DE573105C - Verfahren zum Stabilisieren von niedrigmolekularen chlorierten Kohlenwasserstoffen - Google Patents
Verfahren zum Stabilisieren von niedrigmolekularen chlorierten KohlenwasserstoffenInfo
- Publication number
- DE573105C DE573105C DER84259D DER0084259D DE573105C DE 573105 C DE573105 C DE 573105C DE R84259 D DER84259 D DE R84259D DE R0084259 D DER0084259 D DE R0084259D DE 573105 C DE573105 C DE 573105C
- Authority
- DE
- Germany
- Prior art keywords
- trichlorethylene
- none
- tetrachloroethane
- methylene chloride
- perchlorethylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims 3
- 230000000087 stabilizing effect Effects 0.000 title claims 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 12
- -1 dichloroethylene, Trichlorethylene, perchlorethylene Chemical group 0.000 claims description 11
- 239000003381 stabilizer Substances 0.000 claims description 10
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 8
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims description 8
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 claims description 8
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 claims description 8
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 claims description 6
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 claims description 6
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 6
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000005844 Thymol Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 claims description 4
- 229960000790 thymol Drugs 0.000 claims description 4
- 230000000694 effects Effects 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 229940079877 pyrogallol Drugs 0.000 claims description 3
- 230000006641 stabilisation Effects 0.000 claims description 3
- 238000011105 stabilization Methods 0.000 claims description 3
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 claims description 2
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 229930003836 cresol Natural products 0.000 claims description 2
- 229960004337 hydroquinone Drugs 0.000 claims description 2
- 229960001755 resorcinol Drugs 0.000 claims description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 claims 12
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 claims 5
- 229950011008 tetrachloroethylene Drugs 0.000 claims 5
- OWRCNXZUPFZXOS-UHFFFAOYSA-N 1,3-diphenylguanidine Chemical compound C=1C=CC=CC=1NC(=N)NC1=CC=CC=C1 OWRCNXZUPFZXOS-UHFFFAOYSA-N 0.000 claims 2
- KFUSEUYYWQURPO-UHFFFAOYSA-N 1,2-dichloroethene Chemical group ClC=CCl KFUSEUYYWQURPO-UHFFFAOYSA-N 0.000 claims 1
- NTXKBEUECOMNMM-UHFFFAOYSA-N 1,2-dichloroethene Chemical group ClC=CCl.ClC=CCl NTXKBEUECOMNMM-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- YUCABJALCRQGQF-UHFFFAOYSA-N aniline 1,2-diphenylguanidine Chemical compound C1(=CC=CC=C1)NC(NC1=CC=CC=C1)=N.NC1=CC=CC=C1 YUCABJALCRQGQF-UHFFFAOYSA-N 0.000 claims 1
- LMCWXDJGYRPKHN-UHFFFAOYSA-N benzene-1,4-diol;dichloromethane Chemical compound ClCCl.OC1=CC=C(O)C=C1 LMCWXDJGYRPKHN-UHFFFAOYSA-N 0.000 claims 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/38—Separation; Purification; Stabilisation; Use of additives
- C07C17/42—Use of additives, e.g. for stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US519894A US1904450A (en) | 1931-03-03 | 1931-03-03 | Stabilization of halogenated hydrocarbons |
