DK171468B1 - Pyrrol-, pyrazol- eller triazolforbindelser, farmaceutiske præparater indeholdende disse forbindelser samt deres anvendelse til fremstilling af antihypertensive midler og midler til behandling af kongestivt hjertesvigt - Google Patents
Pyrrol-, pyrazol- eller triazolforbindelser, farmaceutiske præparater indeholdende disse forbindelser samt deres anvendelse til fremstilling af antihypertensive midler og midler til behandling af kongestivt hjertesvigt Download PDFInfo
- Publication number
- DK171468B1 DK171468B1 DK005389A DK5389A DK171468B1 DK 171468 B1 DK171468 B1 DK 171468B1 DK 005389 A DK005389 A DK 005389A DK 5389 A DK5389 A DK 5389A DK 171468 B1 DK171468 B1 DK 171468B1
- Authority
- DK
- Denmark
- Prior art keywords
- propyl
- single bond
- carbon atoms
- alkyl
- methyl
- Prior art date
Links
- 206010007559 Cardiac failure congestive Diseases 0.000 title claims abstract description 5
- 206010019280 Heart failures Diseases 0.000 title claims abstract description 5
- 150000001875 compounds Chemical class 0.000 title claims description 170
- -1 triazole compounds Chemical class 0.000 title claims description 85
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 title claims description 13
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title claims description 12
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 6
- 239000002220 antihypertensive agent Substances 0.000 title abstract description 4
- 229940030600 antihypertensive agent Drugs 0.000 title abstract description 3
- 239000003795 chemical substances by application Substances 0.000 title description 2
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 62
- 125000000217 alkyl group Chemical group 0.000 claims description 49
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 38
- 125000003342 alkenyl group Chemical group 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 125000000304 alkynyl group Chemical group 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- 206010020772 Hypertension Diseases 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- KIWSYRHAAPLJFJ-DNZSEPECSA-N n-[(e,2z)-4-ethyl-2-hydroxyimino-5-nitrohex-3-enyl]pyridine-3-carboxamide Chemical compound [O-][N+](=O)C(C)C(/CC)=C/C(=N/O)/CNC(=O)C1=CC=CN=C1 KIWSYRHAAPLJFJ-DNZSEPECSA-N 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 241001465754 Metazoa Species 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052727 yttrium Inorganic materials 0.000 claims description 4
- YUARURASDIGOQF-UHFFFAOYSA-N 1-[[4-(2-carboxyphenyl)phenyl]methyl]-5-propylpyrazole-3-carboxylic acid Chemical compound CCCC1=CC(C(O)=O)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 YUARURASDIGOQF-UHFFFAOYSA-N 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- BCHJOKBNPLDACJ-UHFFFAOYSA-N 1-[[4-(2-carboxyphenyl)phenyl]methyl]-5-propylpyrrole-2-carboxylic acid Chemical group CCCC1=CC=C(C(O)=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 BCHJOKBNPLDACJ-UHFFFAOYSA-N 0.000 claims description 2
- 101100134925 Gallus gallus COR6 gene Proteins 0.000 claims description 2
- 101001043818 Mus musculus Interleukin-31 receptor subunit alpha Proteins 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- QAUSPAYUEOLOKH-UHFFFAOYSA-N 5-[2-[4-[[3-(methoxymethyl)-5-propyl-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]-2h-tetrazole Chemical group CCCC1=NN=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2NN=NN=2)C=C1 QAUSPAYUEOLOKH-UHFFFAOYSA-N 0.000 claims 1
- 150000003217 pyrazoles Chemical class 0.000 abstract description 21
- 150000003233 pyrroles Chemical class 0.000 abstract description 13
- 150000003852 triazoles Chemical class 0.000 abstract description 9
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 174
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 92
- 238000006243 chemical reaction Methods 0.000 description 71
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 63
- 238000000034 method Methods 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 60
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 43
- 235000019439 ethyl acetate Nutrition 0.000 description 39
- 239000000203 mixture Substances 0.000 description 37
- 239000000243 solution Substances 0.000 description 37
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- 239000007787 solid Substances 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 238000003818 flash chromatography Methods 0.000 description 26
- 229910001868 water Inorganic materials 0.000 description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 20
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 150000001735 carboxylic acids Chemical class 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 230000007062 hydrolysis Effects 0.000 description 13
- 238000006460 hydrolysis reaction Methods 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 150000002825 nitriles Chemical class 0.000 description 12
- 230000008569 process Effects 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 10
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- 150000000177 1,2,3-triazoles Chemical class 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 9
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 150000004820 halides Chemical class 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 150000001540 azides Chemical class 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 230000036772 blood pressure Effects 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical class C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000000623 heterocyclic group Chemical group 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 108020003175 receptors Proteins 0.000 description 7
- 102000005962 receptors Human genes 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 238000005804 alkylation reaction Methods 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical compound [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- 230000003276 anti-hypertensive effect Effects 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical class [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 5
- 150000003939 benzylamines Chemical class 0.000 description 5
- 150000004074 biphenyls Chemical class 0.000 description 5
- 150000001805 chlorine compounds Chemical class 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 150000002440 hydroxy compounds Chemical class 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 150000002905 orthoesters Chemical class 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000002243 precursor Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 108010083387 Saralasin Proteins 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 235000010290 biphenyl Nutrition 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000006352 cycloaddition reaction Methods 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- 125000005594 diketone group Chemical group 0.000 description 4
