DE3423443C2 - - Google Patents
Info
- Publication number
- DE3423443C2 DE3423443C2 DE3423443A DE3423443A DE3423443C2 DE 3423443 C2 DE3423443 C2 DE 3423443C2 DE 3423443 A DE3423443 A DE 3423443A DE 3423443 A DE3423443 A DE 3423443A DE 3423443 C2 DE3423443 C2 DE 3423443C2
- Authority
- DE
- Germany
- Prior art keywords
- transesterification
- lithium
- acrylic
- esters
- trimethylolpropane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000005809 transesterification reaction Methods 0.000 claims description 24
- 239000003054 catalyst Substances 0.000 claims description 21
- 239000000292 calcium oxide Substances 0.000 claims description 11
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 11
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 10
- 150000005846 sugar alcohols Polymers 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 7
- 150000001298 alcohols Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 5
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical group [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 4
- 125000005395 methacrylic acid group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000002148 esters Chemical class 0.000 description 17
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 16
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 10
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 8
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- -1 lithium hydride Chemical class 0.000 description 6
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 4
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- FUJCRWPEOMXPAD-UHFFFAOYSA-N lithium oxide Chemical compound [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 description 2
- 229910001947 lithium oxide Inorganic materials 0.000 description 2
- 229910001386 lithium phosphate Inorganic materials 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000005691 triesters Chemical class 0.000 description 2
- TWQULNDIKKJZPH-UHFFFAOYSA-K trilithium;phosphate Chemical compound [Li+].[Li+].[Li+].[O-]P([O-])([O-])=O TWQULNDIKKJZPH-UHFFFAOYSA-K 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- KYNFOMQIXZUKRK-UHFFFAOYSA-N 2,2'-dithiodiethanol Chemical compound OCCSSCCO KYNFOMQIXZUKRK-UHFFFAOYSA-N 0.000 description 1
- XBFUGGOVPHCNEG-UHFFFAOYSA-N 2-ethyl-2-(hydroxymethyl)propane-1,3-diol Chemical compound CCC(CO)(CO)CO.CCC(CO)(CO)CO XBFUGGOVPHCNEG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- CVPVRHYNHFQLMR-UHFFFAOYSA-M Cl(=O)(=O)[O-].[Li+].[O-2].[Ca+2] Chemical compound Cl(=O)(=O)[O-].[Li+].[O-2].[Ca+2] CVPVRHYNHFQLMR-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GCNKJQRMNYNDBI-UHFFFAOYSA-N [2-(hydroxymethyl)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(CO)(CC)COC(=O)C(C)=C GCNKJQRMNYNDBI-UHFFFAOYSA-N 0.000 description 1
- GQCWURKKJXGABF-UHFFFAOYSA-M [Br-].[Li+].[O-2].[Ca+2] Chemical compound [Br-].[Li+].[O-2].[Ca+2] GQCWURKKJXGABF-UHFFFAOYSA-M 0.000 description 1
- QPXRSRBBIJFEHM-UHFFFAOYSA-M [I-].[Li+].[O-2].[Ca+2] Chemical compound [I-].[Li+].[O-2].[Ca+2] QPXRSRBBIJFEHM-UHFFFAOYSA-M 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000005815 base catalysis Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical class [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000000687 hydroquinonyl group Chemical class C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- VOENKAZJEHZUTB-UHFFFAOYSA-M lithium oxiran-2-ylmethyl 2-methylprop-2-enoate chloride Chemical compound C(C(=C)C)(=O)OCC1CO1.[Cl-].[Li+] VOENKAZJEHZUTB-UHFFFAOYSA-M 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/03—Preparation of carboxylic acid esters by reacting an ester group with a hydroxy group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423443 DE3423443A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
