CA1093081A - Process for the production of aryl ureas - Google Patents
Process for the production of aryl ureasInfo
- Publication number
- CA1093081A CA1093081A CA300,467A CA300467A CA1093081A CA 1093081 A CA1093081 A CA 1093081A CA 300467 A CA300467 A CA 300467A CA 1093081 A CA1093081 A CA 1093081A
- Authority
- CA
- Canada
- Prior art keywords
- isoxazolyl
- butyl
- process according
- group
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 aryl ureas Chemical class 0.000 title claims description 30
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 235000013877 carbamide Nutrition 0.000 title description 5
- 150000001412 amines Chemical class 0.000 claims abstract description 14
- 239000002841 Lewis acid Substances 0.000 claims abstract description 10
- 150000007517 lewis acids Chemical class 0.000 claims abstract description 10
- 150000003672 ureas Chemical class 0.000 claims abstract description 9
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 5
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract 6
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- JLLJHQLUZAKJFH-UHFFFAOYSA-N Isouron Chemical group CN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 JLLJHQLUZAKJFH-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 abstract description 4
- 239000012442 inert solvent Substances 0.000 abstract description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- GGXGVZJHUKEJHO-UHFFFAOYSA-N 5-tert-butyl-1,2-oxazol-3-amine Chemical compound CC(C)(C)C1=CC(N)=NO1 GGXGVZJHUKEJHO-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 3
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- XMXLBDNVSIHRRA-UHFFFAOYSA-N 4,5-dimethyl-1,3-thiazol-2-amine Chemical compound CC=1N=C(N)SC=1C XMXLBDNVSIHRRA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- SUCONPINCPEQKC-UHFFFAOYSA-N 1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)urea Chemical compound CN(C)C(=O)NC1=NC(C)=CS1 SUCONPINCPEQKC-UHFFFAOYSA-N 0.000 description 1
- XRMHIRYPZQIKKK-UHFFFAOYSA-N 1,1-dimethyl-3-pyridin-2-ylurea Chemical compound CN(C)C(=O)NC1=CC=CC=N1 XRMHIRYPZQIKKK-UHFFFAOYSA-N 0.000 description 1
- UMDOQTDANJTGJY-UHFFFAOYSA-N 1,3-bis(5-tert-butyl-1,2-oxazol-3-yl)urea Chemical compound O1C(C(C)(C)C)=CC(NC(=O)NC2=NOC(=C2)C(C)(C)C)=N1 UMDOQTDANJTGJY-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- AMIJSEIHRANBNZ-UHFFFAOYSA-N 3-(1,3-benzothiazol-2-yl)-1,1-dimethylurea Chemical compound C1=CC=C2SC(NC(=O)N(C)C)=NC2=C1 AMIJSEIHRANBNZ-UHFFFAOYSA-N 0.000 description 1
- PXLGYEQYNXNGTC-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-ethyl-1-methylurea Chemical compound CCN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 PXLGYEQYNXNGTC-UHFFFAOYSA-N 0.000 description 1
- IMIXYLFTWDRFHY-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methoxy-1-methylurea Chemical compound CON(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 IMIXYLFTWDRFHY-UHFFFAOYSA-N 0.000 description 1
- KCIPJIIZEPMNPU-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-1-prop-2-enylurea Chemical compound C=CCN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 KCIPJIIZEPMNPU-UHFFFAOYSA-N 0.000 description 1
- OUQMXTJYCAJLGO-UHFFFAOYSA-N 4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(N)=N1 OUQMXTJYCAJLGO-UHFFFAOYSA-N 0.000 description 1
