DE2818947C2 - - Google Patents
Info
- Publication number
- DE2818947C2 DE2818947C2 DE2818947A DE2818947A DE2818947C2 DE 2818947 C2 DE2818947 C2 DE 2818947C2 DE 2818947 A DE2818947 A DE 2818947A DE 2818947 A DE2818947 A DE 2818947A DE 2818947 C2 DE2818947 C2 DE 2818947C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- chloride
- general formula
- tert
- urea
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 24
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- 239000002841 Lewis acid Substances 0.000 claims description 10
- -1 carbamoyl halide Chemical class 0.000 claims description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 9
- 150000007517 lewis acids Chemical class 0.000 claims description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 6
- 150000003672 ureas Chemical class 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 2
- 239000011592 zinc chloride Substances 0.000 claims description 2
- 235000005074 zinc chloride Nutrition 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- GGXGVZJHUKEJHO-UHFFFAOYSA-N 5-tert-butyl-1,2-oxazol-3-amine Chemical compound CC(C)(C)C1=CC(N)=NO1 GGXGVZJHUKEJHO-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- XMXLBDNVSIHRRA-UHFFFAOYSA-N 4,5-dimethyl-1,3-thiazol-2-amine Chemical compound CC=1N=C(N)SC=1C XMXLBDNVSIHRRA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- JLLJHQLUZAKJFH-UHFFFAOYSA-N Isouron Chemical compound CN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 JLLJHQLUZAKJFH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- SUCONPINCPEQKC-UHFFFAOYSA-N 1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)urea Chemical compound CN(C)C(=O)NC1=NC(C)=CS1 SUCONPINCPEQKC-UHFFFAOYSA-N 0.000 description 1
- NYDCIKWIMJJMJX-UHFFFAOYSA-N 1,1-dimethyl-3-(5-phenyl-1,2-thiazol-3-yl)urea Chemical compound S1N=C(NC(=O)N(C)C)C=C1C1=CC=CC=C1 NYDCIKWIMJJMJX-UHFFFAOYSA-N 0.000 description 1
- XRMHIRYPZQIKKK-UHFFFAOYSA-N 1,1-dimethyl-3-pyridin-2-ylurea Chemical compound CN(C)C(=O)NC1=CC=CC=N1 XRMHIRYPZQIKKK-UHFFFAOYSA-N 0.000 description 1
- UMDOQTDANJTGJY-UHFFFAOYSA-N 1,3-bis(5-tert-butyl-1,2-oxazol-3-yl)urea Chemical compound O1C(C(C)(C)C)=CC(NC(=O)NC2=NOC(=C2)C(C)(C)C)=N1 UMDOQTDANJTGJY-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- AMIJSEIHRANBNZ-UHFFFAOYSA-N 3-(1,3-benzothiazol-2-yl)-1,1-dimethylurea Chemical compound C1=CC=C2SC(NC(=O)N(C)C)=NC2=C1 AMIJSEIHRANBNZ-UHFFFAOYSA-N 0.000 description 1
- DDURBKJYRBUVKU-UHFFFAOYSA-N 3-(4,5-dimethyl-1,3-thiazol-2-yl)-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=NC(C)=C(C)S1 DDURBKJYRBUVKU-UHFFFAOYSA-N 0.000 description 1
- PIFBWXULXGPZKO-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1,1-diethylurea Chemical compound CCN(CC)C(=O)NC=1C=C(C(C)(C)C)ON=1 PIFBWXULXGPZKO-UHFFFAOYSA-N 0.000 description 1
- PXLGYEQYNXNGTC-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-ethyl-1-methylurea Chemical compound CCN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 PXLGYEQYNXNGTC-UHFFFAOYSA-N 0.000 description 1
- IMIXYLFTWDRFHY-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methoxy-1-methylurea Chemical compound CON(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 IMIXYLFTWDRFHY-UHFFFAOYSA-N 0.000 description 1
- OUQMXTJYCAJLGO-UHFFFAOYSA-N 4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(N)=N1 OUQMXTJYCAJLGO-UHFFFAOYSA-N 0.000 description 1
- VLQBYPSKWKIMPS-UHFFFAOYSA-N 5-phenyl-1,2-thiazol-3-amine Chemical compound S1N=C(N)C=C1C1=CC=CC=C1 VLQBYPSKWKIMPS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000021235 carbamoylation Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- XZVYDRLPXWFRIS-UHFFFAOYSA-N n-ethyl-n-methylcarbamoyl chloride Chemical compound CCN(C)C(Cl)=O XZVYDRLPXWFRIS-UHFFFAOYSA-N 0.000 description 1
- SHQJHXLWZDMQEJ-UHFFFAOYSA-N n-methoxy-n-methylcarbamoyl chloride Chemical compound CON(C)C(Cl)=O SHQJHXLWZDMQEJ-UHFFFAOYSA-N 0.000 description 1
- UEKTZPNFEQJPLZ-UHFFFAOYSA-N n-methyl-n-prop-2-enylcarbamoyl chloride Chemical compound ClC(=O)N(C)CC=C UEKTZPNFEQJPLZ-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52049629A JPS6033109B2 (ja) | 1977-04-28 | 1977-04-28 | 尿素誘導体の合成法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2818947A1 DE2818947A1 (de) | 1978-11-02 |
| DE2818947C2 true DE2818947C2 (enExample) | 1991-08-22 |
Family
ID=12836505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782818947 Granted DE2818947A1 (de) | 1977-04-28 | 1978-04-28 | Verfahren zur herstellung von harnstoffderivaten |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4183856A (enExample) |
| JP (1) | JPS6033109B2 (enExample) |
| AR (1) | AR225666A1 (enExample) |
| AU (1) | AU513688B2 (enExample) |
| BE (1) | BE866581A (enExample) |
| BG (1) | BG33278A3 (enExample) |
| BR (1) | BR7802618A (enExample) |
| CA (1) | CA1093081A (enExample) |
| CH (1) | CH633542A5 (enExample) |
| CS (1) | CS198297B2 (enExample) |
| DD (1) | DD135905A5 (enExample) |
| DE (1) | DE2818947A1 (enExample) |
| DK (1) | DK144011C (enExample) |
| ES (1) | ES468897A1 (enExample) |
| FR (1) | FR2388802A1 (enExample) |
| GB (1) | GB1572976A (enExample) |
| HU (1) | HU176881B (enExample) |
| IE (1) | IE46769B1 (enExample) |
| IL (1) | IL54468A0 (enExample) |
| IT (1) | IT1111465B (enExample) |
| NL (1) | NL183513C (enExample) |
| PL (1) | PL110681B1 (enExample) |
| SE (1) | SE442867B (enExample) |
| SU (1) | SU1091853A3 (enExample) |
| YU (1) | YU40334B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8422461D0 (en) * | 1984-09-05 | 1984-10-10 | Wyeth John & Brother Ltd | Pyridine derivatives |
| US4808722A (en) * | 1985-10-31 | 1989-02-28 | Fmc Corporation | Pyridinylurea N-oxide compounds and agricultural uses |
| ATE103589T1 (de) * | 1989-11-10 | 1994-04-15 | Agrolinz Agrarchemikalien | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe. |
| DE3940261A1 (de) * | 1989-12-06 | 1991-06-13 | Agrolinz Agrarchemikalien Muen | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe |
| HUP0402309A3 (en) * | 2001-12-21 | 2008-09-29 | Novo Nordisk As | Amide derivatives as glucokinase activators and pharmaceutical compositions containing them |
| EP2471533A1 (en) * | 2002-06-27 | 2012-07-04 | Novo Nordisk A/S | Aryl carbonyl derivatives as therapeutic agents |
| AU2005203930C1 (en) | 2004-01-06 | 2012-02-23 | Vtv Therapeutics Llc | Heteroaryl-ureas and their use as glucokinase activators |
| JP2009500378A (ja) * | 2005-07-08 | 2009-01-08 | ノボ・ノルデイスク・エー/エス | グルコキナーゼ活性化剤としてのジシクロアルキルカルバモイル尿素 |
