DE842407C - Verfahren zur Herstellung von Polymeren - Google Patents
Verfahren zur Herstellung von PolymerenInfo
- Publication number
- DE842407C DE842407C DEN124A DEN0000124A DE842407C DE 842407 C DE842407 C DE 842407C DE N124 A DEN124 A DE N124A DE N0000124 A DEN0000124 A DE N0000124A DE 842407 C DE842407 C DE 842407C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- polymers
- vinyl
- polymer
- preformed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title claims description 135
- 238000000034 method Methods 0.000 title claims description 60
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000203 mixture Substances 0.000 claims description 47
- 239000000178 monomer Substances 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 32
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 23
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 23
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 14
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 13
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 13
- 238000011282 treatment Methods 0.000 claims description 12
- 229920002367 Polyisobutene Polymers 0.000 claims description 11
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- GBURUDXSBYGPBL-UHFFFAOYSA-N 2,2,3-trimethylhexanedioic acid Chemical compound OC(=O)C(C)(C)C(C)CCC(O)=O GBURUDXSBYGPBL-UHFFFAOYSA-N 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 description 59
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 25
- -1 persalts Chemical class 0.000 description 24
- 238000006116 polymerization reaction Methods 0.000 description 23
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 17
- 229920003214 poly(methacrylonitrile) Polymers 0.000 description 17
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 15
- 229920001567 vinyl ester resin Polymers 0.000 description 14
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 13
- 239000004793 Polystyrene Substances 0.000 description 12
- 150000007513 acids Chemical class 0.000 description 12
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- 229920002223 polystyrene Polymers 0.000 description 11
- 229920002554 vinyl polymer Polymers 0.000 description 11
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 229920001519 homopolymer Polymers 0.000 description 10
- 229920002239 polyacrylonitrile Polymers 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 229920000915 polyvinyl chloride Polymers 0.000 description 9
- 239000004800 polyvinyl chloride Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 7
- 150000001253 acrylic acids Chemical class 0.000 description 7
- 230000015556 catabolic process Effects 0.000 description 7
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 6
- 238000007334 copolymerization reaction Methods 0.000 description 6
- 238000006731 degradation reaction Methods 0.000 description 6
- 150000002894 organic compounds Chemical class 0.000 description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 150000002763 monocarboxylic acids Chemical class 0.000 description 5
- JLIDVCMBCGBIEY-UHFFFAOYSA-N 1-penten-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 description 4
- JESXATFQYMPTNL-UHFFFAOYSA-N 2-ethenylphenol Chemical compound OC1=CC=CC=C1C=C JESXATFQYMPTNL-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 4
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 4
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- SXZSFWHOSHAKMN-UHFFFAOYSA-N 2,3,4,4',5-Pentachlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SXZSFWHOSHAKMN-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- TVONJMOVBKMLOM-UHFFFAOYSA-N 2-methylidenebutanenitrile Chemical compound CCC(=C)C#N TVONJMOVBKMLOM-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- 239000001856 Ethyl cellulose Substances 0.000 description 3
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 3
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 3
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 3
- FFYWKOUKJFCBAM-UHFFFAOYSA-N ethenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC=C FFYWKOUKJFCBAM-UHFFFAOYSA-N 0.000 description 3
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 description 3
- 229920001249 ethyl cellulose Polymers 0.000 description 3
- 235000019325 ethyl cellulose Nutrition 0.000 description 3
- 230000001976 improved effect Effects 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- OYLCUJRJCUXQBQ-UHFFFAOYSA-N 1-hepten-3-one Chemical compound CCCCC(=O)C=C OYLCUJRJCUXQBQ-UHFFFAOYSA-N 0.000 description 2
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 2
- CISIJYCKDJSTMX-UHFFFAOYSA-N 2,2-dichloroethenylbenzene Chemical compound ClC(Cl)=CC1=CC=CC=C1 CISIJYCKDJSTMX-UHFFFAOYSA-N 0.000 description 2
- FEUFEGJTJIHPOF-UHFFFAOYSA-N 2-butyl acrylic acid Chemical compound CCCCC(=C)C(O)=O FEUFEGJTJIHPOF-UHFFFAOYSA-N 0.000 description 2
- ZXABMDQSAABDMG-UHFFFAOYSA-N 3-ethenoxyprop-1-ene Chemical compound C=CCOC=C ZXABMDQSAABDMG-UHFFFAOYSA-N 0.000 description 2
- FKWUKKNHLHTXJE-UHFFFAOYSA-N 5-o-ethenyl 1-o-methyl pentanedioate Chemical compound COC(=O)CCCC(=O)OC=C FKWUKKNHLHTXJE-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- JZQAAQZDDMEFGZ-UHFFFAOYSA-N bis(ethenyl) hexanedioate Chemical compound C=COC(=O)CCCCC(=O)OC=C JZQAAQZDDMEFGZ-UHFFFAOYSA-N 0.000 description 2
- 239000012496 blank sample Substances 0.000 description 2
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N butadiene group Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- IYNRVIKPUTZSOR-HWKANZROSA-N ethenyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC=C IYNRVIKPUTZSOR-HWKANZROSA-N 0.000 description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical class C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-M pimelate(1-) Chemical compound OC(=O)CCCCCC([O-])=O WLJVNTCWHIRURA-UHFFFAOYSA-M 0.000 description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 2
- BVIUYHQPSZOHOV-UHFFFAOYSA-N 1,1-dichloroethene;2-methylprop-2-enoic acid Chemical compound ClC(Cl)=C.CC(=C)C(O)=O BVIUYHQPSZOHOV-UHFFFAOYSA-N 0.000 description 1
- STWZWUFRTQEEMW-UHFFFAOYSA-N 1,1-dichloroethene;prop-2-enoic acid Chemical compound ClC(Cl)=C.OC(=O)C=C STWZWUFRTQEEMW-UHFFFAOYSA-N 0.000 description 1
- VFRMAHVDXYSEON-UHFFFAOYSA-N 1,1-diiodoethene Chemical compound IC(I)=C VFRMAHVDXYSEON-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- PIGJZPZYWKFDBR-UHFFFAOYSA-N 2,5-dimethyl-1-(4-methylpyridin-2-yl)pyrrole-3-carbaldehyde Chemical compound CC1=CC(C=O)=C(C)N1C1=CC(C)=CC=N1 PIGJZPZYWKFDBR-UHFFFAOYSA-N 0.000 description 1
- VSGKEWJNJIONGY-UHFFFAOYSA-N 2-methylprop-2-enenitrile;prop-2-enoic acid Chemical compound CC(=C)C#N.OC(=O)C=C VSGKEWJNJIONGY-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- RMZIOVJHUJAAEY-UHFFFAOYSA-N Allyl butyrate Chemical compound CCCC(=O)OCC=C RMZIOVJHUJAAEY-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- TXAHPQBGJGJQME-UHFFFAOYSA-N acetaldehyde;phenol Chemical compound CC=O.OC1=CC=CC=C1 TXAHPQBGJGJQME-UHFFFAOYSA-N 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- HABAXTXIECRCKH-UHFFFAOYSA-N bis(prop-2-enyl) butanedioate Chemical compound C=CCOC(=O)CCC(=O)OCC=C HABAXTXIECRCKH-UHFFFAOYSA-N 0.000 description 1
- FPODCVUTIPDRTE-UHFFFAOYSA-N bis(prop-2-enyl) hexanedioate Chemical compound C=CCOC(=O)CCCCC(=O)OCC=C FPODCVUTIPDRTE-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- DHHPHEAWKZTPAI-UHFFFAOYSA-N chloroethene;2-methylprop-2-enenitrile Chemical compound ClC=C.CC(=C)C#N DHHPHEAWKZTPAI-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- IEPRKVQEAMIZSS-AATRIKPKSA-N diethyl fumarate Chemical compound CCOC(=O)\C=C\C(=O)OCC IEPRKVQEAMIZSS-AATRIKPKSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical class CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009775 high-speed stirring Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- NZIDBRBFGPQCRY-UHFFFAOYSA-N octyl 2-methylprop-2-enoate Chemical compound CCCCCCCCOC(=O)C(C)=C NZIDBRBFGPQCRY-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000009931 pascalization Methods 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920001485 poly(butyl acrylate) polymer Polymers 0.000 description 1
- 229920005735 poly(methyl vinyl ketone) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920005553 polystyrene-acrylate Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical compound C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- UBLMWQYLVOVZMT-UHFFFAOYSA-N tert-butyl n-(3-acetylphenyl)carbamate Chemical compound CC(=O)C1=CC=CC(NC(=O)OC(C)(C)C)=C1 UBLMWQYLVOVZMT-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000009210 therapy by ultrasound Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F293/00—Macromolecular compounds obtained by polymerisation on to a macromolecule having groups capable of inducing the formation of new polymer chains bound exclusively at one or both ends of the starting macromolecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F291/00—Macromolecular compounds obtained by polymerising monomers on to macromolecular compounds according to more than one of the groups C08F251/00 - C08F289/00
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US286509XA | 1948-11-16 | 1948-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE842407C true DE842407C (de) | 1952-06-26 |
Family
ID=21844655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN124A Expired DE842407C (de) | 1948-11-16 | 1949-11-04 | Verfahren zur Herstellung von Polymeren |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE492180A (Direct) |
| CH (1) | CH286509A (Direct) |
| DE (1) | DE842407C (Direct) |
| FR (1) | FR999594A (Direct) |
| GB (1) | GB679562A (Direct) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1012071B (de) * | 1955-02-22 | 1957-07-11 | Courtaulds Ltd | Verfahren zur Herstellung von Blockmischpolymeren |
| DE1104180B (de) * | 1955-12-09 | 1961-04-06 | Natural Rubber Producers | Verfahren zur Herstellung von Pfropf-Mischpolymerisaten |
| DE1245131B (de) * | 1962-12-26 | 1967-07-20 | Dow Chemical Co | Verfahren zur Polymerisation |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2899405A (en) * | 1959-08-11 | Polymerization of vinyl chloride or | ||
| US2741650A (en) * | 1951-11-08 | 1956-04-10 | Shawinigan Resins Corp | Styrene-modified polyvinyl acetate resins |
| US2719136A (en) * | 1951-11-29 | 1955-09-27 | Eastman Kodak Co | Compositions from polymerizing acrylonitrile in the presence of maleic anhydride copolymers |
| US2773050A (en) * | 1952-04-30 | 1956-12-04 | Eastman Kodak Co | Water vapor permeable compositions and articles containing a polyacrylic ester and polyvinyl alcohol |
| US2763631A (en) * | 1952-05-23 | 1956-09-18 | Eastman Kodak Co | Acrylonitrile polymers containing vinyl chloride or vinylidene chloride |
| US2794793A (en) * | 1952-10-21 | 1957-06-04 | Eastman Kodak Co | Copolymerization of ethenoid monomers in the presence of polyacrylonitrile |
| US2879253A (en) * | 1954-02-03 | 1959-03-24 | Eastman Kodak Co | Copolymerization of acrylonitrile and another unsaturated monomer, in the presence of preformed homopolymers and products obtained thereby |
| FR1087197A (fr) * | 1952-11-19 | 1955-02-22 | Basf Ag | Procédé de production de polymères |
| US2837496A (en) * | 1952-12-31 | 1958-06-03 | Hercules Powder Co Ltd | Graft copolymers and preparation thereof from polymer hydroperoxides |
| US2713568A (en) * | 1953-03-04 | 1955-07-19 | Firestone Tire & Rubber Co | Stripping vinylidene-vinyl chloride copolymers with aid of alkyl acrylate and product |
| US3062777A (en) * | 1953-04-14 | 1962-11-06 | Union Carbide Corp | Graft copolymers of styrene on butadiene rubbers and method for making same |
| US2784172A (en) * | 1953-04-27 | 1957-03-05 | Monsanto Chemicals | Acrylonitrile copolymers stabilized with acrylic acid salts |
| US2779025A (en) * | 1953-08-27 | 1957-01-29 | Firestone Tire & Rubber Co | New polymeric material containing copolymerized monochlorotrifluoroethylene and an alkyl vinyl ether |
| DE1123476B (de) * | 1953-09-08 | 1962-02-08 | Phil Oliver Wallis Burke Jun D | Verfahren zur Herstellung von unloeslichen, vernetzten Hochpolymeren kolloider Teilchengroesse |
| US2859201A (en) * | 1953-11-09 | 1958-11-04 | Phillips Petroleum Co | Graft-type polymer of conjugated diene and acrylic acid and process of preparation |
| US2830032A (en) * | 1954-01-15 | 1958-04-08 | Basf Ag | Cross-linked copolymers of a polymerizable monomer with an unsaturated copolymer of a vinyl ether and vinyl allyl ether and process for making same |
| US3019208A (en) * | 1954-01-18 | 1962-01-30 | Firestone Tire & Rubber Co | Method of making graft copolymers of vinyl chloride and polyacrylate |
| US2858281A (en) * | 1954-01-22 | 1958-10-28 | Goodrich Co B F | Insoluble, acid and alkali-resistant carboxylic polymers |
| US2879254A (en) * | 1954-02-03 | 1959-03-24 | Eastman Kodak Co | Copolymerization of acrylonitrile and another monomer in the presence of preformed polymers and products obtained thereby |
| BE535395A (Direct) * | 1954-02-03 | |||
| US2838470A (en) * | 1954-02-03 | 1958-06-10 | Eastman Kodak Co | Copolymerization of acrylonitrile and another unsaturated monomer in the presence ofpreformed interpolymer |
| US2816087A (en) * | 1954-02-10 | 1957-12-10 | Eastman Kodak Co | Modified polyvinyl alcohol polymers and their preparation |
| NL120473C (Direct) * | 1954-03-26 | |||
| US2849419A (en) * | 1954-04-15 | 1958-08-26 | Firestone Tire & Rubber Co | Oriented filaments of graft copolymer of polyacrylate polymerized on vinylidene chloride resin |
| US2886552A (en) * | 1954-06-10 | 1959-05-12 | Diamond Alkali Co | Polymerization employing polyvinyl alkyl ethers as suspension stabilizers |
| US2886551A (en) * | 1954-06-10 | 1959-05-12 | Diamond Alkali Co | Polymerization employing a phthalic glycerol alkyd resin as a suspension stabilizer |
| US2842518A (en) * | 1954-09-13 | 1958-07-08 | Borg Warner | Product produced by polymerization of vinylidene chloride-acrylonitrile mixtures onto polychloroprene |
| US2879256A (en) * | 1954-11-26 | 1959-03-24 | Eastman Kodak Co | Continuous process for preparing vinyl or vinylidene chloride graft polymers of improved solubility |
| US2835645A (en) * | 1955-01-05 | 1958-05-20 | Goodyear Tire & Rubber | High styrene-low diene resins of high heat softening point |
| NL94864C (Direct) * | 1955-02-25 | 1900-01-01 | ||
| US2861973A (en) * | 1956-01-31 | 1958-11-25 | Borden Co | Moldable slurry comprising vinyl butyrate and polyethyl methacrylate and molding obtained therefrom |
| US2991269A (en) * | 1956-02-21 | 1961-07-04 | Shell Oil Co | Process for preparing block copolymers by degrading a preformed polymer in the presence of dissimilar monomer |
| US3091595A (en) * | 1956-03-22 | 1963-05-28 | Shell Oil Co | Cyano-substituted polyamides and their use as curing agents for polyepoxides |
| NL99388C (Direct) * | 1956-09-28 | |||
| US2908661A (en) * | 1957-01-11 | 1959-10-13 | Borg Warner | Polymerization of acrylonitrile-alpha methyl styrene mixtures onto polybutadiene and products produced thereby |
| DE1070381B (de) * | 1957-03-15 | 1959-12-03 | Rohm & LIaas Company, Philadelphia, Pa. (V. St. A.) | Verfahren zur Herstellung von Ionenaustauscherharzen auf Basis der Acrylsäuren und Methacrylsäuren |
| US2992203A (en) * | 1957-03-25 | 1961-07-11 | Rohm & Haas | High impact resistant polymers derived primarily from esters of acrylic and methacrylic acids |
| US2905653A (en) * | 1957-05-14 | 1959-09-22 | Firestone Tire & Rubber Co | Oriented products from graft copolymers of vinyl ester on acrylonitrile polymer |
| US2941990A (en) * | 1957-07-15 | 1960-06-21 | American Cyanamid Co | Cyanoethylated polymers |
| NL111530C (Direct) * | 1957-10-02 | |||
| NL232818A (Direct) * | 1957-10-31 | 1900-01-01 | ||
| US3074866A (en) * | 1958-01-06 | 1963-01-22 | Alelio Gaetano F D | Irradiated polymers |
| US3082161A (en) * | 1958-01-06 | 1963-03-19 | Alelio Gaetano F D | Irradiated polymers |
| US3075905A (en) * | 1958-01-06 | 1963-01-29 | Alelio Gaetano F D | Irradiated polymers |
| US3075904A (en) * | 1958-01-06 | 1963-01-29 | Alelio Gaetano F D | Irradiated polymers |
| US3020257A (en) * | 1958-02-12 | 1962-02-06 | Haris Co Ltd | Method for manufacture of polyisobutylene-vinyl acetate graft copolymer |
| CA643619A (en) * | 1958-02-14 | 1962-06-26 | Dominion Rubber Company | Polymethylmethacrylate polybutadiene and styrene composition |
| US2961421A (en) * | 1958-02-17 | 1960-11-22 | Monsanto Chemicals | Interpolymer latices comprising acrylates and monovinylidene aromatic hydrocarbons, process of preparing same and cellulose coated therewith |
| NL246911A (Direct) * | 1958-03-06 | |||
| US2961423A (en) * | 1958-04-03 | 1960-11-22 | Monsanto Chemicals | Crossed-linked styrene-allyl alcohol copolymers as binders for fibrous fillers and structural units manufactured therefrom |
| US2903440A (en) * | 1958-04-08 | 1959-09-08 | Exxon Research Engineering Co | Thermo setting resin from a liquid butadiene polymer and styrene |
| US3188228A (en) * | 1958-05-14 | 1965-06-08 | Du Pont | Method of graft polymerizing an organic compound to a solid shaped condensation polymer structure |
| US3041308A (en) * | 1959-04-24 | 1962-06-26 | Monsanto Chemicals | Blend of styrene copolymer with a graft-copolymer of styrene and an alkyl methacrylate upon an alkyl acrylate polymer |
| US3061582A (en) * | 1959-07-09 | 1962-10-30 | Nat Distillers Chem Corp | Ethylenic modification of branched chain polyamides |
| US3061581A (en) * | 1959-07-09 | 1962-10-30 | Nat Distillers Chem Corp | Vinyl modification of branched chain polyamides |
| US3113912A (en) * | 1959-07-16 | 1963-12-10 | Phillips Petroleum Co | Preparation of vulcanizates by irradiation of block copolymers |
| US3135717A (en) * | 1960-02-10 | 1964-06-02 | Grace W R & Co | Process of forming graft copolymers of polystyrene and polyvinyl chloride |
| US3128528A (en) * | 1960-04-28 | 1964-04-14 | Du Pont | Preparation of hydroset textile material |
| NL270024A (Direct) * | 1960-10-07 | 1900-01-01 | ||
| US3177270A (en) * | 1960-10-10 | 1965-04-06 | Dow Chemical Co | Graft copolymers of polyolefins and monovinyl aromatic compounds and method of making the same |
| US3177269A (en) * | 1960-10-10 | 1965-04-06 | Dow Chemical Co | Graft copolymers of polyolefins and acrylic and methacrylic acid and method of making the same |
| US3294711A (en) * | 1963-04-22 | 1966-12-27 | Bayer Ag | Graft polymers of vinyl acetate or vinyl chloride onto a saturated polyester backbone, and polyurethane foams therefrom |
| US3297471A (en) * | 1965-04-08 | 1967-01-10 | Du Pont | Acrylic or methacrylic acid grafting copolymerized on nylon and forming salt of said graft |
| US3296339A (en) * | 1966-01-20 | 1967-01-03 | Rohm & Haas | Thermoplastic compositions formed by polymerizing methacrylic acid esters and polybutadiene latices |
| US3413378A (en) * | 1966-11-14 | 1968-11-26 | Du Pont | Graft copolymers of nitrile groups on polyamide substrates |
| IL86605A (en) * | 1988-06-02 | 1992-02-16 | Bromine Compounds Ltd | Process for the polymerization of pentabromobenzylester monoacrylate |
| US6228948B1 (en) | 1998-01-16 | 2001-05-08 | E. I. Du Pont De Nemours And Company | High melt flow, highly-grafted polypropylene |
| DE102007011825B3 (de) * | 2007-03-12 | 2008-05-15 | Deutsche Gumtec Ag | Verfahren zur Modifizierung von Gummi- und Thermoplastabfällen mittels Pfropfung während eines Mahlprozesses sowie Verwendung der so modifizierten Gummi-und Thermoplastabfälle |
-
0
- BE BE492180D patent/BE492180A/xx unknown
-
1949
- 1949-11-04 DE DEN124A patent/DE842407C/de not_active Expired
- 1949-11-15 CH CH286509D patent/CH286509A/de unknown
- 1949-11-15 FR FR999594D patent/FR999594A/fr not_active Expired
- 1949-11-16 GB GB29343/49A patent/GB679562A/en not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1012071B (de) * | 1955-02-22 | 1957-07-11 | Courtaulds Ltd | Verfahren zur Herstellung von Blockmischpolymeren |
| DE1104180B (de) * | 1955-12-09 | 1961-04-06 | Natural Rubber Producers | Verfahren zur Herstellung von Pfropf-Mischpolymerisaten |
| DE1245131B (de) * | 1962-12-26 | 1967-07-20 | Dow Chemical Co | Verfahren zur Polymerisation |
Also Published As
| Publication number | Publication date |
|---|---|
| BE492180A (Direct) | |
| FR999594A (fr) | 1952-02-01 |
| CH286509A (de) | 1952-10-31 |
| GB679562A (en) | 1952-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE842407C (de) | Verfahren zur Herstellung von Polymeren | |
| DE1495694B2 (de) | Verfahren zur Herstellung von Polymerisaten des Vinylchlorids | |
| DE1520119B2 (de) | Verfahren zur Herstellung einer stabilen Disperion eines Additionspolymeren in einer organischen Flüssigkeit | |
| DE1064719B (de) | Verfahren zur Herstellung vernetzbarer bzw. vernetzter Polymerer | |
| DE2034989A1 (de) | Sternförmige Homo und Kopolymerisate von konjugierten Dienen bzw konjugierten Dienen mit vinylaromatischen Verbindungen und Verfahren zu ihrer Herstellung | |
| DE1595849B2 (de) | Verfahren zur herstellung von vinylchloridpolymerisaten | |
| DE1520310B2 (de) | Verfahren zur Herstellung einer Pfropfpolymerisatmasse | |
| DE2104597A1 (de) | Verfahren zur herstellung von polymerisaten von konjugierten dienen | |
| DE2153886B2 (de) | Verfahren zur Herstellung von Vinylchloridpolymeren mit verbesserten Eigenschaften | |
| DE1620960C3 (de) | Verfahren zur Herstellung von Polyvinylidenfluorid | |
| DE2133606A1 (de) | Verfahren zur Herstellung von Pfropfpolymeren des Vinylchlonds | |
| DE1201061B (de) | Verfahren zur Herstellung verspinnbarer Loesungen faserbildender Acrylnitrilpolymerisate | |
| DE2003331B2 (de) | Verfahren zur herstellung eines vinylchloridpfropfpolymerisates | |
| DE1161423B (de) | Verfahren zur Herstellung von Pfropf-polymerisaten | |
| DE2208340A1 (de) | Polymerisate und Verfahren zu ihrer Herstellung | |
| DE1119516B (de) | Verfahren zur Herstellung eines mit Styrol modifizierten Butadien-Styrol-Pfropfmischpolymerisates | |
| DE1128664B (de) | Verfahren zur Herstellung eines Hilfs-Suspensionsmittels, das bei der Erzeugung von koernigem, stark poroesem Polyvinylchlorid mit nicht glasartiger Oberflaeche nach demSuspensions-polymerisationsverfahren verwendbar ist | |
| DE944996C (de) | Verfahren zur Herstellung von Mischpolymerisaten aus Vinylhalogenid mit einer anderen polymerisierbaren organischen Verbindung | |
| DE912152C (de) | Verfahren zur Polymerisation oder Kopolymerisation polymerisierbarer ungesaettigter organischer Verbindungen | |
| DE2500494C2 (Direct) | ||
| DE906515C (de) | Verfahren zur Herstellung von Polyacrylsaeurenitril- oder Acrylsaeurenitrilmischpolymerisat-Weichmacher-Mischungen | |
| DE871366C (de) | Verfahren zum Polymerisieren ungesaettigter Verbindungen | |
| DE1745283A1 (de) | Verfahren zur industriellen Herstellung von Polymerisationsprodukten von Zusammensetzungen auf der Grundlage von Vinylchlorid,die wenigstens teilweise durch Vinylchlorid gepfropfte Copolymere auf der Grundlage von Vinylacetat und AEthylen enthalten,und nach diesem Verfahren hergestellte Erzeugnisse | |
| DE2603758A1 (de) | Verfahren zur herstellung von pfropf-copolymeren | |
| DE966375C (de) | Verfahren zur Herstellung von Acrylnitrilharzen |