DE3423441A1 - Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung - Google Patents
Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterungInfo
- Publication number
- DE3423441A1 DE3423441A1 DE19843423441 DE3423441A DE3423441A1 DE 3423441 A1 DE3423441 A1 DE 3423441A1 DE 19843423441 DE19843423441 DE 19843423441 DE 3423441 A DE3423441 A DE 3423441A DE 3423441 A1 DE3423441 A1 DE 3423441A1
- Authority
- DE
- Germany
- Prior art keywords
- alcohols
- calcium oxide
- transesterification
- acrylic
- lithium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 20
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 title claims description 15
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001298 alcohols Chemical class 0.000 claims description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 27
- 238000005809 transesterification reaction Methods 0.000 claims description 26
- 239000000292 calcium oxide Substances 0.000 claims description 25
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 25
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 150000002148 esters Chemical class 0.000 claims description 22
- 239000003054 catalyst Substances 0.000 claims description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 14
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims description 14
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 11
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 6
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 claims description 6
- JILPJDVXYVTZDQ-UHFFFAOYSA-N lithium methoxide Chemical compound [Li+].[O-]C JILPJDVXYVTZDQ-UHFFFAOYSA-N 0.000 claims description 5
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 4
- 150000004703 alkoxides Chemical class 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 claims description 4
- FUJCRWPEOMXPAD-UHFFFAOYSA-N lithium oxide Chemical compound [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 claims description 4
- 229910001947 lithium oxide Inorganic materials 0.000 claims description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 claims description 3
- 239000001110 calcium chloride Substances 0.000 claims description 3
- 229910001628 calcium chloride Inorganic materials 0.000 claims description 3
- 150000005846 sugar alcohols Polymers 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 125000000129 anionic group Chemical group 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- XIXADJRWDQXREU-UHFFFAOYSA-M lithium acetate Chemical compound [Li+].CC([O-])=O XIXADJRWDQXREU-UHFFFAOYSA-M 0.000 claims description 2
- XQHAGELNRSUUGU-UHFFFAOYSA-M lithium chlorate Chemical compound [Li+].[O-]Cl(=O)=O XQHAGELNRSUUGU-UHFFFAOYSA-M 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- 230000035484 reaction time Effects 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 125000005395 methacrylic acid group Chemical group 0.000 claims 2
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 claims 1
- 229940126062 Compound A Drugs 0.000 claims 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 235000019441 ethanol Nutrition 0.000 description 38
- -1 lithium hydride Chemical class 0.000 description 31
- 238000006243 chemical reaction Methods 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- VAJVDSVGBWFCLW-UHFFFAOYSA-N 3-Phenyl-1-propanol Chemical compound OCCCC1=CC=CC=C1 VAJVDSVGBWFCLW-UHFFFAOYSA-N 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- ZXCYIJGIGSDJQQ-UHFFFAOYSA-N 2,3-dichloropropan-1-ol Chemical compound OCC(Cl)CCl ZXCYIJGIGSDJQQ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- UNTIPIHLGPZDJW-UHFFFAOYSA-N 2-[2-(carbamoylamino)ethenoxy]ethenylurea Chemical compound NC(=O)NC=COC=CNC(N)=O UNTIPIHLGPZDJW-UHFFFAOYSA-N 0.000 description 1
- VUIWJRYTWUGOOF-UHFFFAOYSA-N 2-ethenoxyethanol Chemical compound OCCOC=C VUIWJRYTWUGOOF-UHFFFAOYSA-N 0.000 description 1
- HXDLWJWIAHWIKI-UHFFFAOYSA-N 2-hydroxyethyl acetate Chemical compound CC(=O)OCCO HXDLWJWIAHWIKI-UHFFFAOYSA-N 0.000 description 1
