DE69829888T2 - Verfahren zur Herstellung von Hydroperoxiden - Google Patents
Verfahren zur Herstellung von Hydroperoxiden Download PDFInfo
- Publication number
- DE69829888T2 DE69829888T2 DE69829888T DE69829888T DE69829888T2 DE 69829888 T2 DE69829888 T2 DE 69829888T2 DE 69829888 T DE69829888 T DE 69829888T DE 69829888 T DE69829888 T DE 69829888T DE 69829888 T2 DE69829888 T2 DE 69829888T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- compound
- hydrocarbon
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims description 22
- 150000002432 hydroperoxides Chemical class 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 49
- 150000002430 hydrocarbons Chemical class 0.000 claims description 34
- 229930195733 hydrocarbon Natural products 0.000 claims description 27
- -1 secondary amine compound Chemical class 0.000 claims description 27
- 239000004215 Carbon black (E152) Substances 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 18
- 229910052760 oxygen Inorganic materials 0.000 claims description 18
- 239000001301 oxygen Substances 0.000 claims description 18
- 238000007254 oxidation reaction Methods 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 239000007789 gas Substances 0.000 claims description 11
- 230000003647 oxidation Effects 0.000 claims description 11
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- IAUKWGFWINVWKS-UHFFFAOYSA-N 1,2-di(propan-2-yl)naphthalene Chemical compound C1=CC=CC2=C(C(C)C)C(C(C)C)=CC=C21 IAUKWGFWINVWKS-UHFFFAOYSA-N 0.000 claims description 2
- VUMCUSHVMYIRMB-UHFFFAOYSA-N 1,3,5-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1 VUMCUSHVMYIRMB-UHFFFAOYSA-N 0.000 claims description 2
- UNEATYXSUBPPKP-UHFFFAOYSA-N 1,3-Diisopropylbenzene Chemical compound CC(C)C1=CC=CC(C(C)C)=C1 UNEATYXSUBPPKP-UHFFFAOYSA-N 0.000 claims description 2
- SPPWGCYEYAMHDT-UHFFFAOYSA-N 1,4-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=C(C(C)C)C=C1 SPPWGCYEYAMHDT-UHFFFAOYSA-N 0.000 claims description 2
- PMPBFICDXLLSRM-UHFFFAOYSA-N 1-propan-2-ylnaphthalene Chemical compound C1=CC=C2C(C(C)C)=CC=CC2=C1 PMPBFICDXLLSRM-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000004043 oxo group Chemical group O=* 0.000 claims description 2
- 229940116351 sebacate Drugs 0.000 claims description 2
- AMBHHSBRXZAGDZ-UHFFFAOYSA-N 1-phenyl-2,3-di(propan-2-yl)benzene Chemical group CC(C)C1=CC=CC(C=2C=CC=CC=2)=C1C(C)C AMBHHSBRXZAGDZ-UHFFFAOYSA-N 0.000 claims 1
- HKTCLPBBJDIBGF-UHFFFAOYSA-N 1-phenyl-2-propan-2-ylbenzene Chemical group CC(C)C1=CC=CC=C1C1=CC=CC=C1 HKTCLPBBJDIBGF-UHFFFAOYSA-N 0.000 claims 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims 1
- 229930007927 cymene Natural products 0.000 claims 1
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 description 45
- 238000006243 chemical reaction Methods 0.000 description 41
- 238000009825 accumulation Methods 0.000 description 11
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 125000004104 aryloxy group Chemical group 0.000 description 6