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 150000002391 heterocyclic compounds Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- RMXGTMRDXKUUDJ-UHFFFAOYSA-N methyl 2-[4-(bromomethyl)phenyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=C(CBr)C=C1 RMXGTMRDXKUUDJ-UHFFFAOYSA-N 0.000 description 4
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000002390 rotary evaporation Methods 0.000 description 4
- PFGWGEPQIUAZME-NXSMLHPHSA-N saralasin Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C)C(O)=O)C1=CC=C(O)C=C1 PFGWGEPQIUAZME-NXSMLHPHSA-N 0.000 description 4
- 229960004785 saralasin Drugs 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 150000003536 tetrazoles Chemical class 0.000 description 4
- 150000003568 thioethers Chemical class 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- CUKWUWBLQQDQAC-VEQWQPCFSA-N (3s)-3-amino-4-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s,3s)-1-[[(2s)-1-[(2s)-2-[[(1s)-1-carboxyethyl]carbamoyl]pyrrolidin-1-yl]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-methyl-1-ox Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 CUKWUWBLQQDQAC-VEQWQPCFSA-N 0.000 description 3
- 150000005071 1,2,4-oxadiazoles Chemical class 0.000 description 3
- ICPWFHKNYYRBSZ-UHFFFAOYSA-M 2-methoxypropanoate Chemical compound COC(C)C([O-])=O ICPWFHKNYYRBSZ-UHFFFAOYSA-M 0.000 description 3
- BRWJNSKGKHUIHY-UHFFFAOYSA-N 5-propyl-1h-pyrrole-2-carbaldehyde Chemical compound CCCC1=CC=C(C=O)N1 BRWJNSKGKHUIHY-UHFFFAOYSA-N 0.000 description 3
- 102000005862 Angiotensin II Human genes 0.000 description 3
- 101800000733 Angiotensin-2 Proteins 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- 150000001266 acyl halides Chemical class 0.000 description 3
- 150000001345 alkine derivatives Chemical class 0.000 description 3
- 229950006323 angiotensin ii Drugs 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- NHOWLEZFTHYCTP-UHFFFAOYSA-N benzylhydrazine Chemical class NNCC1=CC=CC=C1 NHOWLEZFTHYCTP-UHFFFAOYSA-N 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 3
- 230000031709 bromination Effects 0.000 description 3
- 238000005893 bromination reaction Methods 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000008297 liquid dosage form Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- UOLMZWZSLYSILW-UHFFFAOYSA-N methyl 2-[4-(azidomethyl)phenyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=C(CN=[N+]=[N-])C=C1 UOLMZWZSLYSILW-UHFFFAOYSA-N 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 238000006053 organic reaction Methods 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical class C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 150000003738 xylenes Chemical class 0.000 description 3
- JDOJFXVTTCGROH-UHFFFAOYSA-N (4-phenylmethoxyphenyl)methanamine Chemical class C1=CC(CN)=CC=C1OCC1=CC=CC=C1 JDOJFXVTTCGROH-UHFFFAOYSA-N 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- KOPMZTKUZCNGFY-UHFFFAOYSA-N 1,1,1-triethoxybutane Chemical compound CCCC(OCC)(OCC)OCC KOPMZTKUZCNGFY-UHFFFAOYSA-N 0.000 description 2
- DIKAUBKIDNXNNW-UHFFFAOYSA-N 1,1,1-triethoxypentane Chemical compound CCCCC(OCC)(OCC)OCC DIKAUBKIDNXNNW-UHFFFAOYSA-N 0.000 description 2
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 2
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 2
- WHQKKKRGZMNCKO-UHFFFAOYSA-N 1-methoxyoct-7-ene-2,4-dione Chemical compound COCC(=O)CC(=O)CCC=C WHQKKKRGZMNCKO-UHFFFAOYSA-N 0.000 description 2
- 125000006017 1-propenyl group Chemical group 0.000 description 2
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- KCAITDXQVXLZHD-UHFFFAOYSA-N 2-[4-[(2-ethoxycarbonyl-5-propylpyrrol-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCC1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 KCAITDXQVXLZHD-UHFFFAOYSA-N 0.000 description 2
- RYYOVSSLVBBIFJ-UHFFFAOYSA-N 2-[4-[[3-(methoxymethyl)-5-propyl-1,2,4-triazol-4-yl]methyl]phenyl]benzonitrile Chemical compound CCCC1=NN=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C#N)C=C1 RYYOVSSLVBBIFJ-UHFFFAOYSA-N 0.000 description 2
- LGXBKPPZWLWURH-UHFFFAOYSA-N 2-methoxy-4,5-dihydro-1,3-oxazole Chemical compound COC1=NCCO1 LGXBKPPZWLWURH-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- OZRGLPAXIYOWIG-HZPUXBNGSA-N 4-nitrobenzylamine Chemical compound CC(C)C(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CCCC[C@]4(C)[C@H]3CC[C@]12C)=O OZRGLPAXIYOWIG-HZPUXBNGSA-N 0.000 description 2
- PEHBOJRERDSOQR-UHFFFAOYSA-N 5-[2-[4-[(5-butyltriazol-1-yl)methyl]phenyl]phenyl]-1-trityltetrazole Chemical class CCCCC1=CN=NN1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 PEHBOJRERDSOQR-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 238000005642 Gabriel synthesis reaction Methods 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229910010084 LiAlH4 Inorganic materials 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- WITXFYCLPDFRNM-UHFFFAOYSA-N N-Benzylphthalimide Chemical class O=C1C2=CC=CC=C2C(=O)N1CC1=CC=CC=C1 WITXFYCLPDFRNM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 108090000783 Renin Proteins 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000001270 agonistic effect Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000001411 amidrazones Chemical class 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 150000003935 benzaldehydes Chemical class 0.000 description 2
- 150000008359 benzonitriles Chemical class 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000011436 cob Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 125000004989 dicarbonyl group Chemical group 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000002085 enols Chemical class 0.000 description 2
- NZXXJLWFLINATO-UHFFFAOYSA-N ethyl 5-(1-hydroxypropyl)-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C(O)CC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 NZXXJLWFLINATO-UHFFFAOYSA-N 0.000 description 2
- HTPFMOGFQKDFHX-UHFFFAOYSA-N ethyl 5-formyl-1h-pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=O)N1 HTPFMOGFQKDFHX-UHFFFAOYSA-N 0.000 description 2
- DEGYYHVSMFYQOI-UHFFFAOYSA-N ethyl 5-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCCC1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 DEGYYHVSMFYQOI-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 150000002240 furans Chemical class 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- OHHITJYTTZWFBQ-UHFFFAOYSA-N methyl 2-[4-(aminomethyl)phenyl]benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=CC=C1C1=CC=C(CN)C=C1 OHHITJYTTZWFBQ-UHFFFAOYSA-N 0.000 description 2
- VURLYOWJPFGHJB-UHFFFAOYSA-N methyl 2-[4-[(3,5-dibutyl-1,2,4-triazol-4-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NN=C(CCCC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 VURLYOWJPFGHJB-UHFFFAOYSA-N 0.000 description 2
- PAHIIEYDTNTHQK-UHFFFAOYSA-N methyl 2-[4-[[3-(methoxymethyl)-5-propyl-1,2,4-triazol-4-yl]methyl]phenyl]benzoate Chemical compound CCCC1=NN=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 PAHIIEYDTNTHQK-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000006502 nitrobenzyl group Chemical group 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000003182 parenteral nutrition solution Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000010189 synthetic method Methods 0.000 description 2
