DE696346C - Schaedlingsbekaempfung - Google Patents
SchaedlingsbekaempfungInfo
- Publication number
- DE696346C DE696346C DE1936I0054711 DEI0054711D DE696346C DE 696346 C DE696346 C DE 696346C DE 1936I0054711 DE1936I0054711 DE 1936I0054711 DE I0054711 D DEI0054711 D DE I0054711D DE 696346 C DE696346 C DE 696346C
- Authority
- DE
- Germany
- Prior art keywords
- pest control
- grain
- ester
- chlorine
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241000607479 Yersinia pestis Species 0.000 title claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 2
- 235000013339 cereals Nutrition 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000575 pesticide Substances 0.000 description 4
- 241000131102 Oryzaephilus Species 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000003673 urethanes Chemical class 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- -1 Dimethyl carbamine Chemical compound 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- TXTORVZCRUFBBO-UHFFFAOYSA-N 2,3-dichloro-2-methylbutane Chemical compound CC(Cl)C(C)(C)Cl TXTORVZCRUFBBO-UHFFFAOYSA-N 0.000 description 1
- FNVAEFVHQJTJGD-UHFFFAOYSA-N 2-chloro-n-(diaminomethylidene)acetamide Chemical compound NC(N)=NC(=O)CCl FNVAEFVHQJTJGD-UHFFFAOYSA-N 0.000 description 1
- 241000378106 Amianthium muscitoxicum Species 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 150000007945 N-acyl ureas Chemical class 0.000 description 1
- 244000089486 Phragmites australis subsp australis Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 241000318997 Rhyzopertha dominica Species 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229940120124 dichloroacetate Drugs 0.000 description 1
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WMKXMEBGSGFRMT-UHFFFAOYSA-N ethyl n-(2-chloroacetyl)carbamate Chemical compound CCOC(=O)NC(=O)CCl WMKXMEBGSGFRMT-UHFFFAOYSA-N 0.000 description 1
- WCDTZLLEUPBYJA-UHFFFAOYSA-N ethyl n-(2-oxopropyl)carbamate Chemical compound CCOC(=O)NCC(C)=O WCDTZLLEUPBYJA-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SURZCVYFPAXNGN-UHFFFAOYSA-N methyl-carbamic acid ethyl ester Chemical compound CCOC(=O)NC SURZCVYFPAXNGN-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL46177D NL46177C (Direct) | 1936-04-05 | ||
| DE1936I0054711 DE696346C (de) | 1936-04-05 | 1936-04-05 | Schaedlingsbekaempfung |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1936I0054711 DE696346C (de) | 1936-04-05 | 1936-04-05 | Schaedlingsbekaempfung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE696346C true DE696346C (de) | 1940-09-19 |
Family
ID=7193947
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1936I0054711 Expired DE696346C (de) | 1936-04-05 | 1936-04-05 | Schaedlingsbekaempfung |
Country Status (2)
| Country | Link |
|---|---|
| DE (1) | DE696346C (Direct) |
| NL (1) | NL46177C (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4919708A (en) * | 1983-10-13 | 1990-04-24 | Fmc Corporation | Haloalkyl triazolinones and herbicidal use thereof |
-
0
- NL NL46177D patent/NL46177C/xx active
-
1936
- 1936-04-05 DE DE1936I0054711 patent/DE696346C/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4919708A (en) * | 1983-10-13 | 1990-04-24 | Fmc Corporation | Haloalkyl triazolinones and herbicidal use thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| NL46177C (Direct) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695269C3 (de) | 2-Dialkylamino-4-pyrimidinylcarbamate, Verfahren zur Herstellung derselben sowie sie enthaltende Schädlingsbekämpfungsmittel | |
| DE2365948C3 (de) | Insektizides Mittel auf Semicarbazid-Basis | |
| DE696346C (de) | Schaedlingsbekaempfung | |
| DE2625808A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1150548B (de) | Insektizide Mittel | |
| DE1792331C3 (de) | Insektizide synergistische Gemische. Ausscheidung aus: 1300725 | |
| DE1171200B (de) | Insektizide synergistische Gemische | |
| DE2041732A1 (de) | Acylierte Arylhydrazino-2-imidazoline,Verfahren zu ihrer Herstellung und ihre Verwendung als Ektoparasitizide | |
| DE1214928B (de) | Verwendung von [Bis-phenyl-(1', 1')-acetyl]-(2)-indandionen-(1, 3) als Rodenticide | |
| DE962124C (de) | Insektenbekaempfungsmittel | |
| DE1094036B (de) | Mittel zur Bekaempfung von Nematoden | |
| DE892093C (de) | Insektentötendes Mittel | |
| DE2512940C2 (de) | N-Benzoyl-N-halogenphenyl-2-aminopropionsäure-ester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE881884C (de) | Schaedlingsbekaempfungsmittel | |
| DE903286C (de) | Insektentoetendes Mittel | |
| DE2132210B2 (de) | Verfahren zur Bekämpfung phytopathogener Organismen | |
| AT220887B (de) | Schädlingsbekämpfungsmittel | |
| DE753828C (de) | Bekaempfung pflanzenschaedigender Insekten | |
| DE891766C (de) | Bekaempfung tierischer Schaedlinge, insbesondere Insekten | |
| DE970759C (de) | Bekaempfung von tierischen Schaedlingen | |
| DE871982C (de) | Bekaempfung tierischer Schaedlinge, insbesondere von Insekten, durch Begasung | |
| CH194377A (de) | Verfahren zur Schädlingsbekämpfung. | |
| DE1542953C3 (de) | Verwendung von Diphenylcyclopropan -Derivaten als Insekticide | |
| DE1136869B (de) | Mittel zur Bekaempfung von Ectoparasiten an Haustieren | |
| DE1032967B (de) | Insekten-, insbesondere Fliegenbekaempfungsmittel |