- GWQWXJZWEMTWLH-UHFFFAOYSA-N 4-tert-butyl-1,2-oxazol-3-amine Chemical compound CC(C)(C)C1=CON=C1N GWQWXJZWEMTWLH-UHFFFAOYSA-N 0.000 description 1
- VLQBYPSKWKIMPS-UHFFFAOYSA-N 5-phenyl-1,2-thiazol-3-amine Chemical compound S1N=C(N)C=C1C1=CC=CC=C1 VLQBYPSKWKIMPS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910010066 TiC14 Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- XZVYDRLPXWFRIS-UHFFFAOYSA-N n-ethyl-n-methylcarbamoyl chloride Chemical compound CCN(C)C(Cl)=O XZVYDRLPXWFRIS-UHFFFAOYSA-N 0.000 description 1
- SHQJHXLWZDMQEJ-UHFFFAOYSA-N n-methoxy-n-methylcarbamoyl chloride Chemical compound CON(C)C(Cl)=O SHQJHXLWZDMQEJ-UHFFFAOYSA-N 0.000 description 1
- UEKTZPNFEQJPLZ-UHFFFAOYSA-N n-methyl-n-prop-2-enylcarbamoyl chloride Chemical compound ClC(=O)N(C)CC=C UEKTZPNFEQJPLZ-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52049629A JPS6033109B2 (ja) | 1977-04-28 | 1977-04-28 | 尿素誘導体の合成法 |
| JP49629/1977 | 1977-04-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1093081A true CA1093081A (en) | 1981-01-06 |
Family
ID=12836505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA300,467A Expired CA1093081A (en) | 1977-04-28 | 1978-04-05 | Process for the production of aryl ureas |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4183856A (enExample) |
| JP (1) | JPS6033109B2 (enExample) |
| AR (1) | AR225666A1 (enExample) |
| AU (1) | AU513688B2 (enExample) |
| BE (1) | BE866581A (enExample) |
| BG (1) | BG33278A3 (enExample) |
| BR (1) | BR7802618A (enExample) |
| CA (1) | CA1093081A (enExample) |
| CH (1) | CH633542A5 (enExample) |
| CS (1) | CS198297B2 (enExample) |
| DD (1) | DD135905A5 (enExample) |
| DE (1) | DE2818947A1 (enExample) |
| DK (1) | DK144011C (enExample) |
| ES (1) | ES468897A1 (enExample) |
| FR (1) | FR2388802A1 (enExample) |
| GB (1) | GB1572976A (enExample) |
| HU (1) | HU176881B (enExample) |
| IE (1) | IE46769B1 (enExample) |
| IL (1) | IL54468A0 (enExample) |
| IT (1) | IT1111465B (enExample) |
| NL (1) | NL183513C (enExample) |
| PL (1) | PL110681B1 (enExample) |
| SE (1) | SE442867B (enExample) |
| SU (1) | SU1091853A3 (enExample) |
| YU (1) | YU40334B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8422461D0 (en) * | 1984-09-05 | 1984-10-10 | Wyeth John & Brother Ltd | Pyridine derivatives |
| US4808722A (en) * | 1985-10-31 | 1989-02-28 | Fmc Corporation | Pyridinylurea N-oxide compounds and agricultural uses |
| ATE103589T1 (de) * | 1989-11-10 | 1994-04-15 | Agrolinz Agrarchemikalien | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe. |
| DE3940261A1 (de) * | 1989-12-06 | 1991-06-13 | Agrolinz Agrarchemikalien Muen | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe |
| US20030171411A1 (en) * | 2001-12-21 | 2003-09-11 | Kodra Janos Tibor | Amide derivatives as therapeutic agents |
| MXPA05000130A (es) * | 2002-06-27 | 2005-02-17 | Novo Nordisk As | Derivados de aril-carbonilo como agentes terapeuticos. |
| PL1723128T3 (pl) * | 2004-01-06 | 2013-04-30 | Novo Nordisk As | Pochodne heteroarylowe mocznika oraz ich zastosowanie jako aktywatory glukokinazy |
| WO2007006761A1 (en) * | 2005-07-08 | 2007-01-18 | Novo Nordisk A/S | Dicycloalkylcarbamoyl ureas as glucokinase activators |
