HU205085B - Process for producing substituted pyrrole and pyrazole derivatives and pharmaceutical compositions comprising same - Google Patents
Process for producing substituted pyrrole and pyrazole derivatives and pharmaceutical compositions comprising same Download PDFInfo
- Publication number
- HU205085B HU205085B HU8948A HU4889A HU205085B HU 205085 B HU205085 B HU 205085B HU 8948 A HU8948 A HU 8948A HU 4889 A HU4889 A HU 4889A HU 205085 B HU205085 B HU 205085B
- Authority
- HU
- Hungary
- Prior art keywords
- mmol
- compound
- methyl
- formula
- propyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 11
- 239000008194 pharmaceutical composition Chemical class 0.000 title claims description 5
- 150000003233 pyrroles Chemical class 0.000 title abstract description 11
- 150000003217 pyrazoles Chemical class 0.000 title abstract description 10
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims description 124
- -1 5-tetrazolyl Chemical group 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 206010007559 Cardiac failure congestive Diseases 0.000 abstract description 4
- 206010019280 Heart failures Diseases 0.000 abstract description 4
- 229940030600 antihypertensive agent Drugs 0.000 abstract description 3
- 239000002220 antihypertensive agent Substances 0.000 abstract description 3
- 150000003852 triazoles Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- 238000005481 NMR spectroscopy Methods 0.000 description 51
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 48
- 235000019439 ethyl acetate Nutrition 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 24
- 239000000243 solution Substances 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 21
- 238000003818 flash chromatography Methods 0.000 description 21
- 239000007787 solid Substances 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 239000000741 silica gel Substances 0.000 description 19
- 229910002027 silica gel Inorganic materials 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 15
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 11
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000036772 blood pressure Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- 0 Cc(cc1)ccc1-c1c(*)cccc1 Chemical compound Cc(cc1)ccc1-c1c(*)cccc1 0.000 description 6
- 206010020772 Hypertension Diseases 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 6
- 239000005557 antagonist Substances 0.000 description 6
- 230000003276 anti-hypertensive effect Effects 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 241000124008 Mammalia Species 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- RMXGTMRDXKUUDJ-UHFFFAOYSA-N methyl 2-[4-(bromomethyl)phenyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=C(CBr)C=C1 RMXGTMRDXKUUDJ-UHFFFAOYSA-N 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 4
- 108090000765 processed proteins & peptides Proteins 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ICPWFHKNYYRBSZ-UHFFFAOYSA-M 2-methoxypropanoate Chemical compound COC(C)C([O-])=O ICPWFHKNYYRBSZ-UHFFFAOYSA-M 0.000 description 3
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical group OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- 108010083387 Saralasin Proteins 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000005594 diketone group Chemical group 0.000 description 3
- HTPFMOGFQKDFHX-UHFFFAOYSA-N ethyl 5-formyl-1h-pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=O)N1 HTPFMOGFQKDFHX-UHFFFAOYSA-N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- PFGWGEPQIUAZME-NXSMLHPHSA-N saralasin Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C)C(O)=O)C1=CC=C(O)C=C1 PFGWGEPQIUAZME-NXSMLHPHSA-N 0.000 description 3
- 229960004785 saralasin Drugs 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- 125000006017 1-propenyl group Chemical group 0.000 description 2
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- YDXGCMHMMCNTBY-UHFFFAOYSA-N 2-[4-[[5-butyl-3-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound CCCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 YDXGCMHMMCNTBY-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- ZTFVTXDWDFIQEU-UHFFFAOYSA-N 5-[2-[4-(bromomethyl)phenyl]phenyl]-1-trityltetrazole Chemical group C1=CC(CBr)=CC=C1C1=CC=CC=C1C1=NN=NN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZTFVTXDWDFIQEU-UHFFFAOYSA-N 0.000 description 2
- BRWJNSKGKHUIHY-UHFFFAOYSA-N 5-propyl-1h-pyrrole-2-carbaldehyde Chemical compound CCCC1=CC=C(C=O)N1 BRWJNSKGKHUIHY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 108010064733 Angiotensins Proteins 0.000 description 2
- 102000015427 Angiotensins Human genes 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N Minaline Natural products OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102100028255 Renin Human genes 0.000 description 2
- 108090000783 Renin Proteins 0.000 description 2
- 229920002472 Starch Chemical class 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 239000001913 cellulose Chemical class 0.000 description 2
- 229920002678 cellulose Chemical class 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- NZXXJLWFLINATO-UHFFFAOYSA-N ethyl 5-(1-hydroxypropyl)-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C(O)CC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 NZXXJLWFLINATO-UHFFFAOYSA-N 0.000 description 2
- UTMUJENJZVVZLN-UHFFFAOYSA-N ethyl 5-formyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 UTMUJENJZVVZLN-UHFFFAOYSA-N 0.000 description 2
- JBHWGJMXKKDKHE-UHFFFAOYSA-N ethyl 5-prop-1-enyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=CC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 JBHWGJMXKKDKHE-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000008297 liquid dosage form Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- YOMYPRTWFYKDGV-UHFFFAOYSA-N methyl 2-[4-[(5-formyl-3-propylpyrazol-1-yl)methyl]phenyl]benzoate Chemical compound N1=C(CCC)C=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 YOMYPRTWFYKDGV-UHFFFAOYSA-N 0.000 description 2