- 238000004364 calculation method Methods 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- RCXZLYUPSMHHCE-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1.CC(C)C1=CC=CC=C1 RCXZLYUPSMHHCE-UHFFFAOYSA-N 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 150000007514 bases Chemical group 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 238000007664 blowing Methods 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000004776 molecular orbital Methods 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000005561 phenanthryl group Chemical group 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical class CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 description 1
- MLXMBIUVXPMUPK-UHFFFAOYSA-N 1-butan-2-yl-2-ethylbenzene Chemical compound CCC(C)C1=CC=CC=C1CC MLXMBIUVXPMUPK-UHFFFAOYSA-N 0.000 description 1
- NUEUMFZLNOCRCQ-UHFFFAOYSA-N 1-propan-2-yl-4-(4-propan-2-ylphenyl)benzene Chemical group C1=CC(C(C)C)=CC=C1C1=CC=C(C(C)C)C=C1 NUEUMFZLNOCRCQ-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- GWLLTEXUIOFAFE-UHFFFAOYSA-N 2,6-diisopropylnaphthalene Chemical compound C1=C(C(C)C)C=CC2=CC(C(C)C)=CC=C21 GWLLTEXUIOFAFE-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- BDCFWIDZNLCTMF-UHFFFAOYSA-N 2-phenylpropan-2-ol Chemical group CC(C)(O)C1=CC=CC=C1 BDCFWIDZNLCTMF-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- DOKXGFDUBRWFCC-UHFFFAOYSA-N CC(C)(C1)NC(C)(C)CC1C#N Chemical compound CC(C)(C1)NC(C)(C)CC1C#N DOKXGFDUBRWFCC-UHFFFAOYSA-N 0.000 description 1
- QKXWNEXHGMFIGB-UHFFFAOYSA-N CC(C)(C1)NC(C)(C)CC1C(O)=O Chemical compound CC(C)(C1)NC(C)(C)CC1C(O)=O QKXWNEXHGMFIGB-UHFFFAOYSA-N 0.000 description 1
- RCFFWTGTLXYWHN-UHFFFAOYSA-N CC(C)(C1)NC(C)(C)CC1N=C=S Chemical compound CC(C)(C1)NC(C)(C)CC1N=C=S RCFFWTGTLXYWHN-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- XITRBUPOXXBIJN-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 XITRBUPOXXBIJN-UHFFFAOYSA-N 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000002884 conformational search Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000008282 halocarbons Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- GRHBQAYDJPGGLF-UHFFFAOYSA-N isothiocyanic acid Chemical group N=C=S GRHBQAYDJPGGLF-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000004219 molecular orbital method Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002927 oxygen compounds Chemical class 0.000 description 1
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- ZJMWRROPUADPEA-UHFFFAOYSA-N sec-butylbenzene Chemical compound CCC(C)C1=CC=CC=C1 ZJMWRROPUADPEA-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/02—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides
- C07C409/04—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides the carbon atom being acyclic
- C07C409/08—Compounds containing six-membered aromatic rings
- C07C409/10—Cumene hydroperoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP18329197 | 1997-07-09 | ||
| JP18329197 | 1997-07-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69829888D1 DE69829888D1 (de) | 2005-05-25 |
| DE69829888T2 true DE69829888T2 (de) | 2006-01-12 |
Family
ID=16133096
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69829888T Expired - Lifetime DE69829888T2 (de) | 1997-07-09 | 1998-06-30 | Verfahren zur Herstellung von Hydroperoxiden |
| DE69808037T Expired - Lifetime DE69808037T2 (de) | 1997-07-09 | 1998-06-30 | Verfahren zur herstellung von hydroperoxiden |
| DE69830207T Expired - Lifetime DE69830207T2 (de) | 1997-07-09 | 1998-06-30 | Verfahren zur Herstellung von Hydroperoxiden |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69808037T Expired - Lifetime DE69808037T2 (de) | 1997-07-09 | 1998-06-30 | Verfahren zur herstellung von hydroperoxiden |
| DE69830207T Expired - Lifetime DE69830207T2 (de) | 1997-07-09 | 1998-06-30 | Verfahren zur Herstellung von Hydroperoxiden |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US6291718B1 (enExample) |
| EP (3) | EP1216993B1 (enExample) |
| JP (1) | JP3985174B2 (enExample) |
| KR (1) | KR100378205B1 (enExample) |
| CN (1) | CN1120835C (enExample) |
| DE (3) | DE69829888T2 (enExample) |
| ES (3) | ES2240596T3 (enExample) |
| FI (1) | FI122526B (enExample) |
| MY (2) | MY141770A (enExample) |
| RU (1) | RU2186767C2 (enExample) |
| TW (1) | TW589299B (enExample) |
| WO (1) | WO1999002491A1 (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10015874A1 (de) | 2000-03-30 | 2001-10-11 | Creavis Tech & Innovation Gmbh | Verfahren zur Herstellung von aromatischen Alkoholen insbesondere Phenol |
| DE10038562B4 (de) * | 2000-08-03 | 2005-12-15 | Siemens Ag | System und Verfahren zur Übertragung von Daten über Datennetze mit Datenumsetzung durch einen COM Automarschaller |
| DE10139212A1 (de) * | 2001-08-09 | 2003-02-27 | Creavis Tech & Innovation Gmbh | Herstellung von Peroxiden des Ethylbenzols und deren Verwendung |
| RU2203273C1 (ru) * | 2001-08-22 | 2003-04-27 | Открытое акционерное общество "Кирово-Чепецкий химический комбинат им. Б.П. Константинова" | Способ получения перфтордиацилпероксида |
| RU2220136C2 (ru) * | 2001-11-02 | 2003-12-27 | Открытое акционерное общество Научно-исследовательский институт "Ярсинтез" | Способ получения гидроперекисей трет-алканов |
| EP1520853B1 (en) * | 2003-09-24 | 2009-12-30 | Repsol Quimica S.A. | Process for preparation of hydroperoxides |
| US7038090B1 (en) * | 2004-04-01 | 2006-05-02 | Uop Llc | Process and catalyst for producing hydroperoxides |
| US7326815B2 (en) * | 2005-12-27 | 2008-02-05 | Exxonmobil Chemical Patents Inc. | Selective oxidation of alkylbenzenes |
| ITMI20061859A1 (it) * | 2006-09-28 | 2008-03-29 | Polimeri Europa Spa | Processo per la preparazione di fenolo mediante nuovi sistemi catalitici |
| US8487138B2 (en) * | 2007-08-22 | 2013-07-16 | Exxonmobil Chemical Patents Inc. | Oxidation of hydrocarbons |
| CN101842338B (zh) * | 2007-10-31 | 2015-02-18 | 埃克森美孚化学专利公司 | 烃的氧化 |
| JP2011500816A (ja) * | 2007-10-31 | 2011-01-06 | エクソンモービル・ケミカル・パテンツ・インク | 炭化水素の酸化 |
| ITMI20080460A1 (it) * | 2008-03-18 | 2009-09-19 | Polimeri Europa Spa | Processo catalitico per la preparazione di idroperossidi di alchilbenzeni mediante ossidazione aerobica in condizioni blande |
| CN101538020B (zh) * | 2008-03-21 | 2010-11-17 | 北京化工大学 | 一种含异丙基芳烃催化氧化制过氧化氢物的方法 |
| RU2370487C1 (ru) * | 2008-04-02 | 2009-10-20 | Государственное образовательное учреждение высшего профессионального образования "Ярославский государственный технический университет" | СПОСОБ ПОЛУЧЕНИЯ ГИДРОПЕРОКСИДА ЦИКЛОГЕКСИЛ-п-КСИЛОЛА |
| RU2365581C1 (ru) * | 2008-05-04 | 2009-08-27 | Государственное образовательное учреждение высшего профессионального образования "Ярославский государственный технический университет" | Способ получения гидропероксида циклогексилтолуола |
| RU2378253C1 (ru) * | 2008-05-04 | 2010-01-10 | Государственное образовательное учреждение высшего профессионального образования "Ярославский государственный технический университет" | Способ получения гидропероксида этилбензола |
| WO2010027562A1 (en) * | 2008-08-26 | 2010-03-11 | Exxonmobil Chemical Patents Inc. | Process for producing alkylbenzene hydroperoxides |
| WO2010042273A1 (en) * | 2008-10-10 | 2010-04-15 | Exxonmobil Chemical Patents Inc. | Oxidation of hydrocarbons |
| KR20140015548A (ko) * | 2008-12-15 | 2014-02-06 | 엑손모빌 케미칼 패턴츠 인코포레이티드 | 알킬방향족 화합물의 산화 |
| RU2404161C1 (ru) * | 2009-03-30 | 2010-11-20 | Государственное образовательное учреждение высшего профессионального образования "Ярославский государственный технический университет" | Способ получения гидропероксидов алкилароматических углеводородов |
| CN106117099A (zh) | 2009-08-28 | 2016-11-16 | 埃克森美孚化学专利公司 | 烃的氧化 |
| US8961804B2 (en) | 2011-10-25 | 2015-02-24 | Applied Materials, Inc. | Etch rate detection for photomask etching |
| US8808559B2 (en) | 2011-11-22 | 2014-08-19 | Applied Materials, Inc. | Etch rate detection for reflective multi-material layers etching |
| US8900469B2 (en) | 2011-12-19 | 2014-12-02 | Applied Materials, Inc. | Etch rate detection for anti-reflective coating layer and absorber layer etching |
| US9805939B2 (en) | 2012-10-12 | 2017-10-31 | Applied Materials, Inc. | Dual endpoint detection for advanced phase shift and binary photomasks |
| US8778574B2 (en) | 2012-11-30 | 2014-07-15 | Applied Materials, Inc. | Method for etching EUV material layers utilized to form a photomask |
| JP2016516683A (ja) * | 2013-03-14 | 2016-06-09 | ダブリン シティー ユニバーシティー | 触媒的ウィッティヒ反応におけるホスフィンオキシド還元のための方法 |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2548435A (en) * | 1946-08-01 | 1951-04-10 | Hercules Powder Co Ltd | Oxidation of aromatic hydrocarbons |
| US2734086A (en) * | 1951-07-03 | 1956-02-07 | Production of aromatic hydroperoxides | |
| US2744149A (en) * | 1953-06-29 | 1956-05-01 | Hercules Powder Co Ltd | Preparation of m- and p-cymene mixture by isomerization of cymene |
| US2792425A (en) * | 1954-10-14 | 1957-05-14 | Monsanto Chemicals | Production of hydroperoxides using malonic esters as oxidation initiators |
| NL92425C (enExample) * | 1955-01-26 | |||
| US2951799A (en) * | 1957-11-13 | 1960-09-06 | Monsanto Chemicals | Photoxidation processes using heterocyclic photosensitizers |
| US3160668A (en) * | 1961-06-19 | 1964-12-08 | Pittsburgh Chemical Company | Hydroperoxide formation |
| US3417158A (en) * | 1965-09-09 | 1968-12-17 | Texaco Inc | Method of inhibiting autooxidizable aromatic compounds |
| US3524888A (en) * | 1967-11-14 | 1970-08-18 | Koppers Co Inc | Alkyl benzene hydroperoxide preparation |
| BE756558A (fr) * | 1969-09-24 | 1971-03-24 | Sun Oil Co | Oxydation d'hydrocarbures |
| JPS4948300B1 (enExample) * | 1970-01-22 | 1974-12-20 | ||
| JPS5146094B2 (enExample) | 1971-10-21 | 1976-12-07 | ||
| SU430092A1 (ru) * | 1972-10-02 | 1974-05-30 | М. А. Дикий, М. С. Вайда , Т. И. Юрженко Львовский ордена Ленина политехнический институт | СПОСОБ ПОЛУЧЕНИЯ ГИДРОПЕРОКСИПЕРЕКИСЕЙ п-ДИИЗОПРОПИЛ БЕНЗОЛ А |
| SU492073A3 (ru) * | 1972-11-23 | 1975-11-15 | Акцо Н.В. (Фирма) | Способ получени гидроперекисей алкилароматических или циклоалифатических углеводородов |
| US4299991A (en) * | 1979-12-28 | 1981-11-10 | The Standard Oil Company | Formation of hydroperoxides |
| US4450303A (en) * | 1983-02-23 | 1984-05-22 | Phillips Petroleum Company | Process for the oxidation of secondary-alkyl substituted benzenes |
| US4602118A (en) * | 1984-11-09 | 1986-07-22 | Exxon Research And Engineering Co. | Liquid phase oxidation of organic compounds to their hydroperoxides |
| DK173704B1 (da) * | 1985-04-17 | 2001-07-09 | Hoffmann La Roche | Fremgangsmåde til katalytisk oxidation af allyliske grupper |
| DE3838028A1 (de) * | 1988-11-09 | 1990-05-10 | Peroxid Chemie Gmbh | Verfahren zur herstellung von aralkylhydroperoxiden |
| US4950794A (en) * | 1989-05-24 | 1990-08-21 | Arco Chemical Technology, Inc. | Ethylbenzene oxidation |
| US5395980A (en) * | 1994-03-21 | 1995-03-07 | Texaco Chemical Inc. | Isobutane oxidation process |
-
1998
- 1998-06-30 ES ES02006696T patent/ES2240596T3/es not_active Expired - Lifetime
- 1998-06-30 CN CN98800944A patent/CN1120835C/zh not_active Expired - Fee Related
- 1998-06-30 US US09/254,176 patent/US6291718B1/en not_active Expired - Lifetime
- 1998-06-30 EP EP02007202A patent/EP1216993B1/en not_active Expired - Lifetime
- 1998-06-30 EP EP98929761A patent/EP0927717B1/en not_active Expired - Lifetime
- 1998-06-30 ES ES98929761T patent/ES2186173T3/es not_active Expired - Lifetime
- 1998-06-30 JP JP18474398A patent/JP3985174B2/ja not_active Expired - Fee Related
- 1998-06-30 DE DE69829888T patent/DE69829888T2/de not_active Expired - Lifetime
- 1998-06-30 WO PCT/JP1998/002935 patent/WO1999002491A1/ja not_active Ceased
- 1998-06-30 DE DE69808037T patent/DE69808037T2/de not_active Expired - Lifetime
- 1998-06-30 DE DE69830207T patent/DE69830207T2/de not_active Expired - Lifetime
- 1998-06-30 EP EP02006696A patent/EP1216992B1/en not_active Expired - Lifetime
- 1998-06-30 KR KR10-1999-7001822A patent/KR100378205B1/ko not_active Expired - Fee Related
- 1998-06-30 ES ES02007202T patent/ES2241917T3/es not_active Expired - Lifetime
- 1998-06-30 RU RU99107563/04A patent/RU2186767C2/ru not_active IP Right Cessation
- 1998-07-07 TW TW087110979A patent/TW589299B/zh not_active IP Right Cessation
- 1998-07-08 MY MYPI20043294A patent/MY141770A/en unknown
- 1998-07-08 MY MYPI98003122A patent/MY120996A/en unknown
-
1999
- 1999-03-08 FI FI990498A patent/FI122526B/fi not_active IP Right Cessation
-
2001
- 2001-07-19 US US09/907,933 patent/US6476276B2/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US20020002313A1 (en) | 2002-01-03 |
| FI990498L (fi) | 1999-03-08 |
| JPH1192449A (ja) | 1999-04-06 |
| EP0927717A4 (enExample) | 1999-07-07 |
| DE69830207T2 (de) | 2006-02-23 |
| RU2186767C2 (ru) | 2002-08-10 |
| ES2186173T3 (es) | 2003-05-01 |
| FI990498A0 (fi) | 1999-03-08 |
| KR100378205B1 (ko) | 2003-03-29 |
| WO1999002491A1 (en) | 1999-01-21 |
| EP0927717A1 (en) | 1999-07-07 |
| US6291718B1 (en) | 2001-09-18 |
| EP1216993B1 (en) | 2005-05-11 |
| DE69808037D1 (de) | 2002-10-24 |
| EP1216992B1 (en) | 2005-04-20 |
| CN1120835C (zh) | 2003-09-10 |
| KR20000068449A (ko) | 2000-11-25 |
| EP1216993A1 (en) | 2002-06-26 |
| MY120996A (en) | 2005-12-30 |
| TW589299B (en) | 2004-06-01 |
| ES2241917T3 (es) | 2005-11-01 |
| DE69830207D1 (de) | 2005-06-16 |
| FI122526B (fi) | 2012-03-15 |
| DE69808037T2 (de) | 2003-06-05 |
| EP1216992A1 (en) | 2002-06-26 |
| DE69829888D1 (de) | 2005-05-25 |
| ES2240596T3 (es) | 2005-10-16 |
| CN1230947A (zh) | 1999-10-06 |
| MY141770A (en) | 2010-06-30 |
| EP0927717B1 (en) | 2002-09-18 |
| US6476276B2 (en) | 2002-11-05 |
| JP3985174B2 (ja) | 2007-10-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69829888T2 (de) | Verfahren zur Herstellung von Hydroperoxiden | |
| DE966684C (de) | Verfahren zur Herstellung von Phenolen durch unvollstaendige Oxydation von Benzolderivaten | |
| DE3886708T2 (de) | Verfahren zur Herstellung von Nitrilen und Anhydriden. | |
| DE3313573A1 (de) | Verfahren zur herstellung eines ungesaettigten aldehyds aus dem entsprechenden alkan | |
| DE3781594T2 (de) | Herstellung von alkylierten hydroxyaromatischen Verbindungen. | |
| EP1363868A1 (de) | Verfahren zur herstellung von cyclohexandicarbonsäuren und deren derivaten | |
| GB1595354A (en) | Manufacture of butanedicarboxylic adic ester | |
| DE2826279A1 (de) | Verfahren zur herstellung von aromatischen kohlenwasserstoffen | |
| DE2916572C2 (enExample) | ||
| DE60114663T2 (de) | Verfahren zur herstellung von organischen hydroperoxiden mit verringertem anteil an verunreinigungen | |
| EP0825165A3 (en) | A process for separating an oxidation reaction product and an oxidation catalyst | |
| DE60216135T2 (de) | Prozess zur herstellung von organischen hydroperoxiden | |
| DE2942069A1 (de) | Verbessertes verfahren zur herstellung aromatischer hydroperoxide | |
| DE60313950T2 (de) | Verfahren zur herstellung eines alkylarylhydroperoxid haltigen produkts | |
| EP0665209B1 (de) | Verfahren zur katalytischen Oxidation von aromatischen Verbindungen | |
| DE1262282B (de) | Verfahren zur Herstellung von Phenolen durch Oxydieren von aromatischen Kohlenwasserstoffen | |
| DE69609940T2 (de) | Verfahren zur Herstellung von Adipinsäure | |
| DE19853916A1 (de) | Verfahren zur Entfärbung von aus Pyrolysebenzin gewonnenem, mit Farbträgern verunreinigtem Styrol | |
| DE602005001551T2 (de) | Verfahren zur herstellung von alkylenoxid | |
| DE2254548C3 (de) | Verfahren zur Herstellung von Äthylphenolen und Acetaldehyd | |
| DE962788C (de) | Verfahren zur Herstellung von aromatischen Carbonsaeuren | |
| DE2828949C2 (enExample) | ||
| EP0211264A2 (de) | Verfahren zur Herstellung von aliphatischen Epoxiden | |
| DE10393950T5 (de) | Verfahren zur Herstellung von Carbonsäure | |
| AT232990B (de) | Verfahren zur Herstellung von neuen Diperoxyden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |