DE2856873C2 - - Google Patents
Info
- Publication number
- DE2856873C2 DE2856873C2 DE2856873A DE2856873A DE2856873C2 DE 2856873 C2 DE2856873 C2 DE 2856873C2 DE 2856873 A DE2856873 A DE 2856873A DE 2856873 A DE2856873 A DE 2856873A DE 2856873 C2 DE2856873 C2 DE 2856873C2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- alkoxy
- chlorine
- bromine
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 formyloxy Chemical group 0.000 claims description 74
- 239000000460 chlorine Substances 0.000 claims description 42
- 229910052801 chlorine Inorganic materials 0.000 claims description 42
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 40
- 125000003545 alkoxy group Chemical group 0.000 claims description 31
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 26
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 26
- 229910052794 bromium Inorganic materials 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 16
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 12
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 11
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 10
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000005394 methallyl group Chemical group 0.000 claims description 8
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 8
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
- 125000005336 allyloxy group Chemical group 0.000 claims description 6
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 4
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 4
- 125000005195 alkyl amino carbonyloxy group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 4
- 125000005202 dialkylaminocarbonyloxy group Chemical group 0.000 claims description 4
- 125000006286 dichlorobenzyl group Chemical group 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 4
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000005425 toluyl group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000005091 alkenylcarbonylamino group Chemical group 0.000 claims description 2
- 125000004949 alkyl amino carbonyl amino group Chemical group 0.000 claims description 2
- 125000006598 aminocarbonylamino group Chemical group 0.000 claims description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000006011 chloroethoxy group Chemical group 0.000 claims description 2
- RFMQOHXWHFHOJF-UHFFFAOYSA-N cyano thiocyanate Chemical compound N#CSC#N RFMQOHXWHFHOJF-UHFFFAOYSA-N 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- TURAMGVWNUTQKH-UHFFFAOYSA-N propa-1,2-dien-1-one Chemical group C=C=C=O TURAMGVWNUTQKH-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 239000000987 azo dye Substances 0.000 claims 1
- 239000000975 dye Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- FZMXXXBUHOWPTC-UHFFFAOYSA-N 2-anilinoethyl acetate Chemical compound CC(=O)OCCNC1=CC=CC=C1 FZMXXXBUHOWPTC-UHFFFAOYSA-N 0.000 description 1
- XWQIUVCDURLODQ-UHFFFAOYSA-N 5-amino-1-benzyltriazole-4-carbonitrile Chemical compound NC1=C(C#N)N=NN1CC1=CC=CC=C1 XWQIUVCDURLODQ-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- HTHKZOCCOVYKKI-UHFFFAOYSA-N dinaphthalen-1-ylmethanedisulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(C(C=3C4=CC=CC=C4C=CC=3)(S(=O)(=O)O)S(O)(=O)=O)=CC=CC2=C1 HTHKZOCCOVYKKI-UHFFFAOYSA-N 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
- C09B29/0029—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing only nitrogen as heteroatom
- C09B29/004—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing only nitrogen as heteroatom containing a five-membered heterocyclic ring with three nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