- OQYFUJBHUFYBFI-UHFFFAOYSA-N 2-methyl-1,3-dioxolan-2-ol Chemical compound CC1(O)OCCO1 OQYFUJBHUFYBFI-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PNDHGPGRKJZCGM-UHFFFAOYSA-M C([O-])(O)=O.[Li+].[O-2].[Ca+2] Chemical compound C([O-])(O)=O.[Li+].[O-2].[Ca+2] PNDHGPGRKJZCGM-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 241000640882 Condea Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- DTGKSKDOIYIVQL-MRTMQBJTSA-N Isoborneol Natural products C1C[C@@]2(C)[C@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-MRTMQBJTSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical class CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical class CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- GQCWURKKJXGABF-UHFFFAOYSA-M [Br-].[Li+].[O-2].[Ca+2] Chemical compound [Br-].[Li+].[O-2].[Ca+2] GQCWURKKJXGABF-UHFFFAOYSA-M 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- NXKLFHRHWLTMLX-UHFFFAOYSA-N [Ca+2].[O-2].[Li+] Chemical compound [Ca+2].[O-2].[Li+] NXKLFHRHWLTMLX-UHFFFAOYSA-N 0.000 description 1
- JAAJAZALCAXTTI-UHFFFAOYSA-M [OH-].[Li+].[O-2].[Ca+2] Chemical compound [OH-].[Li+].[O-2].[Ca+2] JAAJAZALCAXTTI-UHFFFAOYSA-M 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- CKDOCTFBFTVPSN-UHFFFAOYSA-N borneol Natural products C1CC2(C)C(C)CC1C2(C)C CKDOCTFBFTVPSN-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical class [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- HMENXRMTPPSVSM-UHFFFAOYSA-M calcium lithium oxygen(2-) acetate Chemical compound C(C)(=O)[O-].[Li+].[O-2].[Ca+2] HMENXRMTPPSVSM-UHFFFAOYSA-M 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- FHADSMKORVFYOS-UHFFFAOYSA-N cyclooctanol Chemical compound OC1CCCCCCC1 FHADSMKORVFYOS-UHFFFAOYSA-N 0.000 description 1
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- DTGKSKDOIYIVQL-UHFFFAOYSA-N dl-isoborneol Natural products C1CC2(C)C(O)CC1C2(C)C DTGKSKDOIYIVQL-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000000687 hydroquinonyl group Chemical class C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- LZWQNOHZMQIFBX-UHFFFAOYSA-N lithium;2-methylpropan-2-olate Chemical compound [Li+].CC(C)(C)[O-] LZWQNOHZMQIFBX-UHFFFAOYSA-N 0.000 description 1
- 150000004704 methoxides Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 210000002374 sebum Anatomy 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/533—Monocarboxylic acid esters having only one carbon-to-carbon double bond
- C07C69/54—Acrylic acid esters; Methacrylic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/06—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton from hydroxy amines by reactions involving the etherification or esterification of hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/03—Preparation of carboxylic acid esters by reacting an ester group with a hydroxy group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Epoxy Compounds (AREA)
- Catalysts (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423441 DE3423441A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
| FR8508090A FR2566393B1 (fr) | 1984-06-26 | 1985-05-30 | Procede pour la preparation d'esters des acides acrylique et methacrylique par trans-esterification |
| US06/745,486 US4745213A (en) | 1984-06-26 | 1985-06-17 | Method of preparing esters of acrylic acid and methacrylic acid by transesterification |
| IT67583/85A IT1183900B (it) | 1984-06-26 | 1985-06-25 | Procedimento per la produzione di esteri dell'acido acrilico e metacrilico mediante esterificazione |
| JP60138082A JPH07113003B2 (ja) | 1984-06-26 | 1985-06-26 | エステル交換によるアクリル―またはメタクリル酸のエステルの製法 |
| GB08516184A GB2162516B (en) | 1984-06-26 | 1985-06-26 | Process for the preparation of esters of acrylic and methacrylic acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423441 DE3423441A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3423441A1 true DE3423441A1 (de) | 1986-01-02 |
| DE3423441C2 DE3423441C2 (enExample) | 1993-04-29 |
Family
ID=6239129
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843423441 Granted DE3423441A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4745213A (enExample) |
| JP (1) | JPH07113003B2 (enExample) |
| DE (1) | DE3423441A1 (enExample) |
| FR (1) | FR2566393B1 (enExample) |
| IT (1) | IT1183900B (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0224684A1 (de) * | 1985-12-06 | 1987-06-10 | Degussa Aktiengesellschaft | Verfahren zur Herstellung von Tetrahydrofurfuryl-(2)-methacrylat und dazu geeigneter Katalysator |
| DE102007031468A1 (de) | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Allylmethacrylat |
| WO2012038459A1 (de) * | 2010-09-23 | 2012-03-29 | Basf Se | Verfahren zur herstellung von (meth)acrylsäureestern von n,n-substituierten aminoalkoholen |
| DE102017217620A1 (de) | 2017-10-04 | 2019-04-04 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Dimethylaminoalkyl(meth)acrylaten |
| DE202019002505U1 (de) | 2019-06-12 | 2019-06-26 | Basf Se | Härtbare Zusammensetzung mit Cyclohexyl(meth)acrylat |
| DE202019002498U1 (de) | 2019-06-12 | 2019-06-27 | Basf Se | Wässrige Emulsionspolymerisate enthaltend Cyclohexylmethacrylat und ihre Verwendung als Bindemittel zur Herstellung von Druckpasten für den Pigmentdruck auf Textilien |
| DE202019002497U1 (de) | 2019-06-12 | 2019-07-15 | Basf Se | Polymerisier- und härtbare Zusammensetzungen enthaltend Cyclohexylmethacrylat und ihre Verwendung zur Herstellung von Boden- und Fahrbahnbeschichtungen |
| DE202020103213U1 (de) | 2020-06-04 | 2020-06-17 | Basf Se | Klebstoff, enthaltend Polymere aus Cyclohexylmethacrylat und weiterem Monomer, und Artikel umfassend den Klebstoff |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2008258C (en) * | 1989-01-30 | 2001-09-11 | Jacob Emert | Oil soluble dispersant additives modified with monoepoxy monounsaturated compounds |
| DE4217124A1 (de) * | 1992-05-23 | 1993-11-25 | Roehm Gmbh | Verfahren zur Herstellung von endständig Stickstoffheterocyclus-substituiertem (Meth)acrylsäureester |
| US5606103A (en) * | 1993-09-03 | 1997-02-25 | Cps Chemical Company, Inc. | Organotin catalyzed transesterification |
| US5498751A (en) * | 1993-09-03 | 1996-03-12 | Cps Chemical Company, Inc. | Organotin catalyzed transesterification |
| DE19602035C2 (de) * | 1996-01-20 | 1998-04-02 | Roehm Gmbh | Verfahren zur Herstellung von Alkoxypolyglycol(meth)acrylaten |
| US6203720B1 (en) | 1996-12-24 | 2001-03-20 | University Of Southern Mississippi | Low MFT and high Tg , internally plasticizing, and low voc latex compositions |
| US6235916B1 (en) | 1996-12-24 | 2001-05-22 | University Of Southern Mississippi | Internally plasticizing and crosslinkable monomers and applications thereof |
| US6001913A (en) * | 1996-12-24 | 1999-12-14 | The University Of Southern Mississippi | Latex compositions containing ethylenically unsaturated esters of long-chain alkenols |
| US6174948B1 (en) | 1996-12-24 | 2001-01-16 | The University Of Southern Mississippi | Latex compositions containing ethylenically unsaturated esters of fatty compounds and applications thereof |
| US6897257B2 (en) * | 1996-12-24 | 2005-05-24 | The University Of Southern Mississippi | Process for forming latex polymers |
| US6215018B1 (en) * | 1997-08-11 | 2001-04-10 | Ciba Specialty Chemicals Corporation | Acrylate monomer preparation using alkali metal alkoxides as ester interchange catalysts and bromide salt polymerization inhibitors |
| DE19930721C2 (de) * | 1999-07-05 | 2001-12-20 | Roehm Gmbh | Verfahren zur Herstellung und Prozeßinhibierung von Isobornylmethacrylat |
| DE10106642A1 (de) * | 2001-02-12 | 2002-08-22 | Roehm Gmbh | Verfahren zur Herstellung von (Meth)acrylsäureestern durch Umesterung in Gegenwart von Alkalimetallcyanat enthaltenden Mischkatalysatoren |
| US20060236467A1 (en) * | 2004-03-12 | 2006-10-26 | Thames Shelby F | Functionalized vegetable oil derivatives, latex compositions and textile finishes |
| US7361710B2 (en) * | 2004-03-12 | 2008-04-22 | Southern Diversified Products, Llc | Functionalized vegetable oil derivatives, latex compositions and coatings |
