FI109908B - Menetelmä erittäin puhtaan, virusinaktivoidun tekijän VIII ja von Willebrand -tekijän kompleksin saamiseksi talteen anioninvaihtokromatografian avulla - Google Patents
Menetelmä erittäin puhtaan, virusinaktivoidun tekijän VIII ja von Willebrand -tekijän kompleksin saamiseksi talteen anioninvaihtokromatografian avulla Download PDFInfo
- Publication number
- FI109908B FI109908B FI943545A FI943545A FI109908B FI 109908 B FI109908 B FI 109908B FI 943545 A FI943545 A FI 943545A FI 943545 A FI943545 A FI 943545A FI 109908 B FI109908 B FI 109908B
- Authority
- FI
- Finland
- Prior art keywords
- groups
- mono
- factor viii
- carbon atoms
- anion exchange
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 34
- 108010054218 Factor VIII Proteins 0.000 title claims abstract description 30
- 102000001690 Factor VIII Human genes 0.000 title claims abstract description 30
- 229960000301 factor viii Drugs 0.000 title claims abstract description 30
- 238000005571 anion exchange chromatography Methods 0.000 title claims abstract description 6
- 108010047303 von Willebrand Factor Proteins 0.000 title claims description 6
- 102100036537 von Willebrand factor Human genes 0.000 title claims description 6
- 229960001134 von willebrand factor Drugs 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title description 3
- 239000000463 material Substances 0.000 claims abstract description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 9
- -1 sulfonic acid alkyl Chemical group 0.000 claims description 46
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 239000011780 sodium chloride Substances 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 238000000746 purification Methods 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 230000007935 neutral effect Effects 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 5
- 125000005208 trialkylammonium group Chemical group 0.000 claims description 5
- 238000005406 washing Methods 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 4
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 4
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 claims description 3
- 235000019743 Choline chloride Nutrition 0.000 claims description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 3
- 125000002619 bicyclic group Chemical group 0.000 claims description 3
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 3
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical group [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 claims description 3
- 229960003178 choline chloride Drugs 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 230000003612 virological effect Effects 0.000 claims description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical group C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 2
- 229960003328 benzoyl peroxide Drugs 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 238000005349 anion exchange Methods 0.000 claims 2
- 235000002639 sodium chloride Nutrition 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 1
- 230000003139 buffering effect Effects 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- BZWKPZBXAMTXNQ-UHFFFAOYSA-N sulfurocyanidic acid Chemical compound OS(=O)(=O)C#N BZWKPZBXAMTXNQ-UHFFFAOYSA-N 0.000 claims 1
- 210000002381 plasma Anatomy 0.000 abstract description 6
- 229920000642 polymer Polymers 0.000 abstract description 4
- 239000000969 carrier Substances 0.000 abstract description 3
- 238000011084 recovery Methods 0.000 abstract 1
- 239000007853 buffer solution Substances 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 10
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000178 monomer Substances 0.000 description 7
- 238000001914 filtration Methods 0.000 description 6
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 5
- 241000700605 Viruses Species 0.000 description 5
- 239000001110 calcium chloride Substances 0.000 description 5
- 229910001628 calcium chloride Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000001509 sodium citrate Substances 0.000 description 5