| EP1904466A1 (en) * | 2005-07-08 | 2008-04-02 | Novo Nordisk A/S | Dicycloalkyl urea glucokinase activators |
| US7884210B2 (en) | 2005-07-14 | 2011-02-08 | Novo Nordisk A/S | Ureido-thiazole glucokinase activators |
| WO2008084043A1 (en) * | 2007-01-09 | 2008-07-17 | Novo Nordisk A/S | Urea glucokinase activators |
| US8318778B2 (en) * | 2007-01-11 | 2012-11-27 | Novo Nordisk A/S | Urea glucokinase activators |
| EP4487909A3 (en) | 2018-06-12 | 2025-03-19 | vTv Therapeutics LLC | Therapeutic uses of glucokinase activators in combination with insulin or insulin analogs |
| US12391658B2 (en) | 2020-02-18 | 2025-08-19 | Vtv Therapeutics Llc | Sulfoxide and sulfone glucokinase activators and methods of use thereof |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2755285A (en) * | 1956-07-17 | I-xsubstituted | ||
| US2756135A (en) * | 1955-07-13 | 1956-07-24 | Du Pont | 1-methyl-3-(2-benzothiazolyl)-ureas and their use as herbicides |
| DE1209801B (de) * | 1963-05-11 | 1966-01-27 | Bayer Ag | Unkrautbekaempfung in Rueben |
| US3293257A (en) * | 1964-09-14 | 1966-12-20 | United States Borax Chem | Pyridyl urea compounds |
| FR1533184A (fr) * | 1965-04-06 | 1968-07-19 | Pechiney Saint Gobain | Dérivés du thiazole |
| DE1620448C3 (de) * | 1965-05-08 | 1974-08-29 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Harnstoff- bzw. Thioharnstoffderivate des 3-Methylisothiazols |
| US3622593A (en) * | 1967-08-09 | 1971-11-23 | Fmc Corp | 1,1-dimethyl-3-(isothiazol-5-yl)urea |
| US3547940A (en) * | 1967-10-31 | 1970-12-15 | Du Pont | Substituted ureido isoxazoles |
| GB1266769A (enExample) * | 1969-08-15 | 1972-03-15 | ||
| JPS5031039A (enExample) * | 1973-07-27 | 1975-03-27 | ||
| US4062861A (en) * | 1973-07-27 | 1977-12-13 | Shionogi & Co., Ltd. | 3-Isoxazolylurea derivatives |
| US4013706A (en) * | 1973-11-14 | 1977-03-22 | Sucreries Du Soissonnais Et Compagnie Sucriere | Derivatives of substituted urea, acyl ureas, and sulphonyl ureas, and a process for producing the same |
| US4046770A (en) * | 1974-08-30 | 1977-09-06 | Eli Lilly And Company | N-(6-acyloxybenzothiazol-2-yl)-N'-phenyl (or substituted phenyl)ureas |
| JPS5810361B2 (ja) * | 1974-10-04 | 1983-02-25 | 塩野義製薬株式会社 | 3−アルチルイソオキサゾ−ル系除草剤 |
-
1977
- 1977-04-28 JP JP52049629A patent/JPS6033109B2/ja not_active Expired
-
1978
- 1978-04-05 CA CA300,467A patent/CA1093081A/en not_active Expired
- 1978-04-05 GB GB13400/78A patent/GB1572976A/en not_active Expired
- 1978-04-10 US US05/895,105 patent/US4183856A/en not_active Expired - Lifetime
- 1978-04-10 IL IL54468A patent/IL54468A0/xx not_active IP Right Cessation
- 1978-04-11 IE IE707/78A patent/IE46769B1/en not_active IP Right Cessation
- 1978-04-18 ES ES468897A patent/ES468897A1/es not_active Expired
- 1978-04-21 SE SE7804596A patent/SE442867B/sv not_active IP Right Cessation
- 1978-04-25 DK DK180378A patent/DK144011C/da not_active IP Right Cessation
- 1978-04-26 AU AU35468/78A patent/AU513688B2/en not_active Expired
- 1978-04-27 IT IT67959/78A patent/IT1111465B/it active
- 1978-04-27 HU HU78SI1624A patent/HU176881B/hu not_active IP Right Cessation
- 1978-04-27 BR BR7802618A patent/BR7802618A/pt unknown
- 1978-04-27 FR FR7812529A patent/FR2388802A1/fr active Granted
- 1978-04-27 NL NLAANVRAGE7804550,A patent/NL183513C/xx not_active IP Right Cessation
- 1978-04-27 DD DD78205055A patent/DD135905A5/xx unknown
- 1978-04-28 DE DE19782818947 patent/DE2818947A1/de active Granted
- 1978-04-28 YU YU1037/78A patent/YU40334B/xx unknown
- 1978-04-28 BG BG039586A patent/BG33278A3/xx unknown
- 1978-04-28 BE BE187289A patent/BE866581A/xx not_active IP Right Cessation
- 1978-04-28 CH CH470378A patent/CH633542A5/de not_active IP Right Cessation
- 1978-04-28 CS CS782773A patent/CS198297B2/cs unknown
- 1978-04-28 SU SU782608147A patent/SU1091853A3/ru active
- 1978-04-28 PL PL1978206450A patent/PL110681B1/pl unknown
-
1981
- 1981-04-10 AR AR284939A patent/AR225666A1/es active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5679678A (en) | Thienithiazine derivatives | |
| CA1093081A (en) | Process for the production of aryl ureas | |
| Burger et al. | Antimalarials. III. Benzothiazole amino alcohols | |
| SE456581B (sv) | Mellanprodukter for framstellning av 3,4-disubstituerade 1,2,5-tiadiazol-1-oxider och -1,1-dioxider som er h 71-receptorantagonister | |
| CA1102341A (en) | Isoxazole derivatives, process for their manufacture and agents containing these compounds | |
| FI63573C (fi) | Foerfarande foer framstaellning av oxibensotiazin-dioxiders kaboxamider | |
| NO146096B (no) | Analogifremgangsmaate ved fremstilling av thienothiazinderivater | |
| US3891637A (en) | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides | |
| Zinnes et al. | 1, 2-Benzothiazines. 6. 3-Carbamoyl-4-hydroxy-2H-1, 2-benzothiazine 1, 1-dioxides as antiinflammatory agents | |
| US4104388A (en) | 3-Substituted benzisothiazole, 1,1-dioxides | |
| NO770161L (no) | Tiazolidinderivater og fremgangsm}te til deres fremstilling. | |
| US4082757A (en) | Amides of 4-hydroxy-6H-thieno[2,3-b]thiopyran-5-carboxylic acid-7,7-dioxide | |
| Jouve et al. | Oxidative cyclization of n‐methyl‐and n‐benzoylpyridylthioureas. Preparation of new thiazolo [4, 5‐b] and [5, 4‐b] pyridine derivatives | |
| US4090020A (en) | Thienothiazine derivatives | |
| PL95852B1 (pl) | Sposob wytwarzania nowych acylowanych pochodnych 2-aminotiazoli | |
| El‐Meligie et al. | Synthesis and cytotoxic activity of certain new arylazothiazole containing compounds | |
| US4289765A (en) | 4-Aminopyridines and medicaments containing the same | |
| JPH0546356B2 (enExample) | ||
| Chung et al. | Synthesis of 3-fluoro-2-substituted amino-5, 12-dihydro-5-oxobenzoxazolo [3, 2-a] quinoline-6-carboxylic acids employing the tandem double ring closure reaction of N-acetyl-N-(2-hydroxyphenyl) anthranilic acid as the key step | |
| US4254259A (en) | 2-Amino-5-ethylovalyl-6H-1,3,4-thiadiazine oxime | |
| Castro et al. | Intramolecular oxidative cyclizations in heteroarylthioureas: A versatile pathway to bridgehead heterocyclic systems | |
| IE46185B1 (en) | 2,5-dihydro-1,2-thiazino (5,6-b)indol-3-carboxamide-1,1-dioxid derivatives | |
| CS209542B2 (en) | Method of making the 2,6-bis(aminoacylamino)-benzo-1,2-d:5,4-d-bisthiazole and 2-amino-6-(aminoacylamino)-benzo 1,2-d:5,4-d-bisthiazole derivatives | |
| US5008390A (en) | Compounds for preparing 6-phenyl-2,3-dihydroimidazo[2,1-b]-thiazoles and corresponding thiazines | |
| KR810000116B1 (ko) | 요소 유도체의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |