FI66346C - Alfa-substituerade benzyl-fenyl-aettiksyre-esterderivat som ae anvaendbara som besticider - Google Patents
Alfa-substituerade benzyl-fenyl-aettiksyre-esterderivat som ae anvaendbara som besticider Download PDFInfo
- Publication number
- FI66346C FI66346C FI2205/73A FI220573A FI66346C FI 66346 C FI66346 C FI 66346C FI 2205/73 A FI2205/73 A FI 2205/73A FI 220573 A FI220573 A FI 220573A FI 66346 C FI66346 C FI 66346C
- Authority
- FI
- Finland
- Prior art keywords
- acid
- compounds
- phenoxybenzyl
- compound
- ester
- Prior art date
Links
- -1 α-Substituted benzyl-phenyl-acetic acid Chemical class 0.000 claims description 34
- 239000000575 pesticide Substances 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000005297 thienyloxy group Chemical group S1C(=CC=C1)O* 0.000 claims description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 84
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 51
- 239000000203 mixture Substances 0.000 description 47
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- 238000002360 preparation method Methods 0.000 description 43
- 239000000243 solution Substances 0.000 description 42
- 239000002253 acid Substances 0.000 description 34
- 150000002148 esters Chemical class 0.000 description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 238000000034 method Methods 0.000 description 25
- 241000255925 Diptera Species 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 239000000126 substance Substances 0.000 description 20
- 239000011521 glass Substances 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 230000000694 effects Effects 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 13
- 238000005886 esterification reaction Methods 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 230000032050 esterification Effects 0.000 description 12
- 229960005235 piperonyl butoxide Drugs 0.000 description 12
- 241000238631 Hexapoda Species 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 11
- 239000000839 emulsion Substances 0.000 description 11
- 150000004820 halides Chemical class 0.000 description 11
- 150000002825 nitriles Chemical class 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- ZCVAOQKBXKSDMS-AQYZNVCMSA-N (+)-trans-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-AQYZNVCMSA-N 0.000 description 9
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 229940024113 allethrin Drugs 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 238000009863 impact test Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 230000000361 pesticidal effect Effects 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 239000012442 inert solvent Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000000443 aerosol Substances 0.000 description 6
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 6
- 150000002168 ethanoic acid esters Chemical class 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 241000238876 Acari Species 0.000 description 5
- 241001674044 Blattodea Species 0.000 description 5
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 5
- 241000256059 Culex pipiens Species 0.000 description 5
- 240000007594 Oryza sativa Species 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 229960003424 phenylacetic acid Drugs 0.000 description 5
- 239000003279 phenylacetic acid Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 150000003459 sulfonic acid esters Chemical class 0.000 description 5
- VSBPRBXTUAKKSY-UHFFFAOYSA-N 5-(5-methyl-1,3-dioxan-4-yl)-1,3-benzodioxole Chemical compound CC1COCOC1C1=CC=C(OCO2)C2=C1 VSBPRBXTUAKKSY-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 206010011906 Death Diseases 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 239000010425 asbestos Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 229960005286 carbaryl Drugs 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 239000000295 fuel oil Substances 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 229940049953 phenylacetate Drugs 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910052895 riebeckite Inorganic materials 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- 238000009736 wetting Methods 0.000 description 4
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 241000238657 Blattella germanica Species 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241001615768 Musca domestica vicina Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 241001674048 Phthiraptera Species 0.000 description 3
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000003158 alcohol group Chemical group 0.000 description 3
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 3
- 231100000053 low toxicity Toxicity 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 3
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 230000000391 smoking effect Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 2
- JEPQMDAOQDKHKY-UHFFFAOYSA-N (4-methoxy-2-propan-2-ylphenyl) acetate Chemical compound COC1=CC=C(OC(C)=O)C(C(C)C)=C1 JEPQMDAOQDKHKY-UHFFFAOYSA-N 0.000 description 2
- UJUNUASMYSTBSK-UHFFFAOYSA-N 1-(bromomethyl)-3-phenoxybenzene Chemical compound BrCC1=CC=CC(OC=2C=CC=CC=2)=C1 UJUNUASMYSTBSK-UHFFFAOYSA-N 0.000 description 2
- HVKBRQVNADDWAP-UHFFFAOYSA-N 2-(4-bromophenyl)-3-methylbutanenitrile Chemical compound CC(C)C(C#N)C1=CC=C(Br)C=C1 HVKBRQVNADDWAP-UHFFFAOYSA-N 0.000 description 2
- CNBUXJALZYSKQJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)-3-methylbutanenitrile Chemical compound COC1=CC=C(C(C#N)C(C)C)C=C1 CNBUXJALZYSKQJ-UHFFFAOYSA-N 0.000 description 2
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 2
- NRPFNQUDKRYCNX-UHFFFAOYSA-N 4-methoxyphenylacetic acid Chemical compound COC1=CC=C(CC(O)=O)C=C1 NRPFNQUDKRYCNX-UHFFFAOYSA-N 0.000 description 2
- 208000035183 Benign hereditary chorea Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 description 2
- 241000256113 Culicidae Species 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- FSYXMFXBRJFYBS-UHFFFAOYSA-N Furamethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=CC=C(CC#C)O1 FSYXMFXBRJFYBS-UHFFFAOYSA-N 0.000 description 2
- 241000258937 Hemiptera Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 241000254152 Sitophilus oryzae Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 241001454295 Tetranychidae Species 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000000642 acaricide Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 235000014121 butter Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 208000012601 choreatic disease Diseases 0.000 description 2
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical class CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- SCKHCCSZFPSHGR-UHFFFAOYSA-N cyanophos Chemical compound COP(=S)(OC)OC1=CC=C(C#N)C=C1 SCKHCCSZFPSHGR-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 2
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- XIMFCGSNSKXPBO-UHFFFAOYSA-N ethyl 2-bromobutanoate Chemical compound CCOC(=O)C(Br)CC XIMFCGSNSKXPBO-UHFFFAOYSA-N 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 230000002147 killing effect Effects 0.000 description 2
- 229960002809 lindane Drugs 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 150000004045 organic chlorine compounds Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000011120 plywood Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- WBOXBLITKKPYHM-UHFFFAOYSA-N (3-methoxy-2-propan-2-ylphenyl) acetate Chemical compound C(C)(=O)OC1=C(C(=CC=C1)OC)C(C)C WBOXBLITKKPYHM-UHFFFAOYSA-N 0.000 description 1
- XLOPRKKSAJMMEW-SFYZADRCSA-M (R,R)-chrysanthemate Chemical compound CC(C)=C[C@@H]1[C@@H](C([O-])=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-M 0.000 description 1
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- KKHFRAFPESRGGD-UHFFFAOYSA-N 1,3-dimethyl-7-[3-(n-methylanilino)propyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCCN(C)C1=CC=CC=C1 KKHFRAFPESRGGD-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- NNMBNYHMJRJUBC-UHFFFAOYSA-N 1-bromo-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(Br)=C1 NNMBNYHMJRJUBC-UHFFFAOYSA-N 0.000 description 1
- DDGRAFHHXYIQQR-UHFFFAOYSA-N 1-chloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1 DDGRAFHHXYIQQR-UHFFFAOYSA-N 0.000 description 1
- BTQZKHUEUDPRST-UHFFFAOYSA-N 1-fluoro-3-methylbenzene Chemical compound CC1=CC=CC(F)=C1 BTQZKHUEUDPRST-UHFFFAOYSA-N 0.000 description 1
- WRWPPGUCZBJXKX-UHFFFAOYSA-N 1-fluoro-4-methylbenzene Chemical compound CC1=CC=C(F)C=C1 WRWPPGUCZBJXKX-UHFFFAOYSA-N 0.000 description 1
- UDONPJKEOAWFGI-UHFFFAOYSA-N 1-methyl-3-phenoxybenzene Chemical compound CC1=CC=CC(OC=2C=CC=CC=2)=C1 UDONPJKEOAWFGI-UHFFFAOYSA-N 0.000 description 1