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 239000004471 Glycine Substances 0.000 description 4
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 108010049003 Fibrinogen Proteins 0.000 description 3
- 102000008946 Fibrinogen Human genes 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical class CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229940012952 fibrinogen Drugs 0.000 description 3
- 230000002779 inactivation Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 235000018102 proteins Nutrition 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 3
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 208000031220 Hemophilia Diseases 0.000 description 2
- 208000009292 Hemophilia A Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical class O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 239000001913 cellulose Chemical class 0.000 description 2
- 229920002678 cellulose Chemical class 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000013375 chromatographic separation Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 230000001954 sterilising effect Effects 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- VAYTZRYEBVHVLE-UHFFFAOYSA-N 1,3-dioxol-2-one Chemical compound O=C1OC=CO1 VAYTZRYEBVHVLE-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 108010014172 Factor V Proteins 0.000 description 1
- 102000016359 Fibronectins Human genes 0.000 description 1
- 108010067306 Fibronectins Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 230000010849 Ion Exchange Activity Effects 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 208000027276 Von Willebrand disease Diseases 0.000 description 1
- GQPVFBDWIUVLHG-UHFFFAOYSA-N [2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate Chemical class CC(=C)C(=O)OCC(CO)(CO)COC(=O)C(C)=C GQPVFBDWIUVLHG-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000001042 affinity chromatography Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 235000021120 animal protein Nutrition 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 229940099352 cholate Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000012869 ethanol precipitation Methods 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 101150089730 gly-10 gene Proteins 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical class CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 1
- 229960001008 heparin sodium Drugs 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 125000006235 propyl amino ethyl group Chemical group [H]N(C([H])([H])C([H])([H])*)C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K1/00—General methods for the preparation of peptides, i.e. processes for the organic chemical preparation of peptides or proteins of any length
- C07K1/14—Extraction; Separation; Purification
- C07K1/16—Extraction; Separation; Purification by chromatography
- C07K1/18—Ion-exchange chromatography
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K14/00—Peptides having more than 20 amino acids; Gastrins; Somatostatins; Melanotropins; Derivatives thereof
- C07K14/435—Peptides having more than 20 amino acids; Gastrins; Somatostatins; Melanotropins; Derivatives thereof from animals; from humans
- C07K14/745—Blood coagulation or fibrinolysis factors
- C07K14/755—Factors VIII, e.g. factor VIII C (AHF), factor VIII Ag (VWF)
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Gastroenterology & Hepatology (AREA)
- Zoology (AREA)
- Toxicology (AREA)
- Hematology (AREA)
- Analytical Chemistry (AREA)
- Peptides Or Proteins (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4204694A DE4204694C3 (de) | 1992-02-01 | 1992-02-01 | Verfahren zur Gewinnung von hochreinem, virusinaktiviertem Faktor VIII mittels Anionenaustauscher-Chromatographie |
| DE4204694 | 1992-02-01 | ||
| EP9300114 | 1993-01-20 | ||
| PCT/EP1993/000114 WO1993015105A1 (en) | 1992-02-01 | 1993-01-20 | Process for recovering a high-purity virus-inactivated factor viii by anion exchanger chromatography |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI943545A0 FI943545A0 (fi) | 1994-07-28 |
| FI943545A FI943545A (fi) | 1994-07-28 |
| FI109908B true FI109908B (fi) | 2002-10-31 |
Family
ID=6451895
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI943545A FI109908B (fi) | 1992-02-01 | 1994-07-28 | Menetelmä erittäin puhtaan, virusinaktivoidun tekijän VIII ja von Willebrand -tekijän kompleksin saamiseksi talteen anioninvaihtokromatografian avulla |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5714590A (da) |
| EP (1) | EP0625161B9 (da) |
| JP (1) | JP3556947B2 (da) |
| KR (1) | KR100240310B1 (da) |
| AT (1) | ATE203249T1 (da) |
| AU (1) | AU670776B2 (da) |
| DE (2) | DE4204694C3 (da) |
| DK (1) | DK0625161T4 (da) |
| ES (1) | ES2157920T5 (da) |
| FI (1) | FI109908B (da) |
| GR (1) | GR3036849T3 (da) |
| NO (1) | NO315426B1 (da) |
| PT (1) | PT625161E (da) |
| RU (1) | RU2096414C1 (da) |
| TW (1) | TW362099B (da) |
| WO (1) | WO1993015105A1 (da) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2117058A1 (en) * | 1991-09-05 | 1993-03-18 | Daphne C. Tse | Topical fibrinogen complex |
| DE4342132C1 (de) * | 1993-12-10 | 1994-11-03 | Octapharma Ag | Verfahren zur Herstellung virusinaktivierte Vitamin K abhängige Plasmakomponenten sowie Protein C und Protein S enthaltender Mittel durch Membran-Chromatographie |
| DE4407837C1 (de) * | 1994-03-09 | 1995-08-17 | Octapharma Ag | Verfahren zur Gewinnung von hochreinem, virusinaktiviertem alpha¶1¶-Antitrypsin mittels Anionenaustauscher-Chromatographie |
| AT403764B (de) | 1996-03-15 | 1998-05-25 | Immuno Ag | Stabiler faktor viii/vwf-komplex |
| EP1148063A1 (de) | 2000-04-18 | 2001-10-24 | Octapharma AG | Haemostatisch aktives vWF enthaltendes Präparat und Verfahren zu seiner Herstellung |
| FR2874216B1 (fr) * | 2004-08-16 | 2006-11-03 | Lab Francais Du Fractionnement | Procede de preparation d'un concentre de facteur von willebrand (fvw) par voie chromatographique et concentre de fvw susceptible d'etre ainsi obtenu |
| EP1739179A1 (en) | 2005-06-30 | 2007-01-03 | Octapharma AG | Serum-free stable transfection and production of recombinant human proteins in human cell lines |
| CN102648212B (zh) * | 2009-11-13 | 2014-12-03 | 基立福疗法公司 | 包含冯维勒布兰德因子(vWF)的制剂及其相关制备方法、试剂盒和用途 |
| RU2445974C2 (ru) * | 2010-04-26 | 2012-03-27 | Учреждение Российской академии медицинских наук Гематологический научный центр ГНЦ РАМН | Способ получения концентрата фактора viii из плазмы крови человека |
| CA2821711C (en) | 2010-12-15 | 2017-10-10 | Baxter International Inc. | Eluate collection using conductivity gradient |
| BRPI1105317A2 (pt) | 2011-01-24 | 2013-04-30 | Fundacco Hemoct De Ribeirco Preto | produÇço estÁvel e em larga escala de fviii humano em linhagem celular humana sk-hep-1 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4876241A (en) * | 1987-05-22 | 1989-10-24 | Armour Pharmaceutical Company | Stabilization of biological and pharmaceutical products during thermal inactivation of viral and bacterial contaminants |
| DE3811042A1 (de) * | 1988-03-31 | 1989-10-19 | Merck Patent Gmbh | Ionenaustauscher |
| ATE85220T1 (de) * | 1988-05-27 | 1993-02-15 | Centre Regional De Transfusion | Verfahren zur herstellung eines hochreinen, virusfreien antihaemophiliefaktors mittels chromatographie. |
| FR2632309B1 (fr) * | 1988-06-07 | 1990-08-24 | Lille Transfusion Sanguine | Procede de purification par voie chromatographique de proteines, notamment de facteur viii, et les produits obtenus |
| DE3878245D1 (de) * | 1988-11-05 | 1993-03-18 | Octapharma Ag | Verfahren zur herstellung eines hochreinen, nicht infektioesen antihaemophiliefaktors mittels chromatographie. |
| GB8913183D0 (en) * | 1989-06-08 | 1989-07-26 | Central Blood Lab Authority | Chemical products |
| FR2651437A1 (fr) * | 1989-09-05 | 1991-03-08 | Lille Transfusion Sanguine | Procede de preparation de concentre du complexe facteur viii-facteur von willebrand de la coagulation sanguine a partir de plasma total. |
-
1992
- 1992-02-01 DE DE4204694A patent/DE4204694C3/de not_active Expired - Lifetime
-
1993
- 1993-01-20 AU AU33517/93A patent/AU670776B2/en not_active Expired
- 1993-01-20 JP JP51290293A patent/JP3556947B2/ja not_active Expired - Lifetime
- 1993-01-20 DE DE69330458T patent/DE69330458T3/de not_active Expired - Lifetime
- 1993-01-20 AT AT93902233T patent/ATE203249T1/de active
- 1993-01-20 RU RU9394035758A patent/RU2096414C1/ru not_active IP Right Cessation
- 1993-01-20 PT PT93902233T patent/PT625161E/pt unknown
- 1993-01-20 WO PCT/EP1993/000114 patent/WO1993015105A1/en active IP Right Grant
- 1993-01-20 US US08/284,403 patent/US5714590A/en not_active Expired - Lifetime
- 1993-01-20 KR KR1019940702645A patent/KR100240310B1/ko not_active IP Right Cessation
- 1993-01-20 ES ES93902233T patent/ES2157920T5/es not_active Expired - Lifetime
- 1993-01-20 EP EP93902233A patent/EP0625161B9/en not_active Expired - Lifetime
- 1993-01-20 DK DK93902233T patent/DK0625161T4/da active
- 1993-01-28 TW TW082100487A patent/TW362099B/zh not_active IP Right Cessation
-
1994
- 1994-07-28 FI FI943545A patent/FI109908B/fi not_active IP Right Cessation
- 1994-07-29 NO NO19942832A patent/NO315426B1/no not_active IP Right Cessation
-
2001
- 2001-10-09 GR GR20010401713T patent/GR3036849T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO315426B1 (no) | 2003-09-01 |
| WO1993015105A1 (en) | 1993-08-05 |
| EP0625161B9 (en) | 2007-09-19 |
| AU670776B2 (en) | 1996-08-01 |
| KR950700925A (ko) | 1995-02-20 |
| JPH07503241A (ja) | 1995-04-06 |
| AU3351793A (en) | 1993-09-01 |
| EP0625161B1 (en) | 2001-07-18 |
| ES2157920T3 (es) | 2001-09-01 |
| RU2096414C1 (ru) | 1997-11-20 |
| DK0625161T4 (da) | 2007-09-03 |
| NO942832D0 (no) | 1994-07-29 |
| TW362099B (en) | 1999-06-21 |
| ES2157920T5 (es) | 2007-12-16 |
| FI943545A0 (fi) | 1994-07-28 |
| GR3036849T3 (en) | 2002-01-31 |
| PT625161E (pt) | 2001-10-31 |
| EP0625161B2 (en) | 2007-05-16 |
| DE69330458T2 (de) | 2002-05-29 |
| DE69330458T3 (de) | 2008-01-17 |
| ATE203249T1 (de) | 2001-08-15 |
| EP0625161A1 (en) | 1994-11-23 |
| US5714590A (en) | 1998-02-03 |
| DE4204694C2 (de) | 1994-02-10 |
| DE69330458D1 (de) | 2001-08-23 |
| DK0625161T3 (da) | 2001-09-24 |
| NO942832L (no) | 1994-07-29 |
| KR100240310B1 (ko) | 2000-01-15 |
| FI943545A (fi) | 1994-07-28 |
| JP3556947B2 (ja) | 2004-08-25 |
| DE4204694C3 (de) | 1995-10-12 |
| DE4204694A1 (de) | 1993-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI109908B (fi) | Menetelmä erittäin puhtaan, virusinaktivoidun tekijän VIII ja von Willebrand -tekijän kompleksin saamiseksi talteen anioninvaihtokromatografian avulla | |
| AU744085B2 (en) | Chemically modified polypeptides | |
| EP0121468B1 (fr) | Procédé de fractionnement du plasma | |
| US4315851A (en) | Pharmaceutical composition having antitumor activity | |
| JP2003530326A (ja) | ＩｇＧを製造する方法 | |
| FI60501B (fi) | Foerfarande foer selektiv separering av interferon fraon interferon-raopreparat | |
| EP0081853A1 (en) | Conjugates of anticoagulant and protein | |
| CS277592B6 (en) | Dividing materials based on hydroxyl groups-containing carriers | |
| JPS63118301A (ja) | リガンド結合多糖類 | |
| NZ563166A (en) | Triazine-based affinity adsorbents for factor VIII and von willebrand's factor | |
| GB2092470A (en) | Method for reducing the pyrogen content of or removing pyrogens from solutions contaminated therewith | |
| KR20010012412A (ko) | 엽산 길항제 및 담체를 포함하는 컨쥬게이트 | |
| EP0399321B1 (en) | Gel filtration of heat treated factor viii | |
| US5883256A (en) | Process for removing aromatic heterocyclic compounds product-containing solutions | |
| US6414125B1 (en) | Method of chromatographically purifying or fractionating, respectively, von Willebrand factor from a VWF-containing starting material | |
| JPS6226253A (ja) | 新規アントラキノン誘導体、蛋白質吸着剤および蛋白質沈殿剤 | |
| CA2129045C (en) | Process for recovering a high-purity virus-inactivated factor viii by anion exchanger chromatography | |
| JP3357139B2 (ja) | 抗デオキシリボ核酸抗体の吸着剤 | |
| WO1995024428A1 (de) | VERFAHREN ZUR GEWINNUNG VON HOCHREINEM, VIRUSINAKTIVIERTEM α1-ANTITRYPSIN MITTELS ANIONENAUSTAUSCHER-CHROMATOGRAPHIE | |
| JP2775093B2 (ja) | 免疫グロブリン含有組成物 | |
| JPS5917354A (ja) | アフイニテイ−クロマトグラフイ−用吸着体 | |
| JPS606191A (ja) | 低分子ウロキナ−ゼと高分子ウロキナ−ゼの分離方法 | |
| FI116839B (fi) | Menetelmä virusturvallisen immunoglobuliinin valmistamiseksi | |
| JPH01230526A (ja) | 吸着剤およびその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |