-[[3-[(4-fluorophenyl)methyl]imidazo[4,5-c]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]pyrazin-2-amine Chemical compound C1=CC(F)=CC=C1CN1C2=CN=CC=C2N=C1CC1CCN(CCNC=2N=CC=NC=2)CC1 FCJDQNPWUBKSLO-UHFFFAOYSA-N 0.000 description 1
- UKKHWKNEQBGLMI-UHFFFAOYSA-N n-pyrimidin-2-ylacetamide Chemical compound CC(=O)NC1=NC=CC=N1 UKKHWKNEQBGLMI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940098462 oral drops Drugs 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- NFBAXHOPROOJAW-UHFFFAOYSA-N phenindione Chemical compound O=C1C2=CC=CC=C2C(=O)C1C1=CC=CC=C1 NFBAXHOPROOJAW-UHFFFAOYSA-N 0.000 description 1
- 229960000280 phenindione Drugs 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- AXKPFOAXAHJUAG-UHFFFAOYSA-N pipamperone Chemical compound C1CC(C(=O)N)(N2CCCCC2)CCN1CCCC(=O)C1=CC=C(F)C=C1 AXKPFOAXAHJUAG-UHFFFAOYSA-N 0.000 description 1
- 229960002776 pipamperone Drugs 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- FIADGNVRKBPQEU-UHFFFAOYSA-N pizotifen Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2CCC2=C1C=CS2 FIADGNVRKBPQEU-UHFFFAOYSA-N 0.000 description 1
- 229960004572 pizotifen Drugs 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 229960005206 pyrazinamide Drugs 0.000 description 1
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical compound NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 229940085605 saccharin sodium Drugs 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 206010040560 shock Diseases 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- DKGZKTPJOSAWFA-UHFFFAOYSA-N spiperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C(NCN2C=2C=CC=CC=2)=O)CC1 DKGZKTPJOSAWFA-UHFFFAOYSA-N 0.000 description 1
- 229950001675 spiperone Drugs 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CSRUKSZMBWRPRL-UHFFFAOYSA-N tetrazole-5-thione Chemical compound S=C1N=NN=N1 CSRUKSZMBWRPRL-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- UIUWNILCHFBLEQ-NSCUHMNNSA-N trans-pent-3-enoic acid Chemical compound C\C=C\CC(O)=O UIUWNILCHFBLEQ-NSCUHMNNSA-N 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 230000002227 vasoactive effect Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/32—Nitrogen atom
- C07D473/34—Nitrogen atom attached in position 6, e.g. adenine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US56936984A | 1984-01-09 | 1984-01-09 | |
| US67113584A | 1984-11-13 | 1984-11-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT36471A HUT36471A (en) | 1985-09-30 |
| HU200338B true HU200338B (en) | 1990-05-28 |
Family
ID=27075046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU8561A HU200338B (en) | 1984-01-09 | 1985-01-08 | Process for producing 4-square brackets open /bicyclic-heterocyclic/-methyl- and hetero square brackets closed-piperidines and pharmaceutical compositions comprising same |
Country Status (21)
| Country | Link |
|---|---|
| EP (1) | EP0151826B1 (enExample) |
| JP (1) | JPH0768240B2 (enExample) |
| KR (2) | KR870001169B1 (enExample) |
| AU (1) | AU573673B2 (enExample) |
| BG (1) | BG40965A3 (enExample) |
| CA (1) | CA1259609A (enExample) |
| DE (1) | DE3486121T2 (enExample) |
| DK (1) | DK8985A (enExample) |
| ES (1) | ES8706668A1 (enExample) |
| FI (1) | FI83867C (enExample) |
| GR (1) | GR850060B (enExample) |