| CA2614518A1 (en) * | 2005-07-08 | 2007-01-18 | Novo-Nordisk A/S | Dicycloalkyl urea glucokinase activators |
| CN101263131B (zh) * | 2005-07-14 | 2013-04-24 | 特兰斯特克药品公司 | 脲葡糖激酶活化剂 |
| US8138185B2 (en) * | 2007-01-09 | 2012-03-20 | Novo Nordisk A/S | Urea glucokinase activators |
| AU2008204530B2 (en) | 2007-01-11 | 2013-08-01 | Vtv Therapeutics Llc | Urea glucokinase activators |
| CA3093025A1 (en) | 2018-06-12 | 2019-12-19 | Vtv Therapeutics Llc | Therapeutic uses of glucokinase activators in combination with insulin or insulin analogs |
| US12391658B2 (en) | 2020-02-18 | 2025-08-19 | Vtv Therapeutics Llc | Sulfoxide and sulfone glucokinase activators and methods of use thereof |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2755285A (en) * | 1956-07-17 | I-xsubstituted | ||
| US2756135A (en) * | 1955-07-13 | 1956-07-24 | Du Pont | 1-methyl-3-(2-benzothiazolyl)-ureas and their use as herbicides |
| DE1209801B (de) * | 1963-05-11 | 1966-01-27 | Bayer Ag | Unkrautbekaempfung in Rueben |
| US3293257A (en) * | 1964-09-14 | 1966-12-20 | United States Borax Chem | Pyridyl urea compounds |
| FR1533184A (fr) * | 1965-04-06 | 1968-07-19 | Pechiney Saint Gobain | Dérivés du thiazole |
| DE1620448C3 (de) * | 1965-05-08 | 1974-08-29 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Harnstoff- bzw. Thioharnstoffderivate des 3-Methylisothiazols |
| US3622593A (en) * | 1967-08-09 | 1971-11-23 | Fmc Corp | 1,1-dimethyl-3-(isothiazol-5-yl)urea |
| US3547940A (en) * | 1967-10-31 | 1970-12-15 | Du Pont | Substituted ureido isoxazoles |
| GB1266769A (enExample) * | 1969-08-15 | 1972-03-15 | ||
| US4062861A (en) * | 1973-07-27 | 1977-12-13 | Shionogi & Co., Ltd. | 3-Isoxazolylurea derivatives |
| JPS5031039A (enExample) * | 1973-07-27 | 1975-03-27 | ||
| US4013706A (en) * | 1973-11-14 | 1977-03-22 | Sucreries Du Soissonnais Et Compagnie Sucriere | Derivatives of substituted urea, acyl ureas, and sulphonyl ureas, and a process for producing the same |
| US4046770A (en) * | 1974-08-30 | 1977-09-06 | Eli Lilly And Company | N-(6-acyloxybenzothiazol-2-yl)-N'-phenyl (or substituted phenyl)ureas |
| JPS5810361B2 (ja) * | 1974-10-04 | 1983-02-25 | 塩野義製薬株式会社 | 3−アルチルイソオキサゾ−ル系除草剤 |
-
1977
- 1977-04-28 JP JP52049629A patent/JPS6033109B2/ja not_active Expired
-
1978
- 1978-04-05 GB GB13400/78A patent/GB1572976A/en not_active Expired
- 1978-04-05 CA CA300,467A patent/CA1093081A/en not_active Expired
- 1978-04-10 IL IL54468A patent/IL54468A0/xx not_active IP Right Cessation
- 1978-04-10 US US05/895,105 patent/US4183856A/en not_active Expired - Lifetime
- 1978-04-11 IE IE707/78A patent/IE46769B1/en not_active IP Right Cessation
- 1978-04-18 ES ES468897A patent/ES468897A1/es not_active Expired
- 1978-04-21 SE SE7804596A patent/SE442867B/sv not_active IP Right Cessation
- 1978-04-25 DK DK180378A patent/DK144011C/da not_active IP Right Cessation
- 1978-04-26 AU AU35468/78A patent/AU513688B2/en not_active Expired
- 1978-04-27 DD DD78205055A patent/DD135905A5/xx unknown
- 1978-04-27 HU HU78SI1624A patent/HU176881B/hu not_active IP Right Cessation
- 1978-04-27 NL NLAANVRAGE7804550,A patent/NL183513C/xx not_active IP Right Cessation
- 1978-04-27 FR FR7812529A patent/FR2388802A1/fr active Granted
- 1978-04-27 BR BR7802618A patent/BR7802618A/pt unknown
- 1978-04-27 IT IT67959/78A patent/IT1111465B/it active
- 1978-04-28 YU YU1037/78A patent/YU40334B/xx unknown
- 1978-04-28 BG BG039586A patent/BG33278A3/xx unknown
- 1978-04-28 SU SU782608147A patent/SU1091853A3/ru active
- 1978-04-28 CS CS782773A patent/CS198297B2/cs unknown
- 1978-04-28 DE DE19782818947 patent/DE2818947A1/de active Granted
- 1978-04-28 PL PL1978206450A patent/PL110681B1/pl unknown
- 1978-04-28 CH CH470378A patent/CH633542A5/de not_active IP Right Cessation
- 1978-04-28 BE BE187289A patent/BE866581A/xx not_active IP Right Cessation
-
1981
- 1981-04-10 AR AR284939A patent/AR225666A1/es active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2818947C2 (enExample) | ||
| DE1132560B (de) | Verfahren zur Herstellung von 1, 3, 5-Triazinderivaten | |
| DE2707102C2 (de) | Verfahren zur regiospezifischen Herstellung von o-Aminophenylketonen | |
| DE69632919T2 (de) | Verfahren zur herstellung von 2-chlor-5-chloromethyl-thiazol | |
| DE3730748A1 (de) | Neue polyoxygenierte labdanderivate, ein verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2264911C2 (enExample) | ||
| DE2929414A1 (de) | Pyrimido- eckige klammer auf 5',4' zu 5,6 eckige klammer zu -pyrido- eckige klammer auf 1,2-a eckige klammer zu -benzimidazole, verfahren zu ihrer herstellung und deren verwendung | |
| DE2710382A1 (de) | Verfahren zur herstellung von 2,1,3-thiadiazin-4-on-2,2-dioxid-derivaten | |
| EP0102318A2 (de) | Herstellung von beta-Amino-alpha,beta-ungesättigten Carbonsäureestern | |
| DE2230070A1 (de) | Verfahren zur Herstellung von N-(2,4-Dihalogen-s-triazin-6-yl)-harnstoffen | |
| DE1545825C3 (de) | Verfahren zur Herstellung von 3,5-Dioxo-1,2,4-dithiazolidinen | |
| DE2823712C2 (de) | Verfahren zur Herstellung von Pleuromutilin-Derivaten | |
| AT268323B (de) | Verfahren zur Herstellung von neuen 3,1-Benzothiazin-Derivaten und ihren Salzen | |
| DE959551C (de) | Verfahren zur Herstellung von 4-substituierten 1-Carbobenzoxypiperazinen | |
| DE1468351C (de) | Verfahren zur Herstellung von Hydro Chloriden von N Aryl und N Heteroarlyami dinen | |
| EP0611757B1 (de) | Verfahren zur Herstellung von Azaphenothiazinen | |
| DE1806581C3 (de) | Verfahren zur Herstellung von Sulfamytanthranilsäuren | |
| DE1445547B2 (de) | Verfahren zur Herstellung von 3-Amino-2,1-benzoisot triazolen | |
| AT223189B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| DE1136693B (de) | Verfahren zur Herstellung von basisch substituierten Thiolcarbaminsaeure-alkylestern | |
| AT272353B (de) | Verfahren zur Herstellung von basisch substituierten Phthalazonen sowie ihren Salzen und quaternären Ammoniumverbindungen | |
| EP0126923B1 (de) | Verfahren zur Herstellung von 4-substituierten Acetessigsäurederivaten | |
| DE1085524B (de) | Verfahren zur Herstellung von Phosphorsaeure-alkylalkinylestermonoamiden | |
| DE2458823A1 (de) | Verfahren zur herstellung von chlorthiazolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: VOSSIUS, V., DIPL.-CHEM. DR.RER.NAT. TAUCHNER, P., |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: TAUCHNER, P., DIPL.-CHEM. DR.RER.NAT. HEUNEMANN, D., DIPL.-PHYS. DR.RER.NAT., PAT.-ANWAELTE, 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |