FR2463573A1 - Faneuse avec organes porteurs et arbres d'entrainement repliables - Google Patents
Faneuse avec organes porteurs et arbres d'entrainement repliables Download PDFInfo
- Publication number
- FR2463573A1 FR2463573A1 FR8018334A FR8018334A FR2463573A1 FR 2463573 A1 FR2463573 A1 FR 2463573A1 FR 8018334 A FR8018334 A FR 8018334A FR 8018334 A FR8018334 A FR 8018334A FR 2463573 A1 FR2463573 A1 FR 2463573A1
- Authority
- FR
- France
- Prior art keywords
- tedder according
- tedder
- raking
- guide member
- members
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000969 carrier Substances 0.000 title description 3
- 230000008878 coupling Effects 0.000 claims abstract description 17
- 238000010168 coupling process Methods 0.000 claims abstract description 17
- 238000005859 coupling reaction Methods 0.000 claims abstract description 17
- 210000000056 organ Anatomy 0.000 claims description 10
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- 230000001154 acute effect Effects 0.000 claims description 2
- 241000239290 Araneae Species 0.000 claims 1
- 230000009977 dual effect Effects 0.000 abstract description 2
- 210000003423 ankle Anatomy 0.000 description 5
- 238000010276 construction Methods 0.000 description 5
- 238000006073 displacement reaction Methods 0.000 description 5
- 230000005540 biological transmission Effects 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 229910000639 Spring steel Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- RWYFURDDADFSHT-RBBHPAOJSA-N diane Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.C1=C(Cl)C2=CC(=O)[C@@H]3CC3[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 RWYFURDDADFSHT-RBBHPAOJSA-N 0.000 description 1
- 230000003100 immobilizing effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D78/00—Haymakers with tines moving with respect to the machine
- A01D78/08—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels
- A01D78/10—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels the tines rotating about a substantially vertical axis
- A01D78/1007—Arrangements to facilitate transportation specially adapted therefor
- A01D78/1014—Folding frames
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Agricultural Machines (AREA)
- Soil Working Implements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7906381,A NL177070C (nl) | 1979-08-24 | 1979-08-24 | Hooibouwmachine. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| FR2463573A1 true FR2463573A1 (fr) | 1981-02-27 |
Family
ID=19833724
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR8018334A Pending FR2463573A1 (fr) | 1979-08-24 | 1980-08-22 | Faneuse avec organes porteurs et arbres d'entrainement repliables |
| FR898904957A Expired - Lifetime FR2628934B1 (fr) | 1979-08-24 | 1989-04-14 | Faneuse |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR898904957A Expired - Lifetime FR2628934B1 (fr) | 1979-08-24 | 1989-04-14 | Faneuse |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4366666A (esLanguage) |
| JP (1) | JPS5632918A (esLanguage) |
| AT (1) | AT389974B (esLanguage) |
| BE (1) | BE884888A (esLanguage) |
| DE (4) | DE8022517U1 (esLanguage) |
| FR (2) | FR2463573A1 (esLanguage) |
| GB (3) | GB2057239B (esLanguage) |
| IE (1) | IE50078B1 (esLanguage) |
| IT (1) | IT1132447B (esLanguage) |
| NL (2) | NL177070C (esLanguage) |
| NZ (1) | NZ194740A (esLanguage) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2467535A1 (fr) * | 1979-10-16 | 1981-04-30 | Kuhn Sa | Dispositif de liaison entre les chassis des roues rateleuses des machines de fenaison |
| DE3022798A1 (de) * | 1980-06-19 | 1981-12-24 | Rainer Dipl.-Ing. Dipl.-Wirtsch.-Ing. 5202 Hennef Weidtmann | Heuwerbungsmaschine |
| JPS58146433U (ja) * | 1982-03-29 | 1983-10-01 | 佐々木農機株式会社 | 竪軸回転式ヘ−テツダの折り畳み装置 |
| GB2141311A (en) * | 1983-06-13 | 1984-12-19 | Carier | Seed drilling machine |
| DE3418352A1 (de) * | 1984-05-17 | 1986-01-09 | Max 8951 Baisweil Hölzle | Geraet zum zusammenrechen von futter, insbesondere fuer frontanbau am schlepper |
| DE3444374A1 (de) | 1984-12-05 | 1986-06-12 | Alois Pöttinger Landmaschinen-Gesellschaft mbH, 8900 Augsburg | Rotationsmaehwerk |
| FR2582186B1 (fr) * | 1985-05-21 | 1989-05-05 | Kuhn Sa | Perfectionnement aux machines de fenaison munies de plusieurs roues rateleuses |
| NL193967C (nl) * | 1985-09-05 | 2001-04-03 | Lely Nv C Van Der | Machine voor het zijwaarts verplaatsen van op de grond liggend gewas. |
| DE3632767A1 (de) * | 1986-09-26 | 1988-03-31 | Kloeckner Humboldt Deutz Ag | Kreiselheuwerbungsmaschine |
| DE3641116C2 (de) * | 1986-12-02 | 1999-01-28 | Poettinger Alois Landmasch | Heuwerbungsmaschine |
| DE3709097A1 (de) * | 1987-03-20 | 1988-09-29 | Khd Agrartechnik | Kreiselheuwerbungsmaschine |
| DE3713474A1 (de) * | 1987-04-22 | 1988-11-03 | Niemeyer Gmbh & Co Kg Soehne | Heuwerbungsmaschine |
| EP0289864B1 (de) * | 1987-04-22 | 1992-09-30 | H. Niemeyer Söhne GmbH & Co. KG | Heuwerbungsmaschine |
| DE3716927C3 (de) * | 1987-05-20 | 1998-12-10 | Greenland Gmbh & Co Kg | Heuwerbungsmaschine |
| FR2618045B1 (fr) * | 1987-07-15 | 1990-06-08 | Kuhn Sa | Machine de fenaison munie de plusieurs roues rateleuses basculables en vue du repliement pour le transport ou le remisage |
| DE3739305A1 (de) * | 1987-11-20 | 1989-06-01 | Claas Saulgau Gmbh | Landwirtschaftliche arbeitsmaschine mit hochklappbaren werkzeugtraegern |
| DE3739485A1 (de) * | 1987-11-21 | 1989-06-01 | Claas Saulgau Gmbh | Gelenkige rahmenverbindung fuer futtererntemaschinen |
| DE3743025C2 (de) * | 1987-12-18 | 1998-03-26 | Claas Saulgau Gmbh | Schutzbügel für Kreiselheumaschinen |
| FR2631208B1 (fr) * | 1988-05-13 | 1990-08-31 | Kuhn Sa | Perfectionnement aux machines agricoles avec un chassis porte-outils articule |
| FR2639178B1 (fr) * | 1988-11-21 | 1991-07-12 | Kuhn Sa | Machine agricole, notamment pour la fenaison, ayant un chassis articule |
| FR2641936B2 (esLanguage) * | 1988-11-21 | 1992-01-03 | Kuhn Sa | |
| FR2643783B1 (fr) * | 1989-03-01 | 1992-01-17 | Kuhn Sa | Machine de fenaison comportant plusieurs rotors |
| DE3911296A1 (de) * | 1989-04-07 | 1990-10-11 | Claas Saulgau Gmbh | Landwirtschaftliche arbeitsmaschine |
| FR2661312B1 (fr) * | 1990-04-27 | 1992-07-17 | Kuhn Sa | Machine de fenaison avec plusieurs rotors. |
| DE9014438U1 (de) * | 1990-10-18 | 1991-02-14 | H. Niemeyer Söhne GmbH & Co KG, 4446 Hörstel | Heuwerbungsmaschine |
| DE4110634C2 (de) * | 1991-04-02 | 1994-03-03 | Krone Bernhard Gmbh Maschf | Gelenkige Rahmenverbindung |
| EP0539662B1 (de) * | 1991-10-30 | 1996-12-04 | Claas Saulgau Gmbh | Zweikreisel-Schwader |
| FR2696899B1 (fr) * | 1992-10-16 | 1994-12-09 | Kuhn Sa | Machine de fenaison pour l'andainage de fourrage. |
| NL9300974A (nl) * | 1993-06-07 | 1995-01-02 | Lely Nv C Van Der | Hooibouwmachine. |
| NL9401502A (nl) * | 1994-09-16 | 1996-05-01 | Maasland Nv | Landbouwmachine. |
| NL1002141C2 (nl) * | 1996-01-22 | 1997-07-25 | Maasland Nv | Landbouwmachine. |
| DE19747310C1 (de) * | 1997-10-27 | 1999-08-26 | Walterscheid Gmbh Gkn | Antriebsvorrichtung für eine Landmaschine, insbesondere Kreiselheuer |
| GB2346790B (en) * | 1999-02-19 | 2001-11-14 | Spearhead Machinery Ltd | Improvements in mowing head drives |
| DE19918194A1 (de) * | 1999-04-22 | 2000-10-26 | Claas Saulgau Gmbh | Heuwerbungsmaschine mit verstellbarem Prallelement |
| FR2875377B1 (fr) * | 2004-09-23 | 2007-01-19 | Kuhn Sa Sa | Andaineuse de vegetaux avec trois roues rateleuses |
| US7377093B2 (en) * | 2005-10-19 | 2008-05-27 | Cnh America Llc | Rotary crop inverter |
| US20090258717A1 (en) * | 2006-01-23 | 2009-10-15 | Damien Higgins | Power Take-Off Shaft with 80 Degree Angular Displacement |
| NL1037784C2 (nl) * | 2010-03-08 | 2011-09-09 | Forage Innovations Bv | Hooibouwinrichting. |
| US10470372B2 (en) | 2014-07-15 | 2019-11-12 | Pequea Machine, Inc. | Frame suspension for rotary rakes and tedders |
| GB201814800D0 (en) * | 2018-09-12 | 2018-10-24 | Agco Feucht Gmbh | Improved agricultural implement |
| US11477934B2 (en) * | 2019-01-11 | 2022-10-25 | Cnh Industrial Canada, Ltd. | Wing hinge coupling device |
| US12114602B2 (en) * | 2020-06-17 | 2024-10-15 | Deere & Company | Corn head adjustment system with force relief |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2605853A (en) * | 1947-10-23 | 1952-08-05 | Carl E Swenson | Power take-off joint assembly |
| FR1346993A (fr) * | 1961-07-14 | 1963-12-27 | Fahr Ag Maschf | Dispositif facilitant le transport par route de machines de fenaison comportant plus de deux croisillons à dents |
| FR1361205A (fr) * | 1962-07-20 | 1964-05-15 | Steininger Maschinenfabrik & E | Faneuse |
| FR1532881A (fr) * | 1966-08-01 | 1968-07-12 | Lely Nv C Van Der | Dispositif pour travailler les végétaux se trouvant sur le sol |
| FR1535118A (fr) * | 1967-08-18 | 1968-08-02 | Querry Fils Ets | Andaineur adaptable notamment sur faneuse rotative à toupies |
| FR1573631A (esLanguage) * | 1967-07-17 | 1969-07-04 | ||
| DE1482900A1 (de) * | 1964-04-27 | 1969-12-11 | Texas Industries Inc | Heuwerbungsmaschine |
| GB1174420A (en) * | 1965-12-30 | 1969-12-17 | Bucher Guyer Ag Masch | Improvements in or relating to Hay Harvesting Machines. |
| FR2258119A1 (esLanguage) * | 1974-01-18 | 1975-08-18 | Lely Nv C Van Der | |
| FR2375814A1 (fr) * | 1976-12-31 | 1978-07-28 | Fortschritt Veb K | Machine a faucher en andains avec dispositif de traitement des produits en tiges fauches |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7318934U (de) * | 1973-08-30 | Stoll W Maschinenfabrik Gmbh | Heuwerbungsmaschine | |
| CH327994A (de) | 1955-12-16 | 1958-02-28 | Lang Alfred | Landwirtschaftliches Arbeitsgerät |
| US3070938A (en) | 1960-06-20 | 1963-01-01 | Shunk Mfg Company | Grass mowers |
| AT237367B (de) * | 1961-07-14 | 1964-12-10 | Fahr Ag Maschf | Heumaschine |
| DE1263378B (de) * | 1964-09-14 | 1968-03-14 | Massey Ferguson Ltd | Geraeterahmen fuer Bodenbearbeitungswerkzeuge |
| DE1219719B (de) * | 1964-11-09 | 1966-06-23 | Hans Strunk | Landwirtschaftliches Mehrzweckgeraet zum Anhaengen an Ackerschlepper |
| NL142050B (nl) * | 1965-03-29 | 1974-05-15 | Texas Industries Inc | Maaimachine. |
| DE1926268U (de) | 1965-03-31 | 1965-11-04 | Telefunken Patent | Selbstinduktionsspule veraenderbarer induktivitaet mit ueber die laenge der wicklung verteilten abgriffen. |
| DE1266556B (de) * | 1966-06-24 | 1968-04-18 | Fahr Ag Maschf | Gelenkverbindung zwischen den Abschnitten einer mit Tragrohren versehenen Gelenkwelle |
| DE1278161B (de) * | 1966-08-31 | 1968-09-19 | Josef Maugg | Ladewagen |
| US3483683A (en) * | 1966-12-29 | 1969-12-16 | Hesston Of Delaware Inc | Constant velocity drive |
| DE1957940U (de) * | 1967-01-28 | 1967-03-30 | Josef Bautz G M B H | Kreiselzettwender. |
| US3527032A (en) * | 1969-08-07 | 1970-09-08 | Hesston Of Delaware Inc | Cutter section for multisection mower |
| DE7241013U (de) | 1971-11-09 | 1974-02-07 | Texas Industries Inc | Kreiselheuwerbungsmaschine |
| NL7200926A (esLanguage) * | 1972-01-24 | 1973-07-26 | ||
| DE2220162B2 (de) * | 1972-04-25 | 1976-11-25 | Rabewerk Heinrich Clausing, 4515 Bad Essen | Bodenbearbeitungsgeraet mit einem kupplungsrahmen und daran befestigten geraeteteilen |
| NL169947C (nl) * | 1973-06-14 | 1984-03-16 | Zweegers P | Maaimachine. |
| DE2400200C3 (de) * | 1974-01-03 | 1978-08-31 | Deere & Co., Moline, Ill. (V.St.A.), Niederlassung Deere & Co. European Office, 6800 Mannheim | Mähdrescher mit verschwenkbar angeordnetem Entleerungsrohr |
| DE2411489B2 (de) * | 1974-03-11 | 1977-06-30 | An einen Schlepper anbaubares Bodenbearbeitungsgerät Maschinenfabrik Rau oHG, 7315 Weilheim | An einen schlepper anbaubares bodenbearbeitungsgeraet |
| NL7405407A (nl) * | 1974-04-22 | 1975-10-24 | Lely Nv C Van Der | Hooibouwmachine. |
| DE2431366A1 (de) | 1974-06-29 | 1976-01-15 | Weidtmann Rainer Dipl Ing Dipl | Heuwerbungsmaschine |
| US3897832A (en) * | 1974-08-19 | 1975-08-05 | Dunham Lehr Inc | Agricultural tool bar |
| AT334123B (de) * | 1975-07-07 | 1976-12-27 | Prillinger Landmaschf Hans | Egge |
| NL7514820A (nl) * | 1975-12-19 | 1977-06-21 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| FR2342639A1 (fr) * | 1976-03-05 | 1977-09-30 | Kuhn Sa | Dispositif permettant la modification de l'angle de piquage des toupies d'une machine agricole du type faneuse-andaineuse |
| NL7609321A (nl) * | 1976-08-23 | 1978-02-27 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| AU509225B2 (en) * | 1977-01-06 | 1980-05-01 | Massey-Ferguson Services N.V. | Mower |
| NL7708761A (nl) * | 1977-08-09 | 1979-02-13 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| CH626478A5 (esLanguage) * | 1978-04-14 | 1981-11-13 | Micafil Ag | |
| DE7812394U1 (de) * | 1978-04-24 | 1978-08-17 | Wilhelm Stoll Maschinenfabrik Gmbh, 3325 Lengede | Bodenbearbeitungsgeraet |
-
1979
- 1979-08-24 NL NLAANVRAGE7906381,A patent/NL177070C/xx not_active IP Right Cessation
-
1980
- 1980-08-01 IE IE1608/80A patent/IE50078B1/en not_active IP Right Cessation
- 1980-08-01 AT AT0400580A patent/AT389974B/de not_active IP Right Cessation
- 1980-08-06 GB GB8025701A patent/GB2057239B/en not_active Expired
- 1980-08-11 US US06/177,137 patent/US4366666A/en not_active Expired - Lifetime
- 1980-08-21 IT IT24239/80A patent/IT1132447B/it active
- 1980-08-22 JP JP11490380A patent/JPS5632918A/ja active Granted
- 1980-08-22 NZ NZ194740A patent/NZ194740A/xx unknown
- 1980-08-22 BE BE0/201837A patent/BE884888A/nl not_active IP Right Cessation
- 1980-08-22 FR FR8018334A patent/FR2463573A1/fr active Pending
- 1980-08-23 DE DE8022517U patent/DE8022517U1/de not_active Expired
- 1980-08-23 DE DE3050792A patent/DE3050792C2/de not_active Expired
- 1980-08-23 DE DE3031837A patent/DE3031837C2/de not_active Expired
- 1980-08-23 DE DE3050793A patent/DE3050793C2/de not_active Expired
-
1982
- 1982-11-22 GB GB08233211A patent/GB2107563B/en not_active Expired
- 1982-11-22 GB GB08233212A patent/GB2107564B/en not_active Expired
-
1983
- 1983-09-16 NL NLAANVRAGE8303201,A patent/NL179534C/xx not_active IP Right Cessation
-
1989
- 1989-04-14 FR FR898904957A patent/FR2628934B1/fr not_active Expired - Lifetime
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2605853A (en) * | 1947-10-23 | 1952-08-05 | Carl E Swenson | Power take-off joint assembly |
| FR1346993A (fr) * | 1961-07-14 | 1963-12-27 | Fahr Ag Maschf | Dispositif facilitant le transport par route de machines de fenaison comportant plus de deux croisillons à dents |
| FR1361205A (fr) * | 1962-07-20 | 1964-05-15 | Steininger Maschinenfabrik & E | Faneuse |
| DE1482900A1 (de) * | 1964-04-27 | 1969-12-11 | Texas Industries Inc | Heuwerbungsmaschine |
| GB1174420A (en) * | 1965-12-30 | 1969-12-17 | Bucher Guyer Ag Masch | Improvements in or relating to Hay Harvesting Machines. |
| FR1532881A (fr) * | 1966-08-01 | 1968-07-12 | Lely Nv C Van Der | Dispositif pour travailler les végétaux se trouvant sur le sol |
| FR1573631A (esLanguage) * | 1967-07-17 | 1969-07-04 | ||
| FR1535118A (fr) * | 1967-08-18 | 1968-08-02 | Querry Fils Ets | Andaineur adaptable notamment sur faneuse rotative à toupies |
| FR2258119A1 (esLanguage) * | 1974-01-18 | 1975-08-18 | Lely Nv C Van Der | |
| FR2375814A1 (fr) * | 1976-12-31 | 1978-07-28 | Fortschritt Veb K | Machine a faucher en andains avec dispositif de traitement des produits en tiges fauches |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3031837A1 (de) | 1981-03-12 |
| GB2057239A (en) | 1981-04-01 |
| NL177070B (nl) | 1985-03-01 |
| NL7906381A (nl) | 1981-02-26 |
| NL177070C (nl) | 1985-08-01 |
| DE3031837C2 (de) | 1986-10-09 |
| FR2628934A1 (fr) | 1989-09-29 |
| AT389974B (de) | 1990-02-26 |
| GB2057239B (en) | 1983-05-18 |
| BE884888A (nl) | 1981-02-23 |
| NL8303201A (nl) | 1984-01-02 |
| GB2107563B (en) | 1984-03-21 |
| IE801608L (en) | 1981-02-24 |
| GB2107563A (en) | 1983-05-05 |
| ATA400580A (de) | 1989-08-15 |
| NL179534C (nl) | 1989-11-16 |
| FR2628934B1 (fr) | 1993-04-02 |
| NZ194740A (en) | 1983-11-30 |
| JPS6366487B2 (esLanguage) | 1988-12-21 |
| IT8024239A0 (it) | 1980-08-21 |
| IE50078B1 (en) | 1986-02-05 |
| DE8022517U1 (de) | 1985-03-29 |
| DE3050792C2 (esLanguage) | 1987-08-20 |
| IT1132447B (it) | 1986-07-02 |
| GB2107564B (en) | 1984-01-11 |
| JPS5632918A (en) | 1981-04-02 |
| US4366666A (en) | 1983-01-04 |
| GB2107564A (en) | 1983-05-05 |
| DE3050793C2 (de) | 1986-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR2463573A1 (fr) | Faneuse avec organes porteurs et arbres d'entrainement repliables | |
| EP0403409B1 (fr) | Machine agricole pour l'andainage comportant des bras porte-outils repliables | |
| EP1496734B1 (fr) | Machine de fenaison | |
| FR2521823A1 (fr) | Dispositif pour deplacer de la matiere se trouvant sur le sol | |
| EP0763321B1 (fr) | Machine de fenaison | |
| EP0300937B1 (fr) | Machine de fenaison munie de plusieurs roues râteleuses basculables en vue d'un repliement pour le transport ou le remisage | |
| FR2632155A1 (fr) | Machine de fenaison comportant un rotor pour andainer | |
| EP0514302B1 (fr) | Andaineuse de végétaux perfectionnée | |
| FR2578146A1 (fr) | Machine rateleuse | |
| EP0845199B1 (fr) | Machine de fenaison | |
| FR2560737A1 (fr) | Faneuse andaineuse | |
| FR2664127A1 (fr) | Machine agricole, notamment une andaineuse de vegetaux, a largeur de travail reglable. | |
| EP0426588B1 (fr) | Perfectionnement aux machines agricoles destinées notamment à la fenaison | |
| EP0554200B1 (fr) | Machine de fenaison comportant un châssis avec des roues porteuses commandées | |
| FR2759245A1 (fr) | Machine de fenaison avec un dispositif d'appui au sol incluant au moins un balancier avec deux roues porteuses et un moyen pour deplacer ce balancier en vue du transport | |
| FR2474812A1 (fr) | Faneuse presentant des caracteristiques anti-bourrage | |
| EP1111986B1 (fr) | Dispositif de roulement pour engin agricole | |
| FR2549687A1 (fr) | Faneuse avec organes porteurs et arbres d'entrainement repliables | |
| EP0779022B1 (fr) | Machine de fenaison | |
| FR2549686A1 (fr) | Faneuse avec organes porteurs et arbres d'entrainement repliables | |
| FR2687537A1 (fr) | Faneuse. | |
| EP0733302B1 (fr) | Machine de fenaison | |
| EP0593378B1 (fr) | Machine de fenaison pour l'andainage de fourrage | |
| EP0811314B1 (fr) | Machine agricole | |
| FR2462092A1 (fr) | Machine pour la recolte de foin |