- YHXCWNQNVMAENQ-UHFFFAOYSA-N tert-butyl 2-[4-(bromomethyl)phenyl]benzoate Chemical compound CC(C)(C)OC(=O)C1=CC=CC=C1C1=CC=C(CBr)C=C1 YHXCWNQNVMAENQ-UHFFFAOYSA-N 0.000 description 2
- GLOQVSJNUUZOFE-UHFFFAOYSA-N tert-butyl 2-[4-[(2-formyl-5-propylpyrrol-1-yl)methyl]phenyl]benzoate Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC(C)(C)C)C=C1 GLOQVSJNUUZOFE-UHFFFAOYSA-N 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000005526 vasoconstrictor agent Substances 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- XDIYNQZUNSSENW-UUBOPVPUSA-N (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O XDIYNQZUNSSENW-UUBOPVPUSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- MNAXZNRGLVKXEK-UHFFFAOYSA-N 1-(bromomethyl)-4-(2-methylphenyl)benzene Chemical group CC1=CC=CC=C1C1=CC=C(CBr)C=C1 MNAXZNRGLVKXEK-UHFFFAOYSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- CGHIBGNXEGJPQZ-UHFFFAOYSA-N 1-hexyne Chemical compound CCCCC#C CGHIBGNXEGJPQZ-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- HCKUOPXBZCRCKN-UHFFFAOYSA-N 2,4-dioxoheptanoic acid Chemical compound CCCC(=O)CC(=O)C(O)=O HCKUOPXBZCRCKN-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- BVNDBGMQJWTEDW-UHFFFAOYSA-N 2-[(4-chlorophenyl)methyl]-5-methyl-4h-pyrazol-3-one Chemical compound O=C1CC(C)=NN1CC1=CC=C(Cl)C=C1 BVNDBGMQJWTEDW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LRGAANMQNVMQFA-UHFFFAOYSA-N 2-[4-(aminomethyl)phenyl]benzonitrile Chemical compound C1=CC(CN)=CC=C1C1=CC=CC=C1C#N LRGAANMQNVMQFA-UHFFFAOYSA-N 0.000 description 1
- LANSUNWWSUCCJT-UHFFFAOYSA-N 2-[4-(azidomethyl)phenyl]benzonitrile Chemical compound C1=CC(CN=[N+]=[N-])=CC=C1C1=CC=CC=C1C#N LANSUNWWSUCCJT-UHFFFAOYSA-N 0.000 description 1
- NUDMZBBLHDMDGJ-UHFFFAOYSA-N 2-[4-[(2-formyl-5-propylpyrrol-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 NUDMZBBLHDMDGJ-UHFFFAOYSA-N 0.000 description 1
- ASUUCGYEJLQCMW-UHFFFAOYSA-N 2-[4-[(3,5-dibutyl-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NN=C(CCCC)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 ASUUCGYEJLQCMW-UHFFFAOYSA-N 0.000 description 1
- PTQFXXTUWDFFGJ-UHFFFAOYSA-N 2-[4-[(3-formyl-5-propylpyrazol-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCC1=CC(C=O)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 PTQFXXTUWDFFGJ-UHFFFAOYSA-N 0.000 description 1
- PAXIVEDFUUNWEO-UHFFFAOYSA-N 2-[4-[(5-butyltriazol-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=CN=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 PAXIVEDFUUNWEO-UHFFFAOYSA-N 0.000 description 1
- MIHXVKWGFQNYLS-UHFFFAOYSA-N 2-[4-[[3-(hydroxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound CCCC1=CC(CO)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 MIHXVKWGFQNYLS-UHFFFAOYSA-N 0.000 description 1
- LFVZLQMWSNZIGO-UHFFFAOYSA-N 2-[4-[[3-(methoxymethyl)-5-propyl-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid Chemical compound CCCC1=NN=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 LFVZLQMWSNZIGO-UHFFFAOYSA-N 0.000 description 1
- LDZZKFSBAPVBCM-UHFFFAOYSA-N 2-[4-[[3-(methoxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound CCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 LDZZKFSBAPVBCM-UHFFFAOYSA-N 0.000 description 1
- JOKUBVGIGYGMRZ-UHFFFAOYSA-N 2-[4-[[5-(methoxymethyl)-3-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound N1=C(CCC)C=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 JOKUBVGIGYGMRZ-UHFFFAOYSA-N 0.000 description 1
- YDXGCMHMMCNTBY-UHFFFAOYSA-N 2-[4-[[5-butyl-3-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound CCCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 YDXGCMHMMCNTBY-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- LPTOLEOOFIWWLG-UHFFFAOYSA-N 4-benzyl-5-nitro-2h-triazole Chemical class N1N=NC(CC=2C=CC=CC=2)=C1[N+](=O)[O-] LPTOLEOOFIWWLG-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- XNDCMKLLHJBRMO-UHFFFAOYSA-N 5-[2-[4-(azidomethyl)phenyl]phenyl]-1-trityltetrazole Chemical group C1=CC(CN=[N+]=[N-])=CC=C1C1=CC=CC=C1C1=NN=NN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 XNDCMKLLHJBRMO-UHFFFAOYSA-N 0.000 description 1
- PGYJSFDOCRGAHK-UHFFFAOYSA-N 5-[2-[4-[(4-butyltriazol-1-yl)methyl]phenyl]phenyl]-1-trityltetrazole Chemical compound N1=NC(CCCC)=CN1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 PGYJSFDOCRGAHK-UHFFFAOYSA-N 0.000 description 1
- OJAVSTGPEUNSKI-UHFFFAOYSA-N 5-[2-[4-[(4-butyltriazol-1-yl)methyl]phenyl]phenyl]-2h-tetrazole Chemical class N1=NC(CCCC)=CN1CC1=CC=C(C=2C(=CC=CC=2)C=2NN=NN=2)C=C1 OJAVSTGPEUNSKI-UHFFFAOYSA-N 0.000 description 1
- QTVRZLFIMULIDR-UHFFFAOYSA-N 5-butyl-1-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylic acid Chemical compound CCCCC1=CC=C(C(O)=O)N1CC1=CC=C(C=2C(=CC=CC=2)C=2NN=NN=2)C=C1 QTVRZLFIMULIDR-UHFFFAOYSA-N 0.000 description 1
- RNDVGJZUHCKENF-UHFFFAOYSA-N 5-hexen-2-one Chemical compound CC(=O)CCC=C RNDVGJZUHCKENF-UHFFFAOYSA-N 0.000 description 1
- BHTQIUHUIROZDU-UHFFFAOYSA-N 5-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 BHTQIUHUIROZDU-UHFFFAOYSA-N 0.000 description 1
- VKKFZHDQXSRUBH-UHFFFAOYSA-N 5-propyl-1-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C=2NN=NN=2)C=C1 VKKFZHDQXSRUBH-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 102000002572 Alpha-Globulins Human genes 0.000 description 1
- 108010068307 Alpha-Globulins Proteins 0.000 description 1
- 101800000734 Angiotensin-1 Proteins 0.000 description 1
- 102400000344 Angiotensin-1 Human genes 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- 108010064733 Angiotensins Proteins 0.000 description 1
- 102000015427 Angiotensins Human genes 0.000 description 1
- 102000014654 Aromatase Human genes 0.000 description 1
- 108010078554 Aromatase Proteins 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- NQMREDTYYRYSMC-UHFFFAOYSA-N C(CCC)C1=CN=NN1CC1=CC=C(C=C1)C1=C(C=CC=C1)CC(=O)O Chemical compound C(CCC)C1=CN=NN1CC1=CC=C(C=C1)C1=C(C=CC=C1)CC(=O)O NQMREDTYYRYSMC-UHFFFAOYSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- 101150036540 Copb1 gene Proteins 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 101000637625 Cricetulus griseus GTP-binding protein SAR1b Proteins 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 101100289061 Drosophila melanogaster lili gene Proteins 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 230000010740 Hormone Receptor Interactions Effects 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- 238000006736 Huisgen cycloaddition reaction Methods 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 208000034693 Laceration Diseases 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 241000294754 Macroptilium atropurpureum Species 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 229920001410 Microfiber Polymers 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 229940083963 Peptide antagonist Drugs 0.000 description 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 210000004404 adrenal cortex Anatomy 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 238000010976 amide bond formation reaction Methods 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000000561 anti-psychotic effect Effects 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- WOIIIUDZSOLAIW-NSHDSACASA-N azapropazone Chemical compound C1=C(C)C=C2N3C(=O)[C@H](CC=C)C(=O)N3C(N(C)C)=NC2=C1 WOIIIUDZSOLAIW-NSHDSACASA-N 0.000 description 1
- 229960001671 azapropazone Drugs 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical class BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 230000008512 biological response Effects 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- JKMBMIMLVFMXRW-LYYFRFARSA-N epicocconone Chemical compound C1=C2C[C@@H](CO)OC=C2C(=O)[C@]2(C)C1=C(C(/O)=C/C(=O)/C=C/C=C/C=C/C)C(=O)O2 JKMBMIMLVFMXRW-LYYFRFARSA-N 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- ZYNACNSJZLIYCY-UHFFFAOYSA-N ethyl 1-[[4-(2-methoxycarbonylphenyl)phenyl]methyl]-5-propylpyrazole-3-carboxylate Chemical compound CCCC1=CC(C(=O)OCC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 ZYNACNSJZLIYCY-UHFFFAOYSA-N 0.000 description 1
- DMAUJRWSYKLVHX-UHFFFAOYSA-N ethyl 2,4-dioxoheptanoate Chemical compound CCCC(=O)CC(=O)C(=O)OCC DMAUJRWSYKLVHX-UHFFFAOYSA-N 0.000 description 1
- UWVRYNPASYYXDK-UHFFFAOYSA-N ethyl 2-[[4-(2-methoxycarbonylphenyl)phenyl]methyl]-5-propylpyrazole-3-carboxylate Chemical class N1=C(CCC)C=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 UWVRYNPASYYXDK-UHFFFAOYSA-N 0.000 description 1
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 1
- JBHWGJMXKKDKHE-UHFFFAOYSA-N ethyl 5-prop-1-enyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=CC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 JBHWGJMXKKDKHE-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 230000009097 homeostatic mechanism Effects 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000006698 hydrazinolysis reaction Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229960002003 hydrochlorothiazide Drugs 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 description 1
- 229960000991 ketoprofen Drugs 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 1
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940013798 meclofenamate Drugs 0.000 description 1
- SBDNJUWAMKYJOX-UHFFFAOYSA-M meclofenamic acid(1-) Chemical compound CC1=CC=C(Cl)C(NC=2C(=CC=CC=2)C([O-])=O)=C1Cl SBDNJUWAMKYJOX-UHFFFAOYSA-M 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- NKSLFBGWMGWIHD-UHFFFAOYSA-N methyl 2-[4-[(3-butyl-1,2,4-triazol-4-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NN=CN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 NKSLFBGWMGWIHD-UHFFFAOYSA-N 0.000 description 1
- MEFLPNNUDOJYTB-UHFFFAOYSA-N methyl 2-[4-[(3-formyl-5-propylpyrazol-1-yl)methyl]phenyl]benzoate Chemical compound CCCC1=CC(C=O)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 MEFLPNNUDOJYTB-UHFFFAOYSA-N 0.000 description 1
- GQEHJEATPMSKFP-UHFFFAOYSA-N methyl 2-[4-[[3-(hydroxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound CCCC1=CC(CO)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 GQEHJEATPMSKFP-UHFFFAOYSA-N 0.000 description 1
- VCKRHHXORHRNBD-UHFFFAOYSA-N methyl 2-[4-[[3-(methoxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound CCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 VCKRHHXORHRNBD-UHFFFAOYSA-N 0.000 description 1
- WWSVDXVSODHWRP-UHFFFAOYSA-N methyl 2-[4-[[3-butyl-5-(methoxymethyl)-1,2,4-triazol-4-yl]methyl]phenyl]benzoate Chemical compound CCCCC1=NN=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 WWSVDXVSODHWRP-UHFFFAOYSA-N 0.000 description 1
- JUYLPJYOGJYQHT-UHFFFAOYSA-N methyl 2-[4-[[3-butyl-5-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoate Chemical class N1=C(CCCC)C=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 JUYLPJYOGJYQHT-UHFFFAOYSA-N 0.000 description 1
- BVIWGKJOLFGFNS-UHFFFAOYSA-N methyl 2-[4-[[3-ethyl-5-(methoxymethyl)-1,2,4-triazol-4-yl]methyl]phenyl]benzoate Chemical compound CCC1=NN=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 BVIWGKJOLFGFNS-UHFFFAOYSA-N 0.000 description 1
- RUDWUFZTXPODLG-UHFFFAOYSA-N methyl 2-[4-[[5-(hydroxymethyl)-3-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound N1=C(CCC)C=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 RUDWUFZTXPODLG-UHFFFAOYSA-N 0.000 description 1
- UQVWQQVUFKUCOB-UHFFFAOYSA-N methyl 5-(aminomethyl)-2-phenylbenzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC(CN)=CC=C1C1=CC=CC=C1 UQVWQQVUFKUCOB-UHFFFAOYSA-N 0.000 description 1
- ZKUUVVYMPUDTGJ-UHFFFAOYSA-N methyl 5-hydroxy-4-methoxy-2-nitrobenzoate Chemical compound COC(=O)C1=CC(O)=C(OC)C=C1[N+]([O-])=O ZKUUVVYMPUDTGJ-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000003658 microfiber Substances 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-M naproxen(1-) Chemical compound C1=C([C@H](C)C([O-])=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-M 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- 238000005691 oxidative coupling reaction Methods 0.000 description 1
- 238000007248 oxidative elimination reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N p-hydroxybenzoic acid methyl ester Natural products COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- QYSPLQLAKJAUJT-UHFFFAOYSA-N piroxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=CC=CC=N1 QYSPLQLAKJAUJT-UHFFFAOYSA-N 0.000 description 1
- 229960002702 piroxicam Drugs 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical group [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002315 pressor effect Effects 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001525 receptor binding assay Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 210000002254 renal artery Anatomy 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 102220053804 rs727503299 Human genes 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical group C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940001482 sodium sulfite Drugs 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- MLKXDPUZXIRXEP-MFOYZWKCSA-N sulindac Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-MFOYZWKCSA-N 0.000 description 1
- 229960000894 sulindac Drugs 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical class Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- UPSPUYADGBWSHF-UHFFFAOYSA-N tolmetin Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C UPSPUYADGBWSHF-UHFFFAOYSA-N 0.000 description 1
- 229960001017 tolmetin Drugs 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing aromatic rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14166988A | 1988-01-07 | 1988-01-07 | |
| US14166988 | 1988-01-07 | ||
| US27919388 | 1988-12-06 | ||
| US07/279,193 US5015651A (en) | 1988-01-07 | 1988-12-06 | Treatment of hypertension with 1,2,4-angiotensin II antagonists |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK5389D0 DK5389D0 (da) | 1989-01-06 |
| DK5389A DK5389A (da) | 1989-07-08 |
| DK171468B1 true DK171468B1 (da) | 1996-11-11 |
Family
ID=26839346
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK005389A DK171468B1 (da) | 1988-01-07 | 1989-01-06 | Pyrrol-, pyrazol- eller triazolforbindelser, farmaceutiske præparater indeholdende disse forbindelser samt deres anvendelse til fremstilling af antihypertensive midler og midler til behandling af kongestivt hjertesvigt |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5015651A (enExample) |
| EP (1) | EP0323841B1 (enExample) |
| JP (1) | JPH0725733B2 (enExample) |
| KR (1) | KR910002823B1 (enExample) |
| AT (1) | ATE92478T1 (enExample) |
| AU (1) | AU612755B2 (enExample) |
| CA (1) | CA1338013C (enExample) |
| DE (1) | DE68907921T2 (enExample) |
| DK (1) | DK171468B1 (enExample) |
| ES (1) | ES2058342T3 (enExample) |
| FI (1) | FI97381C (enExample) |
| HU (3) | HU906494D0 (enExample) |
| IE (1) | IE65322B1 (enExample) |
| IL (1) | IL88901A (enExample) |
| MY (1) | MY104140A (enExample) |
| NO (1) | NO174508B (enExample) |
| NZ (1) | NZ227541A (enExample) |
| PT (1) | PT89400B (enExample) |
Families Citing this family (155)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5210079A (en) * | 1988-01-07 | 1993-05-11 | E. I. Du Pont De Nemours And Company | Treatment of chronic renal failure with imidazole angiotensin-II receptor antagonists |
| US5315013A (en) * | 1988-01-07 | 1994-05-24 | E. I. Du Pont De Nemours And Company | Substituted pyrazole angiotensin II antagonists |
| GB8911854D0 (en) * | 1989-05-23 | 1989-07-12 | Ici Plc | Heterocyclic compounds |
| CA2020073A1 (en) * | 1989-07-03 | 1991-01-04 | Eric E. Allen | Substituted quinazolinones as angiotensin ii antagonists |
| EP0409332A3 (en) * | 1989-07-19 | 1991-08-07 | Merck & Co. Inc. | Substituted triazoles as angiotensin ii antagonists |
| DE69024556T2 (de) * | 1989-07-28 | 1996-10-17 | Merck & Co Inc | Substituierte Triazolinone, Triazolinthione und Triazolinimine als Angiotensin II-Antagonisten |
| US5411980A (en) * | 1989-07-28 | 1995-05-02 | Merck & Co., Inc. | Substituted triazolinones, triazolinethiones, and triazolinimines as angiotensin II antagonists |
| ATE113281T1 (de) * | 1989-08-02 | 1994-11-15 | Takeda Chemical Industries Ltd | Pyrazol-derivate, verfahren zu deren herstellung und anwendung. |
| ATE117294T1 (de) * | 1989-08-11 | 1995-02-15 | Ici Plc | Chinolin-derivate, verfahren zu ihrer herstellung und ihre anwendung als arzneimittel. |
| IL95975A (en) * | 1989-10-24 | 1997-06-10 | Takeda Chemical Industries Ltd | N-benzyl- 2-alkylbenzimidazole derivatives, their production and pharmaceutical compositions containing them |
| US5250554A (en) * | 1989-10-24 | 1993-10-05 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives useful as angiotensin II inhibitors |
| IE903911A1 (en) * | 1989-11-20 | 1991-05-22 | Ici Plc | Diazine derivatives |
| US5073566A (en) * | 1989-11-30 | 1991-12-17 | Eli Lilly And Company | Angiotensin ii antagonist 1,3-imidazoles and use thereas |
| EP0435827A3 (en) * | 1989-12-28 | 1991-11-13 | Ciba-Geigy Ag | Diaza compounds |
| AU7034791A (en) * | 1989-12-29 | 1991-07-24 | University Technologies International Inc. | Methods for modelling tertiary structures of biologically active ligands including agonists and antagonists thereto and novel synthetic antagonists based on angiotensin |
| JPH05503691A (ja) * | 1989-12-29 | 1993-06-17 | ユニバーシティ・テクノロジーズ・インターナショナル・インコーポレイテッド | アゴニストおよびアンタゴニストを含む生物学的に活性なリガンドの3次構造モデルの設計方法およびアンギオテンシンに基づいた新規合成アンタゴニスト |
| EP0515546A4 (en) * | 1990-02-13 | 1993-05-12 | Merck & Co. Inc. | Triazole angiotensin ii antagonists incorporating a substituted benzyl element |
| US5449682A (en) * | 1990-02-13 | 1995-09-12 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted benzyl element |
| ATE169915T1 (de) * | 1990-02-15 | 1998-09-15 | Takeda Chemical Industries Ltd | Pyrimidindionderivate, deren herstellung und verwendung |
| IL97219A (en) * | 1990-02-19 | 1995-12-08 | Ciba Geigy Ag | Biphenyl substituted aliphatic amino compounds process for their preparation and pharmaceutical compositions containing them |
| CA2036618C (en) * | 1990-02-22 | 2002-10-29 | Akira Morimoto | Fused thiophene derivatives, their production and use |
| US5284661A (en) * | 1990-02-22 | 1994-02-08 | Takeda Chemical Industries, Ltd. | Fused thiophene derivatives, their production and use |
| CA2037630C (en) * | 1990-03-07 | 2001-07-03 | Akira Morimoto | Nitrogen-containing heterocylic compounds, their production and use |
| GB9005354D0 (en) * | 1990-03-09 | 1990-05-02 | Glaxo Group Ltd | Chemical compounds |
| FR2659655B1 (fr) * | 1990-03-19 | 1992-07-24 | Union Pharma Scient Appl | Nouveaux derives d'oxypyrazole antagonistes des recepteurs a l'angiotensine ii ; leurs procedes de preparation, compositions pharmaceutiques les contenant. |
| US5155126A (en) * | 1990-03-20 | 1992-10-13 | E. I. Du Pont De Nemours And Company | Treatment of central nervous system disorders with pyrazole, pyrrole and triazole angiotensin-II receptor antagonists |
| FR2659967B1 (fr) * | 1990-03-20 | 1992-07-24 | Sanofi Sa | Derives d'imidazolinone n-substitues, leur preparation, les compositions pharmaceutiques en contenant. |
| PT97078B (pt) * | 1990-03-20 | 1997-07-31 | Sanofi Sa | Processo para a preparacao de derivados heterociclicos n-substituidos e de composicoes farmaceuticas que os contem |
| US5270317A (en) * | 1990-03-20 | 1993-12-14 | Elf Sanofi | N-substituted heterocyclic derivatives, their preparation and the pharmaceutical compositions in which they are present |
| US5166206A (en) * | 1990-03-30 | 1992-11-24 | Merck & Co., Inc. | Substituted pyrimidines, pyrimidinones and pyridopyrimidines |
| DE4010797A1 (de) * | 1990-04-04 | 1991-10-10 | Hoechst Ag | Substituierte azole, verfahren zu deren herstellung, diese enthaltende mittel und deren verwendung |
| US5198439A (en) * | 1990-04-19 | 1993-03-30 | Imperial Chemical Industries Plc | Angiotension II antagonizing pyridine derivatives |
| US5196444A (en) * | 1990-04-27 | 1993-03-23 | Takeda Chemical Industries, Ltd. | 1-(cyclohexyloxycarbonyloxy)ethyl 2-ethoxy-1-[[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl]benzimidazole-7-carboxylate and compositions and methods of pharmaceutical use thereof |
| GB2244054B (en) * | 1990-04-19 | 1994-04-06 | Ici Plc | Pyridine derivatives |
| US6004989A (en) | 1990-04-27 | 1999-12-21 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives, their production and use |
| ZA912983B (en) | 1990-04-27 | 1992-01-29 | Takeda Chemical Industries Ltd | Benzimidazole derivatives,their production and use |
| US5703110A (en) * | 1990-04-27 | 1997-12-30 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives, their production and use |
| US5098920A (en) * | 1990-05-04 | 1992-03-24 | G. D. Searle & Co. | 1h-substituted-1,2,4-triazole compounds and methods of use thereof for treatment of cardiovascular disorders |
| US5189051A (en) * | 1990-05-10 | 1993-02-23 | E. I. Du Pont De Nemours And Company | Treatment of glaucoma and ocular hypertension with pyrrole angiotensin-II receptor antagonists |
| US5821232A (en) * | 1990-05-11 | 1998-10-13 | Pfizer Inc. | Synergistic therapeutic compositions and methods |
| RU2147875C1 (ru) | 1990-05-11 | 2000-04-27 | Пфайзер Инк. | Способ и композиция для снижения кровяного давления и лечения застойной сердечной недостаточности у млекопитающего |
| JPH05506443A (ja) * | 1990-05-25 | 1993-09-22 | ジー.ディー.サール アンド カンパニー | 心臓血管障害の治療用n―置換1,2,4―トリアゾロン化合物 |
| WO1991019697A1 (fr) * | 1990-06-19 | 1991-12-26 | Meiji Seika Kabushiki Kaisha | Derive de pyridine avec antagonisme de l'angiotensine ii |
| ATE146076T1 (de) * | 1990-06-22 | 1996-12-15 | Du Pont | Behandlung des chronischen nierenversagens mit imidazol-angiotensin-ii-rezeptorantagonisten |
| US5137902A (en) * | 1990-07-13 | 1992-08-11 | E. I. Du Pont De Nemours And Company | 4-alkylimidazole derivatives and anti-hypertensive use thereof |
| CA2044806A1 (en) * | 1990-07-18 | 1992-01-19 | Roland Jaunin | Purine derivatives |
| DE4023215A1 (de) * | 1990-07-21 | 1992-01-23 | Hoechst Ag | Substituierte azole, verfahren zu deren herstellung, sie enthaltende mittel und deren verwendung |
| AU8534291A (en) * | 1990-08-10 | 1992-03-02 | G.D. Searle & Co. | Renal-selective angiotensin ii antagonists for treatment of hypertension |
| US5217985A (en) * | 1990-08-28 | 1993-06-08 | G. D. Searle & Co. | Renal-selective biphenylalkyl 1h-substituted-1,2,4-triazole angiotensin ii antagonists for treatment of hypertension |
| IE912956A1 (en) * | 1990-09-10 | 1992-03-11 | Abbott Lab | Angiotensin ii receptor antagonists |
| US5250548A (en) * | 1990-09-10 | 1993-10-05 | Abbott Laboratories | Angiotensin II receptor antagonists |
| IL99372A0 (en) * | 1990-09-10 | 1992-08-18 | Ciba Geigy Ag | Azacyclic compounds |
| US5229406A (en) * | 1990-09-19 | 1993-07-20 | G. D. Searle & Co. | 1,3,5-trisubstituted-1,2,4-triazole compounds for treatment of circulatory disorders |
| US5140036A (en) * | 1990-09-19 | 1992-08-18 | G. D. Searle & Co. | 1,3,5-trisubstituted-1,2,4-triazole compounds for treatment of circulatory disorders |
| WO1992007852A1 (en) * | 1990-10-25 | 1992-05-14 | G.D. Searle & Co. | Biphenylalkyl xanthine compounds for treatment of cardiovascular disorders |
| AU636066B2 (en) * | 1990-10-30 | 1993-04-08 | Takeda Chemical Industries Ltd. | Thienoimidazole derivatives, their production and use |
| US5087634A (en) * | 1990-10-31 | 1992-02-11 | G. D. Searle & Co. | N-substituted imidazol-2-one compounds for treatment of circulatory disorders |
| US5238952A (en) * | 1990-10-31 | 1993-08-24 | G. D. Searle & Co. | N-substituted imidazol-2-one compounds for treatment of circulatory disorders |
| DE4036706A1 (de) * | 1990-11-17 | 1992-05-21 | Hoechst Ag | Verfahren zur behandlung der cardialen sowie der vasculaeren hypertrophie und hyperplasie |
| GB9025123D0 (en) * | 1990-11-19 | 1991-01-02 | Ici Plc | Nitrogen compounds |
| GB9026006D0 (en) * | 1990-11-29 | 1991-01-16 | Glaxo Group Ltd | Chemical compounds |
| GB9027197D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| US6025380A (en) * | 1990-12-14 | 2000-02-15 | Smithkline Beecham Plc | Medicament |
| GB9027210D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027200D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| US6034114A (en) * | 1990-12-14 | 2000-03-07 | Smithkline Beecham Plc | Medicament |
| US6028091A (en) * | 1990-12-14 | 2000-02-22 | Smithkline Beecham Plc | Medicament |
| GB9027198D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027211D0 (en) | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027201D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027212D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027209D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027208D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| US5175180A (en) * | 1990-12-20 | 1992-12-29 | G. D. Searle & Co. | N-substituted n-(alpha-triazolyl-toluyl)pyrrole compounds and use for treatment of circulatory disorders |
| TW197428B (enExample) | 1991-01-04 | 1993-01-01 | Hoechst Ag | |
| CA2058198A1 (en) * | 1991-01-04 | 1992-07-05 | Adalbert Wagner | Azole derivatives, process for their preparation, and their use |
| US5153347A (en) * | 1991-01-31 | 1992-10-06 | E. R. Squibb & Sons, Inc. | Phosphonate, phosphinate derivatives useful as antihypertensive agents |
| AT395853B (de) * | 1991-01-31 | 1993-03-25 | Chem Pharm Forsch Gmbh | Neue imidazolderivate, verfahren zu ihrer herstellung und ihre verwendung |
| IE920175A1 (en) * | 1991-02-11 | 1992-08-12 | Zeneca Ltd | Nitrogen heterocycles |
| GB9102803D0 (en) * | 1991-02-11 | 1991-03-27 | Ici Plc | Pyridine compounds |
| US5472967A (en) * | 1991-02-20 | 1995-12-05 | Synthelabo | 4-pyrimidinone derivatives their preparation and their application in therapy |
| CA2229000C (en) * | 1991-02-21 | 2002-04-09 | Sankyo Company, Limited | 1-biphenylimidazole derivatives, their preparation and their therapeutic use |
| US5616599A (en) * | 1991-02-21 | 1997-04-01 | Sankyo Company, Limited | Angiotensin II antagosist 1-biphenylmethylimidazole compounds and their therapeutic use |
| CA2061159A1 (en) * | 1991-02-26 | 1992-08-27 | Michael A. Poss | Imidazole and benzimidazole derivatives |
| US5187271A (en) * | 1991-02-28 | 1993-02-16 | G. D. Searle & Co. | N-substituted (α-imidazolyl-toluyl) pyrrole compounds for treatment of circulatory disorders |
| US6008368A (en) * | 1993-04-28 | 1999-12-28 | G. D. Searle & Co. | Pharmaceutical compositions for treatment of circulatory disorders using N-substituted (α-imidazolyl-toluyl) pyrrole aniotensin II antagonists |
| US5191086A (en) * | 1991-03-19 | 1993-03-02 | E.R. Squibb & Sons, Inc. | Imidazole and benzimidazole derivatives |
| US5236928A (en) * | 1991-03-19 | 1993-08-17 | Merck & Co., Inc. | Imidazole derivatives bearing acidic functional groups at the 5-position, their compositions and methods of use as angiotensin II antagonists |
| US5196537A (en) * | 1991-03-21 | 1993-03-23 | G. D. Searle & Co. | 5-apylheteroarylalkyl-1,3,5-trisubstituted-1,2,4-triazole compounds for treatment of circulatory disorders |
| US5187179A (en) * | 1991-03-22 | 1993-02-16 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted imidazo [1,2-b][1,2,4]triazole |
| US5128327A (en) * | 1991-03-25 | 1992-07-07 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a nitrogen containing six membered ring heterocycle |
| US5177074A (en) * | 1991-03-26 | 1993-01-05 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted thiophene or furan |
| US5164403A (en) * | 1991-04-05 | 1992-11-17 | G. D. Searle & Co. | N-arylheteroarylalkyl imidazol-2-one compounds for treatment of circulatory disorders |
| US5157040A (en) * | 1991-04-05 | 1992-10-20 | Merck & Co., Inc. | Substituted quinolines as angiotensin ii antagonists |
| US5155117A (en) * | 1991-04-12 | 1992-10-13 | G. D. Searle & Co. | 1-arylheteroarylalkyl substituted-1h-1,2,4-triazole compounds for treatment of circulatory disorders |
| TW274551B (enExample) * | 1991-04-16 | 1996-04-21 | Takeda Pharm Industry Co Ltd | |
| US5190942A (en) * | 1991-04-22 | 1993-03-02 | E. R. Squibb & Sons, Inc. | Benzoxazole and related heterocyclic substituted imidazole and benzimidazole derivatives |
| US5252574A (en) * | 1991-04-26 | 1993-10-12 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted thiophene or furan |
| JP3290657B2 (ja) * | 1991-05-01 | 2002-06-10 | メルク エンド カムパニー インコーポレーテッド | アンギオテンシンii拮抗剤として活性な酸性アラルキルトリアゾール誘導体 |
| US5198438A (en) * | 1991-05-07 | 1993-03-30 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted thiophene or furan |
| US5436259A (en) * | 1991-05-10 | 1995-07-25 | Merck & Co., Inc. | Substituted 1,2,4-triazolin-3-one compounds bearing acidic functional groups as balanced angiotensin II antagonists |
| NZ242724A (en) * | 1991-05-15 | 1994-09-27 | Du Pont | Synergistic composition comprising an angiotensin-ii receptor antagonist and a calcium channel blocker |
| US5175164A (en) * | 1991-06-05 | 1992-12-29 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted indole or dihydroindole |
| IL102183A (en) * | 1991-06-27 | 1999-11-30 | Takeda Chemical Industries Ltd | Biphenyl substituted heterocyclic compounds their production and pharmaceutical compositions comprising them |
| US5177097A (en) * | 1991-07-24 | 1993-01-05 | E. R. Squibb & Sons, Inc. | Acyl amidine and acyl, guanidine substituted biphenyl derivatives |
| US5246944A (en) * | 1991-08-13 | 1993-09-21 | Merck & Co., Inc. | Quinoline angiotensin ii antagonists incorporating a substituted benzyl element |
| AP254A (en) * | 1991-09-05 | 1993-05-05 | Glaxo Group Ltd | C-Linked pyrazole derivatives. |
| US5256654A (en) * | 1991-10-24 | 1993-10-26 | American Home Products Corporation | Substituted pyrrolopyrimidines, azepinopyrimidines and pyridopyrimidines useful as angiotensin II antagonists |
| US5149699A (en) * | 1991-10-24 | 1992-09-22 | American Home Products Corporation | Substituted pyridopyrimidines useful as antgiotensin II antagonists |
| US5484937A (en) * | 1992-08-04 | 1996-01-16 | G.D. Searle & Co. | N-substituted N-(α-triazolyl-toluyl)pyrrole compounds for treatment of circulatory disorders |
| US5389661A (en) * | 1991-12-05 | 1995-02-14 | Warner-Lambert Company | Imidazole and 1,2,4-triazole derivatives with angiotensin II antagonist properties |
| US5322950A (en) * | 1991-12-05 | 1994-06-21 | Warner-Lambert Company | Imidazole with angiotensin II antagonist properties |
| US5234923A (en) * | 1991-12-16 | 1993-08-10 | E. R. Squibb & Sons, Inc. | Substitute indole and benzimidazole derivatives |
| US5212177A (en) * | 1991-12-16 | 1993-05-18 | E. R. Squibb & Sons, Inc. | Indole and benzimidazole-substituted dihydropyrimidine derivatives |
| US5350752A (en) * | 1991-12-16 | 1994-09-27 | E. R. Squibb & Sons, Inc. | Dihydropyrimidine derivatives |
| GB2263635A (en) * | 1992-01-28 | 1993-08-04 | Merck & Co Inc | Substitiuted triazoles as neurotensin antagonists |
| US5240953A (en) * | 1992-01-30 | 1993-08-31 | Ortho Pharmaceutical Corporation | Substituted triazoles as angiotensin ii inhibitors |
| US5326776A (en) * | 1992-03-02 | 1994-07-05 | Abbott Laboratories | Angiotensin II receptor antagonists |
| TW215434B (enExample) * | 1992-03-07 | 1993-11-01 | Hoechst Ag | |
| US5208234A (en) * | 1992-03-10 | 1993-05-04 | E. R. Squibb & Sons, Inc. | Substituted imidazole phosphonic and phosphinic acid derivatives |
| US5616591A (en) * | 1992-03-27 | 1997-04-01 | E.R. Squibb & Sons, Inc. | Indole- and benzimidazole-substituted quinoline derivatives |
| US5294722A (en) * | 1992-04-16 | 1994-03-15 | E. R. Squibb & Sons, Inc. | Process for the preparation of imidazoles useful in angiotensin II antagonism |
| US5212195A (en) * | 1992-05-13 | 1993-05-18 | Syntex (U.S.A.) Inc. | Substituted indole antagonists derivatives which are angiotensin II |
| US5401851A (en) * | 1992-06-03 | 1995-03-28 | Eli Lilly And Company | Angiotensin II antagonists |
| HU219598B (hu) * | 1992-12-17 | 2001-05-28 | Sankyo Co. Ltd. | Bifenilvegyületek imidazol- és piridinszármazékai, eljárás előállításukra és ezeket a vegyületeket tartalmazó gyógyszerkészítmények |
| US5451597A (en) * | 1993-05-27 | 1995-09-19 | G.D. Searle & Co. | Treatment of circulatory disorders using n-substituted (α-imidazolyl-toluyl) pyrrole angiotensin II antagonists |
| EP0628559B1 (en) * | 1993-06-10 | 2002-04-03 | Beiersdorf-Lilly GmbH | Pyrimidine compounds and their use as pharmaceuticals |
| US5571813A (en) * | 1993-06-10 | 1996-11-05 | Beiersdorf-Lilly Gmbh | Fused pyrimidine compounds and their use as pharmaceuticals |
| US5412102A (en) * | 1994-05-27 | 1995-05-02 | Syntex (U.S.A.) Inc. | Processes for preparing 1-butyl-2-[2'-(2H-tetrazol-5-yl) biphenyl-4-ylmethyl]-1H-indole-3-carboxylic acid |
| US5527920A (en) * | 1994-11-18 | 1996-06-18 | Singh; Inder P. | Economical manufacturing process for 1,2,3-triazoles |
| FR2742148B1 (fr) * | 1995-12-08 | 1999-10-22 | Sanofi Sa | Nouveaux derives du pyrazole-3-carboxamide, procede pour leur preparation et compositions pharmaceutiques les contenant |
| AU751139B2 (en) | 1997-10-13 | 2002-08-08 | Astellas Pharma Inc. | Amide derivative |
| ZA991706B (en) | 1998-03-04 | 2000-10-03 | Takeda Chemical Industries Ltd | Sustained-release preparation for Aii Antagonist, production and use thereof. |
| ATE467620T1 (de) * | 1999-03-26 | 2010-05-15 | Euro Celtique Sa | Arylsubstituierte pyrazole, imidazole, oxazole, thiazole und pyrrole, sowie deren verwendung |
| SE9903028D0 (sv) | 1999-08-27 | 1999-08-27 | Astra Ab | New use |
| CN1321112C (zh) | 2000-03-24 | 2007-06-13 | 欧洲凯尔特股份有限公司 | 作为钠通道阻滞剂的芳基取代的吡唑、三唑和四唑化合物 |
| EP1444988A4 (en) | 2001-11-13 | 2007-04-25 | Takeda Pharmaceutical | CANCER AGENT |
| DE10335027A1 (de) | 2003-07-31 | 2005-02-17 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Verwendung von Angiotensin II Rezeptor Antagonisten |
| DE10306179A1 (de) | 2003-02-13 | 2004-08-26 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Verwendung von Dipyridamol in Kombination mit Acetylsalicylsäure und einem Angiotensin II-Antagonisten zur Schlaganfall-Prophylaxe |
| ITTO20040264A1 (it) | 2004-04-28 | 2004-07-28 | Rotta Res Lab Spa | Nuovi derivati pirrolici ad attivita' angiotensina-ii antagonista |
| ES2555511T3 (es) | 2006-08-03 | 2016-01-04 | Rottapharm Biotech S.R.L. | Inhibidores de COX-2 altamente selectivos y eficaces por vía oral de 1,5-diaril-2-alquil-pirroles 3-sustituidos |
| EP1908469A1 (en) | 2006-10-06 | 2008-04-09 | Boehringer Ingelheim Vetmedica Gmbh | Angiotensin II receptor antagonist for the treatment of systemic diseases in cats |
| TWI448284B (zh) | 2007-04-24 | 2014-08-11 | Theravance Inc | 雙效抗高血壓劑 |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| JP5546451B2 (ja) | 2007-06-04 | 2014-07-09 | シナジー ファーマシューティカルズ インコーポレイテッド | 胃腸の障害、炎症、癌および他の障害の処置に有用なグアニル酸シクラーゼのアゴニスト |
| US20100120694A1 (en) | 2008-06-04 | 2010-05-13 | Synergy Pharmaceuticals, Inc. | Agonists of Guanylate Cyclase Useful for the Treatment of Gastrointestinal Disorders, Inflammation, Cancer and Other Disorders |
| EP3241839B1 (en) | 2008-07-16 | 2019-09-04 | Bausch Health Ireland Limited | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| AU2014235209B2 (en) | 2013-03-15 | 2018-06-14 | Bausch Health Ireland Limited | Guanylate cyclase receptor agonists combined with other drugs |
| HK1220696A1 (zh) | 2013-03-15 | 2017-05-12 | Bausch Health Ireland Limited | 鸟苷酸环化酶激动剂及其用途 |
| EP4424697A3 (en) | 2013-06-05 | 2024-12-25 | Bausch Health Ireland Limited | Ultra-pure agonists of guanylate cyclase c, method of making and using same |
| LT3648761T (lt) | 2017-07-07 | 2024-06-10 | Boehringer Ingelheim Vetmedica Gmbh | Telmisartanas, skirtas kačių hipertenzijos profilaktikai arba gydymui |
| CN114163391B (zh) * | 2021-12-14 | 2024-02-02 | 迪嘉药业集团股份有限公司 | 一种坎地沙坦中间体及坎地沙坦的制备方法 |
| WO2024240633A1 (en) | 2023-05-24 | 2024-11-28 | Boehringer Ingelheim Vetmedica Gmbh | Combination treatment and/or prevention of renal diseases and/or hypertension in non-human mammals comprising one or more sglt-2 inhibitors and telmisartan |
| US20250195525A1 (en) | 2023-12-15 | 2025-06-19 | Boehringer Ingelheim Vetmedica Gmbh | Angiotensin ii receptor antagonist for the prevention of systemic diseases in cats |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2470084A (en) * | 1945-09-25 | 1949-05-17 | Bilhuber Inc E | Substituted alpha-halogen alkyl tetrazoles and process for obtaining the same |
| US3065241A (en) * | 1961-01-18 | 1962-11-20 | Astra Ab | Process for preparing certain tetrazoles |
| US3551571A (en) * | 1967-05-19 | 1970-12-29 | Endo Lab | Methods for reducing pain,reducing fever and alleviating inflammatory syndromes with heteroaromatic pyrrol-3-yl ketones |
| US4209515A (en) * | 1974-06-14 | 1980-06-24 | Ciba-Geigy Corporation | Triazole derivatives |
| JPS54148788A (en) * | 1978-05-15 | 1979-11-21 | Takeda Chem Ind Ltd | 1,2-disubstituted-4-halogenoimidazole-5-acetic acid derivative and its preparation |
| GB2041363B (en) * | 1979-01-19 | 1982-10-06 | Pfizer Ltd | N-benzyl-imidazoles |
| JPS5671073A (en) * | 1979-11-12 | 1981-06-13 | Takeda Chem Ind Ltd | Imidazole derivative |
| JPS5671074A (en) * | 1979-11-12 | 1981-06-13 | Takeda Chem Ind Ltd | 1,2-disubstituted-4-halogenoimidazole-5-acetic acid derivative |
| JPS579771A (en) * | 1980-06-21 | 1982-01-19 | Otsuka Pharmaceut Co Ltd | Tetrazole derivative |
| US4338453A (en) * | 1980-09-17 | 1982-07-06 | The Upjohn Company | Aminoalkyl-1,2,4-triazoles |
| SU1018941A1 (ru) * | 1982-02-03 | 1983-05-23 | Институт Органической Химии Ан Армсср | Способ получени 3/5/-бензил-5/3/-метилпиразола |
| JPS58157768A (ja) * | 1982-03-16 | 1983-09-19 | Takeda Chem Ind Ltd | 4−クロロ−2−フエニルイミダゾ−ル−5−酢酸誘導体 |
| US4577020A (en) * | 1983-01-25 | 1986-03-18 | The Upjohn Company | Aminoalkyl and aminoalkenyl triazoles as anti-psychotic agents |
| US4590201A (en) * | 1984-02-02 | 1986-05-20 | Merck & Co., Inc. | 5-amino or substituted amino 1,2,3-triazoles |
| US4568685A (en) * | 1984-02-29 | 1986-02-04 | American Cyanamid Company | N-[(1H-1,2,4-Triazol-1-yl)alkyl]-arylamides |
| US4755526A (en) * | 1984-06-18 | 1988-07-05 | Eli Lilly And Company | Method of inhibiting aromatase |
| CA1334092C (en) * | 1986-07-11 | 1995-01-24 | David John Carini | Angiotensin ii receptor blocking imidazoles |
| AR245694A1 (es) * | 1989-01-31 | 1994-02-28 | Merrell Dow Pharma | Procedimiento para la preparacion de nuevos derivados de acidos aril- o heteroaril-1-alquilpirrol-2-carboxilicos utiles como inhibidores de interleuquina-1 |
-
1988
- 1988-12-06 US US07/279,193 patent/US5015651A/en not_active Expired - Lifetime
-
1989
- 1989-01-05 EP EP89100142A patent/EP0323841B1/en not_active Expired - Lifetime
- 1989-01-05 NZ NZ227541A patent/NZ227541A/en unknown
- 1989-01-05 ES ES89100142T patent/ES2058342T3/es not_active Expired - Lifetime
- 1989-01-05 DE DE89100142T patent/DE68907921T2/de not_active Expired - Fee Related
- 1989-01-05 CA CA000587617A patent/CA1338013C/en not_active Expired - Fee Related
- 1989-01-05 AT AT89100142T patent/ATE92478T1/de not_active IP Right Cessation
- 1989-01-06 MY MYPI89000016A patent/MY104140A/en unknown
- 1989-01-06 HU HU906494A patent/HU906494D0/hu unknown
- 1989-01-06 JP JP64000588A patent/JPH0725733B2/ja not_active Expired - Fee Related
- 1989-01-06 HU HU8948A patent/HU205085B/hu not_active IP Right Cessation
- 1989-01-06 IE IE2689A patent/IE65322B1/en not_active IP Right Cessation
- 1989-01-06 HU HU9364A patent/HU906493D0/hu unknown
- 1989-01-06 DK DK005389A patent/DK171468B1/da not_active IP Right Cessation
- 1989-01-06 IL IL88901A patent/IL88901A/xx not_active IP Right Cessation
- 1989-01-06 PT PT89400A patent/PT89400B/pt active IP Right Grant
- 1989-01-06 NO NO890074A patent/NO174508B/no not_active IP Right Cessation
- 1989-01-06 FI FI890071A patent/FI97381C/fi not_active IP Right Cessation
- 1989-01-06 AU AU27770/89A patent/AU612755B2/en not_active Ceased
- 1989-01-07 KR KR1019890000095A patent/KR910002823B1/ko not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK171468B1 (da) | Pyrrol-, pyrazol- eller triazolforbindelser, farmaceutiske præparater indeholdende disse forbindelser samt deres anvendelse til fremstilling af antihypertensive midler og midler til behandling af kongestivt hjertesvigt | |
| US5081127A (en) | Substituted 1,2,3-triazole angiotensin II antagonists | |
| DK174948B1 (da) | Antihypertensive forbindelser, farmaceutisk præparat indeholdende en sådan forbindelse, anvendelse af forbindelserne til fremstilling af et lægemiddel samt fremgangsmåde til fremstilling af forbindelserne | |
| KR101677606B1 (ko) | mPGES-1 억제제로서 트리아졸론 화합물 | |
| JPH0529351B2 (enExample) | ||
| US5332820A (en) | Dibenzobicyclo(2.2.2) octane angiotensin II antagonists | |
| EA003056B1 (ru) | АЗОТСОДЕРЖАЩИЕ ГЕТЕРОАРОМАТИЧЕСКИЕ СОЕДИНЕНИЯ В КАЧЕСТВЕ ИНГИБИТОРОВ ФАКТОРА Ха, ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ И СПОСОБ ЛЕЧЕНИЯ | |
| HU218460B (hu) | Eljárás új, szubsztituált imidazolszármazékok, és hatóanyagként e vegyületeket tartalmazó gyógyszerkészítmények előállítására | |
| FI79103C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1,4-dihydropyridinderivat. | |
| TW200843744A (en) | Dual-acting antihypertensive agents | |
| TW200914449A (en) | Organic compounds | |
| US5189048A (en) | Substituted 1,2,3 triazole angiotensin II antagonists | |
| JP5526777B2 (ja) | 二環式複素環化合物 | |
| US5093346A (en) | Substituted 1,2,4-triazole angiotensin II antagonists | |
| ES2358904T3 (es) | Heterociclos de cicloalquilo para tratar el virus de la hepatitis c. | |
| KR910007213B1 (ko) | 안지오텐신 ⅱ 수용체 차단 이미다졸, 및 이뇨제 및 비스테로이드성 소염제와 이의 조성물 | |
| US5043349A (en) | Substituted pyrrole angiotensin II antagonists | |
| US5315013A (en) | Substituted pyrazole angiotensin II antagonists | |
| KR940006532B1 (ko) | 치환된 피롤 안지오텐신 ⅱ 길항제 | |
| JP2008539181A (ja) | Ep1受容体アンタゴニストとして有用なフラン化合物 | |
| JP2014532644A (ja) | Rarアンタゴニストとしての置換ピラゾール類似体 | |
| Gehanne et al. | Novel and Efficient Access to Thieno (3, 4-c) cinnolines | |
| JPWO1994026721A1 (ja) | ピリミジン誘導体及び医薬組成物 | |
| LT4673B (lt) | Azoto heteroaromatiniai junginiai kaip faktoriaus xa inhibitoriai | |
| HU211674A9 (hu) | Az átmeneti oltalom az 1-39. igénypontokra vonatkozik. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B1 | Patent granted (law 1993) | ||
| PBP | Patent lapsed |
Country of ref document: DK |