| FR8508091A FR2566394B1 (fr) | 1984-06-26 | 1985-05-30 | Procede pour la preparation d'esters des acides acrylique et methacrylique par trans-esterification |
| US06/745,485 US4672105A (en) | 1984-06-26 | 1985-06-17 | Method for preparing esters of acrylic acid and methacrylic acid by transesterification |
| IT8567584A IT1183901B (it) | 1984-06-26 | 1985-06-25 | Procedimento per la produzione di esteri dell'acido acrilico e metacrilico mediante esterificazione |
| GB08516185A GB2163149B (en) | 1984-06-26 | 1985-06-26 | Process for the preparation of esters of acrylic and methacrylic acid |
| JP60138083A JPH07113004B2 (ja) | 1984-06-26 | 1985-06-26 | エステル交換によるアクリル酸―またはメタクリル酸エステルの製造法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423443 DE3423443A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3423443A1 DE3423443A1 (de) | 1986-01-02 |
| DE3423443C2 true DE3423443C2 (enExample) | 1993-07-01 |
Family
ID=6239130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843423443 Granted DE3423443A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4672105A (enExample) |
| JP (1) | JPH07113004B2 (enExample) |
| DE (1) | DE3423443A1 (enExample) |
| FR (1) | FR2566394B1 (enExample) |
| GB (1) | GB2163149B (enExample) |
| IT (1) | IT1183901B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005044250A1 (de) * | 2005-09-15 | 2007-03-29 | Röhm Gmbh | Verfahren zur Herstellung von Methacrylaten mit reaktiven Doppelbindungen |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3543115A1 (de) * | 1985-12-06 | 1987-06-11 | Degussa | Verfahren zur herstellung von tetrahydrofurfuryl-(2)-methacrylat und dazu geeigneter katalysator |
| GB9120584D0 (en) * | 1991-09-27 | 1991-11-06 | Bp Chem Int Ltd | Process for the preparation of acrylic acid and methacrylic acid esters |
| DE4217124A1 (de) * | 1992-05-23 | 1993-11-25 | Roehm Gmbh | Verfahren zur Herstellung von endständig Stickstoffheterocyclus-substituiertem (Meth)acrylsäureester |
| DE19602035C2 (de) * | 1996-01-20 | 1998-04-02 | Roehm Gmbh | Verfahren zur Herstellung von Alkoxypolyglycol(meth)acrylaten |
| US6215018B1 (en) * | 1997-08-11 | 2001-04-10 | Ciba Specialty Chemicals Corporation | Acrylate monomer preparation using alkali metal alkoxides as ester interchange catalysts and bromide salt polymerization inhibitors |
| DE19930721C2 (de) * | 1999-07-05 | 2001-12-20 | Roehm Gmbh | Verfahren zur Herstellung und Prozeßinhibierung von Isobornylmethacrylat |
| DE10106642A1 (de) * | 2001-02-12 | 2002-08-22 | Roehm Gmbh | Verfahren zur Herstellung von (Meth)acrylsäureestern durch Umesterung in Gegenwart von Alkalimetallcyanat enthaltenden Mischkatalysatoren |
| US20070129564A1 (en) * | 2004-02-20 | 2007-06-07 | Basf Aktiengesellschaft | Method for the production of (meth)acrylic acid esters |
| CN101088990B (zh) * | 2006-06-13 | 2011-08-03 | 罗门哈斯公司 | 用来制备(甲基)丙烯酸酯单体的酯交换法 |
| DE102007031473A1 (de) | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Ethylenglycoldimethacrylat |
| DE102007031470A1 (de) * | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von (Meth)acrylaten |
| DE102007031474A1 (de) * | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Butandioldimethacrylaten |
| JP2011506517A (ja) * | 2007-12-19 | 2011-03-03 | エボニック レーム ゲゼルシャフト ミット ベシュレンクテル ハフツング | (メタ)アクリレートの製造方法 |
| DE102008002254A1 (de) | 2008-06-06 | 2010-01-21 | Evonik Röhm Gmbh | Monomermischungen, Polymere sowie Beschichtungszusammensetzungen |
| DE102009001217A1 (de) | 2009-02-27 | 2010-09-02 | Evonik Röhm Gmbh | Monomermischungen, Polymere sowie Beschichtungszusammensetzungen |
| DE102008002257A1 (de) | 2008-06-06 | 2010-01-28 | Evonik Röhm Gmbh | Wässrige Dispersionen aufweisend mindestens ein Alkyd-Harz |
| DE102008040221A1 (de) | 2008-07-07 | 2010-01-14 | Evonik Röhm Gmbh | Verfahren zur Herstellung von (Meth)acrylsäureestern |
| DE102008040214A1 (de) | 2008-07-07 | 2010-01-14 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Polyalkylenglykoldi(meth)acrylaten |
| DE102008046075A1 (de) | 2008-09-08 | 2010-03-11 | Evonik Röhm Gmbh | (Meth)acrylatmonomer, Polymer sowie Beschichtungsmittel |
| DE102009026820A1 (de) | 2008-09-08 | 2010-03-11 | Evonik Röhm Gmbh | Funktionalisiertes (Meth)acrylatmonomer, Polymer, Beschichtungsmittel und Verfahren zur Herstellung und Vernetzung |
| US8563751B2 (en) | 2008-12-22 | 2013-10-22 | Honshu Chemical Industry Co., Ltd. | Method for manufacturing trimellitic anhydride aryl ester |
| DE102009001966A1 (de) | 2009-03-30 | 2010-10-07 | Evonik Röhm Gmbh | Beschichtungszusammensetzung,(Meth)acryl-Polymer und Monomermischung zur Herstellung des(Meth)acryl-Polymers |
| DE102009001965A1 (de) | 2009-03-30 | 2010-10-07 | Evonik Röhm Gmbh | Beschichtungsmittel, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102009001964A1 (de) | 2009-03-30 | 2010-10-07 | Evonik Röhm Gmbh | Multifunktionales(Meth)acryl-Polymer, Beschichtungszusammensetzung, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102009001970A1 (de) | 2009-03-30 | 2010-10-14 | Evonik Röhm Gmbh | (Meth)acrylat-Polymer, Beschichtungsmittel, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102009002888A1 (de) | 2009-05-07 | 2010-11-11 | Evonik Röhm Gmbh | Beschichtungsmittel, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102010000945A1 (de) | 2010-01-15 | 2011-07-21 | Evonik Röhm GmbH, 64293 | Verfahren zur Herstellung von (Meth)acrylsäureestern |
| DE102010030970A1 (de) | 2010-07-06 | 2012-01-12 | Evonik Röhm Gmbh | Zusammensetzung zur Herstellung von Polymeren, (Meth)acryl-Polymer, Beschichtungsmittel und Beschichtung |
| DE102010041272A1 (de) | 2010-09-23 | 2012-03-29 | Evonik Röhm Gmbh | Beschichtungsmittel mit (Meth)acryl-Polymeren und Koaleszenzhilfsmitteln |
| AU2012260956B2 (en) | 2011-05-24 | 2015-11-05 | Evonik Rohm Gmbh | Reactive resins for cable sealing compounds |
| DE102011081649A1 (de) | 2011-08-26 | 2013-02-28 | Evonik Röhm Gmbh | Längerkettige Methacrylate aus nachwachsenden Rohstoffen |
| CN106170472B (zh) | 2013-12-26 | 2020-04-14 | 陶氏环球技术有限责任公司 | 用于锂盐催化的酯基转移过程的抑制剂组合和用于移除锂盐的方法 |
| DE102017217620A1 (de) * | 2017-10-04 | 2019-04-04 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Dimethylaminoalkyl(meth)acrylaten |
| CA3100760A1 (en) | 2018-05-23 | 2019-11-28 | Evonik Operations Gmbh | Method for preparing keto-functionalized aromatic (meth)acrylates |
| BR112021000679A2 (pt) | 2018-07-17 | 2021-04-13 | Evonik Operations Gmbh | Método para preparar (met)acrilatos ácidos c-h |
| EP3599232A1 (de) | 2018-07-26 | 2020-01-29 | Evonik Operations GmbH | Verfahren zur herstellung von n-methyl(meth)acrylamid |
| EP4148040B1 (en) | 2021-09-10 | 2023-11-01 | Evonik Operations GmbH | One pot synthesis of urea (meth)acrylates |
| ES2970697T3 (es) | 2021-09-10 | 2024-05-30 | Evonik Operations Gmbh | (Met)acrilatos de urea espaciados |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2469371A (en) * | 1946-08-14 | 1949-05-10 | Baker Castor Oil Co | Process of reacting glyceride oils |
| US2891990A (en) * | 1956-09-28 | 1959-06-23 | California Research Corp | Preparation of higher alkyl methacrylates |
| US2891991A (en) * | 1956-09-28 | 1959-06-23 | California Research Corp | Process for preparing higher alkyl esters of methacrylic acid |
| GB1094998A (en) * | 1966-04-19 | 1967-12-13 | Vergier Chemical Company Ltd D | Process for the production of esters |
| CH464891A (de) * | 1966-11-16 | 1968-11-15 | Lonza Ag | Verfahren zur Herstellung von Acrylsäureestern |
| US3784578A (en) * | 1970-06-26 | 1974-01-08 | Bayer Ag | Process for the production of allyl esters |
| DE2364126A1 (de) * | 1972-12-27 | 1974-07-11 | Ciba Geigy Ag | Verfahren zur herstellung von hydroxyalkylphenylderivaten |
| JPS5653535B2 (enExample) * | 1974-05-13 | 1981-12-19 | ||
| JPS5441815A (en) * | 1977-09-02 | 1979-04-03 | Nitto Chem Ind Co Ltd | Preparation of acrylate or methacrylate |
| DE2744641B2 (de) * | 1977-10-04 | 1979-08-02 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Estern der Methacrylsäure |
| DE3013927A1 (de) * | 1980-04-11 | 1981-10-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von hydroxylgruppenhaltigen polmeren |
-
1984
- 1984-06-26 DE DE19843423443 patent/DE3423443A1/de active Granted
-
1985
- 1985-05-30 FR FR8508091A patent/FR2566394B1/fr not_active Expired
- 1985-06-17 US US06/745,485 patent/US4672105A/en not_active Expired - Lifetime
- 1985-06-25 IT IT8567584A patent/IT1183901B/it active
- 1985-06-26 GB GB08516185A patent/GB2163149B/en not_active Expired
- 1985-06-26 JP JP60138083A patent/JPH07113004B2/ja not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005044250A1 (de) * | 2005-09-15 | 2007-03-29 | Röhm Gmbh | Verfahren zur Herstellung von Methacrylaten mit reaktiven Doppelbindungen |
Also Published As
| Publication number | Publication date |
|---|---|
| US4672105A (en) | 1987-06-09 |
| IT1183901B (it) | 1987-10-22 |
| IT8567584A0 (it) | 1985-06-25 |
| GB2163149A (en) | 1986-02-19 |
| FR2566394A1 (fr) | 1985-12-27 |
| DE3423443A1 (de) | 1986-01-02 |
| JPS6156155A (ja) | 1986-03-20 |
| GB8516185D0 (en) | 1985-07-31 |
| GB2163149B (en) | 1988-07-27 |
| JPH07113004B2 (ja) | 1995-12-06 |
| FR2566394B1 (fr) | 1988-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3423443C2 (enExample) | ||
| DE3423441C2 (enExample) | ||
| DE69434318T2 (de) | Organozinn katalysierte Transesterifizierung | |
| EP1308451B1 (de) | Verfahren zur Herstellung von Carboxyethylmethylphosphinsäureglykolester | |
| EP2294048B1 (de) | Verfahren zur herstellung von (meth)acrylsäureestern | |
| DE69210929T2 (de) | Verfahren zur Herstellung von Estern von Acryl- und Methacrylsäure | |
| EP2162419B1 (de) | Verfahren zur herstellung von ethylenglycoldimethacrylat | |
| WO2009003744A1 (de) | Verfahren zur herstellung von (meth)acrylaten | |
| EP2486000A1 (de) | Verfahren zur herstellung von polyolestern | |
| DE2904822A1 (de) | Verfahren zur abtrennung von estern aus reaktionsgemischen | |
| EP0463434B1 (de) | Verfahren zur Herstellung von monoethylenisch ungesättigten Carbonsäureestern | |
| DE102007031474A1 (de) | Verfahren zur Herstellung von Butandioldimethacrylaten | |
| DE4401132A1 (de) | Verfahren zur Umesterung von (Meth)acrylsäureestern | |
| DE10145228A1 (de) | Synthese von t-Butylaminoethylmethacrylat durch Umesterung des Alkohols mit MMA | |
| DE2423405C3 (de) | Verfahren zur Herstellung von Glycidylmethacrylat | |
| EP0197375B1 (de) | Verfahren zur Inversion der Konfigurationsekundärer Alkohole | |
| EP0317913B1 (de) | Neue Di(meth)acrylate, Verfahren zu deren Herstellung und deren Verwendung | |
| DE19652017A1 (de) | Verfahren zur Herstellung von omega-Hydroxyestern alpha,beta-ungesättigter Carbonsäuren | |
| DE1147938B (de) | Herstellung von AEthan-1, 2-diol- und Propan-1, 2-diolmonoacrylat und -monomethacrylat | |
| WO2023213700A1 (de) | Herstellung terminal ungesättigter (meth)acrylat-vernetzer | |
| DE102010000945A1 (de) | Verfahren zur Herstellung von (Meth)acrylsäureestern | |
| DE19716832C2 (de) | Enantiomerenangereicherte, durch einen tertiären Kohlenwasserstoffrest 2-substituierte 2-Hydroxymethylessigsäuren | |
| DE1643549C (de) | Verfahren zur Herstellung von Estern des 2-Methylol-2,6-epoxymethanonorbornans | |
| EP0706989A1 (de) | Verfahren zur Abtrennung eines (Meth)acrylsäurediesters eines C4- bis C6-Alkandiols aus einem Gemisch, das im wesentlichen aus dem C4- bis C6-Alkandiol, dem (Meth)acrylsäuremonoester des C4- bis C6-Alkandiols und dem (Meth)acrylsäurediester des C4- bis C6-Alkandiols besteht | |
| DE102015226830A1 (de) | Verfahren zur Herstellung von hochsiedenden (Meth)acrylsäureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: ROEHM GMBH & CO. KG, 64293 DARMSTADT, DE |