| US519896A US2008680A (en) | 1931-03-03 | 1931-03-03 | Stabilization of halogenated hydrocarbons |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE573105C true DE573105C (de) | 1933-03-29 |
Family
ID=27059988
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER84259D Expired DE573105C (de) | 1931-03-03 | 1932-03-03 | Verfahren zum Stabilisieren von niedrigmolekularen chlorierten Kohlenwasserstoffen |
| DER84258D Expired DE562820C (de) | 1931-03-03 | 1932-03-03 | Verfahren zum Stabilisieren von niedrigmolekularen chlorierten Kohlenwasserstoffen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER84258D Expired DE562820C (de) | 1931-03-03 | 1932-03-03 | Verfahren zum Stabilisieren von niedrigmolekularen chlorierten Kohlenwasserstoffen |
Country Status (5)
| Country | Link |
|---|---|
| US (2) | US1904450A (OSRAM) |
| BE (1) | BE386905A (OSRAM) |
| DE (2) | DE573105C (OSRAM) |
| FR (1) | FR732569A (OSRAM) |
| GB (1) | GB397915A (OSRAM) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1038035B (de) * | 1953-09-25 | 1958-09-04 | Diamond Alkali Co | Stabilisierung von technischem Tetrachloraethylen |
| DE1041034B (de) * | 1954-07-26 | 1958-10-16 | Diamond Alkali Co | Stabilisatoren fuer niedrigmolekulare aliphatische Chlorkohlenwasserstoffe gegen Zersetzung |
| DE1041035B (de) * | 1954-07-26 | 1958-10-16 | Diamond Alkali Co | Stabilisatoren fuer niedrigmolekulare aliphatische Chlorkohlenwasserstoffe gegen Zersetzung |
| DE1057099B (de) * | 1955-06-16 | 1959-05-14 | Columbia Southern Chem Corp | Stabilisiertes, einen halogenierten aliphatischen Kohlenwasserstoff mit bis zu 3 Kohlenstoffatomen enthaltendes Loesungsmittel |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3000977A (en) * | 1961-09-19 | Method of stabilizing trichloroethyl- | ||
| US2421035A (en) * | 1942-06-10 | 1947-05-27 | Bell Telephone Labor Inc | Composition for and method of extinguishing fires |
| US2426549A (en) * | 1943-09-10 | 1947-08-26 | Sun Oil Co | Lubricant composition |
| US2525473A (en) * | 1945-06-16 | 1950-10-10 | Westinghouse Electric Corp | Dielectric |
| US2432806A (en) * | 1945-11-26 | 1947-12-16 | Gulf Research Development Co | Petroleum oil compositions |
| US2432807A (en) * | 1945-11-26 | 1947-12-16 | Gulf Research Development Co | Petroleum oil compositions |
| US2548636A (en) * | 1946-05-29 | 1951-04-10 | Hawley Products Co | Stabilized cuprammonium hydroxide solution and method of preparing the same |
| US2947792A (en) * | 1954-02-16 | 1960-08-02 | Diamond Alkali Co | Stabilization of tetrachloroethylene with a mixture of a hydroxy alkyne and isoeugenol |
| US2751421A (en) * | 1954-02-18 | 1956-06-19 | Du Pont | Stabilization of trichloroethylene |
| US3031412A (en) * | 1954-07-23 | 1962-04-24 | Detrex Chem Ind | Composition and method of inhibiting corrosion of ferrous metals by aminestabilized chlorinated hydrocarbons |
| US2945895A (en) * | 1956-02-08 | 1960-07-19 | Air Reduction | Stabilization of chlorinated hydrocarbons with a synergistic combination of a tertiary acetylenic monohydric alcohol and 2, 6-di-tert-butyl-paracresol |
| US2911449A (en) * | 1956-02-08 | 1959-11-03 | Air Reduction | Stabilization of chlorinated hydrocarbons with a synergistic combination of a tertiary acetylenic monohydric alcohol and certain phenolic compounds |
| US2906782A (en) * | 1956-12-21 | 1959-09-29 | Sicedison Spa | Stabilization of the trichloroethylene and stabilizing product therefor |
| US2959556A (en) * | 1957-12-05 | 1960-11-08 | Dow Chemical Co | Halogenated hydrocarbons inhibited with organic peroxides |
| US3002029A (en) * | 1959-03-26 | 1961-09-26 | Phillips Petroleum Co | Stabilizer for bromo-substituted acetylenic compounds |
| US3029297A (en) * | 1960-04-07 | 1962-04-10 | Frontier Chemical Company | Stabilization of chlorinated hydrocarbons |
| US3099694A (en) * | 1960-05-27 | 1963-07-30 | Ethyl Corp | Stable methylchloroform compositions |
| US3113154A (en) * | 1960-05-27 | 1963-12-03 | Ethyl Corp | Stable methylchloroform compositions |
| US3092981A (en) * | 1960-07-15 | 1963-06-11 | Gen Motors Corp | Refrigeration apparatus |
| US3228806A (en) * | 1961-08-04 | 1966-01-11 | Du Pont | Stabilization of chlorohydrocarbons in phosphoric acid coating baths |
| DE1215136B (de) * | 1961-10-12 | 1966-04-28 | Vulcan Materials Co | Stabilisierung von Di-, Tri- und Tetrachlor-aethylen sowie anderen niederen aliphatischen Chlorkohlenwasserstoffen und deren Gemischen |
| US3297495A (en) * | 1962-11-29 | 1967-01-10 | Hooker Chemical Corp | Process and composition for phosphatizing metals |
| NL287499A (OSRAM) * | 1962-01-10 | |||
| NL300188A (OSRAM) * | 1962-11-13 | |||
| US3230175A (en) * | 1963-04-01 | 1966-01-18 | Du Pont | Stabilized trichloroethylene and a process for treating metals therewith |
| US3314884A (en) * | 1964-01-02 | 1967-04-18 | Mobil Oil Corp | Fuels and lubricants containing inclusion compounds |
| JPS4816486B1 (OSRAM) * | 1967-08-16 | 1973-05-22 | ||
| GB1288565A (OSRAM) * | 1969-03-24 | 1972-09-13 | ||
| US3657120A (en) * | 1970-03-23 | 1972-04-18 | Feuerloschgeratewerk Neuruppin | Method of stabilizing bromine-containing fire extinguishing halogenated hydrocarbon composition |
| CA1049568A (en) * | 1973-02-23 | 1979-02-27 | Norman L. Beckers | Stabilized methylene chloride |
| US3898195A (en) * | 1973-02-23 | 1975-08-05 | Diamond Shamrock Corp | Stabilized methylene chloride composition |
| CA1049567A (en) * | 1973-02-23 | 1979-02-27 | Diamond Shamrock Corporation | Inhibition of aromatic compound degradation of methylene chloride |
| US4032584A (en) * | 1976-05-03 | 1977-06-28 | Stauffer Chemical Company | Stabilized methylene chloride |
| FR2408642A1 (fr) * | 1977-10-24 | 1979-06-08 | Solvay | Procede pour la stabilisation du chlorure de methylene et compositions contenant le chlorure de methylene ainsi stabilise |
| BE1005713A3 (fr) * | 1992-03-02 | 1993-12-28 | Solvay | Procede de stabilisation d'un hydrofluoroalcane et compositions comprenant au moins un hydrofluoroalcane. |
| US6534688B2 (en) * | 2001-06-11 | 2003-03-18 | Vulcan Chemicals | Dehydrochlorination stabilization of polychlorinated alkanes |
| JP2014221727A (ja) * | 2013-05-13 | 2014-11-27 | 昭和電工株式会社 | ジクロロメタンの精製方法およびそれを用いるジフルオロメタンの製造方法 |
| CN108884422A (zh) | 2016-01-15 | 2018-11-23 | Agc株式会社 | 溶剂组合物、清洗方法、涂膜的形成方法、热传导介质和热循环系统 |
-
1931
- 1931-03-03 US US519894A patent/US1904450A/en not_active Expired - Lifetime
- 1931-03-03 US US519896A patent/US2008680A/en not_active Expired - Lifetime
-
1932
- 1932-03-02 FR FR732569D patent/FR732569A/fr not_active Expired
- 1932-03-03 GB GB6435/32A patent/GB397915A/en not_active Expired
- 1932-03-03 DE DER84259D patent/DE573105C/de not_active Expired
- 1932-03-03 BE BE386905D patent/BE386905A/xx unknown
- 1932-03-03 DE DER84258D patent/DE562820C/de not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1038035B (de) * | 1953-09-25 | 1958-09-04 | Diamond Alkali Co | Stabilisierung von technischem Tetrachloraethylen |
| DE1041034B (de) * | 1954-07-26 | 1958-10-16 | Diamond Alkali Co | Stabilisatoren fuer niedrigmolekulare aliphatische Chlorkohlenwasserstoffe gegen Zersetzung |
| DE1041035B (de) * | 1954-07-26 | 1958-10-16 | Diamond Alkali Co | Stabilisatoren fuer niedrigmolekulare aliphatische Chlorkohlenwasserstoffe gegen Zersetzung |
| DE1057099B (de) * | 1955-06-16 | 1959-05-14 | Columbia Southern Chem Corp | Stabilisiertes, einen halogenierten aliphatischen Kohlenwasserstoff mit bis zu 3 Kohlenstoffatomen enthaltendes Loesungsmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| GB397915A (en) | 1933-09-04 |
| DE562820C (de) | 1932-10-29 |
| US2008680A (en) | 1935-07-23 |
| FR732569A (fr) | 1932-09-22 |
| BE386905A (OSRAM) | 1932-04-30 |
| US1904450A (en) | 1933-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE573105C (de) | Verfahren zum Stabilisieren von niedrigmolekularen chlorierten Kohlenwasserstoffen | |
| DE921775C (de) | Verfahren zur Herabsetzung der Oxydationsgeschwindigkeit von vulkanisiertem Kautschuk | |
| DE2449667C3 (de) | Stabilisiertes Perchloräthylen | |
| DE1593396A1 (de) | Verfahren zum Stabilisieren von halogenierten Kohlenwasserstoffen,insbesondere chlorierten aliphatischen Kohlenwasserstoffen | |
| DE961917C (de) | Isolieroel | |
| DE1942877B2 (de) | Ozonschutzmittel für Kautschuk | |
| DE1115732B (de) | Stabilisierung von Trichloraethylen, Perchloraethylen und aehnlichen aliphatischen Chlorkohlenwasserstoffen gegen Zersetzung | |
| DE2417703A1 (de) | Verfahren zum reinigen von rohem pentachlorphenol durch destillation | |
| DE525534C (de) | Verfahren zum Entwickeln von Chromat-Schellackkopien | |
| DE1900308A1 (de) | Stabilisierte Polyamine | |
| DE649118C (de) | Verfahren zum Haltbarmachen von niedrigmolekularen chlorierten Kohlenwasserstoffen | |
| AT124281B (de) | Verfahren zur Darstellung C-alkylsubstituierter Phenole. | |
| DE2543650C2 (de) | Verwendung von Phenolaminharzen für die Stabilisierung von Kautschuken und Vulkanisaten | |
| DE562942C (de) | Verfahren zum Haltbarmachen von Kautschuk und Kautschukmischungen | |
| DE1028580B (de) | Verfahren zum Stabilisieren von Polyalkylphenolen gegen Farb- und Geruchsverschterung | |
| DE293496C (OSRAM) | ||
| DE615529C (de) | Verfahren zur Reinigung von Teerphenolen | |
| AT133328B (de) | Verfahren zum Vulkanisieren von Kautschuk. | |
| DE1258404B (de) | Stabilisierung von Trichlor- und Perchloraethylen | |
| DE878849C (de) | Stabilisiermittel fuer synthetische kautschukaehnliche Massen | |
| DE1220410B (de) | Stabilisierung von Trichloraethylen und Perchloraethylen | |
| DE932487C (de) | Verfahren zur zeitweisen Stabilisation von Styrol gegen Polymerisation unter Zusatz von Stabilisatoren | |
| DE709652C (de) | Verfahren zur Herstellung eines Staerkeproduktes aus Kartoffelstaerke | |
| AT155965B (de) | Verfahren zur Herstellung von Netzmitteln für Mercerisierlaugen. | |
| DE593048C (de) | Verfahren zur Erhoehung der Netzfaehigkeit von Mercerisierlaugen |