- JUYLPJYOGJYQHT-UHFFFAOYSA-N methyl 2-[4-[[3-butyl-5-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoate Chemical compound N1=C(CCCC)C=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 JUYLPJYOGJYQHT-UHFFFAOYSA-N 0.000 description 2
- QATYKNFWLVUARK-UHFFFAOYSA-N methyl 2-[4-[[5-(methoxymethyl)-3-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound N1=C(CCC)C=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 QATYKNFWLVUARK-UHFFFAOYSA-N 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000003182 parenteral nutrition solution Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- ZSKGQVFRTSEPJT-UHFFFAOYSA-N pyrrole-2-carboxaldehyde Chemical compound O=CC1=CC=CN1 ZSKGQVFRTSEPJT-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000008107 starch Chemical class 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YHXCWNQNVMAENQ-UHFFFAOYSA-N tert-butyl 2-[4-(bromomethyl)phenyl]benzoate Chemical compound CC(C)(C)OC(=O)C1=CC=CC=C1C1=CC=C(CBr)C=C1 YHXCWNQNVMAENQ-UHFFFAOYSA-N 0.000 description 2
- GLOQVSJNUUZOFE-UHFFFAOYSA-N tert-butyl 2-[4-[(2-formyl-5-propylpyrrol-1-yl)methyl]phenyl]benzoate Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC(C)(C)C)C=C1 GLOQVSJNUUZOFE-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- YUARURASDIGOQF-UHFFFAOYSA-N 1-[[4-(2-carboxyphenyl)phenyl]methyl]-5-propylpyrazole-3-carboxylic acid Chemical compound CCCC1=CC(C(O)=O)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 YUARURASDIGOQF-UHFFFAOYSA-N 0.000 description 1
- BCHJOKBNPLDACJ-UHFFFAOYSA-N 1-[[4-(2-carboxyphenyl)phenyl]methyl]-5-propylpyrrole-2-carboxylic acid Chemical compound CCCC1=CC=C(C(O)=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 BCHJOKBNPLDACJ-UHFFFAOYSA-N 0.000 description 1
- WHQKKKRGZMNCKO-UHFFFAOYSA-N 1-methoxyoct-7-ene-2,4-dione Chemical compound COCC(=O)CC(=O)CCC=C WHQKKKRGZMNCKO-UHFFFAOYSA-N 0.000 description 1
- HCKUOPXBZCRCKN-UHFFFAOYSA-N 2,4-dioxoheptanoic acid Chemical compound CCCC(=O)CC(=O)C(O)=O HCKUOPXBZCRCKN-UHFFFAOYSA-N 0.000 description 1
- BVNDBGMQJWTEDW-UHFFFAOYSA-N 2-[(4-chlorophenyl)methyl]-5-methyl-4h-pyrazol-3-one Chemical compound O=C1CC(C)=NN1CC1=CC=C(Cl)C=C1 BVNDBGMQJWTEDW-UHFFFAOYSA-N 0.000 description 1
- NUDMZBBLHDMDGJ-UHFFFAOYSA-N 2-[4-[(2-formyl-5-propylpyrrol-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 NUDMZBBLHDMDGJ-UHFFFAOYSA-N 0.000 description 1
- PTQFXXTUWDFFGJ-UHFFFAOYSA-N 2-[4-[(3-formyl-5-propylpyrazol-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCC1=CC(C=O)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 PTQFXXTUWDFFGJ-UHFFFAOYSA-N 0.000 description 1
- ZQPRJNCLFCDJTD-UHFFFAOYSA-N 2-[4-[(5-formyl-3-propylpyrazol-1-yl)methyl]phenyl]benzoic acid Chemical compound N1=C(CCC)C=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 ZQPRJNCLFCDJTD-UHFFFAOYSA-N 0.000 description 1
- MIHXVKWGFQNYLS-UHFFFAOYSA-N 2-[4-[[3-(hydroxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound CCCC1=CC(CO)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 MIHXVKWGFQNYLS-UHFFFAOYSA-N 0.000 description 1
- LDZZKFSBAPVBCM-UHFFFAOYSA-N 2-[4-[[3-(methoxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound CCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 LDZZKFSBAPVBCM-UHFFFAOYSA-N 0.000 description 1
- RXSQDLFLLCXPIZ-UHFFFAOYSA-N 2-[4-[[3-butyl-5-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound N1=C(CCCC)C=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 RXSQDLFLLCXPIZ-UHFFFAOYSA-N 0.000 description 1
- AJUAIZDUJFFIAX-UHFFFAOYSA-N 2-[4-[[5-(hydroxymethyl)-3-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound N1=C(CCC)C=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 AJUAIZDUJFFIAX-UHFFFAOYSA-N 0.000 description 1
- JOKUBVGIGYGMRZ-UHFFFAOYSA-N 2-[4-[[5-(methoxymethyl)-3-propylpyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound N1=C(CCC)C=C(COC)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 JOKUBVGIGYGMRZ-UHFFFAOYSA-N 0.000 description 1
- AYTLYJCRHMPQDR-UHFFFAOYSA-N 2-[4-[[5-but-3-enyl-3-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoic acid Chemical compound N1=C(COC)C=C(CCC=C)N1CC1=CC=C(C=2C(=CC=CC=2)C(O)=O)C=C1 AYTLYJCRHMPQDR-UHFFFAOYSA-N 0.000 description 1
- NOIXNOMHHWGUTG-UHFFFAOYSA-N 2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline Chemical class C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1C1=NN(CC(F)(F)F)C=C1C1=CC=NC=C1 NOIXNOMHHWGUTG-UHFFFAOYSA-N 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- QTVRZLFIMULIDR-UHFFFAOYSA-N 5-butyl-1-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylic acid Chemical compound CCCCC1=CC=C(C(O)=O)N1CC1=CC=C(C=2C(=CC=CC=2)C=2NN=NN=2)C=C1 QTVRZLFIMULIDR-UHFFFAOYSA-N 0.000 description 1
- RNDVGJZUHCKENF-UHFFFAOYSA-N 5-hexen-2-one Chemical compound CC(=O)CCC=C RNDVGJZUHCKENF-UHFFFAOYSA-N 0.000 description 1
- BHTQIUHUIROZDU-UHFFFAOYSA-N 5-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde Chemical compound CCCC1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 BHTQIUHUIROZDU-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- XASOHFCUIQARJT-UHFFFAOYSA-N 8-methoxy-6-[7-(2-morpholin-4-ylethoxy)imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one Chemical compound C(N1C(=O)C2=C(OC)C=C(C=3N4C(=NC=3)C=C(C=C4)OCCN3CCOCC3)C=C2CC1)C(F)(F)F XASOHFCUIQARJT-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 102000002572 Alpha-Globulins Human genes 0.000 description 1
- 108010068307 Alpha-Globulins Proteins 0.000 description 1
- 102000005862 Angiotensin II Human genes 0.000 description 1
- 102000008873 Angiotensin II receptor Human genes 0.000 description 1
- 108050000824 Angiotensin II receptor Proteins 0.000 description 1
- 101800000734 Angiotensin-1 Proteins 0.000 description 1
- 102400000344 Angiotensin-1 Human genes 0.000 description 1
- 101800000733 Angiotensin-2 Proteins 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- 102000003984 Aryl Hydrocarbon Receptors Human genes 0.000 description 1
- 108090000448 Aryl Hydrocarbon Receptors Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 229920001410 Microfiber Polymers 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 238000006086 Paal-Knorr synthesis reaction Methods 0.000 description 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 208000001647 Renal Insufficiency Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 210000004404 adrenal cortex Anatomy 0.000 description 1
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 description 1
- 150000001337 aliphatic alkines Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 1
- 229950006323 angiotensin ii Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000003886 aromatase inhibitor Substances 0.000 description 1
- 229940046844 aromatase inhibitors Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229960001671 azapropazone Drugs 0.000 description 1
- WOIIIUDZSOLAIW-NSHDSACASA-N azapropazone Chemical compound C1=C(C)C=C2N3C(=O)[C@H](CC=C)C(=O)N3C(N(C)C)=NC2=C1 WOIIIUDZSOLAIW-NSHDSACASA-N 0.000 description 1
- 150000007980 azole derivatives Chemical class 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- NHOWLEZFTHYCTP-UHFFFAOYSA-N benzylhydrazine Chemical class NNCC1=CC=CC=C1 NHOWLEZFTHYCTP-UHFFFAOYSA-N 0.000 description 1
- 230000008512 biological response Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OPHUWKNKFYBPDR-UHFFFAOYSA-N copper lithium Chemical compound [Li].[Cu] OPHUWKNKFYBPDR-UHFFFAOYSA-N 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 125000002587 enol group Chemical group 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- ZYNACNSJZLIYCY-UHFFFAOYSA-N ethyl 1-[[4-(2-methoxycarbonylphenyl)phenyl]methyl]-5-propylpyrazole-3-carboxylate Chemical compound CCCC1=CC(C(=O)OCC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 ZYNACNSJZLIYCY-UHFFFAOYSA-N 0.000 description 1
- DMAUJRWSYKLVHX-UHFFFAOYSA-N ethyl 2,4-dioxoheptanoate Chemical compound CCCC(=O)CC(=O)C(=O)OCC DMAUJRWSYKLVHX-UHFFFAOYSA-N 0.000 description 1
- UWVRYNPASYYXDK-UHFFFAOYSA-N ethyl 2-[[4-(2-methoxycarbonylphenyl)phenyl]methyl]-5-propylpyrazole-3-carboxylate Chemical compound N1=C(CCC)C=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 UWVRYNPASYYXDK-UHFFFAOYSA-N 0.000 description 1
- MGDJAYMQGIBPHC-UHFFFAOYSA-N ethyl 5-(1-hydroxybutyl)-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCCC(O)C1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 MGDJAYMQGIBPHC-UHFFFAOYSA-N 0.000 description 1
- UCNLIORNDQWDSM-UHFFFAOYSA-N ethyl 5-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCCCC1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 UCNLIORNDQWDSM-UHFFFAOYSA-N 0.000 description 1
- CNUZLCRABDUENJ-UHFFFAOYSA-N ethyl 5-butyl-1-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCCCC1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C2=NNN=N2)C=C1 CNUZLCRABDUENJ-UHFFFAOYSA-N 0.000 description 1
- WYOGTPUANFUHLQ-UHFFFAOYSA-N ethyl 5-formyl-1-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=O)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC(C)(C)C)C=C1 WYOGTPUANFUHLQ-UHFFFAOYSA-N 0.000 description 1
- DEGYYHVSMFYQOI-UHFFFAOYSA-N ethyl 5-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCCC1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C=2N(N=NN=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 DEGYYHVSMFYQOI-UHFFFAOYSA-N 0.000 description 1
- AIVJJFBQHYZDEM-UHFFFAOYSA-N ethyl 5-propyl-1-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carboxylate Chemical compound CCCC1=CC=C(C(=O)OCC)N1CC1=CC=C(C=2C(=CC=CC=2)C2=NNN=N2)C=C1 AIVJJFBQHYZDEM-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 230000009097 homeostatic mechanism Effects 0.000 description 1
- 108091008039 hormone receptors Proteins 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229960002003 hydrochlorothiazide Drugs 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 description 1
- 229960000991 ketoprofen Drugs 0.000 description 1
- 201000006370 kidney failure Diseases 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 150000002641 lithium Chemical class 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 1
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 1
- RQLKAKQYERUOJD-UHFFFAOYSA-N lithium;1,3,5-trimethylbenzene-6-ide Chemical compound [Li+].CC1=CC(C)=[C-]C(C)=C1 RQLKAKQYERUOJD-UHFFFAOYSA-N 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940013798 meclofenamate Drugs 0.000 description 1
- SBDNJUWAMKYJOX-UHFFFAOYSA-M meclofenamic acid(1-) Chemical compound CC1=CC=C(Cl)C(NC=2C(=CC=CC=2)C([O-])=O)=C1Cl SBDNJUWAMKYJOX-UHFFFAOYSA-M 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- MEFLPNNUDOJYTB-UHFFFAOYSA-N methyl 2-[4-[(3-formyl-5-propylpyrazol-1-yl)methyl]phenyl]benzoate Chemical compound CCCC1=CC(C=O)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 MEFLPNNUDOJYTB-UHFFFAOYSA-N 0.000 description 1
- GQEHJEATPMSKFP-UHFFFAOYSA-N methyl 2-[4-[[3-(hydroxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound CCCC1=CC(CO)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 GQEHJEATPMSKFP-UHFFFAOYSA-N 0.000 description 1
- VCKRHHXORHRNBD-UHFFFAOYSA-N methyl 2-[4-[[3-(methoxymethyl)-5-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound CCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 VCKRHHXORHRNBD-UHFFFAOYSA-N 0.000 description 1
- RUDWUFZTXPODLG-UHFFFAOYSA-N methyl 2-[4-[[5-(hydroxymethyl)-3-propylpyrazol-1-yl]methyl]phenyl]benzoate Chemical compound N1=C(CCC)C=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 RUDWUFZTXPODLG-UHFFFAOYSA-N 0.000 description 1
- GKXWLYQEDLTDFV-UHFFFAOYSA-N methyl 2-[4-[[5-butyl-3-(methoxymethyl)pyrazol-1-yl]methyl]phenyl]benzoate Chemical compound CCCCC1=CC(COC)=NN1CC1=CC=C(C=2C(=CC=CC=2)C(=O)OC)C=C1 GKXWLYQEDLTDFV-UHFFFAOYSA-N 0.000 description 1
- WNAFVJVEADYQAI-UHFFFAOYSA-N methyl 2-phenylbenzoate Chemical group COC(=O)C1=CC=CC=C1C1=CC=CC=C1 WNAFVJVEADYQAI-UHFFFAOYSA-N 0.000 description 1
