DE925472C - Verfahren zur Herstellung von Cumarinderivaten - Google Patents
Verfahren zur Herstellung von CumarinderivatenInfo
- Publication number
- DE925472C DE925472C DEH16370A DEH0016370A DE925472C DE 925472 C DE925472 C DE 925472C DE H16370 A DEH16370 A DE H16370A DE H0016370 A DEH0016370 A DE H0016370A DE 925472 C DE925472 C DE 925472C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- coumarin
- weight
- oxy
- toluene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000001893 coumarin derivatives Chemical class 0.000 title 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- -1 alkyl radical Chemical class 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 7
- 150000002902 organometallic compounds Chemical class 0.000 claims description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000004775 coumarins Chemical class 0.000 claims description 3
- 230000018044 dehydration Effects 0.000 claims description 3
- 238000006297 dehydration reaction Methods 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 238000010533 azeotropic distillation Methods 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 239000007859 condensation product Substances 0.000 claims 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- 230000003197 catalytic effect Effects 0.000 claims 1
- 239000000047 product Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- 239000011777 magnesium Substances 0.000 description 8
- 229910052749 magnesium Inorganic materials 0.000 description 8
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000010626 work up procedure Methods 0.000 description 5
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- DLKQHBOKULLWDQ-UHFFFAOYSA-N 1-bromonaphthalene Chemical compound C1=CC=C2C(Br)=CC=CC2=C1 DLKQHBOKULLWDQ-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- GWQSENYKCGJTRI-UHFFFAOYSA-N 1-chloro-4-iodobenzene Chemical compound ClC1=CC=C(I)C=C1 GWQSENYKCGJTRI-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- PZIIGUMPOSVMSD-UHFFFAOYSA-M [Br-].C1=CC=C2C([Mg+])=CC=CC2=C1 Chemical compound [Br-].C1=CC=C2C([Mg+])=CC=CC2=C1 PZIIGUMPOSVMSD-UHFFFAOYSA-M 0.000 description 1
- KZZRJVVATSFEQE-UHFFFAOYSA-M [I-].[Mg+]C1=CC=C(Cl)C=C1 Chemical compound [I-].[Mg+]C1=CC=C(Cl)C=C1 KZZRJVVATSFEQE-UHFFFAOYSA-M 0.000 description 1
- IZFMMUBPBGYYCI-UHFFFAOYSA-N [Mg]C1=CC=C(Cl)C=C1 Chemical compound [Mg]C1=CC=C(Cl)C=C1 IZFMMUBPBGYYCI-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229960000956 coumarin Drugs 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- LWLPYZUDBNFNAH-UHFFFAOYSA-M magnesium;butane;bromide Chemical group [Mg+2].[Br-].CCC[CH2-] LWLPYZUDBNFNAH-UHFFFAOYSA-M 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- UGVPKMAWLOMPRS-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].CC[CH2-] UGVPKMAWLOMPRS-UHFFFAOYSA-M 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/42—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4
- C07D311/44—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3
- C07D311/46—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3 unsubstituted in the carbocyclic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH743271X | 1952-05-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE925472C true DE925472C (de) | 1955-03-21 |
Family
ID=4533315
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEH16370A Expired DE925472C (de) | 1952-05-16 | 1953-05-13 | Verfahren zur Herstellung von Cumarinderivaten |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2723276A (Direct) |
| BE (1) | BE519956A (Direct) |
| DE (1) | DE925472C (Direct) |
| FR (1) | FR1092278A (Direct) |
| GB (1) | GB743271A (Direct) |
| NL (2) | NL82169C (Direct) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1017620B (de) * | 1956-07-20 | 1957-10-17 | Bayer Ag | Verfahren zur Herstellung von Derivaten des 4-Oxycumarins |
| DE1047788B (de) * | 1956-01-20 | 1958-12-31 | Geigy Ag J R | Verfahren zur Herstellung von Derivaten des 4-Oxycumarins |
| DE1263778B (de) * | 1963-06-05 | 1968-03-21 | Spitzner W | Verfahren zur Herstellung von 3-(alpha-AEthinyl-benzyl)-4-oxycumarin |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3022317A (en) * | 1956-01-20 | 1962-02-20 | Geigy Chem Corp | 3-benzyl-4-hydroxycoumarin and a process for the preparation of derivatives of 3-benzyl-4-hydroxycoumarin |
| US2872457A (en) * | 1956-04-19 | 1959-02-03 | Wisconsin Alumni Res Found | Process for the preparation of 4-hydroxycoumarin derivatives |
| BE556754A (Direct) * | 1956-07-20 | |||
| US2932652A (en) * | 1957-02-11 | 1960-04-12 | Nicholas M Molnar | 3-(1'-(alpha-naphthyl) 3'-oxo-butyl) 4-hydroxy coumarin and salts thereof |
| US3153035A (en) * | 1962-03-22 | 1964-10-13 | Sterling Drug Inc | 3-acylamino-7-glycosyloxycoumarins and their preparation |
| IL108459A0 (en) * | 1993-02-05 | 1994-04-12 | Opjohn Company | 4-Hydroxy-benzopyran-2-ones and 4-hydroxy-cycloalkyl [B] pyran-2-ones useful for treating infections due to hiv and other retroviruses |
| IL129871A (en) * | 1994-05-06 | 2003-11-23 | Pharmacia & Upjohn Inc | Process for preparing 4-phenyl-substituted octanoyl-oxazolidin-2-one intermediates that are useful for preparing pyran-2-ones useful for treating retroviral infections |
| CN104193718B (zh) * | 2014-08-14 | 2016-03-30 | 安徽工业大学 | 一种催化制备双香豆素类衍生物的方法 |
| CN112877721A (zh) * | 2021-01-12 | 2021-06-01 | 河南师范大学 | 电化学氧化脱氢偶联合成异香豆素类化合物的方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB578589A (en) * | 1942-08-29 | 1946-07-04 | Wisconsin Alumni Res Found | Improvements in or relating to synthesis of 4-hydroxycoumarins |
| CH294903A (de) * | 1951-06-05 | 1953-11-30 | Ag J R Geigy | Verfahren zur Herstellung eines Derivates des 4-Oxy-cumarins. |
-
0
- NL NL83407D patent/NL83407C/xx active
- BE BE519956D patent/BE519956A/xx unknown
- NL NL82169D patent/NL82169C/xx active
-
1953
- 1953-05-13 DE DEH16370A patent/DE925472C/de not_active Expired
- 1953-05-15 GB GB13733/53A patent/GB743271A/en not_active Expired
- 1953-05-15 FR FR1092278D patent/FR1092278A/fr not_active Expired
- 1953-05-15 US US355394A patent/US2723276A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1047788B (de) * | 1956-01-20 | 1958-12-31 | Geigy Ag J R | Verfahren zur Herstellung von Derivaten des 4-Oxycumarins |
| DE1017620B (de) * | 1956-07-20 | 1957-10-17 | Bayer Ag | Verfahren zur Herstellung von Derivaten des 4-Oxycumarins |
| DE1263778B (de) * | 1963-06-05 | 1968-03-21 | Spitzner W | Verfahren zur Herstellung von 3-(alpha-AEthinyl-benzyl)-4-oxycumarin |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1092278A (fr) | 1955-04-20 |
| GB743271A (en) | 1956-01-11 |
| BE519956A (Direct) | |
| US2723276A (en) | 1955-11-08 |
| NL82169C (Direct) | |
| NL83407C (Direct) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69709938T2 (de) | N-benzylpiperidin- und tetrahydropyridin-derivate | |
| DE925472C (de) | Verfahren zur Herstellung von Cumarinderivaten | |
| DE2062001C2 (de) | 1,2,3,4-Tetrahydro-4-phenylisochinolin-Derivate, deren Säureadditionssalze, Verfahren zu deren Herstellung und pharmazeutisches Präparat | |
| DE1161273B (de) | Verfahren zur Herstellung von N-substituierten 3-Oxypyrrolidinbenzilsäureestern. | |
| DE2035903A1 (de) | Verfahren zur Herstellung neuer hetero cyclischer Verbindungen | |
| DE905246C (de) | Verfahren zur Herstellung von Aminoalkoholen | |
| DE2747987C2 (Direct) | ||
| DE937952C (de) | Verfahren zur Herstellung analeptisch wirksamer 2-Aminoindanverbindungen | |
| DE764598C (de) | Verfahren zur Herstellung von analgetisch wirksamen Derivaten des 1-Oxyphenyl-3-aminobutans | |
| DE1936452C3 (de) | Verfahren zur Herstellung von 4,4-Diphenylpiperidlnen | |
| DE2640026C2 (de) | Verfahren zur Herstellung von 6,10,14-Trimethylpentadecan-2-on | |
| DE900938C (de) | Verfahren zur Herstellung von 1-(o-Oxyphenyl)-1-oxy-2-aralkylamino-propanen | |
| AT208872B (de) | Verfahren zur Herstellung neuer 1,4-Diazacycloheptane | |
| DE642290C (de) | Verfahren zur Darstellung von Reduktionsprodukten des maennlichen Sexualhormons und aehnlich wirkender Stoffe | |
| DE725535C (de) | Verfahren zur Herstellung von Tetrahydroisochinolinverbindungen | |
| DE414598C (de) | Verfahren zur Herstellung von Dihydrodesoxymorphin und Dihydrodesoxycodein | |
| CH307800A (de) | Verfahren zur Herstellung von Cumarinderivaten. | |
| DE2101813C3 (de) | Neue 17alpha-(2',3'-difluormethylenprop-1 '-en-1 '-yl)-östra-4-en-3-one, Verfahren zu deren Herstellung sowie diese enthaltende Mittel | |
| AT214455B (de) | Verfahren zur Herstellung von neuen phosphorhaltigen Indolderivaten | |
| DE1668909C3 (de) | Verfahren zur Herstellung von 2-Methylamino-cumaranen | |
| DE879098C (de) | Verfahren zur Herstellung von ringsubstituierten gesaettigten oder ungesaettigten Androstanol-(17)-onen-(3) bzw. deren 17-Derivaten | |
| DE533692C (de) | Verfahren zur Darstellung von Abkoemmlingen des 4,5-Oxidophenanthrens | |
| DE1493699C (de) | Verfahren zur Herstellung von cyclischen Äthern | |
| DE1178068B (de) | Verfahren zur Herstellung von halognierten Iminodibenzylen. | |
| DE670920C (de) | Verfahren zur Darstellung von 3,4,5-Triaminopyridin |