| US7999030B2 (en) * | 2004-03-12 | 2011-08-16 | Southern Diversified Products, Llc | Latex compositions comprising functionalized vegetable oil derivatives |
| CN101088990B (zh) * | 2006-06-13 | 2011-08-03 | 罗门哈斯公司 | 用来制备(甲基)丙烯酸酯单体的酯交换法 |
| DE102007031470A1 (de) * | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von (Meth)acrylaten |
| CN102381996A (zh) * | 2011-08-23 | 2012-03-21 | 里光 | 一种甲基丙烯酸二乙基氨基乙酯的制备方法 |
| JP6809366B2 (ja) * | 2016-06-10 | 2021-01-06 | 三菱ケミカル株式会社 | 光学活性カルボン酸エステルの製造方法 |
| US10710956B2 (en) | 2018-02-08 | 2020-07-14 | Regents Of The University Of Minnesota | Process for the preparation of acrylate esters from alkyl lactates |
| CA3100760A1 (en) | 2018-05-23 | 2019-11-28 | Evonik Operations Gmbh | Method for preparing keto-functionalized aromatic (meth)acrylates |
| JP7374171B2 (ja) | 2018-07-17 | 2023-11-06 | エボニック オペレーションズ ゲーエムベーハー | C-h酸性(メタ)アクリレートの製造方法 |
| EP3599232A1 (de) | 2018-07-26 | 2020-01-29 | Evonik Operations GmbH | Verfahren zur herstellung von n-methyl(meth)acrylamid |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1067806B (de) * | 1954-09-09 | 1959-10-29 | Roehm & Haas Gmbh | Verfahren zur kontinuierlichen Herstellung von Estern der Acryl- und Methacrylsaeuremit hoehermolekularen Alkoholen |
| AT277951B (de) * | 1967-11-16 | 1970-01-12 | Lonza Ag | Verfahren zur herstellung von acrylsaeureestern |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2138763A (en) * | 1938-03-30 | 1938-11-29 | Du Pont | Amino alcohol esters of the alpha substituted acrylic acids |
| US2891991A (en) * | 1956-09-28 | 1959-06-23 | California Research Corp | Process for preparing higher alkyl esters of methacrylic acid |
| US2891990A (en) * | 1956-09-28 | 1959-06-23 | California Research Corp | Preparation of higher alkyl methacrylates |
| DE1180527B (de) * | 1959-03-12 | 1964-10-29 | Union Carbide Corp | Verfahren zur Herstellung von Homo- oder Mischpolymerisaten der Acrylsaeureester |
| CH464891A (de) * | 1966-11-16 | 1968-11-15 | Lonza Ag | Verfahren zur Herstellung von Acrylsäureestern |
| US3784578A (en) * | 1970-06-26 | 1974-01-08 | Bayer Ag | Process for the production of allyl esters |
| JPS5653535B2 (enExample) * | 1974-05-13 | 1981-12-19 | ||
| DE2423405C3 (de) * | 1974-05-14 | 1983-05-19 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Glycidylmethacrylat |
| JPS5441815A (en) * | 1977-09-02 | 1979-04-03 | Nitto Chem Ind Co Ltd | Preparation of acrylate or methacrylate |
| DE2744641B2 (de) * | 1977-10-04 | 1979-08-02 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Estern der Methacrylsäure |
| DE3013927A1 (de) * | 1980-04-11 | 1981-10-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von hydroxylgruppenhaltigen polmeren |
| JPS58170731A (ja) * | 1982-03-31 | 1983-10-07 | Mitsui Toatsu Chem Inc | アクリル酸又はメタアクリル酸エステルの製造法 |
-
1984
- 1984-06-26 DE DE19843423441 patent/DE3423441A1/de active Granted
-
1985
- 1985-05-30 FR FR8508090A patent/FR2566393B1/fr not_active Expired
- 1985-06-17 US US06/745,486 patent/US4745213A/en not_active Expired - Fee Related
- 1985-06-25 IT IT67583/85A patent/IT1183900B/it active
- 1985-06-26 JP JP60138082A patent/JPH07113003B2/ja not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1067806B (de) * | 1954-09-09 | 1959-10-29 | Roehm & Haas Gmbh | Verfahren zur kontinuierlichen Herstellung von Estern der Acryl- und Methacrylsaeuremit hoehermolekularen Alkoholen |
| AT277951B (de) * | 1967-11-16 | 1970-01-12 | Lonza Ag | Verfahren zur herstellung von acrylsaeureestern |
Non-Patent Citations (5)
| Title |
|---|
| CA, Bd. 91, 1979, Ref. 40095v * |
| CA, Bd. 96, 1982, Ref. 180806f * |
| CPI-Basic Abstracts Journal 1984 * |
| Römpps Chemie-Lexikon, 8. Aufl., 1979, S. 108 * |
| Römpps Chemie-Lexikon, 8. Aufl., 1981, S. 995 * |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0224684A1 (de) * | 1985-12-06 | 1987-06-10 | Degussa Aktiengesellschaft | Verfahren zur Herstellung von Tetrahydrofurfuryl-(2)-methacrylat und dazu geeigneter Katalysator |
| DE102007031468A1 (de) | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Allylmethacrylat |