- ZKUUVVYMPUDTGJ-UHFFFAOYSA-N methyl 5-hydroxy-4-methoxy-2-nitrobenzoate Chemical compound COC(=O)C1=CC(O)=C(OC)C=C1[N+]([O-])=O ZKUUVVYMPUDTGJ-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000003658 microfiber Substances 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N p-hydroxybenzoic acid methyl ester Natural products COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Natural products OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001525 receptor binding assay Methods 0.000 description 1
- 210000002254 renal artery Anatomy 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical group C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- MLKXDPUZXIRXEP-MFOYZWKCSA-N sulindac Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-MFOYZWKCSA-N 0.000 description 1
- 229960000894 sulindac Drugs 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- UPSPUYADGBWSHF-UHFFFAOYSA-N tolmetin Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C UPSPUYADGBWSHF-UHFFFAOYSA-N 0.000 description 1
- 229960001017 tolmetin Drugs 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229940024986 topical antifungal imidazole and triazole derivative Drugs 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing aromatic rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14166988A | 1988-01-07 | 1988-01-07 | |
| US07/279,193 US5015651A (en) | 1988-01-07 | 1988-12-06 | Treatment of hypertension with 1,2,4-angiotensin II antagonists |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT49571A HUT49571A (en) | 1989-10-30 |
| HU205085B true HU205085B (en) | 1992-03-30 |
Family
ID=26839346
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU8948A HU205085B (en) | 1988-01-07 | 1989-01-06 | Process for producing substituted pyrrole and pyrazole derivatives and pharmaceutical compositions comprising same |
| HU906494A HU906494D0 (en) | 1988-01-07 | 1989-01-06 | Process for producing substituted 1,2,3-triazole derivatives and pharmaceutical preparatives containing these compounds |
| HU9364A HU906493D0 (en) | 1988-01-07 | 1989-01-06 | Process for producing substituted 1,2,4-triazole derivatives and pharmaceutical preparatives containing these compounds |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU906494A HU906494D0 (en) | 1988-01-07 | 1989-01-06 | Process for producing substituted 1,2,3-triazole derivatives and pharmaceutical preparatives containing these compounds |
| HU9364A HU906493D0 (en) | 1988-01-07 | 1989-01-06 | Process for producing substituted 1,2,4-triazole derivatives and pharmaceutical preparatives containing these compounds |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5015651A (enExample) |
| EP (1) | EP0323841B1 (enExample) |
| JP (1) | JPH0725733B2 (enExample) |
| KR (1) | KR910002823B1 (enExample) |
| AT (1) | ATE92478T1 (enExample) |
| AU (1) | AU612755B2 (enExample) |
| CA (1) | CA1338013C (enExample) |
| DE (1) | DE68907921T2 (enExample) |
| DK (1) | DK171468B1 (enExample) |
| ES (1) | ES2058342T3 (enExample) |
| FI (1) | FI97381C (enExample) |
| HU (3) | HU205085B (enExample) |
| IE (1) | IE65322B1 (enExample) |
| IL (1) | IL88901A (enExample) |
| MY (1) | MY104140A (enExample) |
| NO (1) | NO174508B (enExample) |
| NZ (1) | NZ227541A (enExample) |
| PT (1) | PT89400B (enExample) |
Families Citing this family (155)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5210079A (en) * | 1988-01-07 | 1993-05-11 | E. I. Du Pont De Nemours And Company | Treatment of chronic renal failure with imidazole angiotensin-II receptor antagonists |
| US5315013A (en) * | 1988-01-07 | 1994-05-24 | E. I. Du Pont De Nemours And Company | Substituted pyrazole angiotensin II antagonists |
| GB8911854D0 (en) * | 1989-05-23 | 1989-07-12 | Ici Plc | Heterocyclic compounds |
| CA2020073A1 (en) * | 1989-07-03 | 1991-01-04 | Eric E. Allen | Substituted quinazolinones as angiotensin ii antagonists |
| EP0409332A3 (en) * | 1989-07-19 | 1991-08-07 | Merck & Co. Inc. | Substituted triazoles as angiotensin ii antagonists |
| US5411980A (en) * | 1989-07-28 | 1995-05-02 | Merck & Co., Inc. | Substituted triazolinones, triazolinethiones, and triazolinimines as angiotensin II antagonists |
| DE69024556T2 (de) * | 1989-07-28 | 1996-10-17 | Merck & Co Inc | Substituierte Triazolinone, Triazolinthione und Triazolinimine als Angiotensin II-Antagonisten |
| EP0411507B1 (en) * | 1989-08-02 | 1994-10-26 | Takeda Chemical Industries, Ltd. | Pyrazole derivatives, their production and use |
| AU623546B2 (en) * | 1989-08-11 | 1992-05-14 | Imperial Chemical Industries Plc | Nitrogen compounds |
| IL95975A (en) * | 1989-10-24 | 1997-06-10 | Takeda Chemical Industries Ltd | N-benzyl- 2-alkylbenzimidazole derivatives, their production and pharmaceutical compositions containing them |
| US5250554A (en) * | 1989-10-24 | 1993-10-05 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives useful as angiotensin II inhibitors |
| IE903911A1 (en) * | 1989-11-20 | 1991-05-22 | Ici Plc | Diazine derivatives |
| US5073566A (en) * | 1989-11-30 | 1991-12-17 | Eli Lilly And Company | Angiotensin ii antagonist 1,3-imidazoles and use thereas |
| EP0435827A3 (en) * | 1989-12-28 | 1991-11-13 | Ciba-Geigy Ag | Diaza compounds |
| ZA9010460B (en) * | 1989-12-29 | 1992-11-25 | Univ Technologies Int | Methods for modelling tertiary structures of biologically active ligands including agonists and antagonists thereto and novel synthetic antagonists based on angiotensin |
| WO1991010140A2 (en) * | 1989-12-29 | 1991-07-11 | University Technologies International Inc. | Methods for modelling tertiary structures of biologically active ligands including agonists and antagonists thereto and novel synthetic antagonists based on angiotensin |
| US5449682A (en) * | 1990-02-13 | 1995-09-12 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted benzyl element |
| WO1991011909A1 (en) * | 1990-02-13 | 1991-08-22 | Merck & Co., Inc. | Triazole angiotensin ii antagonists incorporating a substituted benzyl element |
| EP0442473B1 (en) * | 1990-02-15 | 1998-08-19 | Takeda Chemical Industries, Ltd. | Pyrimidinedione derivatives, their production and use |
| DE122010000024I1 (de) * | 1990-02-19 | 2010-07-08 | Novartis Ag | Acylverbindungen |
| CA2036618C (en) * | 1990-02-22 | 2002-10-29 | Akira Morimoto | Fused thiophene derivatives, their production and use |
| US5284661A (en) * | 1990-02-22 | 1994-02-08 | Takeda Chemical Industries, Ltd. | Fused thiophene derivatives, their production and use |
| CA2037630C (en) * | 1990-03-07 | 2001-07-03 | Akira Morimoto | Nitrogen-containing heterocylic compounds, their production and use |
| GB9005354D0 (en) * | 1990-03-09 | 1990-05-02 | Glaxo Group Ltd | Chemical compounds |
| FR2659655B1 (fr) * | 1990-03-19 | 1992-07-24 | Union Pharma Scient Appl | Nouveaux derives d'oxypyrazole antagonistes des recepteurs a l'angiotensine ii ; leurs procedes de preparation, compositions pharmaceutiques les contenant. |
| US5155126A (en) * | 1990-03-20 | 1992-10-13 | E. I. Du Pont De Nemours And Company | Treatment of central nervous system disorders with pyrazole, pyrrole and triazole angiotensin-II receptor antagonists |
| FR2659967B1 (fr) * | 1990-03-20 | 1992-07-24 | Sanofi Sa | Derives d'imidazolinone n-substitues, leur preparation, les compositions pharmaceutiques en contenant. |
| IE910913A1 (en) * | 1990-03-20 | 1991-09-25 | Sanofi Sa | N-substituted heterocyclic derivates, their preparation¹and pharmaceutical compositions containing them |
| US5270317A (en) * | 1990-03-20 | 1993-12-14 | Elf Sanofi | N-substituted heterocyclic derivatives, their preparation and the pharmaceutical compositions in which they are present |
| US5166206A (en) * | 1990-03-30 | 1992-11-24 | Merck & Co., Inc. | Substituted pyrimidines, pyrimidinones and pyridopyrimidines |
| DE4010797A1 (de) * | 1990-04-04 | 1991-10-10 | Hoechst Ag | Substituierte azole, verfahren zu deren herstellung, diese enthaltende mittel und deren verwendung |
| US5198439A (en) * | 1990-04-19 | 1993-03-30 | Imperial Chemical Industries Plc | Angiotension II antagonizing pyridine derivatives |
| US5196444A (en) * | 1990-04-27 | 1993-03-23 | Takeda Chemical Industries, Ltd. | 1-(cyclohexyloxycarbonyloxy)ethyl 2-ethoxy-1-[[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl]benzimidazole-7-carboxylate and compositions and methods of pharmaceutical use thereof |
| GB2244054B (en) * | 1990-04-19 | 1994-04-06 | Ici Plc | Pyridine derivatives |
| ZA912983B (en) | 1990-04-27 | 1992-01-29 | Takeda Chemical Industries Ltd | Benzimidazole derivatives,their production and use |
| US5703110A (en) * | 1990-04-27 | 1997-12-30 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives, their production and use |
| US6004989A (en) * | 1990-04-27 | 1999-12-21 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives, their production and use |
| US5098920A (en) * | 1990-05-04 | 1992-03-24 | G. D. Searle & Co. | 1h-substituted-1,2,4-triazole compounds and methods of use thereof for treatment of cardiovascular disorders |
| US5189051A (en) * | 1990-05-10 | 1993-02-23 | E. I. Du Pont De Nemours And Company | Treatment of glaucoma and ocular hypertension with pyrrole angiotensin-II receptor antagonists |
| AU653724B2 (en) | 1990-05-11 | 1994-10-13 | Pfizer Inc. | Synergistic therapeutic compositions and methods |
| US5821232A (en) * | 1990-05-11 | 1998-10-13 | Pfizer Inc. | Synergistic therapeutic compositions and methods |
| AU7903091A (en) * | 1990-05-25 | 1991-12-31 | G.D. Searle & Co. | N-substituted-1,2,4-triazolone compounds for treatment of cardiovascular disorders |
| EP0487745A4 (en) * | 1990-06-19 | 1993-01-20 | Meiji Seika Kabushiki Kaisha | Pyridine derivative with angiotensin ii antagonism |
| JPH05509086A (ja) * | 1990-06-22 | 1993-12-16 | イー・アイ・デュポン・ドゥ・ヌムール・アンド・カンパニー | イミダゾールアンジオテンシン―2受容体拮抗薬による慢性腎不全の治療 |
| US5137902A (en) * | 1990-07-13 | 1992-08-11 | E. I. Du Pont De Nemours And Company | 4-alkylimidazole derivatives and anti-hypertensive use thereof |
| CA2044806A1 (en) * | 1990-07-18 | 1992-01-19 | Roland Jaunin | Purine derivatives |
| DE4023215A1 (de) * | 1990-07-21 | 1992-01-23 | Hoechst Ag | Substituierte azole, verfahren zu deren herstellung, sie enthaltende mittel und deren verwendung |
| AU8534291A (en) * | 1990-08-10 | 1992-03-02 | G.D. Searle & Co. | Renal-selective angiotensin ii antagonists for treatment of hypertension |
| US5217985A (en) * | 1990-08-28 | 1993-06-08 | G. D. Searle & Co. | Renal-selective biphenylalkyl 1h-substituted-1,2,4-triazole angiotensin ii antagonists for treatment of hypertension |
| IL99372A0 (en) * | 1990-09-10 | 1992-08-18 | Ciba Geigy Ag | Azacyclic compounds |
| US5250548A (en) * | 1990-09-10 | 1993-10-05 | Abbott Laboratories | Angiotensin II receptor antagonists |
| IL99246A0 (en) * | 1990-09-10 | 1992-07-15 | Abbott Lab | Angiotensin ii receptor antagonists and pharmaceutical compositions containing them |
| US5140036A (en) * | 1990-09-19 | 1992-08-18 | G. D. Searle & Co. | 1,3,5-trisubstituted-1,2,4-triazole compounds for treatment of circulatory disorders |
| US5229406A (en) * | 1990-09-19 | 1993-07-20 | G. D. Searle & Co. | 1,3,5-trisubstituted-1,2,4-triazole compounds for treatment of circulatory disorders |
| WO1992007852A1 (en) * | 1990-10-25 | 1992-05-14 | G.D. Searle & Co. | Biphenylalkyl xanthine compounds for treatment of cardiovascular disorders |
| AU636066B2 (en) * | 1990-10-30 | 1993-04-08 | Takeda Chemical Industries Ltd. | Thienoimidazole derivatives, their production and use |
| US5238952A (en) * | 1990-10-31 | 1993-08-24 | G. D. Searle & Co. | N-substituted imidazol-2-one compounds for treatment of circulatory disorders |
| US5087634A (en) * | 1990-10-31 | 1992-02-11 | G. D. Searle & Co. | N-substituted imidazol-2-one compounds for treatment of circulatory disorders |
| DE4036706A1 (de) * | 1990-11-17 | 1992-05-21 | Hoechst Ag | Verfahren zur behandlung der cardialen sowie der vasculaeren hypertrophie und hyperplasie |
| GB9025123D0 (en) * | 1990-11-19 | 1991-01-02 | Ici Plc | Nitrogen compounds |
| GB9026006D0 (en) * | 1990-11-29 | 1991-01-16 | Glaxo Group Ltd | Chemical compounds |
| GB9027197D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027211D0 (en) | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027201D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027210D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| US6028091A (en) * | 1990-12-14 | 2000-02-22 | Smithkline Beecham Plc | Medicament |
| GB9027209D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027198D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027200D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| GB9027208D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| US6025380A (en) * | 1990-12-14 | 2000-02-15 | Smithkline Beecham Plc | Medicament |
| US6034114A (en) * | 1990-12-14 | 2000-03-07 | Smithkline Beecham Plc | Medicament |
| GB9027212D0 (en) * | 1990-12-14 | 1991-02-06 | Smithkline Beecham Plc | Medicaments |
| US5175180A (en) * | 1990-12-20 | 1992-12-29 | G. D. Searle & Co. | N-substituted n-(alpha-triazolyl-toluyl)pyrrole compounds and use for treatment of circulatory disorders |
| CA2058198A1 (en) * | 1991-01-04 | 1992-07-05 | Adalbert Wagner | Azole derivatives, process for their preparation, and their use |
| TW197428B (enExample) | 1991-01-04 | 1993-01-01 | Hoechst Ag | |
| US5153347A (en) * | 1991-01-31 | 1992-10-06 | E. R. Squibb & Sons, Inc. | Phosphonate, phosphinate derivatives useful as antihypertensive agents |
| AT395853B (de) * | 1991-01-31 | 1993-03-25 | Chem Pharm Forsch Gmbh | Neue imidazolderivate, verfahren zu ihrer herstellung und ihre verwendung |
| GB9102803D0 (en) * | 1991-02-11 | 1991-03-27 | Ici Plc | Pyridine compounds |
| IE920175A1 (en) * | 1991-02-11 | 1992-08-12 | Zeneca Ltd | Nitrogen heterocycles |
| US5472967A (en) * | 1991-02-20 | 1995-12-05 | Synthelabo | 4-pyrimidinone derivatives their preparation and their application in therapy |
| CA2061607C (en) * | 1991-02-21 | 1999-01-19 | Hiroaki Yanagisawa | 1-biphenylimidazole derivatives, their preparation and their therapeutic use |
| US5616599A (en) * | 1991-02-21 | 1997-04-01 | Sankyo Company, Limited | Angiotensin II antagosist 1-biphenylmethylimidazole compounds and their therapeutic use |
| CA2061159A1 (en) * | 1991-02-26 | 1992-08-27 | Michael A. Poss | Imidazole and benzimidazole derivatives |
| US6008368A (en) * | 1993-04-28 | 1999-12-28 | G. D. Searle & Co. | Pharmaceutical compositions for treatment of circulatory disorders using N-substituted (α-imidazolyl-toluyl) pyrrole aniotensin II antagonists |
| US5187271A (en) * | 1991-02-28 | 1993-02-16 | G. D. Searle & Co. | N-substituted (α-imidazolyl-toluyl) pyrrole compounds for treatment of circulatory disorders |
| US5191086A (en) * | 1991-03-19 | 1993-03-02 | E.R. Squibb & Sons, Inc. | Imidazole and benzimidazole derivatives |
| US5236928A (en) * | 1991-03-19 | 1993-08-17 | Merck & Co., Inc. | Imidazole derivatives bearing acidic functional groups at the 5-position, their compositions and methods of use as angiotensin II antagonists |
| US5196537A (en) * | 1991-03-21 | 1993-03-23 | G. D. Searle & Co. | 5-apylheteroarylalkyl-1,3,5-trisubstituted-1,2,4-triazole compounds for treatment of circulatory disorders |
| US5187179A (en) * | 1991-03-22 | 1993-02-16 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted imidazo [1,2-b][1,2,4]triazole |
| US5128327A (en) * | 1991-03-25 | 1992-07-07 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a nitrogen containing six membered ring heterocycle |
| US5177074A (en) * | 1991-03-26 | 1993-01-05 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted thiophene or furan |
| US5164403A (en) * | 1991-04-05 | 1992-11-17 | G. D. Searle & Co. | N-arylheteroarylalkyl imidazol-2-one compounds for treatment of circulatory disorders |
| US5157040A (en) * | 1991-04-05 | 1992-10-20 | Merck & Co., Inc. | Substituted quinolines as angiotensin ii antagonists |
| US5155117A (en) * | 1991-04-12 | 1992-10-13 | G. D. Searle & Co. | 1-arylheteroarylalkyl substituted-1h-1,2,4-triazole compounds for treatment of circulatory disorders |
| TW274551B (enExample) * | 1991-04-16 | 1996-04-21 | Takeda Pharm Industry Co Ltd | |
| US5190942A (en) * | 1991-04-22 | 1993-03-02 | E. R. Squibb & Sons, Inc. | Benzoxazole and related heterocyclic substituted imidazole and benzimidazole derivatives |
| US5252574A (en) * | 1991-04-26 | 1993-10-12 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted thiophene or furan |
| WO1992020662A1 (en) * | 1991-05-10 | 1992-11-26 | Merck & Co., Inc. | Acidic aralkyl triazole derivatives active as angiotensin ii antagonists |
| US5198438A (en) * | 1991-05-07 | 1993-03-30 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted thiophene or furan |
| US5436259A (en) * | 1991-05-10 | 1995-07-25 | Merck & Co., Inc. | Substituted 1,2,4-triazolin-3-one compounds bearing acidic functional groups as balanced angiotensin II antagonists |
| NZ242724A (en) * | 1991-05-15 | 1994-09-27 | Du Pont | Synergistic composition comprising an angiotensin-ii receptor antagonist and a calcium channel blocker |
| US5175164A (en) * | 1991-06-05 | 1992-12-29 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted indole or dihydroindole |
| IL102183A (en) * | 1991-06-27 | 1999-11-30 | Takeda Chemical Industries Ltd | Biphenyl substituted heterocyclic compounds their production and pharmaceutical compositions comprising them |
| US5177097A (en) * | 1991-07-24 | 1993-01-05 | E. R. Squibb & Sons, Inc. | Acyl amidine and acyl, guanidine substituted biphenyl derivatives |
| US5246944A (en) * | 1991-08-13 | 1993-09-21 | Merck & Co., Inc. | Quinoline angiotensin ii antagonists incorporating a substituted benzyl element |
| AP254A (en) * | 1991-09-05 | 1993-05-05 | Glaxo Group Ltd | C-Linked pyrazole derivatives. |
| US5256654A (en) * | 1991-10-24 | 1993-10-26 | American Home Products Corporation | Substituted pyrrolopyrimidines, azepinopyrimidines and pyridopyrimidines useful as angiotensin II antagonists |
| US5149699A (en) * | 1991-10-24 | 1992-09-22 | American Home Products Corporation | Substituted pyridopyrimidines useful as antgiotensin II antagonists |
| US5484937A (en) * | 1992-08-04 | 1996-01-16 | G.D. Searle & Co. | N-substituted N-(α-triazolyl-toluyl)pyrrole compounds for treatment of circulatory disorders |
| US5389661A (en) * | 1991-12-05 | 1995-02-14 | Warner-Lambert Company | Imidazole and 1,2,4-triazole derivatives with angiotensin II antagonist properties |
| US5322950A (en) * | 1991-12-05 | 1994-06-21 | Warner-Lambert Company | Imidazole with angiotensin II antagonist properties |
| US5350752A (en) * | 1991-12-16 | 1994-09-27 | E. R. Squibb & Sons, Inc. | Dihydropyrimidine derivatives |
| US5212177A (en) * | 1991-12-16 | 1993-05-18 | E. R. Squibb & Sons, Inc. | Indole and benzimidazole-substituted dihydropyrimidine derivatives |
| US5234923A (en) * | 1991-12-16 | 1993-08-10 | E. R. Squibb & Sons, Inc. | Substitute indole and benzimidazole derivatives |
| GB2263635A (en) * | 1992-01-28 | 1993-08-04 | Merck & Co Inc | Substitiuted triazoles as neurotensin antagonists |
| US5240953A (en) * | 1992-01-30 | 1993-08-31 | Ortho Pharmaceutical Corporation | Substituted triazoles as angiotensin ii inhibitors |
| WO1993017681A1 (en) * | 1992-03-02 | 1993-09-16 | Abbott Laboratories | Angiotensin ii receptor antagonists |
| TW215434B (enExample) * | 1992-03-07 | 1993-11-01 | Hoechst Ag | |
| US5208234A (en) * | 1992-03-10 | 1993-05-04 | E. R. Squibb & Sons, Inc. | Substituted imidazole phosphonic and phosphinic acid derivatives |
| US5616591A (en) * | 1992-03-27 | 1997-04-01 | E.R. Squibb & Sons, Inc. | Indole- and benzimidazole-substituted quinoline derivatives |
| US5294722A (en) * | 1992-04-16 | 1994-03-15 | E. R. Squibb & Sons, Inc. | Process for the preparation of imidazoles useful in angiotensin II antagonism |
| US5212195A (en) * | 1992-05-13 | 1993-05-18 | Syntex (U.S.A.) Inc. | Substituted indole antagonists derivatives which are angiotensin II |
| US5401851A (en) * | 1992-06-03 | 1995-03-28 | Eli Lilly And Company | Angiotensin II antagonists |
| CZ283315B6 (cs) * | 1992-12-17 | 1998-02-18 | Sankyo Company Limited | Bifenylové deriváty, způsob výroby a farmaceutické prostředky k léčení hypertense a srdečních onemocnění, které tyto deriváty obsahují |
| US5451597A (en) * | 1993-05-27 | 1995-09-19 | G.D. Searle & Co. | Treatment of circulatory disorders using n-substituted (α-imidazolyl-toluyl) pyrrole angiotensin II antagonists |
| US5571813A (en) * | 1993-06-10 | 1996-11-05 | Beiersdorf-Lilly Gmbh | Fused pyrimidine compounds and their use as pharmaceuticals |
| EP0628559B1 (en) * | 1993-06-10 | 2002-04-03 | Beiersdorf-Lilly GmbH | Pyrimidine compounds and their use as pharmaceuticals |
| US5412102A (en) * | 1994-05-27 | 1995-05-02 | Syntex (U.S.A.) Inc. | Processes for preparing 1-butyl-2-[2'-(2H-tetrazol-5-yl) biphenyl-4-ylmethyl]-1H-indole-3-carboxylic acid |
| US5527920A (en) * | 1994-11-18 | 1996-06-18 | Singh; Inder P. | Economical manufacturing process for 1,2,3-triazoles |
| FR2742148B1 (fr) * | 1995-12-08 | 1999-10-22 | Sanofi Sa | Nouveaux derives du pyrazole-3-carboxamide, procede pour leur preparation et compositions pharmaceutiques les contenant |
| AU751139B2 (en) | 1997-10-13 | 2002-08-08 | Astellas Pharma Inc. | Amide derivative |
| IL137979A0 (en) | 1998-03-04 | 2001-10-31 | Takeda Chemical Industries Ltd | Production, release preparation for aii antagonist-sustained and use thereof |
| AR023171A1 (es) * | 1999-03-26 | 2002-09-04 | Cocensys Inc | Pirazoles, imidazoles, oxazoles, tiazoles, y pirroles sustituidos por arilo, y el uso de los mismos. |
| SE9903028D0 (sv) | 1999-08-27 | 1999-08-27 | Astra Ab | New use |
| BR0108819A (pt) | 2000-03-24 | 2002-12-10 | Euro Celtique Sa | Pirazóis triazóis e tetrazóis substituìdos de arila, e o uso dos mesmos |
| US7812044B2 (en) | 2001-11-13 | 2010-10-12 | Takeda Pharmaceutical Company Limited | Anticancer agents |
| DE10335027A1 (de) | 2003-07-31 | 2005-02-17 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Verwendung von Angiotensin II Rezeptor Antagonisten |
| DE10306179A1 (de) | 2003-02-13 | 2004-08-26 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Verwendung von Dipyridamol in Kombination mit Acetylsalicylsäure und einem Angiotensin II-Antagonisten zur Schlaganfall-Prophylaxe |
| ITTO20040264A1 (it) * | 2004-04-28 | 2004-07-28 | Rotta Res Lab Spa | Nuovi derivati pirrolici ad attivita' angiotensina-ii antagonista |
| ES2555511T3 (es) | 2006-08-03 | 2016-01-04 | Rottapharm Biotech S.R.L. | Inhibidores de COX-2 altamente selectivos y eficaces por vía oral de 1,5-diaril-2-alquil-pirroles 3-sustituidos |
| EP1908469A1 (en) | 2006-10-06 | 2008-04-09 | Boehringer Ingelheim Vetmedica Gmbh | Angiotensin II receptor antagonist for the treatment of systemic diseases in cats |
| TWI448284B (zh) | 2007-04-24 | 2014-08-11 | Theravance Inc | 雙效抗高血壓劑 |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| AU2008261102B2 (en) | 2007-06-04 | 2013-11-28 | Bausch Health Ireland Limited | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| EP3239170B1 (en) | 2008-06-04 | 2019-03-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| WO2010009319A2 (en) | 2008-07-16 | 2010-01-21 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| EP2970384A1 (en) | 2013-03-15 | 2016-01-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| WO2014151200A2 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| HRP20240805T1 (hr) | 2013-06-05 | 2024-09-27 | Bausch Health Ireland Limited | Ultra-pročišćeni agonisti guanilat-ciklaze c, postupak njihove pripreme i uporabe |
| KR20250007040A (ko) | 2017-07-07 | 2025-01-13 | 베링거잉겔하임베트메디카게엠베하 | 고양이에서 전신 질환의 예방 또는 치료를 위한 안지오텐신 ii 수용체 길항제 |
| CN114163391B (zh) * | 2021-12-14 | 2024-02-02 | 迪嘉药业集团股份有限公司 | 一种坎地沙坦中间体及坎地沙坦的制备方法 |
| CN121175053A (zh) | 2023-05-24 | 2025-12-19 | 勃林格殷格翰动物保健有限公司 | 包含一或多种sglt-2抑制剂及替米沙坦的非人类哺乳动物中肾脏疾病和/或高血压的组合治疗和/或预防 |
| TW202541793A (zh) | 2023-12-15 | 2025-11-01 | 德商百靈佳殷格翰維美迪加股份有限公司 | 用於預防貓之全身性疾病之血管緊張素ii受體拮抗劑 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2470084A (en) * | 1945-09-25 | 1949-05-17 | Bilhuber Inc E | Substituted alpha-halogen alkyl tetrazoles and process for obtaining the same |
| US3065241A (en) * | 1961-01-18 | 1962-11-20 | Astra Ab | Process for preparing certain tetrazoles |
| US3551571A (en) * | 1967-05-19 | 1970-12-29 | Endo Lab | Methods for reducing pain,reducing fever and alleviating inflammatory syndromes with heteroaromatic pyrrol-3-yl ketones |
| US4209515A (en) * | 1974-06-14 | 1980-06-24 | Ciba-Geigy Corporation | Triazole derivatives |
| JPS54148788A (en) * | 1978-05-15 | 1979-11-21 | Takeda Chem Ind Ltd | 1,2-disubstituted-4-halogenoimidazole-5-acetic acid derivative and its preparation |
| GB2041363B (en) * | 1979-01-19 | 1982-10-06 | Pfizer Ltd | N-benzyl-imidazoles |
| JPS5671074A (en) * | 1979-11-12 | 1981-06-13 | Takeda Chem Ind Ltd | 1,2-disubstituted-4-halogenoimidazole-5-acetic acid derivative |
| JPS5671073A (en) * | 1979-11-12 | 1981-06-13 | Takeda Chem Ind Ltd | Imidazole derivative |
| JPS579771A (en) * | 1980-06-21 | 1982-01-19 | Otsuka Pharmaceut Co Ltd | Tetrazole derivative |
| US4338453A (en) * | 1980-09-17 | 1982-07-06 | The Upjohn Company | Aminoalkyl-1,2,4-triazoles |
| SU1018941A1 (ru) * | 1982-02-03 | 1983-05-23 | Институт Органической Химии Ан Армсср | Способ получени 3/5/-бензил-5/3/-метилпиразола |
| JPS58157768A (ja) * | 1982-03-16 | 1983-09-19 | Takeda Chem Ind Ltd | 4−クロロ−2−フエニルイミダゾ−ル−5−酢酸誘導体 |
| US4577020A (en) * | 1983-01-25 | 1986-03-18 | The Upjohn Company | Aminoalkyl and aminoalkenyl triazoles as anti-psychotic agents |
| US4590201A (en) * | 1984-02-02 | 1986-05-20 | Merck & Co., Inc. | 5-amino or substituted amino 1,2,3-triazoles |
| US4568685A (en) * | 1984-02-29 | 1986-02-04 | American Cyanamid Company | N-[(1H-1,2,4-Triazol-1-yl)alkyl]-arylamides |
| US4755526A (en) * | 1984-06-18 | 1988-07-05 | Eli Lilly And Company | Method of inhibiting aromatase |
| CA1334092C (en) * | 1986-07-11 | 1995-01-24 | David John Carini | Angiotensin ii receptor blocking imidazoles |
| CA2008616C (en) * | 1989-01-31 | 2000-07-18 | Roger A. Parker | Aryl- or heteroaryl-1-alkyl-pyrrole-2-carboxylic acid compounds useful in treating interleukin-1 mediated conditions |
-
1988
- 1988-12-06 US US07/279,193 patent/US5015651A/en not_active Expired - Lifetime
-
1989
- 1989-01-05 NZ NZ227541A patent/NZ227541A/en unknown
- 1989-01-05 ES ES89100142T patent/ES2058342T3/es not_active Expired - Lifetime
- 1989-01-05 CA CA000587617A patent/CA1338013C/en not_active Expired - Fee Related
- 1989-01-05 EP EP89100142A patent/EP0323841B1/en not_active Expired - Lifetime
- 1989-01-05 AT AT89100142T patent/ATE92478T1/de not_active IP Right Cessation
- 1989-01-05 DE DE89100142T patent/DE68907921T2/de not_active Expired - Fee Related
- 1989-01-06 AU AU27770/89A patent/AU612755B2/en not_active Ceased
- 1989-01-06 MY MYPI89000016A patent/MY104140A/en unknown
- 1989-01-06 HU HU8948A patent/HU205085B/hu not_active IP Right Cessation
- 1989-01-06 DK DK005389A patent/DK171468B1/da not_active IP Right Cessation
- 1989-01-06 FI FI890071A patent/FI97381C/fi not_active IP Right Cessation
- 1989-01-06 JP JP64000588A patent/JPH0725733B2/ja not_active Expired - Fee Related
- 1989-01-06 HU HU906494A patent/HU906494D0/hu unknown
- 1989-01-06 PT PT89400A patent/PT89400B/pt active IP Right Grant
- 1989-01-06 HU HU9364A patent/HU906493D0/hu unknown
- 1989-01-06 IL IL88901A patent/IL88901A/xx not_active IP Right Cessation
- 1989-01-06 IE IE2689A patent/IE65322B1/en not_active IP Right Cessation
- 1989-01-06 NO NO890074A patent/NO174508B/no not_active IP Right Cessation
- 1989-01-07 KR KR1019890000095A patent/KR910002823B1/ko not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU205085B (en) | Process for producing substituted pyrrole and pyrazole derivatives and pharmaceutical compositions comprising same | |
| US5081127A (en) | Substituted 1,2,3-triazole angiotensin II antagonists | |
| US4585771A (en) | Antiinflammatory imidazole derivatives | |
| US5563165A (en) | Substituted pyrazolyl benzenesulfonamides for the treatment of inflammation | |
| AU2007305235C1 (en) | Pyrazole derivatives as modulators of the 5-HT2a serotonin receptor useful for the treatment of disorders related thereto | |
| JP2862374B2 (ja) | Crfアンタゴニスト活性を有するピラゾール及びピラゾロピリミジン | |
| US5753688A (en) | Substituted pyrazolyl benzenesulfonamides for the treatment of gastrointestinal conditions | |
| FI79103C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1,4-dihydropyridinderivat. | |
| DE69212346T2 (de) | Diazotierte heterocyclische Derivate aus Stickstoff, substituiert durch eine Biphenylgruppe, ihre Herstellung, und diese enthaltende pharmazeutische Zubereitungen | |
| HU217958B (hu) | Helyettesített imidazolszármazékok, ezeket tartalmazó gyógyszerkészítmények és eljárás előállításukra | |
| US5332820A (en) | Dibenzobicyclo(2.2.2) octane angiotensin II antagonists | |
| RO109735B1 (ro) | Derivati de imidazol, substituiti cu indol si benzimidazol | |
| IE910766A1 (en) | Novel pyrazole derivatives which are angiotensin ii¹receptor antagonists; their methods of preparation¹and pharmaceutical compositions in which they are present | |
| WO1997013755A1 (en) | 1,3,5-trisubstituted pyrazoles for treament of inflammation | |
| US5189048A (en) | Substituted 1,2,3 triazole angiotensin II antagonists | |
| US5093346A (en) | Substituted 1,2,4-triazole angiotensin II antagonists | |
| US5389661A (en) | Imidazole and 1,2,4-triazole derivatives with angiotensin II antagonist properties | |
| WO1992006081A1 (en) | Anilide derivatives with angiotensin ii antagonist properties | |
| JPH09504804A (ja) | アンジオテンシンii拮抗薬としての新規なピラゾール誘導体 | |
| US5043349A (en) | Substituted pyrrole angiotensin II antagonists | |
| US5315013A (en) | Substituted pyrazole angiotensin II antagonists | |
| US3726978A (en) | Tetrahydropyridazines and pyridazinones as anti-inflammatory agents | |
| FR2479827A1 (enExample) | ||
| SU1709907A3 (ru) | Способ получени азолов | |
| JP2690814B2 (ja) | ピラゾロトリアゾール誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HPC4 | Succession in title of patentee |
Owner name: BRISTOL-MYERS SQUIBB PHARMA COMPANY, US |
|
| HMM4 | Cancellation of final prot. due to non-payment of fee |