- C09B29/0805—Amino benzenes free of acid groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH23078A CH632291A5 (de) | 1978-01-10 | 1978-01-10 | Organische azoverbindungen. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2856873A1 DE2856873A1 (de) | 1979-07-12 |
| DE2856873C2 true DE2856873C2 (enEXAMPLES) | 1989-02-23 |
Family
ID=4182250
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782856873 Granted DE2856873A1 (de) | 1978-01-10 | 1978-12-30 | Organische verbindungen, ihre herstellung und verwendung |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4341700A (enEXAMPLES) |
| JP (1) | JPS54101835A (enEXAMPLES) |
| AR (1) | AR227003A1 (enEXAMPLES) |
| BE (1) | BE873393A (enEXAMPLES) |
| BR (1) | BR7900114A (enEXAMPLES) |
| CA (1) | CA1122975A (enEXAMPLES) |
| CH (1) | CH632291A5 (enEXAMPLES) |
| DD (1) | DD143919A5 (enEXAMPLES) |
| DE (1) | DE2856873A1 (enEXAMPLES) |
| ES (1) | ES476680A1 (enEXAMPLES) |
| FR (1) | FR2414064B1 (enEXAMPLES) |
| GB (1) | GB2014175B (enEXAMPLES) |
| IT (1) | IT1111376B (enEXAMPLES) |
| TR (1) | TR21151A (enEXAMPLES) |
| ZA (1) | ZA79108B (enEXAMPLES) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10149805A1 (de) * | 2001-10-09 | 2003-04-24 | Degussa | Kohlenstoffhaltiges Material |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3016301A1 (de) * | 1980-04-28 | 1981-10-29 | Cassella Ag, 6000 Frankfurt | Wasserunloesliche azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| FI834666A7 (fi) * | 1982-12-23 | 1984-06-24 | Ciba Geigy Ag | Foerfarande foer framstaellning av nya aralkyltriazolfoereningar. |
| US4590201A (en) * | 1984-02-02 | 1986-05-20 | Merck & Co., Inc. | 5-amino or substituted amino 1,2,3-triazoles |
| EP0229011A1 (de) * | 1986-01-06 | 1987-07-15 | Ciba-Geigy Ag | Trisubstituierte Triazole |
| JP2759697B2 (ja) * | 1990-02-03 | 1998-05-28 | オリヱント化学工業株式会社 | ジシアノイミダゾール系色素誘導体及びその関連技術 |
| DE4225634A1 (de) * | 1991-08-12 | 1993-02-18 | Sandoz Ag | Azo-dispersionsfarbstoffe |
| US6225023B1 (en) * | 1996-11-20 | 2001-05-01 | Mitsubishi Chemical Corporation | Sulfonamide compound and method for its production, metal chelate compound employing the sulfonamide compound, and optical recording medium employing the metal chelate compound |
| CN1245516A (zh) * | 1996-11-27 | 2000-02-23 | 伊斯曼化学公司 | 制备吸光聚合物组合物的方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1927416U (de) | 1963-07-24 | 1965-11-18 | Bremshey & Co | Rahmen fuer diapositivfilme. |
| FR1398366A (fr) | 1964-06-10 | 1965-05-07 | Hoechst Ag | Colorants azoïques métallifères et leur préparation |
| DD96708A1 (enEXAMPLES) * | 1971-12-30 | 1973-04-12 | ||
| DD95438A1 (enEXAMPLES) * | 1972-01-10 | 1973-02-12 | ||
| US3785829A (en) * | 1972-06-02 | 1974-01-15 | Eastman Kodak Co | Novel cyan-dye forming coupler |
| GB1444731A (en) * | 1972-07-31 | 1976-08-04 | Sandoz Ltd | Basic dyes |
| DE2355076A1 (de) * | 1973-11-03 | 1975-05-07 | Bayer Ag | Kationische farbstoffe |
| DE2357448A1 (de) | 1973-11-17 | 1975-08-28 | Hoechst Ag | Basische azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| DE2437549A1 (de) * | 1974-08-03 | 1976-02-19 | Bayer Ag | Kationische farbstoffe |
| US4082740A (en) * | 1975-05-17 | 1978-04-04 | Hoechst Aktiengesellschaft | Quaternary basic azodyestuffs containing a propenyl amino radical |
-
1978
- 1978-01-10 CH CH23078A patent/CH632291A5/de not_active IP Right Cessation
- 1978-12-19 IT IT52348/78A patent/IT1111376B/it active