| HU (1) | HU200338B (enExample) |
| IE (1) | IE59707B1 (enExample) |
| IL (1) | IL74018A (enExample) |
| MA (1) | MA20323A1 (enExample) |
| NO (1) | NO160849C (enExample) |
| NZ (1) | NZ210776A (enExample) |
| PH (1) | PH23995A (enExample) |
| PT (1) | PT79809B (enExample) |
| RO (1) | RO90622A (enExample) |
| ZW (1) | ZW485A1 (enExample) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0144101B1 (en) * | 1983-11-30 | 1991-02-06 | Janssen Pharmaceutica N.V. | Bicyclic heterocyclyl containing n-(bicyclic heterocyclyl)-4-piperidinamines |
| US4588722A (en) * | 1984-01-09 | 1986-05-13 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives |
| CA1260474A (en) * | 1984-12-03 | 1989-09-26 | Raymond A. Stokbroekx | Benzoxazol- and benzothiazolamine derivatives |
| US4804663A (en) * | 1985-03-27 | 1989-02-14 | Janssen Pharmaceutica N.V. | 3-piperidinyl-substituted 1,2-benzisoxazoles and 1,2-benzisothiazoles |
| KR930005004B1 (ko) * | 1985-04-15 | 1993-06-11 | 쟈안센 파아마슈우티카 엔. 부이. | 치환된 n-[(4-피페리디닐)알킬]이환 축합 옥사졸아민 및 티아졸아민의 제조방법 |
| GB8515934D0 (en) * | 1985-06-24 | 1985-07-24 | Janssen Pharmaceutica Nv | (4-piperidinomethyl and-hetero)purines |
| FR2587029B1 (fr) * | 1985-09-11 | 1987-10-30 | Synthelabo | Derives de benzimidazole, leur preparation et leur application en therapeutique |
| KR950001015B1 (ko) * | 1986-01-10 | 1995-02-07 | 닛뽕 케미화 가부시끼가이샤 | 술폭시드 유도체의 제조방법 |
| CA1327579C (en) * | 1986-02-03 | 1994-03-08 | Frans Eduard Janssens | Anti-histaminic compositions containing n-heterocyclyl-4-piperidinamines |
| NZ223654A (en) * | 1987-03-09 | 1990-03-27 | Janssen Pharmaceutica Nv | 1-alkyl-substituted-benzimidazole-4-piperidinamines and pharmaceutical compositions |
| US4943580A (en) * | 1987-03-09 | 1990-07-24 | Janssen Pharmaceutica N.V. | Anti-histaminic benzimidazole, imidazopyridine and purine derivatives |
| CA1317939C (en) * | 1987-07-01 | 1993-05-18 | Janssen Pharmaceutica Naamloze Vennootschap | ¬(bicyclic heterocyclyl)methyl and -hetero| substituted hexahydro-1h-azepines and pyrrolidines |
| GB8716313D0 (en) * | 1987-07-10 | 1987-08-19 | Janssen Pharmaceutica Nv | 2-(heterocyclylalkyl)imidazopyridines |
| US4908372A (en) * | 1988-10-13 | 1990-03-13 | Merrell Dow Pharmaceuticals Inc. | Antihistaminic piperidinyl benzimidazoles |
| GB8900380D0 (en) * | 1989-01-09 | 1989-03-08 | Janssen Pharmaceutica Nv | 2-aminopyrimidinone derivatives |
| PH30434A (en) * | 1989-04-07 | 1997-05-09 | Janssen Pharmaceutica Nv | Hydroxyalkylfuranyl derivatives |
| IT1229230B (it) * | 1989-05-08 | 1991-07-26 | Dompe Farmaceutici Spa | Piperidinilimidazopiridine farmacologicamente attive. |
| JP2679745B2 (ja) * | 1989-06-29 | 1997-11-19 | 明治製菓株式会社 | アゾール誘導体及びそれらを有効成分とする抗潰瘍剤 |
| US5200407A (en) * | 1989-06-29 | 1993-04-06 | Meiji Seika Kaburhiki Kaisha | Azole derivatives and anti-ulcerative composition containing same |
| CA2022451C (en) * | 1989-08-03 | 2001-01-23 | Albert Anthony Carr | Anti-psychotic piperidynl benzimidazole compounds |
| GB9000305D0 (en) * | 1990-01-06 | 1990-03-07 | Pfizer Ltd | Anticholinergic agents |
| US5217980A (en) * | 1990-07-19 | 1993-06-08 | Janssen Pharmaceutica N.V. | Oxazolyl and piperidinyl substituted benimidazolyl compounds |
| KR100190299B1 (ko) * | 1990-07-19 | 1999-06-01 | 디르크 반테 | 신규한 옥사졸릴 유도체 |
| WO1992006086A1 (en) * | 1990-10-01 | 1992-04-16 | Janssen Pharmaceutica N.V. | Novel 4-piperidinylcarbonyl derivatives |
| FI932687L (fi) * | 1990-12-14 | 1993-06-11 | Merrell Dow Pharma | Antiallergiska foereningar |
| AU3347493A (en) * | 1992-01-09 | 1993-08-03 | Janssen Pharmaceutica N.V. | Pharmaceutically active substituted benzimidazole derivatives |
| WO1993016081A1 (en) * | 1992-02-13 | 1993-08-19 | Merrell Dow Pharmaceuticals Inc. | Piperidinyl thiacyclic derivatives |
| CA2091204C (en) * | 1992-03-11 | 1997-04-08 | Ronald J. Mattson | Antiischemic-piperazinyl and piperidinyl-cyclohexanes |
| ES2048109B1 (es) * | 1992-07-20 | 1994-12-16 | Espanola Prod Quimicos | Procedimiento de preparacion de nuevos derivados piperidicos del bencimidazol. |
| JPH08508030A (ja) * | 1993-03-18 | 1996-08-27 | メルク シヤープ エンド ドーム リミテツド | ベンゾイミダゾール誘導体 |
| US5521183A (en) * | 1994-08-30 | 1996-05-28 | Allergan | Use of 5-HT ligands as anti-pruritic agents |
| TW429256B (en) * | 1995-12-27 | 2001-04-11 | Janssen Pharmaceutica Nv | 1-(1,2-disubstituted piperidinyl)-4-(benzimidazolyl- and imidazopyridinyl)-piperidine derivatives |
| TR200002567T2 (tr) * | 1998-03-06 | 2000-11-21 | Janssen Pharmaceutica N.V. | Glisin naklini önleyiciler. |
| ATE258928T1 (de) | 1999-06-28 | 2004-02-15 | Janssen Pharmaceutica Nv | Respiratorisches syncytialvirus replikation inhibitoren |
| EP1418175A1 (en) | 1999-06-28 | 2004-05-12 | Janssen Pharmaceutica N.V. | Respiratory syncytial virus replication inhibitors |
| EP1400519B1 (en) * | 1999-06-28 | 2007-03-07 | Janssen Pharmaceutica N.V. | Respiratory syncytial virus replication inhibitors |
| TWI225488B (en) * | 1999-12-21 | 2004-12-21 | Janssen Pharmaceutica Nv | Derivatives of homopiperidinyl substituted benzimidazole analogues |
| AR033517A1 (es) | 2000-04-08 | 2003-12-26 | Astrazeneca Ab | Derivados de piperidina, proceso para su preparacion y uso de estos derivados en la fabricacion de medicamentos |
| EE05643B1 (et) * | 2001-02-24 | 2013-04-15 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Ksantiini derivaadid, nende valmistamine ja kasutamine ravimina |
| US7030150B2 (en) | 2001-05-11 | 2006-04-18 | Trimeris, Inc. | Benzimidazole compounds and antiviral uses thereof |
| EP1604982A1 (en) | 2001-07-02 | 2005-12-14 | AstraZeneca AB | Intermediates for the preparation of piperidine derivatives useful as modulators of chemokine receptor activity |
| US6530660B1 (en) | 2001-08-16 | 2003-03-11 | Contour Optik, Inc. | Eyeglass frame with a reversible arm |
| GB0120461D0 (en) | 2001-08-22 | 2001-10-17 | Astrazeneca Ab | Novel compounds |
| GB0122503D0 (en) | 2001-09-18 | 2001-11-07 | Astrazeneca Ab | Chemical compounds |
| EP1465635A4 (en) * | 2002-01-10 | 2005-04-13 | Neurogen Corp | MELANIN-CONCENTRATING HORMONIC RECEPTOR LIGANDS: SUBSTITUTED 2- (4-BENZYL-PIPERAZIN-1-YLMETHYL) AND 2- (4-BENZYL-DIAZEPAN-1-YLMETHYL) -1H-BENZOIMIDAZOLE ANALOGUES |
| SE0200844D0 (sv) | 2002-03-19 | 2002-03-19 | Astrazeneca Ab | Chemical compounds |
| SE0200843D0 (sv) | 2002-03-19 | 2002-03-19 | Astrazeneca Ab | Chemical compounds |
| US6939877B2 (en) | 2002-09-12 | 2005-09-06 | Wyeth | Antidepressant piperidine derivatives of heterocycle-fused benzodioxans |
| AU2004209522A1 (en) * | 2003-01-17 | 2004-08-19 | Gilead Palo Alto, Inc. | Substituted heterocyclic compounds useful in the treatment of cardiovascular diseases |
| SE0300957D0 (sv) | 2003-04-01 | 2003-04-01 | Astrazeneca Ab | Chemical compounds |
| KR100640783B1 (ko) | 2004-10-30 | 2006-11-01 | 주식회사 하이닉스반도체 | 노이즈를 줄일 수 있는 데이터 출력 드라이버 |
| DE602006016244D1 (de) | 2005-03-08 | 2010-09-30 | Janssen Pharmaceutica Nv | Diazaspiro-ä4,4ü-nonanderivate als neurokinin-(nk1)-antagonisten |
| BRPI0613563A2 (pt) | 2005-07-21 | 2012-01-17 | Astrazeneca Ab | novos derivados de piperidina |
| ATE525370T1 (de) * | 2007-10-11 | 2011-10-15 | Glaxo Group Ltd | Phthalazin- und pyridoä3,4- düpyridazinverbindungen als h1-rezeptor- antagonisten |
| AU2010360038B2 (en) | 2010-09-02 | 2014-05-15 | Suven Life Sciences Limited | Heterocyclyl compounds as Histamine H3 receptor ligands |
| US10913736B2 (en) * | 2014-08-22 | 2021-02-09 | University Of Washington | Specific inhibitors of methionyl-tRNA synthetase |
| JP2018525350A (ja) | 2015-07-02 | 2018-09-06 | ホライズン オルファン エルエルシー | Ado耐性システアミン類似体およびその使用 |
| WO2017207340A1 (de) * | 2016-05-31 | 2017-12-07 | Bayer Pharma Aktiengesellschaft | Neue substituierte benzimidazole, verfahren zu ihrer herstellung, pharmazeutische präparate die diese enthalten, sowie deren verwendung zur herstellung von arzneimitteln |
| GB2585700A (en) | 2019-07-12 | 2021-01-20 | Hire Torque Ltd | Hydraulic torque wrench and control system for a hydraulic torque wrench |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2857391A (en) * | 1955-04-15 | 1958-10-21 | Merck & Co Inc | Aminomethylbenzimidazoles |
| GB1260857A (en) * | 1968-07-10 | 1972-01-19 | Hexachimie | IMIDAZO-3H-(4,5-b)-PYRIDINE DERIVATIVES |
| DE2334009A1 (de) * | 1973-07-04 | 1975-01-23 | Boehringer Mannheim Gmbh | Purin-derivate sowie verfahren zu ihrer herstellung |
| SE416649B (sv) * | 1974-05-16 | 1981-01-26 | Haessle Ab | Forfarande for framstellning av foreningar som paverkar magsyrasekretionen |
| US4219559A (en) * | 1979-01-10 | 1980-08-26 | Janssen Pharmaceutica N.V. | N-Heterocyclyl-4-piperidinamines |
| US4335127A (en) * | 1979-01-08 | 1982-06-15 | Janssen Pharmaceutica, N.V. | Piperidinylalkyl quinazoline compounds, composition and method of use |
| US4342870A (en) * | 1980-03-28 | 1982-08-03 | Janssen Pharmaceutica N.V. | Novel 3-(1-piperidinylalkyl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives |
| PL129612B1 (en) * | 1980-07-24 | 1984-05-31 | Rhone Poulenc Ind | Process for preparing novel derivatives of 2,3,6,7-tetrahydrothiazole/3,2-a/pirymidin-5-one |
| US4443451A (en) * | 1981-07-15 | 1984-04-17 | Janssen Pharmaceutica N.V. | Bicyclic pyrimidin-5-one derivatives |
| US4634704A (en) * | 1983-10-06 | 1987-01-06 | Janssen Pharmaceutica, N.V. | Anti-allergic five membered heterocyclic ring containing N-(bicyclic heterocycyl)-4-piperidinamines |
| EP0144101B1 (en) * | 1983-11-30 | 1991-02-06 | Janssen Pharmaceutica N.V. | Bicyclic heterocyclyl containing n-(bicyclic heterocyclyl)-4-piperidinamines |
| US4588722A (en) * | 1984-01-09 | 1986-05-13 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives |
-
1984
- 1984-11-16 PH PH31450A patent/PH23995A/en unknown
- 1984-12-13 KR KR1019840007901A patent/KR870001169B1/ko not_active Expired
- 1984-12-13 EP EP84201851A patent/EP0151826B1/en not_active Expired - Lifetime
- 1984-12-13 DE DE8484201851T patent/DE3486121T2/de not_active Expired - Fee Related
- 1984-12-31 ES ES539281A patent/ES8706668A1/es not_active Expired
-
1985
- 1985-01-07 CA CA000471589A patent/CA1259609A/en not_active Expired
- 1985-01-07 NZ NZ210776A patent/NZ210776A/en unknown
- 1985-01-07 AU AU37364/85A patent/AU573673B2/en not_active Ceased
- 1985-01-08 PT PT79809A patent/PT79809B/pt not_active IP Right Cessation
- 1985-01-08 DK DK8985A patent/DK8985A/da not_active Application Discontinuation
- 1985-01-08 MA MA20547A patent/MA20323A1/fr unknown
- 1985-01-08 ZW ZW4/85A patent/ZW485A1/xx unknown
- 1985-01-08 NO NO850085A patent/NO160849C/no unknown
- 1985-01-08 JP JP60000479A patent/JPH0768240B2/ja not_active Expired - Lifetime
- 1985-01-08 RO RO85117252A patent/RO90622A/ro unknown
- 1985-01-08 FI FI850079A patent/FI83867C/fi not_active IP Right Cessation
- 1985-01-08 IL IL74018A patent/IL74018A/xx unknown
- 1985-01-08 IE IE4285A patent/IE59707B1/en not_active IP Right Cessation
- 1985-01-08 HU HU8561A patent/HU200338B/hu not_active IP Right Cessation
- 1985-01-09 BG BG068329A patent/BG40965A3/xx unknown
- 1985-01-09 GR GR850060A patent/GR850060B/el unknown
-
1987
- 1987-08-13 KR KR1019870008895A patent/KR900001545B1/ko not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR870001169B1 (ko) | 4-[(두고리 헤테로시클릴)-메틸 및 -헤테로] 피페리딘 유도체의 제조방법 | |
| US4695575A (en) | 4-[(bicycle heterocyclyl)-methyl and -hetero]-piperidines | |
| US4556660A (en) | N-(Bicyclic heterocyclyl)-4-piperidinamines | |
| US5258380A (en) | (4-piperidinylmethyl and -hetero)purines | |
| US5041448A (en) | (4-piperidinylmethyl and -hetero) purines | |
| EP0151824B1 (en) | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives | |
| EP0144101B1 (en) | Bicyclic heterocyclyl containing n-(bicyclic heterocyclyl)-4-piperidinamines | |
| JP3085707B2 (ja) | 新規な置換チアゾリル及び置換ピリジニル誘導体 | |
| CZ279344B6 (cs) | Nové oxazolylderiváty, způsob jejich výroby a antialergické přípravky na jejich bázi | |
| US4695569A (en) | Bicyclic heterocyclyl containing N-(bicyclic heterocyclyl)-4-piperidinamines | |
| EP0393738B1 (en) | Hydroxyalkylfuranyl derivatives | |
| US4839374A (en) | 4-((Bicyclic heterocyclyl)-methyl and -hetero)-piperidines | |
| US5360807A (en) | Substituted thiazolyl and substituted pyridinyl derivatives | |
| US4943580A (en) | Anti-histaminic benzimidazole, imidazopyridine and purine derivatives | |
| US5126339A (en) | Anti-allergic bicyclic heterocyclyl-containing N-(bicyclic heterocyclyl)-4-piperidinamines | |
| USRE33833E (en) | Novel N-(bicyclic heterocyclyl)-4-piperidinamines | |
| US5025014A (en) | Bicyclic heterocyclyl containing N-(bicyclic heterocyclyl)-4-piperidinamines as pharmaceuticals | |
| US4888426A (en) | 1-(5-methyl-furan-2-ylmethyl)-N-(4-piperidinyl)imidazo [4,5-6]pyridine-2-amine | |
| US4820822A (en) | Novel N-(bicyclic heterocyclyl)-4-piperidinamines | |
| US4760074A (en) | Novel-N-(bicyclic heterocyclyl)-4-piperidinamines | |
| KR880000247B1 (ko) | 4-[(두고리 헤테로시클릴)-메틸 및-헤테로] 피페리딘 유도체의 제조방법 | |
| CZ16485A3 (cs) | Způsob přípravy 4-/(bicyklyl heterocyklyl) methyl a hetero/-piperidinů | |
| PH26643A (en) | Bicyclic heterocyclic containing N-(bicyclic hetero-cyclyl)-4-piperidinamines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |