SE442867B - Forfarande for framstellning av karbamidderivat - Google Patents
Forfarande for framstellning av karbamidderivatInfo
- Publication number
- SE442867B SE442867B SE7804596A SE7804596A SE442867B SE 442867 B SE442867 B SE 442867B SE 7804596 A SE7804596 A SE 7804596A SE 7804596 A SE7804596 A SE 7804596A SE 442867 B SE442867 B SE 442867B
- Authority
- SE
- Sweden
- Prior art keywords
- butyl
- urea
- isoxazolyl
- process according
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 150000003672 ureas Chemical class 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 4
- -1 3-isoxazolyl Chemical group 0.000 claims description 24
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 11
- 239000002841 Lewis acid Substances 0.000 claims description 9
- 150000007517 lewis acids Chemical class 0.000 claims description 9
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 6
- JLLJHQLUZAKJFH-UHFFFAOYSA-N Isouron Chemical group CN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 JLLJHQLUZAKJFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 6
- GGXGVZJHUKEJHO-UHFFFAOYSA-N 5-tert-butyl-1,2-oxazol-3-amine Chemical compound CC(C)(C)C1=CC(N)=NO1 GGXGVZJHUKEJHO-UHFFFAOYSA-N 0.000 description 5
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- XMXLBDNVSIHRRA-UHFFFAOYSA-N 4,5-dimethyl-1,3-thiazol-2-amine Chemical compound CC=1N=C(N)SC=1C XMXLBDNVSIHRRA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- SUCONPINCPEQKC-UHFFFAOYSA-N 1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)urea Chemical compound CN(C)C(=O)NC1=NC(C)=CS1 SUCONPINCPEQKC-UHFFFAOYSA-N 0.000 description 1
- NYDCIKWIMJJMJX-UHFFFAOYSA-N 1,1-dimethyl-3-(5-phenyl-1,2-thiazol-3-yl)urea Chemical compound S1N=C(NC(=O)N(C)C)C=C1C1=CC=CC=C1 NYDCIKWIMJJMJX-UHFFFAOYSA-N 0.000 description 1
- XRMHIRYPZQIKKK-UHFFFAOYSA-N 1,1-dimethyl-3-pyridin-2-ylurea Chemical compound CN(C)C(=O)NC1=CC=CC=N1 XRMHIRYPZQIKKK-UHFFFAOYSA-N 0.000 description 1
- UMDOQTDANJTGJY-UHFFFAOYSA-N 1,3-bis(5-tert-butyl-1,2-oxazol-3-yl)urea Chemical compound O1C(C(C)(C)C)=CC(NC(=O)NC2=NOC(=C2)C(C)(C)C)=N1 UMDOQTDANJTGJY-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- PIFBWXULXGPZKO-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1,1-diethylurea Chemical compound CCN(CC)C(=O)NC=1C=C(C(C)(C)C)ON=1 PIFBWXULXGPZKO-UHFFFAOYSA-N 0.000 description 1
- KCIPJIIZEPMNPU-UHFFFAOYSA-N 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-1-prop-2-enylurea Chemical compound C=CCN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 KCIPJIIZEPMNPU-UHFFFAOYSA-N 0.000 description 1
- VLQBYPSKWKIMPS-UHFFFAOYSA-N 5-phenyl-1,2-thiazol-3-amine Chemical compound S1N=C(N)C=C1C1=CC=CC=C1 VLQBYPSKWKIMPS-UHFFFAOYSA-N 0.000 description 1
- GOYSWVUGDCGCPI-UHFFFAOYSA-N 5-tert-butyl-1,2-oxazole Chemical compound CC(C)(C)C1=CC=NO1 GOYSWVUGDCGCPI-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000412750 Cicones Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- XZVYDRLPXWFRIS-UHFFFAOYSA-N n-ethyl-n-methylcarbamoyl chloride Chemical compound CCN(C)C(Cl)=O XZVYDRLPXWFRIS-UHFFFAOYSA-N 0.000 description 1
- SHQJHXLWZDMQEJ-UHFFFAOYSA-N n-methoxy-n-methylcarbamoyl chloride Chemical compound CON(C)C(Cl)=O SHQJHXLWZDMQEJ-UHFFFAOYSA-N 0.000 description 1
- UEKTZPNFEQJPLZ-UHFFFAOYSA-N n-methyl-n-prop-2-enylcarbamoyl chloride Chemical compound ClC(=O)N(C)CC=C UEKTZPNFEQJPLZ-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52049629A JPS6033109B2 (ja) | 1977-04-28 | 1977-04-28 | 尿素誘導体の合成法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7804596L SE7804596L (sv) | 1978-10-29 |
| SE442867B true SE442867B (sv) | 1986-02-03 |
Family
ID=12836505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7804596A SE442867B (sv) | 1977-04-28 | 1978-04-21 | Forfarande for framstellning av karbamidderivat |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4183856A (enExample) |
| JP (1) | JPS6033109B2 (enExample) |
| AR (1) | AR225666A1 (enExample) |
| AU (1) | AU513688B2 (enExample) |
| BE (1) | BE866581A (enExample) |
| BG (1) | BG33278A3 (enExample) |
| BR (1) | BR7802618A (enExample) |
| CA (1) | CA1093081A (enExample) |
| CH (1) | CH633542A5 (enExample) |
| CS (1) | CS198297B2 (enExample) |
| DD (1) | DD135905A5 (enExample) |
| DE (1) | DE2818947A1 (enExample) |
| DK (1) | DK144011C (enExample) |
| ES (1) | ES468897A1 (enExample) |
| FR (1) | FR2388802A1 (enExample) |
| GB (1) | GB1572976A (enExample) |
| HU (1) | HU176881B (enExample) |
| IE (1) | IE46769B1 (enExample) |
| IL (1) | IL54468A0 (enExample) |
| IT (1) | IT1111465B (enExample) |
| NL (1) | NL183513C (enExample) |
| PL (1) | PL110681B1 (enExample) |
| SE (1) | SE442867B (enExample) |
| SU (1) | SU1091853A3 (enExample) |
| YU (1) | YU40334B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8422461D0 (en) * | 1984-09-05 | 1984-10-10 | Wyeth John & Brother Ltd | Pyridine derivatives |
| US4808722A (en) * | 1985-10-31 | 1989-02-28 | Fmc Corporation | Pyridinylurea N-oxide compounds and agricultural uses |
| ATE103589T1 (de) * | 1989-11-10 | 1994-04-15 | Agrolinz Agrarchemikalien | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe. |
| DE3940261A1 (de) * | 1989-12-06 | 1991-06-13 | Agrolinz Agrarchemikalien Muen | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe |
| HUP0402309A3 (en) * | 2001-12-21 | 2008-09-29 | Novo Nordisk As | Amide derivatives as glucokinase activators and pharmaceutical compositions containing them |
| EP2471533A1 (en) * | 2002-06-27 | 2012-07-04 | Novo Nordisk A/S | Aryl carbonyl derivatives as therapeutic agents |
| AU2005203930C1 (en) | 2004-01-06 | 2012-02-23 | Vtv Therapeutics Llc | Heteroaryl-ureas and their use as glucokinase activators |
| JP2009500378A (ja) * | 2005-07-08 | 2009-01-08 | ノボ・ノルデイスク・エー/エス | グルコキナーゼ活性化剤としてのジシクロアルキルカルバモイル尿素 |
| CA2614518A1 (en) * | 2005-07-08 | 2007-01-18 | Novo-Nordisk A/S | Dicycloalkyl urea glucokinase activators |
| CN101263131B (zh) * | 2005-07-14 | 2013-04-24 | 特兰斯特克药品公司 | 脲葡糖激酶活化剂 |
| US8138185B2 (en) * | 2007-01-09 | 2012-03-20 | Novo Nordisk A/S | Urea glucokinase activators |
| AU2008204530B2 (en) | 2007-01-11 | 2013-08-01 | Vtv Therapeutics Llc | Urea glucokinase activators |
| CA3093025A1 (en) | 2018-06-12 | 2019-12-19 | Vtv Therapeutics Llc | Therapeutic uses of glucokinase activators in combination with insulin or insulin analogs |
| US12391658B2 (en) | 2020-02-18 | 2025-08-19 | Vtv Therapeutics Llc | Sulfoxide and sulfone glucokinase activators and methods of use thereof |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2755285A (en) * | 1956-07-17 | I-xsubstituted | ||
| US2756135A (en) * | 1955-07-13 | 1956-07-24 | Du Pont | 1-methyl-3-(2-benzothiazolyl)-ureas and their use as herbicides |
| DE1209801B (de) * | 1963-05-11 | 1966-01-27 | Bayer Ag | Unkrautbekaempfung in Rueben |
| US3293257A (en) * | 1964-09-14 | 1966-12-20 | United States Borax Chem | Pyridyl urea compounds |
| FR1533184A (fr) * | 1965-04-06 | 1968-07-19 | Pechiney Saint Gobain | Dérivés du thiazole |
| DE1620448C3 (de) * | 1965-05-08 | 1974-08-29 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Harnstoff- bzw. Thioharnstoffderivate des 3-Methylisothiazols |
| US3622593A (en) * | 1967-08-09 | 1971-11-23 | Fmc Corp | 1,1-dimethyl-3-(isothiazol-5-yl)urea |
| US3547940A (en) * | 1967-10-31 | 1970-12-15 | Du Pont | Substituted ureido isoxazoles |
| GB1266769A (enExample) * | 1969-08-15 | 1972-03-15 | ||
| US4062861A (en) * | 1973-07-27 | 1977-12-13 | Shionogi & Co., Ltd. | 3-Isoxazolylurea derivatives |
| JPS5031039A (enExample) * | 1973-07-27 | 1975-03-27 | ||
| US4013706A (en) * | 1973-11-14 | 1977-03-22 | Sucreries Du Soissonnais Et Compagnie Sucriere | Derivatives of substituted urea, acyl ureas, and sulphonyl ureas, and a process for producing the same |
| US4046770A (en) * | 1974-08-30 | 1977-09-06 | Eli Lilly And Company | N-(6-acyloxybenzothiazol-2-yl)-N'-phenyl (or substituted phenyl)ureas |
| JPS5810361B2 (ja) * | 1974-10-04 | 1983-02-25 | 塩野義製薬株式会社 | 3−アルチルイソオキサゾ−ル系除草剤 |
-
1977
- 1977-04-28 JP JP52049629A patent/JPS6033109B2/ja not_active Expired
-
1978
- 1978-04-05 GB GB13400/78A patent/GB1572976A/en not_active Expired
- 1978-04-05 CA CA300,467A patent/CA1093081A/en not_active Expired
- 1978-04-10 IL IL54468A patent/IL54468A0/xx not_active IP Right Cessation
- 1978-04-10 US US05/895,105 patent/US4183856A/en not_active Expired - Lifetime
- 1978-04-11 IE IE707/78A patent/IE46769B1/en not_active IP Right Cessation
- 1978-04-18 ES ES468897A patent/ES468897A1/es not_active Expired
- 1978-04-21 SE SE7804596A patent/SE442867B/sv not_active IP Right Cessation
- 1978-04-25 DK DK180378A patent/DK144011C/da not_active IP Right Cessation
- 1978-04-26 AU AU35468/78A patent/AU513688B2/en not_active Expired
- 1978-04-27 DD DD78205055A patent/DD135905A5/xx unknown
- 1978-04-27 HU HU78SI1624A patent/HU176881B/hu not_active IP Right Cessation
- 1978-04-27 NL NLAANVRAGE7804550,A patent/NL183513C/xx not_active IP Right Cessation
- 1978-04-27 FR FR7812529A patent/FR2388802A1/fr active Granted
- 1978-04-27 BR BR7802618A patent/BR7802618A/pt unknown
- 1978-04-27 IT IT67959/78A patent/IT1111465B/it active
- 1978-04-28 YU YU1037/78A patent/YU40334B/xx unknown
- 1978-04-28 BG BG039586A patent/BG33278A3/xx unknown
- 1978-04-28 SU SU782608147A patent/SU1091853A3/ru active
- 1978-04-28 CS CS782773A patent/CS198297B2/cs unknown
- 1978-04-28 DE DE19782818947 patent/DE2818947A1/de active Granted
- 1978-04-28 PL PL1978206450A patent/PL110681B1/pl unknown
- 1978-04-28 CH CH470378A patent/CH633542A5/de not_active IP Right Cessation
- 1978-04-28 BE BE187289A patent/BE866581A/xx not_active IP Right Cessation
-
1981
- 1981-04-10 AR AR284939A patent/AR225666A1/es active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4113731A (en) | Fused isoquinoline derivatives | |
| SE442867B (sv) | Forfarande for framstellning av karbamidderivat | |
| Newkome et al. | Chemistry of heterocyclic compounds. Part 119. Synthesis of halogenated terpyridines and incorporation of the terpyridine nucleus into a polyetheral macrocycle | |
| NL8203410A (nl) | Alkanoylaniliden. | |
| EP2424848B1 (en) | Process for the preparation of [4-(2-chloro-4-methoxy-5-methylphenyl)-5-methyl-thiazol-2-yl]-[2-cyclopropyl-1-(3-fluoro-4-methylphenyl)-ethyl]-amine | |
| NO762661L (enExample) | ||
| Crank et al. | Photochemistry of heterocyclics. III. Photolysis of various 2-substituted benzimidazoles | |
| SE439307B (sv) | Mellanprodukter for framstellning av pyrimido(6,1-a)isokinolin-4-on-derivat och forfarande for framstellning av mellanprodukterna | |
| HU214216B (hu) | Eljárás szubsztituált N-(aril)-1,2,4-triazolopirimidin-2-szulfonamid-származékok előállítására | |
| De Kimpe et al. | A Novel synthesis of 2-imino-4-thiazolines via α-bromoketimines | |
| Zinnes et al. | 1, 2-Benzothiazines. 6. 3-Carbamoyl-4-hydroxy-2H-1, 2-benzothiazine 1, 1-dioxides as antiinflammatory agents | |
| SE439309B (sv) | Analogiforfarande for framstellning av 1-azaxanton-3-karboxylsyraderivat | |
| US4226799A (en) | α-Aminomethylene-β-formylaminopropionitrile and its manufacture | |
| JPH0641135A (ja) | イミダゾプテリジン誘導体及びその製造方法 | |
| US3523119A (en) | Process of producing pyrimidine-5-carboxylic acid with a basic substituent in the 4-position | |
| Ma̧kosza et al. | Vicarious nucleophilic substitution of hydrogen proceeding via heterocyclic ring opening | |
| US5008390A (en) | Compounds for preparing 6-phenyl-2,3-dihydroimidazo[2,1-b]-thiazoles and corresponding thiazines | |
| EP0404134B1 (en) | Organosilicon compounds and method for their preparation | |
| US20040002538A1 (en) | 4-Thio coumarins | |
| Razus et al. | Azulene‐substituted pyridines and pyridinium salts. Synthesis and structure. 1. Azulene‐substituted pyridines | |
| FI73680C (fi) | Foerfarande foer framstaellning av terapeutiskt verksam 5,11-dihydro-11-/(4-metyl-1-piperazinyl)- acetyl/-6h-pyrido/2,3-b//1,4/benzodiazepin-6-on. | |
| EP0203787A2 (en) | Process for preparing pyridyl-substituted imidazo[2,1-b]thiazoles and thiazines | |
| Hassaneen et al. | A facile Synthesis of arylazoselenazoles and of aroylselenadiazoles | |
| US3129216A (en) | S-basic substituted-s-dibenso-fb | |
| US2794803A (en) | Substituted pyridines and their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7804596-0 Effective date: 19931110 Format of ref document f/p: F |