- XTHIBZBVLKGOEW-UHFFFAOYSA-N 2-(4-bromophenyl)-3-methylbutanoic acid Chemical compound CC(C)C(C(O)=O)C1=CC=C(Br)C=C1 XTHIBZBVLKGOEW-UHFFFAOYSA-N 0.000 description 1
- MFHFWRBXPQDZSA-UHFFFAOYSA-N 2-(4-bromophenyl)acetonitrile Chemical compound BrC1=CC=C(CC#N)C=C1 MFHFWRBXPQDZSA-UHFFFAOYSA-N 0.000 description 1
- ZJZUKKIKLRJIKR-UHFFFAOYSA-N 2-(4-methoxyphenyl)-3-methylbut-3-enoic acid Chemical compound CC(=C)C(C1=CC=C(C=C1)OC)C(=O)O ZJZUKKIKLRJIKR-UHFFFAOYSA-N 0.000 description 1
- OWSOZXBIUKEPTD-UHFFFAOYSA-N 2-(4-methoxyphenyl)-3-methylbutanoic acid Chemical compound COC1=CC=C(C(C(C)C)C(O)=O)C=C1 OWSOZXBIUKEPTD-UHFFFAOYSA-N 0.000 description 1
- PACGLQCRGWFBJH-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1 PACGLQCRGWFBJH-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- QGXMHCMPIAYMGT-UHFFFAOYSA-N 2-phenylbutanoyl chloride Chemical compound CCC(C(Cl)=O)C1=CC=CC=C1 QGXMHCMPIAYMGT-UHFFFAOYSA-N 0.000 description 1
- HLLOQKAJNPXKKB-UHFFFAOYSA-N 2-phenylpent-4-ynoic acid Chemical compound C#CCC(C(=O)O)C1=CC=CC=C1 HLLOQKAJNPXKKB-UHFFFAOYSA-N 0.000 description 1
- SFXXYKYOGGWUHX-UHFFFAOYSA-N 2-phenylpentanoic acid Chemical compound CCCC(C(O)=O)C1=CC=CC=C1 SFXXYKYOGGWUHX-UHFFFAOYSA-N 0.000 description 1
- URIHGOBUQRXIHX-UHFFFAOYSA-N 3-methyl-2-[3-(trifluoromethyl)phenyl]butanoic acid Chemical compound CC(C)C(C(O)=O)C1=CC=CC(C(F)(F)F)=C1 URIHGOBUQRXIHX-UHFFFAOYSA-N 0.000 description 1
- RVMGXWBCQGAWBR-UHFFFAOYSA-N 4-oxo-1-benzopyran-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)=CC(=O)C2=C1 RVMGXWBCQGAWBR-UHFFFAOYSA-N 0.000 description 1
- 241000934067 Acarus Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 241000238421 Arthropoda Species 0.000 description 1
- 241000238658 Blattella Species 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- QIVOXSXGLHGTNI-UHFFFAOYSA-N C(C)(=O)OC1=C(C(=C(C=C1)CC1=CC=CC=C1)OC1=CC=CC=C1)CC Chemical compound C(C)(=O)OC1=C(C(=C(C=C1)CC1=CC=CC=C1)OC1=CC=CC=C1)CC QIVOXSXGLHGTNI-UHFFFAOYSA-N 0.000 description 1
- WRUDQKIVDMYMRB-UHFFFAOYSA-N C(C)C(C(=O)OC(C(CC)C1=CC=C(C=C1)OC)=O)C1=CC=C(C=C1)OC Chemical compound C(C)C(C(=O)OC(C(CC)C1=CC=C(C=C1)OC)=O)C1=CC=C(C=C1)OC WRUDQKIVDMYMRB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 240000008886 Ceratonia siliqua Species 0.000 description 1
- 235000013912 Ceratonia siliqua Nutrition 0.000 description 1
- 241000426497 Chilo suppressalis Species 0.000 description 1
- STUSTWKEFDQFFZ-UHFFFAOYSA-N Chlordimeform Chemical compound CN(C)C=NC1=CC=C(Cl)C=C1C STUSTWKEFDQFFZ-UHFFFAOYSA-N 0.000 description 1
- 241001437994 Cicadula Species 0.000 description 1
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 1
- 241001301805 Epilachna Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PNVJTZOFSHSLTO-UHFFFAOYSA-N Fenthion Chemical compound COP(=S)(OC)OC1=CC=C(SC)C(C)=C1 PNVJTZOFSHSLTO-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001470017 Laodelphax striatella Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- CRZQGDNQQAALAY-UHFFFAOYSA-N Me ester-Phenylacetic acid Natural products COC(=O)CC1=CC=CC=C1 CRZQGDNQQAALAY-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- 241000359016 Nephotettix Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 241000256259 Noctuidae Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 241001480169 Phaseolus maculatus Species 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- 241000907661 Pieris rapae Species 0.000 description 1
- BHUIUXNAPJIDOG-UHFFFAOYSA-N Piperonol Chemical compound OCC1=CC=C2OCOC2=C1 BHUIUXNAPJIDOG-UHFFFAOYSA-N 0.000 description 1
- 241000500437 Plutella xylostella Species 0.000 description 1
- 244000088415 Raphanus sativus Species 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- CVQODEWAPZVVBU-UHFFFAOYSA-N XMC Chemical compound CNC(=O)OC1=CC(C)=CC(C)=C1 CVQODEWAPZVVBU-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- BXEHKCUWIODEDE-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methanol Chemical compound OCC1=CC=CC(C(F)(F)F)=C1 BXEHKCUWIODEDE-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000005667 attractant Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- AQXSIEAUQGUXBG-UHFFFAOYSA-N benzene;hex-1-ene Chemical compound CCCCC=C.C1=CC=CC=C1 AQXSIEAUQGUXBG-UHFFFAOYSA-N 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 229950002478 chromocarb Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- HJSLFCCWAKVHIW-UHFFFAOYSA-N cyclohexane-1,3-dione Chemical compound O=C1CCCC(=O)C1 HJSLFCCWAKVHIW-UHFFFAOYSA-N 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- UNVUUVYPBGPMGH-UHFFFAOYSA-N diethyl 2-phenyl-2-prop-2-enylpropanedioate Chemical compound CCOC(=O)C(CC=C)(C(=O)OCC)C1=CC=CC=C1 UNVUUVYPBGPMGH-UHFFFAOYSA-N 0.000 description 1
- FGYDHYCFHBSNPE-UHFFFAOYSA-N diethyl phenylmalonate Chemical compound CCOC(=O)C(C(=O)OCC)C1=CC=CC=C1 FGYDHYCFHBSNPE-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 208000002173 dizziness Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- NRGIEIOYKGORCY-UHFFFAOYSA-N ethyl 2,3-diethyl-3-hydroxypentanoate Chemical compound CCOC(=O)C(CC)C(O)(CC)CC NRGIEIOYKGORCY-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 208000034199 familial abdominal 4 aortic aneurysm Diseases 0.000 description 1
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 238000010413 gardening Methods 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000008676 import Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000077 insect repellent Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- PBMIETCUUSQZCG-UHFFFAOYSA-N n'-cyclohexylmethanediimine Chemical compound N=C=NC1CCCCC1 PBMIETCUUSQZCG-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- SBNFWQZLDJGRLK-UHFFFAOYSA-N phenothrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 SBNFWQZLDJGRLK-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- VEMKTZHHVJILDY-UHFFFAOYSA-N resmethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UHFFFAOYSA-N 0.000 description 1
- 210000004767 rumen Anatomy 0.000 description 1
- MSHXTAQSSIEBQS-UHFFFAOYSA-N s-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydron;chloride Chemical compound [Cl-].NC(=O)SCC([NH+](C)C)CSC(N)=O MSHXTAQSSIEBQS-UHFFFAOYSA-N 0.000 description 1
- 108091007548 scavenger receptor class K Proteins 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- CXBMCYHAMVGWJQ-UHFFFAOYSA-N tetramethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCN1C(=O)C(CCCC2)=C2C1=O CXBMCYHAMVGWJQ-UHFFFAOYSA-N 0.000 description 1
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 239000006200 vaporizer Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/08—Preparation of carboxylic acids or their salts, halides or anhydrides from nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C57/42—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/608—Esters of carboxylic acids having a carboxyl group bound to an acyclic carbon atom and having a ring other than a six-membered aromatic ring in the acid moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/612—Esters of carboxylic acids having a carboxyl group bound to an acyclic carbon atom and having a six-membered aromatic ring in the acid moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/612—Esters of carboxylic acids having a carboxyl group bound to an acyclic carbon atom and having a six-membered aromatic ring in the acid moiety
- C07C69/618—Esters of carboxylic acids having a carboxyl group bound to an acyclic carbon atom and having a six-membered aromatic ring in the acid moiety having unsaturation outside the six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/62—Halogen-containing esters
- C07C69/65—Halogen-containing esters of unsaturated acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/734—Ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/738—Esters of keto-carboxylic acids or aldehydo-carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/08—One of the condensed rings being a six-membered aromatic ring the other ring being five-membered, e.g. indane
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/10—One of the condensed rings being a six-membered aromatic ring the other ring being six-membered, e.g. tetraline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Furan Compounds (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI3537/74A FI66345C (fi) | 1972-07-11 | 1974-12-09 | Som pesticider anvaendbara alfa-substituerade 2'-cyklopenten-1'-on-4'-yl-fenylaettiksyrederivat |
| FI812079A FI78294C (fi) | 1972-07-11 | 1981-07-01 | Estrar av fenylaettiksyra, vilka innehaoller en heterocyklisk grupp och aer anvaendbara som skadeinsektigifter. |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6980572A JPS564522B2 (index.php) | 1972-07-11 | 1972-07-11 | |
| JP6980572 | 1972-07-11 | ||
| JP4480973 | 1973-04-19 | ||
| JP48044809A JPS5133612B2 (index.php) | 1973-04-19 | 1973-04-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI66346B FI66346B (fi) | 1984-06-29 |
| FI66346C true FI66346C (fi) | 1984-10-10 |
Family
ID=26384773
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI2205/73A FI66346C (fi) | 1972-07-11 | 1973-07-11 | Alfa-substituerade benzyl-fenyl-aettiksyre-esterderivat som ae anvaendbara som besticider |
Country Status (30)
| Country | Link |
|---|---|
| US (3) | US3996244A (index.php) |
| AT (1) | AT341510B (index.php) |
| AU (1) | AU475379B2 (index.php) |
| BG (1) | BG21174A3 (index.php) |
| CA (1) | CA1023370A (index.php) |
| CH (1) | CH585688A5 (index.php) |
| CS (1) | CS207554B2 (index.php) |
| DD (1) | DD108737A1 (index.php) |
| DE (1) | DE2365555A1 (index.php) |
| DK (1) | DK153467C (index.php) |
| EG (1) | EG11383A (index.php) |
| ES (1) | ES416790A1 (index.php) |
| FI (1) | FI66346C (index.php) |
| FR (2) | FR2241533B1 (index.php) |
| GB (2) | GB1439615A (index.php) |
| HK (1) | HK12677A (index.php) |
| HU (3) | HU184524B (index.php) |
| IL (1) | IL42703A (index.php) |
| IN (1) | IN138895B (index.php) |
| IT (1) | IT989803B (index.php) |
| KE (1) | KE2717A (index.php) |
| MY (1) | MY7700167A (index.php) |
| NL (1) | NL166009C (index.php) |
| NO (1) | NO141752C (index.php) |
| PH (1) | PH13884A (index.php) |
| PL (1) | PL104464B1 (index.php) |
| RO (1) | RO68448A (index.php) |
| SE (1) | SE412228B (index.php) |
| SU (1) | SU627749A3 (index.php) |
| YU (1) | YU40252B (index.php) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4100363A (en) * | 1975-05-23 | 1978-07-11 | Shell Oil Company | 2-Substituted isovaleric acid ester pesticides |
| US4196215A (en) | 1975-06-19 | 1980-04-01 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Alkyne compounds and method of use |
| JPS5941966B2 (ja) | 1975-10-21 | 1984-10-11 | 住友化学工業株式会社 | ガイチユウボウジヨソセイブツ オヨビ ソノセイゾウホウ |
| US4242357A (en) * | 1976-04-09 | 1980-12-30 | Bayer Aktiengesellschaft | Carboxylic acid esters for combating pests |
| GB1518509A (en) * | 1976-04-12 | 1978-07-19 | Ici Ltd | Insecticidal esters |
| GB1580193A (en) * | 1976-04-22 | 1980-11-26 | Nat Res Dev | Phenyl acetic acid derivatives |
| US4130656A (en) * | 1976-07-29 | 1978-12-19 | Ciba-Geigy Corporation | Pesticidal 1-(phenyl)-cyclobutane-1-carboxylates |
| JPS5324019A (en) * | 1976-08-18 | 1978-03-06 | Sumitomo Chem Co Ltd | Inspecticide comprising optically active isomer of alpha-cyano-3-phenoxybenzyl-2-(4-chlorophenyl)-isovalerate as an effective component |
| LV5150A3 (lv) * | 1976-08-18 | 1993-10-10 | Sumitomo Chemical Co | Insekticida kompozicija |
| EG12885A (en) * | 1976-09-30 | 1980-12-31 | Ciba Geigy Ag | Process for preparing of 2-isopropyl-4-phenyl 3-butenoic acid benzyl esters used as pesticides |
| US4239777A (en) * | 1976-10-01 | 1980-12-16 | American Cyanamid Company | (-)-α-Cyano-m-phenoxybenzyl(+)-α-isopropyl-4-difluoromethoxyphenylacetate |
| GB1592691A (en) * | 1976-10-05 | 1981-07-08 | Ici Australia Ltd | Stabilised tickicidal compositions |
| US4161536A (en) * | 1976-11-12 | 1979-07-17 | Ciba-Geigy Corporation | Pesticidal aliphatic carboxylates |
| GB1595081A (en) * | 1977-02-08 | 1981-08-05 | Shell Int Research | Pesticidal composition |
| GB1594462A (en) * | 1977-02-09 | 1981-07-30 | Shell Int Research | Pesticidal composition |
| IL53946A0 (en) * | 1977-03-03 | 1978-04-30 | American Cyanamid Co | Phenoxybenzyl esters of benzodioxole acetic acids |
| DE2709264C3 (de) * | 1977-03-03 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | Substituierte Phenoxybenzyloxycarbonylderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide und Akarizide sowie neue Zwischenprodukte |
| US4409238A (en) * | 1977-03-11 | 1983-10-11 | Kuraray Co., Ltd. | Insecticides and insecticidal compositions |
| GB1594299A (en) * | 1977-06-10 | 1981-07-30 | Sumitomo Chemical Co | Chloro- alkoxy- and alkyl-substituted aryl carboxylates processes for producing them and their acaricidal and insecticidal use |
| CH635563A5 (fr) * | 1977-07-07 | 1983-04-15 | Sumitomo Chemical Co | Procede pour la preparation d'un alpha-cyano-3-phenoxybenzyle optiquement actif. |
| EP0000508B1 (de) * | 1977-07-20 | 1981-09-02 | Ciba-Geigy Ag | Phenylacetate von 2-Oxy-Pyridyl, Verfahren zu deren Herstellung und deren Verwendung als Schädlingsbekämpfungsmittel |
| EP0000962B1 (en) * | 1977-08-10 | 1981-11-18 | Shell Internationale Researchmaatschappij B.V. | Pesticidal composition and method of combating pests |
| DE2739854A1 (de) * | 1977-09-03 | 1979-03-15 | Bayer Ag | Fluorsubstituierte phenoxybenzyloxycarbonylderivate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| CA1123003A (en) * | 1977-09-28 | 1982-05-04 | Arend Reinink | Preparation of alpha-cyanobenzyl esters |
| DE2750030A1 (de) * | 1977-11-09 | 1979-05-10 | Basf Ag | Insektizide mittel |
| US4153626A (en) * | 1977-12-14 | 1979-05-08 | Shell Oil Company | Preparation of α-cyanobenzyl esters |
| JPS54103831A (en) * | 1978-01-27 | 1979-08-15 | Sumitomo Chem Co Ltd | Separation of stereoisomers of higher active cyanoo33 phenoxybenzyl 22*44chlorophenyl**isovalerate |
| EP0005563B1 (en) * | 1978-04-12 | 1981-10-21 | Shell Internationale Researchmaatschappij B.V. | Pesticidal compositions and their use |
| US4267359A (en) * | 1978-05-04 | 1981-05-12 | Zoecon Corporation | Novel carboxylic acid esters |
| NL7904833A (nl) * | 1978-06-26 | 1979-12-28 | Ciba Geigy | Esters van alpha-isopropyl-alpha-fenyl-thiolazijnzuur, werkwijzen voor de bereiding daarvan en de toepassing daarvan als middel ter bestrijding van schadelijke organismen. |
| US4230722A (en) * | 1978-06-26 | 1980-10-28 | Ciba-Geigy Corporation | Dihalovinylcyclopropanethiolic acid esters and their use in pest control |
| US4176195A (en) * | 1978-07-20 | 1979-11-27 | Sumitomo Chemical Company, Limited | Pesticidal α-cyanobenzyl ester enantiomer pair |
| US4217302A (en) * | 1978-07-24 | 1980-08-12 | Zoecon Corporation | Phenoxybenzyl 2-indenyl-3-methylbutanoates |
| WO1980000563A1 (en) * | 1978-09-14 | 1980-04-03 | Sorex Ltd | Substituted acetic acid esters |
| US4151293A (en) * | 1978-10-23 | 1979-04-24 | Abbott Laboratories | Insecticidal pyrazole-4-methanol esters |
| EP0011893B1 (en) * | 1978-11-29 | 1982-06-09 | Shell Internationale Researchmaatschappij B.V. | Pesticidal composition and method of combating pests |
| DE3062656D1 (en) * | 1979-02-21 | 1983-05-19 | Shell Int Research | Pesticidal compositions and their use |
| FR2471187A1 (fr) * | 1979-12-10 | 1981-06-19 | Roussel Uclaf | Nouvelles compositions destinees a la lutte contre les parasites des animaux a sang chaud |
| US4291057A (en) * | 1979-07-02 | 1981-09-22 | Union Carbide Corporation | Biocidal esters of halo-4-alkenoic acids |
| GB2058065B (en) * | 1979-09-07 | 1983-07-06 | Nippon Soda Co | Pesticidal isovaleric acid derivatives |
| US4308262A (en) * | 1979-09-18 | 1981-12-29 | Shell Oil Company | Pyrethroid pesticidal compositions |
| US4254051A (en) | 1979-09-27 | 1981-03-03 | Fmc Corporation | Preparation of esters |
| US4254050A (en) | 1979-09-27 | 1981-03-03 | Fmc Corporation | Preparation of esters |
| US4254052A (en) | 1979-09-27 | 1981-03-03 | Fmc Corporation | Preparation of esters |
| JPS57500147A (index.php) * | 1979-11-15 | 1982-01-28 | ||
| US4297370A (en) | 1979-11-27 | 1981-10-27 | E. I. Du Pont De Nemours And Company | Insecticidal compositions |
| US4299776A (en) | 1979-12-13 | 1981-11-10 | Fmc Corporation | Preparation of esters |
| JPS57163306A (en) | 1980-02-01 | 1982-10-07 | Hoffmann La Roche | Insecticidal composition |
| US4322534A (en) | 1980-06-06 | 1982-03-30 | Fmc Corporation | Preparation of esters |
| US4322535A (en) | 1980-06-13 | 1982-03-30 | Fmc Corporation | Preparation of esters |
| US4323685A (en) | 1980-06-13 | 1982-04-06 | Fmc Corporation | Preparation of esters |
| DE3044010A1 (de) | 1980-11-22 | 1982-06-24 | Hoechst Ag, 6000 Frankfurt | Phenoxybenzylester, ihre herstellung und ihre verwendung als pflanzenschutzmittel und im veterinaermedizinischen bereich |
| DE3166207D1 (en) * | 1980-11-25 | 1984-10-25 | Ciba Geigy Ag | Pesticide agents |
| US4311696A (en) * | 1981-02-12 | 1982-01-19 | E. I. Du Pont De Nemours And Company | Substituted butanoic acid esters |
| US4547360A (en) * | 1983-01-14 | 1985-10-15 | The Hartz Mountain Corporation | Method and compositions for repelling pests |
| GB8309855D0 (en) * | 1983-04-12 | 1983-05-18 | Tate & Lyle Plc | Flavour modifiers |
| DE3531257A1 (de) * | 1985-08-31 | 1987-03-12 | Desowag Bayer Holzschutz Gmbh | Mittel oder konzentrat zum konservieren von holz und holzwerkstoffen |
| DE3602169A1 (de) | 1986-01-22 | 1987-07-23 | Schering Ag | Neue alkan- und alkoxyalkanderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende insektizide und akarizide mittel |
| JP2717602B2 (ja) * | 1990-01-16 | 1998-02-18 | 富士写真フイルム株式会社 | 感光性組成物 |
| US5129217A (en) * | 1991-02-14 | 1992-07-14 | Ransomes, Inc. | Multiblade mulching mower |
| WO2000062615A1 (en) | 1999-04-21 | 2000-10-26 | University Of Florida Research Foundation, Inc. | Neuropeptides and their use for pest control |
| US6593299B1 (en) | 1999-04-21 | 2003-07-15 | University Of Florida Research Foundation, Inc. | Compositions and methods for controlling pests |
| DE19953775A1 (de) | 1999-11-09 | 2001-05-10 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10007411A1 (de) | 2000-02-18 | 2001-08-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| WO2001070219A1 (en) * | 2000-03-21 | 2001-09-27 | Emisphere Technologies, Inc. | Method of preparing alkylated salicylamides via a dicarboxylate intermediate |
| AR029677A1 (es) | 2000-06-29 | 2003-07-10 | Bayer Ag | Combinaciones de compuestos activos con propiedades insecticidas y acaricidas |
| DE102004001271A1 (de) * | 2004-01-08 | 2005-08-04 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| DE102004006324A1 (de) * | 2004-02-10 | 2005-08-25 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| US20090281157A1 (en) * | 2006-07-11 | 2009-11-12 | Bayer Cropscience Ag | Active Ingredient Combinations With Insecticidal and Acaricidal Properties |
| DE102006046688B3 (de) * | 2006-09-29 | 2008-01-24 | Siemens Ag | Kälteanlage mit einem warmen und einem kalten Verbindungselement und einem mit den Verbindungselementen verbundenen Wärmerohr |
| EP2068633A1 (de) * | 2006-09-30 | 2009-06-17 | Bayer CropScience Aktiengesellschaft | Suspensionskonzentrate zur verbesserung der wurzelaufnahme von agrochemischen wirkstoffen |
| EP2039248A1 (de) * | 2007-09-21 | 2009-03-25 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| CA2723616C (en) * | 2008-05-07 | 2017-10-31 | Bayer Cropscience Ag | Synergistic combinations comprising a sulfoximine insecticide |
| KR101647706B1 (ko) | 2009-03-25 | 2016-08-11 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 살충 및 살비성을 지니는 활성 성분 배합물 |
| JP7538380B1 (ja) * | 2023-12-22 | 2024-08-21 | 住友化学株式会社 | エステル化合物及びその用途 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK69223C (da) * | 1944-04-26 | 1949-05-16 | Geigy Ag J R | Middel til beskyttelse mod og udryddelse af skadedyr. |
| FR919193A (fr) * | 1944-12-21 | 1947-02-28 | Geigy Ag J R | Produits antiparasitaires |
| FR919197A (fr) * | 1944-12-21 | 1947-02-28 | Geigy Ag J R | Esters et leur procédé de préparation |
| DK83924C (da) * | 1949-02-08 | 1957-12-02 | Fmc Corp | Insekticid. |
| GB1021014A (en) * | 1963-07-19 | 1966-02-23 | Shell Res Ltd | Novel herbicidal compounds and compositions |
| FR1495793A (fr) * | 1965-10-08 | 1967-09-22 | Merck & Co Inc | Procédé de fabrication d'acides alpha-(alkyl inférieur)-phénylacétiques à partir des cétones correspondantes |
| GB1117625A (en) * | 1966-08-24 | 1968-06-19 | Rexall Drug Chemical | Substituted phthalans |
| AT278441B (de) * | 1966-10-28 | 1970-01-26 | Sumitomo Chemical Co | Insektizide mischung |
| BE718930A (index.php) * | 1968-08-01 | 1969-02-03 | ||
| DE1793312A1 (de) * | 1968-08-29 | 1971-07-08 | Basf Ag | Substituierte Chrysanthemumsaeureester und diese enthaltende Schaedlingsbekaempfungsmittel |
| AT292682B (de) * | 1968-10-23 | 1971-09-10 | Heilmittelwerke Wien Ges Mit B | Verfahren zur Herstellung neuer basischer Ester und deren Salze |
| US3573304A (en) * | 1968-12-03 | 1971-03-30 | Delalande Sa | 1-dimethylamino - 3 - methyl-2(pyridyl or pyridazinyl) pentane and the corresponding non-toxic acid addition salts thereof |
| US3666789A (en) * | 1969-05-21 | 1972-05-30 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| FR2054532A1 (en) * | 1969-07-30 | 1971-04-23 | Bouchara Emile | Antiinflammatory, analgesic o-hydroxy-phenyl |
| AU432259B1 (en) * | 1970-02-26 | 1972-08-24 | Sumitomo Chemical Company, Limited | Novel substituted chrysanthemates |
| JPS4821487B1 (index.php) * | 1970-08-04 | 1973-06-29 | ||
| JPS515450B1 (index.php) * | 1971-06-29 | 1976-02-20 | ||
| US4062968A (en) * | 1972-07-11 | 1977-12-13 | Sumitomo Chemical Company, Limited | Insecticidal substituted acetate compounds |
| US3888920A (en) * | 1973-08-06 | 1975-06-10 | Sandoz Ag | Aryl substituted-4-alkenoic acids |
-
1973
- 1973-06-26 EG EG245/73A patent/EG11383A/xx active
- 1973-07-06 NL NL7309483.A patent/NL166009C/xx not_active IP Right Cessation
- 1973-07-09 IT IT51335/73A patent/IT989803B/it active
- 1973-07-09 CH CH996373A patent/CH585688A5/xx not_active IP Right Cessation
- 1973-07-09 NO NO2805/73A patent/NO141752C/no unknown
- 1973-07-10 HU HU73SU956A patent/HU184524B/hu unknown
- 1973-07-10 HU HU73SU957A patent/HU185369B/hu unknown
- 1973-07-10 PH PH14808A patent/PH13884A/en unknown
- 1973-07-10 IL IL42703A patent/IL42703A/xx unknown
- 1973-07-10 DK DK383073A patent/DK153467C/da not_active IP Right Cessation
- 1973-07-10 YU YU1867/73A patent/YU40252B/xx unknown
- 1973-07-10 HU HU73SU824A patent/HU173393B/hu unknown
- 1973-07-10 SE SE7309685A patent/SE412228B/sv unknown
- 1973-07-10 DD DD172194A patent/DD108737A1/xx unknown
- 1973-07-10 RO RO7375418A patent/RO68448A/ro unknown
- 1973-07-10 SU SU731953201A patent/SU627749A3/ru active
- 1973-07-11 FI FI2205/73A patent/FI66346C/fi active
- 1973-07-11 AU AU57996/73A patent/AU475379B2/en not_active Expired
- 1973-07-11 DE DE2365555*A patent/DE2365555A1/de active Granted
- 1973-07-11 ES ES416790A patent/ES416790A1/es not_active Expired
- 1973-07-11 FR FR7325476A patent/FR2241533B1/fr not_active Expired
- 1973-07-11 CA CA176,185A patent/CA1023370A/en not_active Expired
- 1973-07-11 GB GB3316273A patent/GB1439615A/en not_active Expired
- 1973-07-11 BG BG024084A patent/BG21174A3/xx unknown
- 1973-07-11 GB GB1356375A patent/GB1439616A/en not_active Expired
- 1973-07-11 US US05/378,301 patent/US3996244A/en not_active Expired - Lifetime
- 1973-07-11 CS CS734989A patent/CS207554B2/cs unknown
- 1973-07-11 AT AT608673A patent/AT341510B/de not_active IP Right Cessation
- 1973-07-11 IN IN1633/CAL/73A patent/IN138895B/en unknown
- 1973-07-11 PL PL1973163997A patent/PL104464B1/pl unknown
-
1974
- 1974-07-01 FR FR7422886A patent/FR2216919B1/fr not_active Expired
-
1975
- 1975-07-16 US US05/596,332 patent/US4266074A/en not_active Expired - Lifetime
-
1977
- 1977-03-10 HK HK126/77A patent/HK12677A/xx unknown
- 1977-03-30 KE KE2717A patent/KE2717A/xx unknown
- 1977-12-30 MY MY167/77A patent/MY7700167A/xx unknown
-
1983
- 1983-05-23 US US06/497,289 patent/US4531008A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66346C (fi) | Alfa-substituerade benzyl-fenyl-aettiksyre-esterderivat som ae anvaendbara som besticider | |
| DE2547534C2 (de) | Cyclopropancarbonsäureester, Verfahren zu deren Herstellung und deren Verwendung | |
| CS196253B2 (en) | Insecticide and process for preparing effective compound thereof | |
| JPH0112742B2 (index.php) | ||
| NZ190621A (en) | Esters with pyrethrin acid or pyrethroid type acid moiety;insecticidal and acaricidal compositions;intermediates | |
| GB2066810A (en) | Fluorinated benzyl esters of cyclopropane carboxylic acids | |
| DK159430B (da) | Hydantoin-n-methylestere til anvendelse i insekticider og acaricider samt insekticider og acaricider indeholdende saadanne forbindelser samt anvendelse af hydantoin-n-methylesterne som insekticider og acaricider | |
| US4496586A (en) | Cyclopropanecarboxylates, their production and insecticide containing them as an active ingredient | |
| US4309439A (en) | Substituted-acetic acid ester | |
| GB2055822A (en) | Carboxylic ester compounds for use as insecticides | |
| AU595796B2 (en) | Novel carboxylic acid esters, methods for production thereof and insecticides containing them as the active ingredient | |
| PL135350B1 (pl) | Method of obtaining novel pyretroides and insecticide and/or acaricide | |
| US3857863A (en) | Certain furylmethyl and thenyl esters of certain cyclopropane carboxylic acids | |
| US5574194A (en) | 2,6-bis-(trifluoromethyl)-benzyl alcohol | |
| AP97A (en) | Fluorobenzyl esters. | |
| US5504112A (en) | Pyrethrinoid esters | |
| US4599358A (en) | Pyrethroids | |
| FI78294C (fi) | Estrar av fenylaettiksyra, vilka innehaoller en heterocyklisk grupp och aer anvaendbara som skadeinsektigifter. | |
| NL8001267A (nl) | Nieuwe pyrethroiden. | |
| KR790000843B1 (ko) | 치환 아세테이트의 제조방법 | |
| JPH0429668B2 (index.php) | ||
| DE2335347C3 (de) | Substituierte Essigsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Pestizide | |
| JPH05310641A (ja) | 2,2−ジメチル−3−[(2,2−ジフルオルシクロプロピリデン)メチルシクロプロパンカルボン酸の新誘導体、それらの製造法及びそれらの有害生物駆除剤としての用途 | |
| JPS6042220B2 (ja) | 置換酢酸エステル、その製造法およびそのエステルからなる殺虫、殺ダニ剤 | |
| JPS6221776B2 (index.php) |