| WO2012038459A1 (de) * | 2010-09-23 | 2012-03-29 | Basf Se | Verfahren zur herstellung von (meth)acrylsäureestern von n,n-substituierten aminoalkoholen |
| DE102017217620A1 (de) | 2017-10-04 | 2019-04-04 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Dimethylaminoalkyl(meth)acrylaten |
| WO2019068578A1 (en) | 2017-10-04 | 2019-04-11 | Evonik Röhm Gmbh | PROCESS FOR THE PREPARATION OF DIMETHYLAMINOALKYL (METH) ACRYLATES |
| DE202019002505U1 (de) | 2019-06-12 | 2019-06-26 | Basf Se | Härtbare Zusammensetzung mit Cyclohexyl(meth)acrylat |
| DE202019002498U1 (de) | 2019-06-12 | 2019-06-27 | Basf Se | Wässrige Emulsionspolymerisate enthaltend Cyclohexylmethacrylat und ihre Verwendung als Bindemittel zur Herstellung von Druckpasten für den Pigmentdruck auf Textilien |
| DE202019002497U1 (de) | 2019-06-12 | 2019-07-15 | Basf Se | Polymerisier- und härtbare Zusammensetzungen enthaltend Cyclohexylmethacrylat und ihre Verwendung zur Herstellung von Boden- und Fahrbahnbeschichtungen |
| DE202020103213U1 (de) | 2020-06-04 | 2020-06-17 | Basf Se | Klebstoff, enthaltend Polymere aus Cyclohexylmethacrylat und weiterem Monomer, und Artikel umfassend den Klebstoff |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6150940A (ja) | 1986-03-13 |
| JPH07113003B2 (ja) | 1995-12-06 |
| FR2566393A1 (fr) | 1985-12-27 |
| FR2566393B1 (fr) | 1988-10-28 |
| IT1183900B (it) | 1987-10-22 |
| DE3423441C2 (enExample) | 1993-04-29 |
| IT8567583A0 (it) | 1985-06-25 |
| US4745213A (en) | 1988-05-17 |
| IT8567583A1 (it) | 1986-12-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3423441A1 (de) | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung | |
| DE3423443C2 (enExample) | ||
| EP0001082B1 (de) | Verfahren zur Herstellung von Dialkylcarbonaten | |
| DE69414516T2 (de) | Organozinnkatalysierte Transesterifikation | |
| EP1465859B1 (de) | Verfahren zur kontinuierlichen herstellung von alkyl(meth)acrylaten | |
| EP1399408B1 (de) | Verfahren zur herstellung von (meth)acrylsäureestern | |
| DE60130670T2 (de) | Verfahren zur herstellung einer fluorierten esterverbindung | |
| EP0623582A2 (de) | Verfahren zur Herstellung von Carbonsäureestern aus Carbonsäurehalogeniden und Alkoholen | |
| EP2675780B1 (de) | Verfahren zur herstellung von divinylethern | |
| EP0008654A1 (de) | Verfahren zur Gewinnung von reinen 2-(Perfluoralkyl)-äthanolen aus ihren Gemischen mit 2-(Perfluoralkyl)-äthylenen und gegebenenfalls 2-(Perfluoralkyl)-äthylestern | |
| EP0571851B1 (de) | Verfahren zur Herstellung von endständig Stickstoffheterocyclus-substituiertem (Meth)acrylsäureester | |
| DE10145228A1 (de) | Synthese von t-Butylaminoethylmethacrylat durch Umesterung des Alkohols mit MMA | |
| EP0344419B1 (de) | Verfahren zur Herstellung von Fettsäure- oder Hydroxyfettsäureestern von Isopropylidenderivaten eines Polyglycerins | |
| DE2824782C3 (de) | Verfahren zur Herstellung von Glycidylmethacrylat oder Glycidylacrylat Nippon Oil and Fats Co, Ltd, Tokio | |
| DE3214247C2 (enExample) | ||
| DE2519305A1 (de) | Verfahren zum herstellen von alpha,beta-ungesaettigten thiolestern | |
| EP0087585A1 (de) | Verfahren zur Herstellung von 3-Alkoxi-acrylnitrilen | |
| DE69904545T2 (de) | Verfahren zum Herstellen von Allyl 2-hydroxyisobutyrat | |
| DE2651531A1 (de) | Verfahren zur herstellung eines fluorierten acylfluorids mit einer estergruppe | |
| DE1939827C3 (de) | Verfahren zur Herstellung von Tns (C tief 6 C tief 12 alkyl) phos phaten | |
| DE60101391T2 (de) | Verfahren zum Herstellen von Pivaloylessigsäureester | |
| DE19652017A1 (de) | Verfahren zur Herstellung von omega-Hydroxyestern alpha,beta-ungesättigter Carbonsäuren | |
| EP1259473B1 (de) | Verfahren zur herstellung von chlorcarbonsäurechloriden | |
| EP1053995B1 (de) | Verfahren zur Herstellung von (Meth)acrylsäureestern | |
| GB2162516A (en) | Process for the preparation of esters of acrylic and methacrylic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: ROEHM GMBH & CO. KG, 64293 DARMSTADT, DE |