DE69823662T2 - 1,4,7,10-tetraazabicyclo(8.2.2)tetradecan-2-on, verfahren zu ihrer herstellung und ihrer verwendung für die herstellung von tetraazamacrocyclen - Google Patents
1,4,7,10-tetraazabicyclo(8.2.2)tetradecan-2-on, verfahren zu ihrer herstellung und ihrer verwendung für die herstellung von tetraazamacrocyclen Download PDFInfo
- Publication number
- DE69823662T2 DE69823662T2 DE69823662T DE69823662T DE69823662T2 DE 69823662 T2 DE69823662 T2 DE 69823662T2 DE 69823662 T DE69823662 T DE 69823662T DE 69823662 T DE69823662 T DE 69823662T DE 69823662 T2 DE69823662 T2 DE 69823662T2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- preparation
- tetraazacyclododecane
- methyl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- ICFKXBBBMCMHGK-UHFFFAOYSA-N 1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-9-one Chemical compound O=C1CNCCNCCN2CCN1CC2 ICFKXBBBMCMHGK-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 238000000034 method Methods 0.000 title claims description 83
- 238000004519 manufacturing process Methods 0.000 title description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 82
- 238000002360 preparation method Methods 0.000 claims abstract description 47
- 239000002168 alkylating agent Substances 0.000 claims description 38
- 229940100198 alkylating agent Drugs 0.000 claims description 38
- 230000015572 biosynthetic process Effects 0.000 claims description 37
- 238000003786 synthesis reaction Methods 0.000 claims description 34
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 30
- -1 phenyloxy Chemical group 0.000 claims description 28
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 18
- 238000006460 hydrolysis reaction Methods 0.000 claims description 18
- 230000007062 hydrolysis Effects 0.000 claims description 17
- 238000005804 alkylation reaction Methods 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- HHLZCENAOIROSL-UHFFFAOYSA-N 2-[4,7-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound OC(=O)CN1CCNCCN(CC(O)=O)CCN(CC(O)=O)CC1 HHLZCENAOIROSL-UHFFFAOYSA-N 0.000 claims description 13
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 12
- WDLRUFUQRNWCPK-UHFFFAOYSA-N Tetraxetan Chemical compound OC(=O)CN1CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1 WDLRUFUQRNWCPK-UHFFFAOYSA-N 0.000 claims description 11
- XUIUFWYNMIXKIG-UHFFFAOYSA-N 2-(11-oxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-7-yl)acetic acid Chemical compound C1CN(CC(=O)O)CCNCCN2CC(=O)N1CC2 XUIUFWYNMIXKIG-UHFFFAOYSA-N 0.000 claims description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 8
- 230000029936 alkylation Effects 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 8
- ZYBZVUZTVRRSHJ-UHFFFAOYSA-N 2-[4,7,10-tris(carboxymethyl)-6-(phenylmethoxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound C1N(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CCN(CC(O)=O)C1COCC1=CC=CC=C1 ZYBZVUZTVRRSHJ-UHFFFAOYSA-N 0.000 claims description 6
- SPSJFVXUOKRIGT-UHFFFAOYSA-N 2-[7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound OC(=O)CN1CCNCCN(CC(O)=O)CCNCC1 SPSJFVXUOKRIGT-UHFFFAOYSA-N 0.000 claims description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- XDLOGHYCUQYEKA-UHFFFAOYSA-N 2-(1,4,7,10-tetrazacyclododec-1-yl)acetic acid Chemical compound OC(=O)CN1CCNCCNCCNCC1 XDLOGHYCUQYEKA-UHFFFAOYSA-N 0.000 claims description 5
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 4
- 125000004054 acenaphthylenyl group Chemical group C1(=CC2=CC=CC3=CC=CC1=C23)* 0.000 claims description 4
- HXGDTGSAIMULJN-UHFFFAOYSA-N acetnaphthylene Natural products C1=CC(C=C2)=C3C2=CC=CC3=C1 HXGDTGSAIMULJN-UHFFFAOYSA-N 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 4
- QFRXJKWKEMQRCR-UHFFFAOYSA-N 2-[4,7-bis(1-carboxyethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid Chemical compound OC(=O)C(C)N1CCN(CC(O)=O)CCN(C(C)C(O)=O)CCN(C(C)C(O)=O)CC1 QFRXJKWKEMQRCR-UHFFFAOYSA-N 0.000 claims description 3
- KXCNAXRVYKJXRG-UHFFFAOYSA-N 2-[4-(carboxymethyl)-7,10-bis(1-carboxy-2-phenylmethoxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-3-phenylmethoxypropanoic acid Chemical compound C1CN(CC(=O)O)CCN(C(COCC=2C=CC=CC=2)C(O)=O)CCN(C(COCC=2C=CC=CC=2)C(O)=O)CCN1C(C(O)=O)COCC1=CC=CC=C1 KXCNAXRVYKJXRG-UHFFFAOYSA-N 0.000 claims description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- 239000012670 alkaline solution Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 239000000460 chlorine Chemical group 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000007810 chemical reaction solvent Substances 0.000 claims description 2
- 229910052801 chlorine Chemical group 0.000 claims description 2
- 150000007530 organic bases Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 claims description 2
- 150000005691 triesters Chemical class 0.000 claims description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 claims description 2
- YAQLSKVCTLCIIE-UHFFFAOYSA-M 2-bromobutanoate Chemical compound CCC(Br)C([O-])=O YAQLSKVCTLCIIE-UHFFFAOYSA-M 0.000 claims 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims 1
- 229940106681 chloroacetic acid Drugs 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 57
- 238000005481 NMR spectroscopy Methods 0.000 description 53
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- 239000000047 product Substances 0.000 description 40
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 28
- 238000001228 spectrum Methods 0.000 description 26
- 239000008367 deionised water Substances 0.000 description 15
- 229910021641 deionized water Inorganic materials 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 229960005141 piperazine Drugs 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 10
- 239000011347 resin Substances 0.000 description 10
- 229920005989 resin Polymers 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- DPNNNPAKRZOSMO-UHFFFAOYSA-K gadoteridol Chemical compound [Gd+3].CC(O)CN1CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC1 DPNNNPAKRZOSMO-UHFFFAOYSA-K 0.000 description 7
- 230000003068 static effect Effects 0.000 description 7
- ZPDFIIGFYAHNSK-CTHHTMFSSA-K 2-[4,10-bis(carboxylatomethyl)-7-[(2r,3s)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) Chemical compound [Gd+3].OC[C@@H](O)[C@@H](CO)N1CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC1 ZPDFIIGFYAHNSK-CTHHTMFSSA-K 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 229960003411 gadobutrol Drugs 0.000 description 6
- 229960005451 gadoteridol Drugs 0.000 description 6
- QBPPRVHXOZRESW-UHFFFAOYSA-N 1,4,7,10-tetraazacyclododecane Chemical compound C1CNCCNCCNCCN1 QBPPRVHXOZRESW-UHFFFAOYSA-N 0.000 description 5
- 229910052688 Gadolinium Inorganic materials 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 5
- 229920002125 Sokalan® Polymers 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 239000002872 contrast media Substances 0.000 description 4
- 150000002678 macrocyclic compounds Chemical class 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 0 CCCN(C)C*C Chemical compound CCCN(C)C*C 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003957 anion exchange resin Substances 0.000 description 3
- 229920001429 chelating resin Polymers 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 3
- 238000002595 magnetic resonance imaging Methods 0.000 description 3
- KBWIIBVKXVUCIV-UHFFFAOYSA-N methyl 2-bromo-3-phenylmethoxypropanoate Chemical compound COC(=O)C(Br)COCC1=CC=CC=C1 KBWIIBVKXVUCIV-UHFFFAOYSA-N 0.000 description 3
- 229920002717 polyvinylpyridine Polymers 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- DWUXICSBEIXBNB-UHFFFAOYSA-N 2-[4,7,10-tris(carboxymethyl)-6-(hydroxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound OCC1CN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CCN1CC(O)=O DWUXICSBEIXBNB-UHFFFAOYSA-N 0.000 description 2
- DJAXXIOUPXBMJT-UHFFFAOYSA-N 2-[4,7-bis(1-carboxy-2-hydroxyethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]-3-hydroxypropanoic acid Chemical compound OCC(C(O)=O)N1CCN(CC(O)=O)CCN(C(CO)C(O)=O)CCN(C(CO)C(O)=O)CC1 DJAXXIOUPXBMJT-UHFFFAOYSA-N 0.000 description 2
- YTDKKUIAFWNGDD-UHFFFAOYSA-N 2-[4,7-bis(carboxymethyl)-6-(phenylmethoxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound C1N(CC(O)=O)CCN(CC(=O)O)CCNCCN(CC(O)=O)C1COCC1=CC=CC=C1 YTDKKUIAFWNGDD-UHFFFAOYSA-N 0.000 description 2
- ITJXFYLVKSERKK-UHFFFAOYSA-N 2-[4-(carboxymethyl)-8-oxo-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical compound OC(=O)CN1CCNCC(=O)NCCN(CC(O)=O)CC1 ITJXFYLVKSERKK-UHFFFAOYSA-N 0.000 description 2
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000000921 Gadolinium Chemical class 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000003745 diagnosis Methods 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- OKHVSTSMWHWVMK-UHFFFAOYSA-K trisodium;2-[4,7-bis(carboxylatomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN1CCNCCN(CC([O-])=O)CCN(CC([O-])=O)CC1 OKHVSTSMWHWVMK-UHFFFAOYSA-K 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 1
- VSYYFHPZJKRUOV-UHFFFAOYSA-N 2-[4-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid Chemical class OC(=O)CN1CCNCCNCCN(CC(O)=O)CC1 VSYYFHPZJKRUOV-UHFFFAOYSA-N 0.000 description 1
- VKJQJNVYWGDEQN-UHFFFAOYSA-N 2-bromo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Br)COCC1=CC=CC=C1 VKJQJNVYWGDEQN-UHFFFAOYSA-N 0.000 description 1
- QEYBMJSQGBIRHS-UHFFFAOYSA-N 2-chloro-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Cl)COCC1=CC=CC=C1 QEYBMJSQGBIRHS-UHFFFAOYSA-N 0.000 description 1
- OZGUGVRKYBSDBN-UHFFFAOYSA-N 3-phenylmethoxypropanoic acid Chemical class OC(=O)CCOCC1=CC=CC=C1 OZGUGVRKYBSDBN-UHFFFAOYSA-N 0.000 description 1
- GEKNCWQQNMEIMS-UHFFFAOYSA-N 4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane Chemical compound C1OC(C)(C)OCC2OC21 GEKNCWQQNMEIMS-UHFFFAOYSA-N 0.000 description 1
- BDDLHHRCDSJVKV-UHFFFAOYSA-N 7028-40-2 Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O BDDLHHRCDSJVKV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- IQUHNCOJRJBMSU-UHFFFAOYSA-N H3HP-DO3A Chemical compound CC(O)CN1CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1 IQUHNCOJRJBMSU-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical group 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 229940039231 contrast media Drugs 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- RYHQMKVRYNEBNJ-BMWGJIJESA-K gadoterate meglumine Chemical compound [Gd+3].CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC(=O)CN1CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC1 RYHQMKVRYNEBNJ-BMWGJIJESA-K 0.000 description 1
- GFSTXYOTEVLASN-UHFFFAOYSA-K gadoteric acid Chemical compound [Gd+3].OC(=O)CN1CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC1 GFSTXYOTEVLASN-UHFFFAOYSA-K 0.000 description 1
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical class O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- NYYDZOSYLUOKEM-UHFFFAOYSA-N oxaldehyde;hydrate Chemical compound O.O=CC=O NYYDZOSYLUOKEM-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 229960003506 piperazine hexahydrate Drugs 0.000 description 1
- AVRVZRUEXIEGMP-UHFFFAOYSA-N piperazine;hexahydrate Chemical compound O.O.O.O.O.O.C1CNCCN1 AVRVZRUEXIEGMP-UHFFFAOYSA-N 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 235000020046 sherry Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT97MI001766A IT1293778B1 (it) | 1997-07-25 | 1997-07-25 | 1,4,7,10-tetraazabiciclo(8.2.2.)tetradecan-2 one, sua preparazione e suo uso per la preparazione di tetraazamacrocicli |
| ITMI971766 | 1997-07-25 | ||
| PCT/EP1998/004263 WO1999005145A1 (en) | 1997-07-25 | 1998-07-09 | 1,4,7,10-tetraazabicyclo[8.2.2]tetradecan-2-one, a process for the preparation thereof and the use thereof for the preparation of tetraazamacrocycles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69823662D1 DE69823662D1 (de) | 2004-06-09 |
| DE69823662T2 true DE69823662T2 (de) | 2005-04-28 |
Family
ID=11377626
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69823662T Expired - Lifetime DE69823662T2 (de) | 1997-07-25 | 1998-07-09 | 1,4,7,10-tetraazabicyclo(8.2.2)tetradecan-2-on, verfahren zu ihrer herstellung und ihrer verwendung für die herstellung von tetraazamacrocyclen |
Country Status (9)
| Country | Link |
|---|---|
| US (5) | US5977353A (enExample) |
| EP (1) | EP0998476B1 (enExample) |
| JP (1) | JP4386471B2 (enExample) |
| AT (1) | ATE266030T1 (enExample) |
| AU (1) | AU8974298A (enExample) |
| DE (1) | DE69823662T2 (enExample) |
| IN (1) | IN187722B (enExample) |
| IT (1) | IT1293778B1 (enExample) |
| WO (1) | WO1999005145A1 (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20050187126A1 (en) * | 2002-08-27 | 2005-08-25 | Busch Daryle H. | Catalysts and methods for catalytic oxidation |
| US20030017941A1 (en) * | 1997-03-07 | 2003-01-23 | The Procter & Gamble Company | Catalysts and methods for catalytic oxidation |
| US20080125344A1 (en) * | 2006-11-28 | 2008-05-29 | Daryle Hadley Busch | Bleach compositions |
| ZA981883B (en) * | 1997-03-07 | 1998-09-01 | Univ Kansas | Catalysts and methods for catalytic oxidation |
| TR199902673T2 (en) * | 1997-03-07 | 2000-04-21 | The Procter & Gamble Company | A�art�c� bile�imler. |
| IT1293778B1 (it) * | 1997-07-25 | 1999-03-10 | Bracco Spa | 1,4,7,10-tetraazabiciclo(8.2.2.)tetradecan-2 one, sua preparazione e suo uso per la preparazione di tetraazamacrocicli |
| IT1297035B1 (it) | 1997-12-30 | 1999-08-03 | Bracco Spa | Derivati dell'acido 1,4,7,10-tetraazaciclododecan-1,4-diacetico |
| DE10135356C1 (de) * | 2001-07-20 | 2003-04-17 | Schering Ag | Makrocyclische Metallkomplexe und deren Verwendung zur Herstellung von Konjugaten mit Biomolekülen |
| EP1302465A1 (en) * | 2001-10-11 | 2003-04-16 | BRACCO IMAGING S.p.A. | Enhanced substrate imaging by reversible binding to a paramagnetic complex |
| RU2224755C2 (ru) * | 2002-04-08 | 2004-02-27 | Институт органической химии Уфимского научного центра РАН | Способ получения циклокарботиальдегидов |
| US20040048763A1 (en) * | 2002-08-27 | 2004-03-11 | The Procter & Gamble Co. | Bleach compositions |
| DE102009053171B4 (de) | 2009-11-04 | 2011-07-21 | Bayer Schering Pharma Aktiengesellschaft, 13353 | Verfahren zur Herstellung des Calcium-Komplexes von Dihydroxy-hydroxy-methylpropyl-tetraazacyclododecan-triessigsäure (Calcobutrol) |
| KR101253100B1 (ko) * | 2010-02-16 | 2013-04-10 | 경북대학교 산학협력단 | 폴리아자마크로사이클릭 화합물, 그 제조 방법 및 생의학적 적용 |
| KR101971435B1 (ko) | 2017-08-29 | 2019-04-24 | 주식회사 엔지켐생명과학 | 가도부트롤 중간체 및 이를 이용한 가도부트롤의 제조 방법 |
| CN112574131B (zh) * | 2019-09-30 | 2022-11-01 | 威智医药有限公司 | 一种dota的纯化方法 |
| CN114573521B (zh) * | 2020-12-01 | 2023-10-27 | 威智医药股份有限公司 | 一种钆布醇及其中间体的制备方法 |
| ES3041702T3 (en) * | 2020-12-04 | 2025-11-13 | Bracco Imaging Spa | Manufacturing process for preparing gadoteridol |
| EP4059925A1 (en) | 2021-03-15 | 2022-09-21 | Bayer Aktiengesellschaft | New contrast agent for use in magnetic resonance imaging |
| CN113880850B (zh) * | 2021-10-18 | 2022-10-04 | 苏州百灵威超精细材料有限公司 | 一种钆布醇中间体及制备方法和在制备钆布醇中的应用 |
| EP4335462A1 (en) | 2022-09-09 | 2024-03-13 | Bayer AG | Contrast agents for use in diagnostic computed tomography imaging |
| EP4335840A1 (en) | 2022-09-09 | 2024-03-13 | Bayer Aktiengesellschaft | New contrast agents for use in diagnostic imaging |
| CN116217504A (zh) * | 2023-02-07 | 2023-06-06 | 赣州康瑞泰药业有限公司 | 一种大环二羧酸化合物的合成方法 |
| WO2025087229A1 (zh) * | 2023-10-27 | 2025-05-01 | 四川科伦博泰生物医药股份有限公司 | 一类喹啉结构的配体化合物及其放射性或非放射性标记物以及应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1224416B (it) * | 1987-12-24 | 1990-10-04 | Bracco Ind Chimica Spa | Chelanti macrociclici e loro chelati |
| US5539105A (en) * | 1990-08-29 | 1996-07-23 | Dibra S.P.A. | Intermediates for chelating agents with prefixed symmetry and process for their preparation |
| US5587451A (en) * | 1993-11-26 | 1996-12-24 | The Dow Chemical Company | Process for preparing polyazamacrocycles |
| GB9504922D0 (en) * | 1995-03-10 | 1995-04-26 | Nycomed As | Process |
| IT1291673B1 (it) * | 1997-04-28 | 1999-01-19 | Bracco Spa | Processo per la preparazione di 1,4,7,10 - tetraazaciclododecano |
| IT1293778B1 (it) * | 1997-07-25 | 1999-03-10 | Bracco Spa | 1,4,7,10-tetraazabiciclo(8.2.2.)tetradecan-2 one, sua preparazione e suo uso per la preparazione di tetraazamacrocicli |
-
1997
- 1997-07-25 IT IT97MI001766A patent/IT1293778B1/it active IP Right Grant
-
1998
- 1998-07-09 DE DE69823662T patent/DE69823662T2/de not_active Expired - Lifetime
- 1998-07-09 EP EP98941307A patent/EP0998476B1/en not_active Expired - Lifetime
- 1998-07-09 AT AT98941307T patent/ATE266030T1/de not_active IP Right Cessation
- 1998-07-09 AU AU89742/98A patent/AU8974298A/en not_active Abandoned
- 1998-07-09 WO PCT/EP1998/004263 patent/WO1999005145A1/en not_active Ceased
- 1998-07-09 JP JP50923899A patent/JP4386471B2/ja not_active Expired - Lifetime
- 1998-07-23 IN IN1646MA1998 patent/IN187722B/en unknown
- 1998-07-23 US US09/121,673 patent/US5977353A/en not_active Expired - Lifetime
-
1999
- 1999-07-28 US US09/362,184 patent/US6020485A/en not_active Expired - Lifetime
- 1999-07-28 US US09/362,186 patent/US6162912A/en not_active Expired - Lifetime
- 1999-07-28 US US09/362,183 patent/US6048980A/en not_active Expired - Lifetime
- 1999-07-28 US US09/362,185 patent/US6028194A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US6020485A (en) | 2000-02-01 |
| DE69823662D1 (de) | 2004-06-09 |
| IN187722B (enExample) | 2002-06-15 |
| WO1999005145A1 (en) | 1999-02-04 |
| AU8974298A (en) | 1999-02-16 |
| EP0998476B1 (en) | 2004-05-06 |
| ITMI971766A1 (it) | 1999-01-25 |
| US6028194A (en) | 2000-02-22 |
| JP4386471B2 (ja) | 2009-12-16 |
| JP2002511884A (ja) | 2002-04-16 |
| ATE266030T1 (de) | 2004-05-15 |
| IT1293778B1 (it) | 1999-03-10 |
| US5977353A (en) | 1999-11-02 |
| EP0998476A1 (en) | 2000-05-10 |
| US6162912A (en) | 2000-12-19 |
| US6048980A (en) | 2000-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69823662T2 (de) | 1,4,7,10-tetraazabicyclo(8.2.2)tetradecan-2-on, verfahren zu ihrer herstellung und ihrer verwendung für die herstellung von tetraazamacrocyclen | |
| DE69807558T2 (de) | Chelatkomplexe paramagnetischer Metalle mit niedriger Toxizität | |
| US5880281A (en) | Process for the preparation of tetraazamacrocycles | |
| DE19724186C2 (de) | Verfahren zur Mono- und 1,7-Bis-N-ß-Hydroxyalkylierung von Cyclen und die entsprechenden N-ß-Hydroxyalkyl-1,4,7,10-tetraazacyclododecan-Li-Salz-Komplexe | |
| DE2011376A1 (de) | Cephalosporinverbindungen | |
| DE10064467C2 (de) | Lithium-Komplexe von N-(1-Hydroxymethyl-2,3-dihydroxypropyl)-1,4,7-triscarboxymethyl-1,4,7,10-tetraazacyclododecan, deren Herstellung und Verwendung | |
| DE69808086T2 (de) | Ein verfahren zur herstellung von 1,4,7,10-tetraazacyclododecan-1,4,7-triessigsäure und deren derivaten | |
| DE69830931T2 (de) | Verfahren zur Herstellung von 1,4,7,10-Tetraazadodecan-1,4-Diessigsäurederivaten | |
| DE1906527C3 (de) | Thioninderivate, Verfahren zu deren Herstellung und pharmazeutische Präparate, welche diese enthalten | |
| DE69808771T2 (de) | Ein verfahren zur herstellung von tetraaza makrocyclen | |
| DE69837219T2 (de) | 1,4,7,10-tetraazacyclododecan-1,4-diessigsäure | |
| DE1695929B2 (de) | 1,2-dihydro-1-hydroxy-2-imino-4-amino- 6-methylpyrimidine sowie ein verfahren zu deren herstellung | |
| DE69806368T2 (de) | Verfahren zur herstellung von tetraazamakrozyklen | |
| EP1115726B1 (de) | Verfahren zur herstellung von metalloporphyrin-metallkomplex-konjugaten | |
| CH507966A (de) | Verfahren zur Herstellung von Benzodiazepinderivaten | |
| DE1770421C3 (de) | Verfahren zur Herstellung von 1,3-Dihydro-2H-1,4-benzodiazepin-2-onderivaten | |
| AT323154B (de) | Verfahren zur herstellung von neuen 5-methoxy-2-methylindol-3-essigsäurederivaten sowie von deren salzen | |
| DE1795771C3 (de) | 1 -Cyclopropylmethyl-S- (o-halogenphenyl) -7-chlor-1,3-dihydro-2H-1,4-benzodiazepin-2-one | |
| CH621550A5 (enExample) | ||
| DE1817761C3 (de) | 2-Aminomethyl-3-phenyl-5-nitroindole und ihre Salze | |
| DE2510528A1 (de) | Benzimidazo-/1,2-a/-chinoline und verfahren zu ihrer herstellung | |
| DE4320307A1 (de) | Neue Eisenkomplexe | |
| DE1795771B2 (de) | 1-cyclopropyl-5-(o-halogenphenyl)- 7-clor-1,3-dihydro-2h-1,4-benzodiazepin- 2-one | |
| CH511872A (de) | Verfahren zur Herstellung neuer 1-substituierter-1H-1,2,8,9-Tetraazaphenalene und ihrer Säureadditionssalze | |
| DE1493567B2 (de) | Ester von alpha-Alkylthyroxinderivaten und Verfahren zu ihrer Herstellu ng |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |