FI59408C - Foerfarande foer framstaellning av farmakologiskt vaerdefulla bensimidazoler - Google Patents
Foerfarande foer framstaellning av farmakologiskt vaerdefulla bensimidazoler Download PDFInfo
- Publication number
- FI59408C FI59408C FI751700A FI751700A FI59408C FI 59408 C FI59408 C FI 59408C FI 751700 A FI751700 A FI 751700A FI 751700 A FI751700 A FI 751700A FI 59408 C FI59408 C FI 59408C
- Authority
- FI
- Finland
- Prior art keywords
- oxo
- phenyl
- benzimidazole
- dihydro
- pyridazinyl
- Prior art date
Links
- 230000000144 pharmacologic effect Effects 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 32
- -1 hydroxy, methylmercapto, methylsulfinyl Chemical group 0.000 claims description 29
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 5
- 150000001556 benzimidazoles Chemical class 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 235000005985 organic acids Nutrition 0.000 claims description 4
- 230000003647 oxidation Effects 0.000 claims description 4
- 238000007254 oxidation reaction Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 claims description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 241000277284 Salvelinus fontinalis Species 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 96
- 238000002844 melting Methods 0.000 description 59
- 230000008018 melting Effects 0.000 description 59
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 53
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 43
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 31
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 24
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 24
- 229960000583 acetic acid Drugs 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 239000012362 glacial acetic acid Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 13
- 238000001816 cooling Methods 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000003480 eluent Substances 0.000 description 9
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 4
- LBAHWBJTZGANAH-UHFFFAOYSA-N 3-(3,4-diaminophenyl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound C1=C(N)C(N)=CC=C1C1=NNC(=O)CC1 LBAHWBJTZGANAH-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000003276 anti-hypertensive effect Effects 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 102000008186 Collagen Human genes 0.000 description 3
- 108010035532 Collagen Proteins 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229920001436 collagen Polymers 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- KJJBWKVNOLDBAY-UHFFFAOYSA-N (4-methoxyphenyl)-morpholin-4-ylmethanethione Chemical compound C1=CC(OC)=CC=C1C(=S)N1CCOCC1 KJJBWKVNOLDBAY-UHFFFAOYSA-N 0.000 description 2
- GPLJKMBFECYYKO-UHFFFAOYSA-N 2,4-dimethoxy-n-[2-nitro-4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]benzamide Chemical compound COC1=CC(OC)=CC=C1C(=O)NC1=CC=C(C=2CCC(=O)NN=2)C=C1[N+]([O-])=O GPLJKMBFECYYKO-UHFFFAOYSA-N 0.000 description 2
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 2
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- VTPJKYGDFVHSKP-UHFFFAOYSA-N 3-(3,4-diaminophenyl)-1h-pyridazin-6-one Chemical compound C1=C(N)C(N)=CC=C1C1=NNC(=O)C=C1 VTPJKYGDFVHSKP-UHFFFAOYSA-N 0.000 description 2
- UOKRAZLPPUKITH-UHFFFAOYSA-N 3-(4-amino-3-nitrophenyl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C1=NNC(=O)CC1 UOKRAZLPPUKITH-UHFFFAOYSA-N 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- DIWCEXAEVKWBCZ-UHFFFAOYSA-N 4-(4-acetamido-3-nitrophenyl)-4-oxobutanoic acid Chemical compound CC(=O)NC1=CC=C(C(=O)CCC(O)=O)C=C1[N+]([O-])=O DIWCEXAEVKWBCZ-UHFFFAOYSA-N 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 230000003177 cardiotonic effect Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- AZKPWOWADZZORR-UHFFFAOYSA-N methyl 4-[3-amino-4-(2-methylpropanoylamino)phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(NC(=O)C(C)C)C(N)=C1 AZKPWOWADZZORR-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- XLIUDYMPNOIEOY-UHFFFAOYSA-N n-[2-amino-4-(1-methyl-6-oxo-4,5-dihydropyridazin-3-yl)phenyl]acetamide Chemical compound C1CC(=O)N(C)N=C1C1=CC=C(NC(C)=O)C(N)=C1 XLIUDYMPNOIEOY-UHFFFAOYSA-N 0.000 description 2
- UVGCXWUMXKYVBH-UHFFFAOYSA-N n-[2-nitro-4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC=C1C1=NNC(=O)CC1 UVGCXWUMXKYVBH-UHFFFAOYSA-N 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 210000004623 platelet-rich plasma Anatomy 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 230000009090 positive inotropic effect Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- KVIUXRJCBBXEGJ-UHFFFAOYSA-N 2,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C(OC)=C1 KVIUXRJCBBXEGJ-UHFFFAOYSA-N 0.000 description 1
- TZFBWYPCMVLDNI-UHFFFAOYSA-N 2-fluoro-n-[2-nitro-4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]benzamide Chemical compound [O-][N+](=O)C1=CC(C=2CCC(=O)NN=2)=CC=C1NC(=O)C1=CC=CC=C1F TZFBWYPCMVLDNI-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- AIRRELHUAAZTTL-UHFFFAOYSA-N 3-nitrobenzenesulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 AIRRELHUAAZTTL-UHFFFAOYSA-N 0.000 description 1
- SSWTVKKFWKJDHO-UHFFFAOYSA-N 4-(4-amino-3-nitrophenyl)-4-oxobutanoic acid Chemical compound NC1=CC=C(C(=O)CCC(O)=O)C=C1[N+]([O-])=O SSWTVKKFWKJDHO-UHFFFAOYSA-N 0.000 description 1
- ULIIJMHCWYIWNT-UHFFFAOYSA-N 4-(dimethylamino)-n-[2-nitro-4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]benzamide Chemical compound C1=CC(N(C)C)=CC=C1C(=O)NC1=CC=C(C=2CCC(=O)NN=2)C=C1[N+]([O-])=O ULIIJMHCWYIWNT-UHFFFAOYSA-N 0.000 description 1
- XETHRNHGJIZCQR-UHFFFAOYSA-N 4-[4-(2-methylpropanoylamino)-3-nitrophenyl]-4-oxobutanoic acid Chemical compound CC(C)C(=O)NC1=CC=C(C(=O)CCC(O)=O)C=C1[N+]([O-])=O XETHRNHGJIZCQR-UHFFFAOYSA-N 0.000 description 1
- AJOSDIDPIBJFAI-UHFFFAOYSA-N 4-methoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.COC1=CC=C(C(N)=N)C=C1 AJOSDIDPIBJFAI-UHFFFAOYSA-N 0.000 description 1
- DBOKGVHKRYFRTP-UHFFFAOYSA-N 4-methylsulfanyl-n-[2-nitro-4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]benzamide Chemical compound C1=CC(SC)=CC=C1C(=O)NC1=CC=C(C=2CCC(=O)NN=2)C=C1[N+]([O-])=O DBOKGVHKRYFRTP-UHFFFAOYSA-N 0.000 description 1
- QGEWVCQFZUXKFY-UHFFFAOYSA-N 6-(3,4-diaminophenyl)-2-methyl-4,5-dihydropyridazin-3-one Chemical compound C1CC(=O)N(C)N=C1C1=CC=C(N)C(N)=C1 QGEWVCQFZUXKFY-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- PDVCYNPIPVCKFO-UHFFFAOYSA-N NC1=C(C=C(C=C1)C=1CCC=CC1N1N=CC=CC1=O)[N+](=O)[O-] Chemical compound NC1=C(C=C(C=C1)C=1CCC=CC1N1N=CC=CC1=O)[N+](=O)[O-] PDVCYNPIPVCKFO-UHFFFAOYSA-N 0.000 description 1
- JQKLEVRHGNRQNV-UHFFFAOYSA-N NC=1C=C(C=CC1N)C1=CC=C(NN1)O Chemical compound NC=1C=C(C=CC1N)C1=CC=C(NN1)O JQKLEVRHGNRQNV-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 210000005242 cardiac chamber Anatomy 0.000 description 1
- OJYGBLRPYBAHRT-IPQSZEQASA-N chloralose Chemical compound O1[C@H](C(Cl)(Cl)Cl)O[C@@H]2[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]21 OJYGBLRPYBAHRT-IPQSZEQASA-N 0.000 description 1
- 229950009941 chloralose Drugs 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- UZEDIBTVIIJELN-UHFFFAOYSA-N chromium(2+) Chemical class [Cr+2] UZEDIBTVIIJELN-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- WREDNSAXDZCLCP-UHFFFAOYSA-N methanedithioic acid Chemical compound SC=S WREDNSAXDZCLCP-UHFFFAOYSA-N 0.000 description 1
- RPCKQIPGXXQLKH-UHFFFAOYSA-N methyl 4-[3-amino-4-[(4-methoxybenzoyl)amino]phenyl]-4-oxobutanoate Chemical compound COC(CCC(=O)C1=CC(=C(C=C1)NC(C1=CC=C(C=C1)OC)=O)N)=O RPCKQIPGXXQLKH-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229940105631 nembutal Drugs 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- BNZYBNYNPXKWCM-UHFFFAOYSA-N phenyl 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=CC=C1 BNZYBNYNPXKWCM-UHFFFAOYSA-N 0.000 description 1
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- NXXCYNZMBSPHGI-UHFFFAOYSA-N potassium sodium 2-methylpropan-2-olate Chemical compound [Na+].[K+].CC(C)(C)[O-].CC(C)(C)[O-] NXXCYNZMBSPHGI-UHFFFAOYSA-N 0.000 description 1
- 239000004540 pour-on Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VSAISIQCTGDGPU-UHFFFAOYSA-N tetraphosphorus hexaoxide Chemical compound O1P(O2)OP3OP1OP2O3 VSAISIQCTGDGPU-UHFFFAOYSA-N 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 239000011135 tin Chemical class 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742427943 DE2427943C2 (de) | 1974-06-10 | 1974-06-10 | Benzimidazole, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| DE2427943 | 1974-06-10 | ||
| DE2516040A DE2516040C2 (de) | 1974-06-10 | 1975-04-12 | Benzimidazole, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| DE2516040 | 1975-04-12 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI751700A7 FI751700A7 (https=) | 1975-12-11 |
| FI59408B FI59408B (fi) | 1981-04-30 |
| FI59408C true FI59408C (fi) | 1981-08-10 |
Family
ID=25767253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI751700A FI59408C (fi) | 1974-06-10 | 1975-06-09 | Foerfarande foer framstaellning av farmakologiskt vaerdefulla bensimidazoler |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4026891A (https=) |
| JP (1) | JPS6015632B2 (https=) |
| AT (1) | AT342610B (https=) |
| BE (1) | BE830030A (https=) |
| BG (2) | BG23216A3 (https=) |
| CA (1) | CA1041095A (https=) |
| CH (1) | CH620438A5 (https=) |
| CS (1) | CS195292B2 (https=) |
| DD (1) | DD120440A5 (https=) |
| DE (1) | DE2516040C2 (https=) |
| DK (1) | DK258975A (https=) |
| ES (2) | ES437296A1 (https=) |
| FI (1) | FI59408C (https=) |
| FR (1) | FR2273545A1 (https=) |
| GB (1) | GB1466547A (https=) |
| HU (1) | HU171059B (https=) |
| IE (1) | IE41257B1 (https=) |
| IL (1) | IL47445A (https=) |
| NL (1) | NL178969C (https=) |
| NO (1) | NO142402C (https=) |
| PH (1) | PH14298A (https=) |
| RO (1) | RO68750A (https=) |
| SE (1) | SE420836B (https=) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53117215A (en) * | 1977-03-24 | 1978-10-13 | Hideyoshi Morita | Earthquakeeproof steel beam |
| ES8101067A1 (es) * | 1978-08-25 | 1980-12-01 | Thomae Gmbh Dr K | Procedimiento para la preparacion de nuevos bencimidazoles sustituidos en posicion 5 o 6 con un anillo de piridazinona |
| US4258185A (en) * | 1978-10-17 | 1981-03-24 | Yoshitomi Pharmaceutical Industries, Ltd. | Pyridazinone compounds |
| DE2935359A1 (de) * | 1979-09-01 | 1981-03-26 | Basf Ag, 67063 Ludwigshafen | 6-imidazolyl-3-hydrazino-pyridazine |
| DE3006671A1 (de) * | 1980-02-22 | 1981-08-27 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue benzoxazole, deren herstellung und deren verwendung als arzneumittel |
| DE3129447A1 (de) * | 1981-07-25 | 1983-02-10 | Dr. Karl Thomae Gmbh, 7950 Biberach | "neue benztriazole, ihre herstellung und ihre verwendung als arzneimittel" |
| US4699909A (en) * | 1981-07-25 | 1987-10-13 | Dr. Karl Thomae Gmbh | Benzotriazolyl-4,5-dihydro-3(2H)-pyridazinones |
| ZA859091B (en) * | 1984-12-24 | 1987-07-29 | Warner Lambert Co | Novel 6-substituted-2 (1h)-quinolinones and related compounds having use as cardiotonic,anti-hypertensive,and anti-thrombotic agents |
| US4840955A (en) * | 1984-12-24 | 1989-06-20 | Warner-Lambert Company | 6-substituted-2(1H)-quinolinones and related compounds having use as cardiotonic, antihypertensive, and antithrombotic agents |
| US4725686A (en) * | 1985-11-22 | 1988-02-16 | William H. Rorer, Inc. | Benzodiazinone-pyridazinone and hydroxy-pyrazolyl compounds, cardiotonic compositions including the same, and their uses |
| US4906630A (en) * | 1985-11-22 | 1990-03-06 | Rorer Pharmaceutical Corporation | Method of increasing cardiac contractility using pharmaceutical compositions comprising benzodiazinone- pyridazinone or hydroxy-pyrazolyl compounds |
| US4785101A (en) * | 1985-11-22 | 1988-11-15 | Rorer Pharmaceutical Corporation | Benzodiazinone-hydroxypyrazolyl compounds, cardiotonic compositions including the same and their uses |
| US4868300A (en) * | 1985-11-22 | 1989-09-19 | Rorer Pharmaceutical Corporation | Benzodiazinone-pyridazinone and hydroxy-pyrazolyl compounds, cardiotonic compositions including the same, and their uses |
| US4859672A (en) * | 1986-10-29 | 1989-08-22 | Rorer Pharmaceutical Corporation | Pyrido[2,3-d]pyrimidinone and imidazo[4,5-b]pyrimidinone |
| US5002944A (en) * | 1986-10-29 | 1991-03-26 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Compounds having cardiotonic activity |
| JPS63181827U (https=) * | 1987-05-13 | 1988-11-24 | ||
| DE4237656A1 (de) * | 1992-06-13 | 1993-12-16 | Merck Patent Gmbh | Benzimidazolderivate |
| US6162804A (en) * | 1997-09-26 | 2000-12-19 | Merck & Co., Inc. | Tyrosine kinase inhibitors |
| US6465484B1 (en) | 1997-09-26 | 2002-10-15 | Merck & Co., Inc. | Angiogenesis inhibitors |
| CA2347939C (en) * | 1998-10-23 | 2006-10-10 | Akira Matsumori | Composition for the treatment of rheumatism, hepatitis or pancreatitis |
| US20050119251A1 (en) * | 2001-12-21 | 2005-06-02 | Jian-Min Fu | Nicotinamide derivatives and their use as therapeutic agents |
| US20030236259A1 (en) * | 2002-02-05 | 2003-12-25 | Rolf Hohlweg | Novel aryl- and heteroarylpiperazines |
| AU2005286647A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| BRPI0515500A (pt) | 2004-09-20 | 2008-07-29 | Xenon Pharmaceuticals Inc | derivados piridazina para inibição de estearoil-coa-desaturase |
| MX2007003332A (es) * | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como inhibidores de estearoil-coa-desaturasa. |
| CN101084211A (zh) | 2004-09-20 | 2007-12-05 | 泽农医药公司 | 杂环衍生物及其作为治疗剂的用途 |
| BRPI0515482A (pt) * | 2004-09-20 | 2008-07-22 | Xenon Pharmaceuticals Inc | derivados heterocìclicos e seus usos como agentes terapêuticos |
| MX2007003318A (es) | 2004-09-20 | 2007-05-18 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como agentes terapeuticos. |
| AU2005286728A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as mediators of stearoyl-CoA desaturase |
| AU2005286790A1 (en) * | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Bicyclic heterocyclic derivatives and their use as inhibitors of stearoyl-CoA-desaturase (SCD) |
| JP4714921B2 (ja) * | 2005-02-14 | 2011-07-06 | トーアエイヨー株式会社 | ピモベンダンの製造法及びその中間体 |
| CA2618646A1 (en) * | 2005-06-03 | 2007-11-15 | Xenon Pharmaceuticals Inc. | Aminothiazole derivatives as human stearoyl-coa desaturase inhibitors |
| MX2007015675A (es) | 2005-07-04 | 2008-02-20 | Novo Nordisk As | Antagonistas del receptor de histamina h3. |
| KR20080035700A (ko) | 2005-08-15 | 2008-04-23 | 아이알엠 엘엘씨 | Tpo 모방체로서의 화합물 및 조성물 |
| EP2402324A1 (en) * | 2006-05-29 | 2012-01-04 | High Point Pharmaceuticals, LLC | Benzodioxolylcyclopropylpiperazinylpyridazines |
| EP2014656A3 (en) * | 2007-06-11 | 2011-08-24 | High Point Pharmaceuticals, LLC | New heteocyclic h3 antagonists |
| WO2010107768A1 (en) | 2009-03-18 | 2010-09-23 | Schering Corporation | Bicyclic compounds as inhibitors of diacylglycerol acyltransferase |
| US8729263B2 (en) | 2012-08-13 | 2014-05-20 | Novartis Ag | 1,4-disubstituted pyridazine analogs there of and methods for treating SMN-deficiency-related conditions |
| KR20210130843A (ko) * | 2013-07-31 | 2021-11-01 | 노파르티스 아게 | 1,4-이치환된 피리다진 유사체 및 smn-결핍-관련 상태를 치료하기 위한 그의 용도 |
| WO2018086703A1 (en) * | 2016-11-11 | 2018-05-17 | Bayer Pharma Aktiengesellschaft | Dihydropyridazinones substituted with phenylureas |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL23847A (en) * | 1964-08-07 | 1969-02-27 | Merck & Co Inc | Benzimidazoles useful as antifungals |
| US3705157A (en) * | 1970-10-19 | 1972-12-05 | American Cyanamid Co | Azolylpyridazine compounds and quaternary salts thereof |
| US3935209A (en) * | 1973-03-12 | 1976-01-27 | Syntex (U.S.A.) Inc. | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US3969526A (en) * | 1973-05-29 | 1976-07-13 | Smithkline Corporation | Anthelmintic 5-heterocycliothio and oxy-2-carbalkoxyaminobenzimidazles |
-
1975
- 1975-04-12 DE DE2516040A patent/DE2516040C2/de not_active Expired
- 1975-04-30 ES ES437296A patent/ES437296A1/es not_active Expired
- 1975-05-06 AT AT344575A patent/AT342610B/de not_active IP Right Cessation
- 1975-05-23 GB GB2283475A patent/GB1466547A/en not_active Expired
- 1975-05-27 BG BG030846A patent/BG23216A3/xx unknown
- 1975-05-27 BG BG030103A patent/BG24052A3/xx unknown
- 1975-06-04 US US05/583,641 patent/US4026891A/en not_active Expired - Lifetime
- 1975-06-05 PH PH17237A patent/PH14298A/en unknown
- 1975-06-05 CS CS753953A patent/CS195292B2/cs unknown
- 1975-06-06 CH CH728375A patent/CH620438A5/de not_active IP Right Cessation
- 1975-06-06 DD DD186498A patent/DD120440A5/xx unknown
- 1975-06-09 SE SE7506583A patent/SE420836B/xx not_active IP Right Cessation
- 1975-06-09 NL NLAANVRAGE7506806,A patent/NL178969C/xx not_active IP Right Cessation
- 1975-06-09 CA CA228,827A patent/CA1041095A/en not_active Expired
- 1975-06-09 BE BE157162A patent/BE830030A/xx not_active IP Right Cessation
- 1975-06-09 FI FI751700A patent/FI59408C/fi not_active IP Right Cessation
- 1975-06-09 IL IL47445A patent/IL47445A/xx unknown
- 1975-06-09 DK DK258975A patent/DK258975A/da not_active Application Discontinuation
- 1975-06-09 NO NO752022A patent/NO142402C/no unknown
- 1975-06-09 JP JP50069454A patent/JPS6015632B2/ja not_active Expired
- 1975-06-10 FR FR7518061A patent/FR2273545A1/fr active Granted
- 1975-06-10 IE IE1305/75A patent/IE41257B1/xx unknown
- 1975-06-10 HU HU75TO00001005A patent/HU171059B/hu unknown
- 1975-06-11 RO RO7582511A patent/RO68750A/ro unknown
- 1975-09-27 ES ES441340A patent/ES441340A1/es not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI59408C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla bensimidazoler | |
| FI66372C (fi) | Foerfarande foer framstaellning av farmakologiskt verkande i 5- eller 6-staellning med en pyridazinonring substituerade besimidazoler | |
| AU731055B2 (en) | 1-phenylpyrazole compounds and pharmaceutical use thereof | |
| Thyes et al. | 6-Aryl-4, 5-dihydro-3 (2H)-pyridazinones. A new class of compounds with platelet aggregation inhibiting and hypotensive activities | |
| US5278166A (en) | 4-amino-3-heteroaryl butyric acid compounds, compositions, and their use for treating disorders involving a dysfunction of GABAB receptors | |
| EP0275997B1 (en) | 3(2h)pyridazinone, process for its preparation and antagonistic agent against srs-a containing it | |
| JPS6324996B2 (https=) | ||
| Combs et al. | Heteroatom analogs of bemoradan: chemistry and cardiotonic activity of 1, 4-benzothiazinylpyridazinones | |
| JPH07116155B2 (ja) | 抗炎症性4―アミノフェノール誘導体 | |
| PT751132E (pt) | Derivados da piridazinona e processos para preparar os mesmos | |
| SU581866A3 (ru) | Способ получени проивзодных бензимидазола или их солей | |
| FI97295B (fi) | Menetelmä uusien terapeuttisesti käyttökelpoisten pyridatsinonijohdannaisten valmistamiseksi | |
| US3824271A (en) | 3-alkyl-3-(benzoyl)propionitriles | |
| HU181000B (en) | Process for preparing substituted 7,7-dimethyl-5h,7h-imidazo/4,5-h/-isoquinoline-4,6-diones | |
| CS226747B2 (en) | Method of preparing new benztriazols | |
| US4942245A (en) | Benzimidazole Derivatives | |
| US4289768A (en) | Phenothiazine derivatives and a process for their preparation | |
| KR790001578B1 (ko) | 벤즈이미다졸류의 제조 방법 | |
| JP3269658B2 (ja) | フェノール誘導体 | |
| SK281921B6 (sk) | Spôsob prípravy benzo[b]naftyridínov a derivát benzo[b]naftyridínu | |
| KR840001613B1 (ko) | 퀴놀론 화합물의 제조방법 | |
| JPS6334846B2 (https=) | ||
| CH620212A5 (en) | 5(6)-Pyridazinyl-benzimidazoles | |
| JPS62228081A (ja) | フロベンゾイソオキサゾ−ル誘導体 | |
| JPH0543573A (ja) | シアノグアニジン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: DR. KARL THOMAE GESELLSCHAFT MIT |