- 1978-12-30 DE DE19782856873 patent/DE2856873A1/de active Granted
-
1979
- 1979-01-05 GB GB7900336A patent/GB2014175B/en not_active Expired
- 1979-01-09 JP JP45179A patent/JPS54101835A/ja active Pending
- 1979-01-09 DD DD79210398A patent/DD143919A5/xx unknown
- 1979-01-09 BR BR7900114A patent/BR7900114A/pt unknown
- 1979-01-09 TR TR21151A patent/TR21151A/xx unknown
- 1979-01-09 FR FR7900437A patent/FR2414064B1/fr not_active Expired
- 1979-01-09 US US06/002,085 patent/US4341700A/en not_active Expired - Lifetime
- 1979-01-09 CA CA319,309A patent/CA1122975A/en not_active Expired
- 1979-01-09 ES ES476680A patent/ES476680A1/es not_active Expired
- 1979-01-10 BE BE0/192831A patent/BE873393A/xx not_active IP Right Cessation
- 1979-01-10 AR AR275124A patent/AR227003A1/es active
- 1979-01-10 ZA ZA79108A patent/ZA79108B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10149805A1 (de) * | 2001-10-09 | 2003-04-24 | Degussa | Kohlenstoffhaltiges Material |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2856873A1 (de) | 1979-07-12 |
| BR7900114A (pt) | 1979-08-14 |
| CA1122975A (en) | 1982-05-04 |
| CH632291A5 (de) | 1982-09-30 |
| AR227003A1 (es) | 1982-09-15 |
| TR21151A (tr) | 1983-09-01 |
| GB2014175B (en) | 1982-06-30 |
| JPS54101835A (en) | 1979-08-10 |
| FR2414064A1 (fr) | 1979-08-03 |
| GB2014175A (en) | 1979-08-22 |
| IT7852348A0 (it) | 1978-12-19 |
| DD143919A5 (de) | 1980-09-17 |
| US4341700A (en) | 1982-07-27 |
| ES476680A1 (es) | 1979-12-16 |
| FR2414064B1 (fr) | 1986-02-07 |
| ZA79108B (en) | 1980-08-27 |
| BE873393A (fr) | 1979-07-10 |
| IT1111376B (it) | 1986-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3108077C2 (enEXAMPLES) | ||
| DE1295115B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2856873C2 (enEXAMPLES) | ||
| DE2600036C2 (de) | Monoazo-Dispersionsfarbstoffe | |
| DE2120877C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2433260C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE1644343B2 (de) | Dispersions-Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH674987A5 (enEXAMPLES) | ||
| DE2134518C3 (de) | Verfahren zur Herstellung von Verbindungen der Benzothloxanthenreihe | |
| DE2729914A1 (de) | Azo-dispersionsfarbstoffe, ihre herstellung und verwendung | |
| DE2334169A1 (de) | In wasser schwer loesliche azoverbindungen, ihre herstellung und verwendung | |
| EP0083313B1 (de) | Farbstoffmischung, Verfahren zu ihrer Herstellung und Verwendung zum Färben und Bedrucken von hydrophobem Fasermaterial | |
| DE2222639A1 (de) | In Wasser schwer loesliche Azoverbindungen,ihre Herstellung und Verwendung als Dispersionsfarbstoffe | |
| CH684408A5 (de) | Azo-Dispersionsfarbstoffe. | |
| DE2035002C3 (de) | Monoazo-Dispersionsf arbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2941512A1 (de) | Neue monoazofarbstoffe und deren verwendung | |
| DE3245977C2 (enEXAMPLES) | ||
| CH639376A5 (en) | Process for preparing disperse dyes of the triazolylazo class | |
| DE1943250C (de) | Verfahren zur Herstellung von Azoverbindungen und deren Verwendung zum Färben und Bedrucken | |
| DD143919A1 (de) | Verfahren zur herstellung von azoverbindungen | |
| CH505880A (de) | Verfahren zur Herstellung von in Wasser schwerlöslichen Azofarbstoffen | |
| DE2604571A1 (de) | Organische verbindungen | |
| DE1932404A1 (de) | Verbindungen der heterocyclischen Reihe,ihre Herstellung und Verwendung | |
| CH243868A (de) | Schieblehre. | |
| DE1943032B (de) | Verfahren zur Herstellung von Azover bindungen und deren Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |