GB1399086A - Cephalosporin compounds - Google Patents
Cephalosporin compoundsInfo
- Publication number
- GB1399086A GB1399086A GB1508271A GB1508271A GB1399086A GB 1399086 A GB1399086 A GB 1399086A GB 1508271 A GB1508271 A GB 1508271A GB 1508271 A GB1508271 A GB 1508271A GB 1399086 A GB1399086 A GB 1399086A
- Authority
- GB
- United Kingdom
- Prior art keywords
- syn
- group
- compounds
- anti isomers
- organic group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title abstract 2
- -1 Cephalosporin compounds Chemical class 0.000 title abstract 2
- 229940124587 cephalosporin Drugs 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 150000002148 esters Chemical class 0.000 abstract 2
- 125000000962 organic group Chemical group 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 abstract 2
- GSSHOWKSLFTGFK-KGMSYRRLSA-N (6R)-7-isocyanato-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylic acid Chemical compound N(=C=O)C1[C@@H]2N(C=CC(S2)C(=O)O)C1=O GSSHOWKSLFTGFK-KGMSYRRLSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000005518 carboxamido group Chemical group 0.000 abstract 1
- 150000001735 carboxylic acids Chemical class 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- 238000000926 separation method Methods 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/14—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (68)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB1508271A GB1399086A (en) | 1971-05-14 | 1971-05-14 | Cephalosporin compounds |
DK237372A DK155187C (da) | 1971-05-14 | 1972-05-12 | Analogifremgangsmaade til fremstilling af cephalosporinforbindelser i den syn-isomere form eller ugiftige salte deraf |
BE783449A BE783449A (fr) | 1971-05-14 | 1972-05-12 | Perfectionnements relatifs aux antibiotiques |
IL39428A IL39428A (en) | 1971-05-14 | 1972-05-12 | Alpha-(etherified oximino) acylamino-penicillanic acid derivatives |
ZA723223A ZA723223B (en) | 1971-05-14 | 1972-05-12 | Improvements in or relating to antibiotics |
CA141,963A CA1027933A (en) | 1971-05-14 | 1972-05-12 | PREPARATION OF 6.beta.-(2-SUBSTITUTED OXYIMINO-2-SUBSTITUTED ACETAMIDO)-2,2-DIMETHYL-PENAM-3.alpha.-CARBOXYLIC ACIDS |
BE783448A BE783448A (fr) | 1971-05-14 | 1972-05-12 | Perfectionnements relatifs aux antibiotiques |
DE2265234A DE2265234C2 (de) | 1971-05-14 | 1972-05-12 | Zwischenprodukt für Antibiotika der Cephalosporinreihe, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung |
CS72839A CS245754B2 (en) | 1971-05-14 | 1972-05-12 | Production method of 7beta-acylamido-3-cefem-4-carboxyl acids |
ZA723224A ZA723224B (en) | 1971-05-14 | 1972-05-12 | Improvements in or relating to antibiotics |
NL7206466A NL7206466A (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-12 | |
HU72GA00001095A HU172017B (hu) | 1971-05-14 | 1972-05-12 | Sposob poluchenija 7-beta-skobka-al'fa-oksiimino-skobka zakryta-acilamido-cef-3-em-4-karbonovykh kislot, zamehhennykh efirom v pozicii oksiimino-gruppa |
NO721705A NO154797C (no) | 1971-05-14 | 1972-05-12 | Analogifremgangsmaate for fremstilling av cefalosporinforbindelser i den syn-isomere form eller ugiftige salter derav |
CH705972A CH591497A5 (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-12 | |
JP47047149A JPS5248997B1 (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-12 | |
JP4714872A JPS531280B1 (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-12 | |
DE2223375A DE2223375C2 (de) | 1971-05-14 | 1972-05-12 | 7β-(α-substit. Hydroxyiminoheteroarylacetamido)-cephalosporine und Verfahren zu ihrer Herstellung |
IE645/72A IE37782B1 (en) | 1971-05-14 | 1972-05-12 | Penicillin compounds |
IE644/72A IE38172B1 (en) | 1971-05-14 | 1972-05-12 | Cephalosporin compounds |
ES402650A ES402650A1 (es) | 1971-05-14 | 1972-05-12 | Procedimiento para la preparacion de derivados de la peni- cilina. |
DE19722223287 DE2223287A1 (de) | 1971-05-14 | 1972-05-12 | Antibiotika und Verfahren zu ihrer Herstellung |
CA141,965A CA1027554A (en) | 1971-05-14 | 1972-05-12 | PREPARATION OF 7.beta.-(.alpha.-ETHERIFIED OXIMINO) ACYLAMIDO-CEPH-3-EM-4-CARBOXYLIC ACIDS |
ES402651A ES402651A1 (es) | 1971-05-14 | 1972-05-12 | Procedimiento para la preparacion de derivados de la cefa- losperina. |
CY971A CY971A (en) | 1971-05-14 | 1972-05-12 | Cephalosporin compounds |
IL39429A IL39429A (en) | 1971-05-14 | 1972-05-12 | (etherified oximino)acylamido chephalosporanic acid derivatives |
NLAANVRAGE7206403,A NL166688C (nl) | 1971-05-14 | 1972-05-12 | Werkwijze voor het bereiden van een therapeutisch preparaat met anti-biotische werking, gevormd voortbrengsel, alsmede werkwijze voor het bereiden van een daarvoor geschikte 2-ether van een (6r,7r)-3-gesubstitueerde 7-(2-heteroaryl-2-hydroxyiminoacetamido)cef -3-em-4-carbonzuurverbinding. |
SE7206296A SE457795B (sv) | 1971-05-14 | 1972-05-12 | Analogifoerfarande foer framstaellning av 7-/alfa-oximino-acylamido/-3-cefem-4-karboxyl-syror |
CS723209A CS245753B2 (en) | 1971-05-14 | 1972-05-12 | Production method of 7 beta-acylamido-3-cefem-4-carboxyle acids |
PL1972155354A PL101031B1 (pl) | 1971-05-14 | 1972-05-12 | Sposob wytwarzania nowych pochodnych cefalosporyny |
CH705872A CH579571A5 (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-12 | |
YU1267/72A YU41807B (en) | 1971-05-14 | 1972-05-12 | Improved process for obtaining antibiotics |
FR7217284A FR2137900B1 (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-15 | |
AU42299/72A AU475444B2 (en) | 1971-05-14 | 1972-05-15 | Cephalosporin antibiotics |
FR7217283A FR2137899B1 (enrdf_load_stackoverflow) | 1971-05-14 | 1972-05-15 | |
FR7217282A FR2137898A1 (en) | 1971-05-14 | 1972-05-15 | Alpha-oximino-penicillins - with antibacterial activity |
MX484872U MX5109E (es) | 1971-05-14 | 1972-05-15 | Procedimiento para la preparacion de antibioticos de la serie de cefalosporina |
AU42298/72A AU474163B2 (en) | 1971-05-14 | 1972-05-15 | 6b-ACYLAMIDOPENAM-3A-CARBOXYLIC ACIDS |
AT420872A AT336786B (de) | 1971-05-14 | 1972-05-15 | Verfahren zur herstellung von neuen cephalosporinderivaten |
AT420772A AT329176B (de) | 1971-05-14 | 1972-05-15 | Verfahren zur herstellung von neuen penicillinen |
US05/304,501 US3932385A (en) | 1971-05-14 | 1972-11-07 | Penicillins having a 6β-(α-etherified oximino) acylamido group |
PH14070A PH13762A (en) | 1971-05-14 | 1972-11-10 | 7 beta-acylamido-ceph-3-em-4-carboxylic acid derivatives |
US05/413,970 US3966717A (en) | 1971-05-14 | 1973-11-08 | 7-β-Acylamido-3-carbamoyloxymethylceph-3-em-4-carboxylic acids and salts thereof |
US05/497,113 US3974153A (en) | 1971-05-14 | 1974-08-13 | 7-Hydrocarbonoxy imino-acetamido-3-carbamoyloxy methylceph-3-em-4 carboxylic acids |
PH16206A PH11205A (en) | 1971-05-14 | 1974-08-23 | (6r,7r)-7-(2-aryl-2-etherified oximino acetamido)-3carbamoyloxymethylceph-3-em-4carboxylic acids and pharmaceutical composition thereof |
ES430104A ES430104A1 (es) | 1971-05-14 | 1974-09-16 | Procedimiento para la preparacion de derivados de la cefa- losporina. |
AT82575A AT348672B (de) | 1971-05-14 | 1975-02-04 | Verfahren zur herstellung von neuen cephalosporinderivaten |
US05/587,064 US4024133A (en) | 1971-05-14 | 1975-06-16 | 7β-[2-Etherified oximino-2-(thienyl-,furyl- or pyridylacetamido)]cephalosporins |
US05/587,065 US4024137A (en) | 1971-05-14 | 1975-06-16 | 7β-[2-Etherified oximino-2-(phenyl- or naphthylacetamido)] cephalosporins |
BE159206A BE832435R (fr) | 1971-05-14 | 1975-08-14 | Perfectionnements relatifs aux antibiotiques |
US05/618,167 US4017515A (en) | 1971-05-14 | 1975-09-30 | α-(Etherified oximino) carboxylic acids and acid chlorides |
US05/627,905 US3975376A (en) | 1971-05-14 | 1975-10-31 | Pencillins having a 6β-(α-etherified oximino) acylamido group |
FR7537636A FR2287231A1 (fr) | 1971-05-14 | 1975-12-09 | Acides a (oximino etherifie) carboxyliques et leurs derives |
US05/642,304 US4079178A (en) | 1971-05-14 | 1975-12-19 | Cephalosporins having (α-etherified oximino) acylamido groups at the 7-position |
US05/668,247 US4064346A (en) | 1971-05-14 | 1976-03-18 | 3-Acetoxymethyl-7β-(2-carboxy-methoxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
US05/669,818 US4033950A (en) | 1971-05-14 | 1976-03-24 | 3-Hydroxymethyl-7β-(2-alkoxy-or benzyloxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
US05/762,943 US4092477A (en) | 1971-05-14 | 1977-01-26 | 7β-[2-Etherified oximino-2-(phenyl- or naphthylacetamido)] cephalosporins |
US05/762,942 US4091209A (en) | 1971-05-14 | 1977-01-26 | 7β-[2-Etherified oximino-2-(phenyl or naphthylacetamido)]cephalosporins having a 2-haloalkylcarbamoyloxymethyl group at the 3-position |
US05/762,927 US4093803A (en) | 1971-05-14 | 1977-01-26 | 7β-[2-Etherified oximino-2-(thienyl-, furyl- or pyridylacetamido)] cephalosporins |
JP7426977A JPS5328141A (en) | 1971-05-14 | 1977-06-22 | Production of novel carboxylic acid |
US05/852,808 US4138555A (en) | 1971-05-14 | 1977-11-18 | (6R,7R)-7-[2-aryl-2-(etherified oximino)acetamido]-3-carbamoyloxymethylceph-3-em-4-carboxylic acid 1-oxides |
AT851477A AT358730B (de) | 1971-05-14 | 1977-11-28 | Verfahren zur herstellung von neuen cephalos- porinderivaten |
AT851577A AT353966B (de) | 1971-05-14 | 1977-11-28 | Verfahren zur herstellung von neuen cephalos- porinderivaten |
KE2895A KE2895A (en) | 1971-05-14 | 1978-10-19 | Cephalosporin compounds |
HK660/78A HK66078A (en) | 1971-05-14 | 1978-11-16 | Cephalosporin compounds |
MY466/78A MY7800466A (en) | 1971-05-14 | 1978-12-30 | Cephalosporin compounds |
JP2128779A JPS54135792A (en) | 1971-05-14 | 1979-02-24 | Manufacture of cephalosporin compound |
NLAANVRAGE7905299,A NL177020C (nl) | 1971-05-14 | 1979-07-06 | Werkwijze voor het bereiden van een therapeutisch preparaat met antibiotische werking, therapeutisch voorwerp, alsmede werkwijze voor het bereiden van een daarvoor geschikte ether van een (6r, 7r)-3-gesubstitueerde 7-(2-heteroaryl-2-hydroxy-imino-aceetamido) cef-3-em-4-carbonzuurverbinding. |
YU03213/79A YU321379A (en) | 1971-05-14 | 1979-12-28 | Improved process for obtaining antibiotics |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB1508271A GB1399086A (en) | 1971-05-14 | 1971-05-14 | Cephalosporin compounds |
GB4588471 | 1971-10-01 |
Publications (1)
Publication Number | Publication Date |
---|---|
GB1399086A true GB1399086A (en) | 1975-06-25 |
Family
ID=26251025
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
GB1508271A Expired GB1399086A (en) | 1971-05-14 | 1971-05-14 | Cephalosporin compounds |
Country Status (22)
Cited By (36)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0007470A3 (en) * | 1978-07-10 | 1980-04-16 | Fujisawa Pharmaceutical Co. Ltd. | Cephem compounds, processes for their preparation, pharmaceutical compositions containing them and their starting compounds |
FR2464960A1 (fr) * | 1979-09-10 | 1981-03-20 | Glaxo Group Ltd | Nouvelle forme non hygroscopique d'une cephalosporine sodique, son procede de preparation et son application en therapeutique |
US4258041A (en) | 1978-05-26 | 1981-03-24 | Glaxo Group Limited | (6R,7R)-7-[(Z)-2-(2-Aminothiazol-4-yl)-2-(2-carboxyprop-2-oxyimino)acetamido]-3-(1-pyridiniummethyl)-ceph-3-em-4-carboxylate and salts thereof |
US4394503A (en) | 1981-12-07 | 1983-07-19 | Bristol-Myers Company | Cephalosporin derivatives |
US4406899A (en) | 1982-03-04 | 1983-09-27 | Bristol-Myers Company | Cephalosporins |
EP0097961A2 (en) | 1982-06-28 | 1984-01-11 | Bristol-Myers Company | Cephalosporin derivatives, a process for the manufacture thereof and pharmaceutical compositions containing said derivatives |
US4457929A (en) * | 1982-03-29 | 1984-07-03 | Bristol-Myers Company | 3-Quaternary ammonium methyl)-substituted cephalosporin derivatives |
US4464368A (en) * | 1978-11-15 | 1984-08-07 | Glaxo Group Limited | Cephalosporin antibiotics |
US4474954A (en) * | 1981-12-07 | 1984-10-02 | Bristol-Myers Company | Intermediates for cephalosporin derivatives |
GB2137996A (en) * | 1983-04-12 | 1984-10-17 | Lilly Co Eli | Benzothienylglycyl cephalosporin derivatives |
GB2137995A (en) * | 1983-04-12 | 1984-10-17 | Lilly Co Eli | Benzothienylglycyl cephalosporin derivatives |
US4486586A (en) * | 1983-02-10 | 1984-12-04 | Bristol-Myers Company | Cephalosporin derivatives |
US4500526A (en) * | 1982-06-28 | 1985-02-19 | Bristol-Myers Company | Cephalosporin derivatives |
US4503234A (en) * | 1980-07-24 | 1985-03-05 | Lonza Ltd. | Production of 2-(2-aminothiazole-4-yl)-2-(syn)-methoxyimino acetic esters |
US4521413A (en) * | 1981-09-14 | 1985-06-04 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US4525473A (en) * | 1983-03-30 | 1985-06-25 | Bristol-Myers Company | Cephalosporins |
US4598154A (en) * | 1982-08-07 | 1986-07-01 | Tanabe Seiyaku Co., Ltd. | Thiazole intermediates for cephalosporin compounds |
US4677100A (en) * | 1984-12-27 | 1987-06-30 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4708955A (en) * | 1985-06-24 | 1987-11-24 | Bristol-Myers Company | 3-(substituted)propenyl-7-aminothiazol-ylcephalosporanic acids and esters thereof |
US4814328A (en) * | 1986-03-19 | 1989-03-21 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives, and antibacterial agents |
US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4866055A (en) * | 1986-11-25 | 1989-09-12 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives and their crystalline derivatives |
US4868173A (en) * | 1984-11-20 | 1989-09-19 | Ici Pharma | Cephalosporin derivatives |
US4874856A (en) * | 1985-06-24 | 1989-10-17 | Bristol-Myers Company | 3-(substituted)propenyl-7-(aminothiazolylacetamido) ceph-3-em-4-carboxylic acids and esters thereof |
US4880798A (en) * | 1986-11-25 | 1989-11-14 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4888332A (en) * | 1983-12-29 | 1989-12-19 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
EP0164944B1 (en) * | 1984-05-30 | 1990-07-11 | Imperial Chemical Industries Plc | Cephalosporin derivatives |
US4971962A (en) * | 1988-05-11 | 1990-11-20 | Lucky, Ltd. | Cephalosporin compounds |
US5008258A (en) * | 1987-07-23 | 1991-04-16 | I.C.I.-Pharma | Cephalosporin derivatives |
US5013730A (en) * | 1987-07-23 | 1991-05-07 | Ici-Pharma | Cephem derivatives |
US5017569A (en) * | 1986-11-12 | 1991-05-21 | Ici Pharma | Cephalosporin derivatives |
US5057511A (en) * | 1986-12-23 | 1991-10-15 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
US5064953A (en) * | 1983-12-29 | 1991-11-12 | Mochida Pharmaceutical Co., Ltd. | Intermediates cephalosporin derivatives |
US5189157A (en) * | 1987-06-16 | 1993-02-23 | Hoffmann La Roche Inc. | Antibacterial cephalosporin compounds |
US5202315A (en) * | 1989-05-11 | 1993-04-13 | Lucky, Ltd. | Cephalosporin compounds |
US5412093A (en) * | 1986-12-23 | 1995-05-02 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
Families Citing this family (85)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4064346A (en) * | 1971-05-14 | 1977-12-20 | Glaxo Laboratories Limited | 3-Acetoxymethyl-7β-(2-carboxy-methoxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
US4138555A (en) | 1971-05-14 | 1979-02-06 | Glaxo Laboratories, Limited | (6R,7R)-7-[2-aryl-2-(etherified oximino)acetamido]-3-carbamoyloxymethylceph-3-em-4-carboxylic acid 1-oxides |
US4079178A (en) * | 1971-05-14 | 1978-03-14 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino) acylamido groups at the 7-position |
US4033950A (en) * | 1971-05-14 | 1977-07-05 | Glaxo Laboratories Limited | 3-Hydroxymethyl-7β-(2-alkoxy-or benzyloxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
GB1445979A (en) * | 1972-10-25 | 1976-08-11 | Glaxo Lab Ltd | Cephalosporin derivatives |
AR208283A1 (es) * | 1973-03-15 | 1976-12-20 | Fujisawa Pharmaceutical Co | Un procedimiento para la preparacion de derivados de acido 2-alquil-2-o 3-fefem-4-carboxilico |
US4144393A (en) | 1973-12-21 | 1979-03-13 | Glaxo Laboratories Limited | 3-Acetoxymethyl cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyiminoarylacetamido group |
US4144392A (en) | 1973-12-21 | 1979-03-13 | Glaxo Laboratories Limited | Cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyimino-arylacetamido group and at position-3 the residue of a sulphur nucleophile |
AT344888B (de) * | 1973-12-21 | 1978-08-10 | Glaxo Lab Ltd | Verfahren zur herstellung von neuen cephalosporin-antibiotika |
GB1512957A (en) * | 1974-08-23 | 1978-06-01 | Glaxo Lab Ltd | Gephalosporin antibiotics |
DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
US4200746A (en) | 1974-12-20 | 1980-04-29 | Glaxo Laboratories, Ltd. | Cephalosporins |
GB1522140A (en) * | 1974-12-20 | 1978-08-23 | Glaxo Lab Ltd | Syn-7-(2-hydroxyiminoacetamido)-3-pyridiniummethyl cephalosporins methods for their preparation and compositions containing them |
PH15487A (en) * | 1975-02-04 | 1983-01-31 | Fujisawa Pharmaceutical Co | 7((2-hydroxyamino-2-disubstituted phenyl-acetamido)-)3-heterocyclithio-3-cephem-4-carboxylic acids |
GB1555471A (en) * | 1975-06-19 | 1979-11-14 | Glaxo Lab Ltd | 7 carbamoylalkoxyimino acetamido 3 em 4 carboxylic acidsand derivatives thereof |
SE440655B (sv) * | 1976-01-23 | 1985-08-12 | Roussel Uclaf | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra |
IE44888B1 (en) * | 1976-03-09 | 1982-05-05 | Fujisawa Pharmaceutical Co | 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation theroef |
US4165430A (en) | 1976-03-19 | 1979-08-21 | Glaxo Laboratories Limited | Cephalosporins having a 7-carboxy substituted α-etherified oximinoarylacetamido) group |
FR2345153A1 (fr) * | 1976-03-25 | 1977-10-21 | Roussel Uclaf | Nouvelles alcoyloximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
DK162391C (da) * | 1976-04-12 | 1992-03-09 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af syn-isomerer af 3,7-disubstituerede 3-cephem-4-carboxylsyreforbindelser |
DE2715385A1 (de) * | 1976-04-14 | 1977-11-10 | Takeda Chemical Industries Ltd | Cephalosporinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |
US4066762A (en) * | 1976-07-12 | 1978-01-03 | Smithkline Corporation | Derivatives of 7-(2-substituted-2-hydroxyiminoacetamido)-3-(1-substituted tetrazol-5-ylthiomethyl-3-cephem-4-carboxylic acid |
US4278670A (en) * | 1976-07-12 | 1981-07-14 | Smithkline Corporation | 7-Alpha-oxyiminoacylcephalosporins |
FR2361895A1 (fr) * | 1976-08-20 | 1978-03-17 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-carbamoyloxymethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
GB1592149A (en) * | 1976-10-08 | 1981-07-01 | Fujisawa Pharmaceutical Co | 3 7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for preparation thereof |
FR2381053A1 (fr) * | 1977-02-18 | 1978-09-15 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-thiadiazolyl thiomethyl 7-aminothiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
JPS53103493A (en) * | 1977-02-18 | 1978-09-08 | Takeda Chem Ind Ltd | Cephalosporin derivatives and process for their preparation |
FR2384779A1 (fr) * | 1977-03-25 | 1978-10-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-chloro ou 3-methoxy 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
SE439312B (sv) | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
DE2716677C2 (de) | 1977-04-15 | 1985-10-10 | Hoechst Ag, 6230 Frankfurt | Cephemderivate und Verfahren zu ihrer Herstellung |
NL7805715A (nl) * | 1977-06-03 | 1978-12-05 | Hoffmann La Roche | Werkwijze voor het bereiden van acylderivaten. |
IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
FR2438051A2 (fr) * | 1978-10-05 | 1980-04-30 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-azidomethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
SE445350B (sv) * | 1978-04-14 | 1986-06-16 | Roussel Uclaf | Oximderivat av 3-azidometyl-7-amino-tiazolyl-acetamido-cefalosporansyra och dess anvendning som antibiotika |
DE2822860A1 (de) * | 1978-05-26 | 1979-11-29 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
DE2822861A1 (de) * | 1978-05-26 | 1979-11-29 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
US4284631A (en) * | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
DE2914327A1 (de) * | 1979-04-09 | 1980-10-30 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
EP0088454B1 (en) * | 1979-09-03 | 1986-03-05 | Fujisawa Pharmaceutical Co., Ltd. | New starting compounds for preparing cephem compounds and processes for their preparation |
CA1215969A (en) * | 1979-10-12 | 1986-12-30 | Tsutomu Teraji | Cephem compounds and processes for preparation thereof |
FR2476087A1 (fr) * | 1980-02-18 | 1981-08-21 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-alkyloxy ou 3-alkyl-thiomethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
EP0076528B1 (fr) * | 1980-02-18 | 1990-05-23 | Roussel-Uclaf | Nouvelles oximes dérivées de l'acide 3-alkyloxy ou 3-alkylthiométhyl 7-amino thiazolylacétamido céphalosporanique et leur préparation |
EP0037797A3 (de) * | 1980-03-11 | 1981-12-16 | Ciba-Geigy Ag | Cephalosporinverbindungen, Verfahren zu ihrer Herstellung, sie enthaltende pharmazeutische Zusammensetzungen und ihre Verwendung |
GR75644B (enrdf_load_stackoverflow) * | 1980-06-18 | 1984-08-02 | Fujisawa Pharmaceutical Co | |
ZA813787B (en) * | 1980-06-18 | 1982-07-28 | Fujisawa Pharmaceutical Co | New cephem compounds and processes for preparation thereof |
US4443444A (en) * | 1980-08-11 | 1984-04-17 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
EP0046964B1 (en) * | 1980-08-29 | 1986-08-20 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds and processes for preparation thereof |
US4416879A (en) * | 1980-09-08 | 1983-11-22 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
NZ198350A (en) * | 1980-09-25 | 1985-02-28 | Toyama Chemical Co Ltd | Cephalosporins and intermediates;pharmaceutical compositions |
US4458072A (en) * | 1980-10-10 | 1984-07-03 | Hoffmann-La Roche Inc. | Acyl derivatives |
FR2494275A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouveaux derives de vinyl-3 cephalosporines et leur preparation |
FR2494274A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles thiovinyl-3 cephalosporines, leur preparation et les medicaments qui les contiennent |
FR2494279A1 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles oxacephalosporines, leur preparation et les medicaments qui les contiennent |
FR2494280A1 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouveaux derives de la cephalosporine et leur preparation |
FR2494276A2 (fr) * | 1980-11-20 | 1982-05-21 | Rhone Poulenc Ind | Nouvelles vinyl-3 cephalosporines, et leur preparation |
GR76342B (enrdf_load_stackoverflow) * | 1981-02-02 | 1984-08-06 | Fujisawa Pharmaceutical Co | |
FR2499995A1 (fr) * | 1981-02-13 | 1982-08-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-alkyloxy ou 3-alkylthiomethyl 7-amino thiazolylacetamido cephalosporanique, leur preparation, leur application comme medicaments, les compositions les renfermant et les nouveaux intermediaires obtenus. |
JPS6011917B2 (ja) * | 1981-04-09 | 1985-03-28 | 山之内製薬株式会社 | 新規なセファロスポリン化合物 |
FR2505339A1 (fr) * | 1981-05-11 | 1982-11-12 | Rhone Poulenc Sante | Nouvelles oxacephalosporines et leur preparation |
FR2505338A1 (fr) * | 1981-05-11 | 1982-11-12 | Rhone Poulenc Sante | Nouvelles oxacephalosporines et leur preparation |
EP0070803A3 (de) * | 1981-07-16 | 1984-05-02 | Ciba-Geigy Ag | Antibiotisch wirksame Aminotriazolyl-Cephalosporinderivate und ihre Herstellung |
GR76701B (enrdf_load_stackoverflow) * | 1981-09-08 | 1984-08-29 | Lilly Co Eli | |
JPS5859992A (ja) * | 1981-09-14 | 1983-04-09 | Fujisawa Pharmaceut Co Ltd | 新規セフエム化合物およびその製造法、並びに細菌感染症予防・治療剤 |
MA19602A1 (fr) * | 1981-09-30 | 1983-04-01 | Ciba Geigy Ag | Composes d'amino-oxazolyle, procede pour leur preparation, preparations pharmaceutiques qui contiennent ces composes, et leur application |
US4401668A (en) * | 1981-10-02 | 1983-08-30 | Eli Lilly And Company | Pyrazinium substituted cephalosporins |
PH19163A (en) * | 1982-04-06 | 1986-01-16 | Daiichi Seiyaku Co | Cephalosporin derivatives |
GB2125033B (en) * | 1982-07-23 | 1985-08-29 | Servipharm Ltd | Cephalosporins |
US4546101A (en) * | 1982-09-10 | 1985-10-08 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds useful for treating infectious diseases in human being and animals and processes for preparation thereof |
FR2533216A1 (fr) * | 1982-09-22 | 1984-03-23 | Toyama Chemical Co Ltd | Nouvelles cephalosporines, et leurs sels |
JPS5973043A (ja) * | 1982-10-19 | 1984-04-25 | House Food Ind Co Ltd | 易溶性ゲル化剤の製造法 |
US4492694A (en) * | 1983-04-12 | 1985-01-08 | Eli Lilly And Company | Indolylglycyl cephalosporin derivatives |
AU2673884A (en) * | 1983-04-12 | 1984-10-18 | Eli Lilly And Company | Naphthylglycyl cephalosporin derivatives |
DE3330605A1 (de) * | 1983-08-25 | 1985-03-14 | Hoechst Ag, 6230 Frankfurt | Cephalosporinderivate und verfahren zu ihrer herstellung |
JPS60190783A (ja) * | 1983-12-21 | 1985-09-28 | Sumitomo Seiyaku Kk | セフエム系化合物 |
JPS60132983A (ja) * | 1983-12-21 | 1985-07-16 | Tanabe Seiyaku Co Ltd | チアゾ−ル酢酸誘導体及びその製法 |
GB8411954D0 (en) * | 1984-05-10 | 1984-06-13 | Glaxo Group Ltd | Cephalosporin antibiotics |
IE58487B1 (en) * | 1984-09-07 | 1993-09-22 | Kaisha Maiji Seika | New cephalosporin compounds and the production thereof |
JPS61145186A (ja) * | 1984-12-20 | 1986-07-02 | Meiji Seika Kaisha Ltd | 新規セフエム化合物及びその製造法 |
DE3623921A1 (de) * | 1986-07-16 | 1988-01-21 | Basf Ag | Oximether und diese enthaltende fungizide |
GB8927871D0 (en) * | 1989-12-08 | 1990-02-14 | Beecham Group Plc | Novel compounds |
IN189046B (enrdf_load_stackoverflow) | 1998-03-30 | 2002-12-14 | Ranbaxy Lab Ltd | |
AU2820700A (en) * | 1999-03-09 | 2000-09-28 | Ranbaxy Laboratories Limited | Process for the preparation of cefuroxime |
Family Cites Families (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
SE311519B (enrdf_load_stackoverflow) * | 1962-12-14 | 1969-06-16 | Astra Ab | |
GB1208014A (en) * | 1967-03-23 | 1970-10-07 | Glaxo Lab Ltd | Cephalosporins |
GB1208015A (en) * | 1967-03-23 | 1970-10-07 | Glaxo Lab Ltd | Cephalosporins |
GB1241657A (en) * | 1967-08-21 | 1971-08-04 | Glaxo Lab Ltd | Improvements in or relating to cephalosporin compounds |
GB1279402A (en) * | 1968-06-14 | 1972-06-28 | Glaxo Lab Ltd | Improvements in or relating to cephalosporin derivatives |
US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
ZA72568B (en) * | 1971-01-29 | 1972-10-25 | Glaxo Lab Ltd | Improvements in or relating to antibiotics |
GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
-
1971
- 1971-05-14 GB GB1508271A patent/GB1399086A/en not_active Expired
-
1972
- 1972-05-12 IL IL39429A patent/IL39429A/xx unknown
- 1972-05-12 DE DE2223375A patent/DE2223375C2/de not_active Expired
- 1972-05-12 IE IE644/72A patent/IE38172B1/xx unknown
- 1972-05-12 CH CH705972A patent/CH591497A5/xx not_active IP Right Cessation
- 1972-05-12 SE SE7206296A patent/SE457795B/xx unknown
- 1972-05-12 BE BE783449A patent/BE783449A/xx not_active IP Right Cessation
- 1972-05-12 DE DE2265234A patent/DE2265234C2/de not_active Expired
- 1972-05-12 CA CA141,965A patent/CA1027554A/en not_active Expired
- 1972-05-12 CY CY971A patent/CY971A/xx unknown
- 1972-05-12 CS CS723209A patent/CS245753B2/cs unknown
- 1972-05-12 JP JP4714872A patent/JPS531280B1/ja active Pending
- 1972-05-12 ES ES402651A patent/ES402651A1/es not_active Expired
- 1972-05-12 NO NO721705A patent/NO154797C/no unknown
- 1972-05-12 YU YU1267/72A patent/YU41807B/xx unknown
- 1972-05-12 CS CS72839A patent/CS245754B2/cs unknown
- 1972-05-12 NL NLAANVRAGE7206403,A patent/NL166688C/xx not_active IP Right Cessation
- 1972-05-12 DK DK237372A patent/DK155187C/da active
- 1972-05-15 AT AT420872A patent/AT336786B/de not_active IP Right Cessation
- 1972-05-15 FR FR7217283A patent/FR2137899B1/fr not_active Expired
- 1972-05-15 FR FR7217284A patent/FR2137900B1/fr not_active Expired
-
1974
- 1974-08-23 PH PH16206A patent/PH11205A/en unknown
- 1974-09-16 ES ES430104A patent/ES430104A1/es not_active Expired
-
1977
- 1977-06-22 JP JP7426977A patent/JPS5328141A/ja active Granted
-
1978
- 1978-10-19 KE KE2895A patent/KE2895A/xx unknown
- 1978-11-16 HK HK660/78A patent/HK66078A/xx unknown
- 1978-12-30 MY MY466/78A patent/MY7800466A/xx unknown
-
1979
- 1979-02-24 JP JP2128779A patent/JPS54135792A/ja active Pending
- 1979-12-28 YU YU03213/79A patent/YU321379A/xx unknown
Cited By (41)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4258041A (en) | 1978-05-26 | 1981-03-24 | Glaxo Group Limited | (6R,7R)-7-[(Z)-2-(2-Aminothiazol-4-yl)-2-(2-carboxyprop-2-oxyimino)acetamido]-3-(1-pyridiniummethyl)-ceph-3-em-4-carboxylate and salts thereof |
US4600772A (en) * | 1978-05-26 | 1986-07-15 | Glaxo Group Limited | Cephalosporin antibiotics |
EP0036673A1 (en) * | 1978-07-10 | 1981-09-30 | Fujisawa Pharmaceutical Co., Ltd. | New thiadiazol compounds and processes for their preparation |
EP0007470A3 (en) * | 1978-07-10 | 1980-04-16 | Fujisawa Pharmaceutical Co. Ltd. | Cephem compounds, processes for their preparation, pharmaceutical compositions containing them and their starting compounds |
US4464368A (en) * | 1978-11-15 | 1984-08-07 | Glaxo Group Limited | Cephalosporin antibiotics |
FR2464960A1 (fr) * | 1979-09-10 | 1981-03-20 | Glaxo Group Ltd | Nouvelle forme non hygroscopique d'une cephalosporine sodique, son procede de preparation et son application en therapeutique |
US4503234A (en) * | 1980-07-24 | 1985-03-05 | Lonza Ltd. | Production of 2-(2-aminothiazole-4-yl)-2-(syn)-methoxyimino acetic esters |
US4521413A (en) * | 1981-09-14 | 1985-06-04 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
US4394503A (en) | 1981-12-07 | 1983-07-19 | Bristol-Myers Company | Cephalosporin derivatives |
US4474954A (en) * | 1981-12-07 | 1984-10-02 | Bristol-Myers Company | Intermediates for cephalosporin derivatives |
US4406899A (en) | 1982-03-04 | 1983-09-27 | Bristol-Myers Company | Cephalosporins |
US4457929A (en) * | 1982-03-29 | 1984-07-03 | Bristol-Myers Company | 3-Quaternary ammonium methyl)-substituted cephalosporin derivatives |
US4500526A (en) * | 1982-06-28 | 1985-02-19 | Bristol-Myers Company | Cephalosporin derivatives |
EP0097961A2 (en) | 1982-06-28 | 1984-01-11 | Bristol-Myers Company | Cephalosporin derivatives, a process for the manufacture thereof and pharmaceutical compositions containing said derivatives |
US4598154A (en) * | 1982-08-07 | 1986-07-01 | Tanabe Seiyaku Co., Ltd. | Thiazole intermediates for cephalosporin compounds |
US4598075A (en) * | 1982-08-07 | 1986-07-01 | Tanabe Seiyaku Co., Ltd. | Cephalosporin compounds |
US4486586A (en) * | 1983-02-10 | 1984-12-04 | Bristol-Myers Company | Cephalosporin derivatives |
US4525473A (en) * | 1983-03-30 | 1985-06-25 | Bristol-Myers Company | Cephalosporins |
GB2137995A (en) * | 1983-04-12 | 1984-10-17 | Lilly Co Eli | Benzothienylglycyl cephalosporin derivatives |
GB2137996A (en) * | 1983-04-12 | 1984-10-17 | Lilly Co Eli | Benzothienylglycyl cephalosporin derivatives |
US5064953A (en) * | 1983-12-29 | 1991-11-12 | Mochida Pharmaceutical Co., Ltd. | Intermediates cephalosporin derivatives |
US4888332A (en) * | 1983-12-29 | 1989-12-19 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
EP0164944B1 (en) * | 1984-05-30 | 1990-07-11 | Imperial Chemical Industries Plc | Cephalosporin derivatives |
US4868173A (en) * | 1984-11-20 | 1989-09-19 | Ici Pharma | Cephalosporin derivatives |
US4677100A (en) * | 1984-12-27 | 1987-06-30 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4956474A (en) * | 1985-04-01 | 1990-09-11 | Mochida Pharmaceutical Co., Ltd. | Intermediates of cephalosporin compounds |
US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4904791A (en) * | 1985-04-01 | 1990-02-27 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4874856A (en) * | 1985-06-24 | 1989-10-17 | Bristol-Myers Company | 3-(substituted)propenyl-7-(aminothiazolylacetamido) ceph-3-em-4-carboxylic acids and esters thereof |
US4708955A (en) * | 1985-06-24 | 1987-11-24 | Bristol-Myers Company | 3-(substituted)propenyl-7-aminothiazol-ylcephalosporanic acids and esters thereof |
US4814328A (en) * | 1986-03-19 | 1989-03-21 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives, and antibacterial agents |
US5017569A (en) * | 1986-11-12 | 1991-05-21 | Ici Pharma | Cephalosporin derivatives |
US4880798A (en) * | 1986-11-25 | 1989-11-14 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
US4866055A (en) * | 1986-11-25 | 1989-09-12 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives and their crystalline derivatives |
US5057511A (en) * | 1986-12-23 | 1991-10-15 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
US5412093A (en) * | 1986-12-23 | 1995-05-02 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
US5189157A (en) * | 1987-06-16 | 1993-02-23 | Hoffmann La Roche Inc. | Antibacterial cephalosporin compounds |
US5008258A (en) * | 1987-07-23 | 1991-04-16 | I.C.I.-Pharma | Cephalosporin derivatives |
US5013730A (en) * | 1987-07-23 | 1991-05-07 | Ici-Pharma | Cephem derivatives |
US4971962A (en) * | 1988-05-11 | 1990-11-20 | Lucky, Ltd. | Cephalosporin compounds |
US5202315A (en) * | 1989-05-11 | 1993-04-13 | Lucky, Ltd. | Cephalosporin compounds |
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
GB1399086A (en) | Cephalosporin compounds | |
SE7807810L (sv) | 3-metylensmorsyraderivat | |
GB1377304A (en) | Alkyl esters of pyrrolidone carboxylic acid | |
GB1399088A (en) | Cephalosporin compounds | |
GB1318291A (en) | Carboxamide derivatives and fungicidal compositions containing them | |
GB1348093A (en) | Dialkyl-4-hydroxyphenylcarboxylates of tris-hydroxyalkyl-iso cyanurate | |
GB1363597A (en) | 2-acyloxy-benzoic acid anilides process for their preparation and their insecticidal and acaricidal use | |
GB1399089A (en) | Carboxylic acids and derivatives thereof | |
GB1399087A (en) | Penicillin compounds | |
GB1307809A (en) | Capronylhydroxy-benzoic acid esters their use as nematogenic compounds and nematogenic mixtures containing them | |
GB1496491A (en) | Dihydroergopeptine derivatives | |
ES464123A1 (es) | Un procedimiento para la preparacion de esteres de acido clavulanico. | |
SE7514475L (sv) | Cefalosporiner | |
GB1396368A (en) | Perfluoroalkyl sulphinic acids and a process for their production | |
GB1358948A (en) | Process for the manufacture of cycloalkenone esters | |
GB1389195A (en) | Antibiotics | |
GB1298005A (enrdf_load_stackoverflow) | ||
GB907677A (en) | 17ª--alkyl-17ª--hydroxyestr-1-en-3-ones and derivatives thereof | |
ES385834A1 (es) | Un procedimiento para preparar monoesteres de alfa carboxi-bencilpenicilina. | |
GB1143430A (en) | New cyclobutene derivative | |
GB1429697A (en) | Method for producing isonitrosomalonic esters | |
GB1383522A (en) | 2-methyl-6-chloropyridines and salts thereof | |
GB846737A (en) | 3-substituted 4-hydroxybenzoic acids and their preparation | |
GB1292662A (en) | Bicycloheptaneheptanoic acids and esters thereof | |
GB1416040A (en) | Proces for the preparation of 3-mono-alkyl and 3,6-dialkyl -resorcylic esters |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PS | Patent sealed [section 19, patents act 1949] | ||
PE20 | Patent expired after termination of 20 years |