DE2802962A1 - Halogenierte ester, verfahren zu ihrer herstellung und sie enthaltende insektizide zusammensetzungen - Google Patents
Halogenierte ester, verfahren zu ihrer herstellung und sie enthaltende insektizide zusammensetzungenInfo
- Publication number
- DE2802962A1 DE2802962A1 DE19782802962 DE2802962A DE2802962A1 DE 2802962 A1 DE2802962 A1 DE 2802962A1 DE 19782802962 DE19782802962 DE 19782802962 DE 2802962 A DE2802962 A DE 2802962A DE 2802962 A1 DE2802962 A1 DE 2802962A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- trans
- symbols
- chlorine
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 title claims description 110
- 150000002148 esters Chemical class 0.000 title claims description 35
- 230000000749 insecticidal effect Effects 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 220
- 239000000460 chlorine Substances 0.000 claims description 74
- 238000000034 method Methods 0.000 claims description 63
- 238000002360 preparation method Methods 0.000 claims description 46
- -1 phenoxybenzyloxy Chemical group 0.000 claims description 43
- 229910052801 chlorine Inorganic materials 0.000 claims description 42
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 38
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 241000607479 Yersinia pestis Species 0.000 claims description 31
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 28
- 229910052731 fluorine Inorganic materials 0.000 claims description 28
- 239000011737 fluorine Substances 0.000 claims description 28
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 26
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 26
- 229910052794 bromium Inorganic materials 0.000 claims description 26
- 239000002253 acid Substances 0.000 claims description 25
- 150000002431 hydrogen Chemical class 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 239000004480 active ingredient Substances 0.000 claims description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 239000002585 base Substances 0.000 claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 150000001993 dienes Chemical class 0.000 claims description 10
- SRAKKNOEHFCVLC-UJURSFKZSA-N (1s,3s)-2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C=C(C(F)(F)F)C(F)(F)F)[C@@H]1C(O)=O SRAKKNOEHFCVLC-UJURSFKZSA-N 0.000 claims description 9
- 241000238631 Hexapoda Species 0.000 claims description 9
- 125000004494 ethyl ester group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 239000002917 insecticide Substances 0.000 claims description 9
- SPVZAYWHHVLPBN-UJURSFKZSA-N (1s,3r)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C=C(Cl)C(F)(F)F)[C@@H]1C(O)=O SPVZAYWHHVLPBN-UJURSFKZSA-N 0.000 claims description 8
- 125000005907 alkyl ester group Chemical group 0.000 claims description 8
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 8
- 150000004820 halides Chemical class 0.000 claims description 8
- 241000238876 Acari Species 0.000 claims description 7
- BXEFQPCKQSTMKA-UHFFFAOYSA-N OC(=O)C=[N+]=[N-] Chemical compound OC(=O)C=[N+]=[N-] BXEFQPCKQSTMKA-UHFFFAOYSA-N 0.000 claims description 6
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 5
- 125000001188 haloalkyl group Chemical group 0.000 claims description 5
- 150000002576 ketones Chemical class 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- SPVZAYWHHVLPBN-XINAWCOVSA-N (1R,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@H](C=C(Cl)C(F)(F)F)[C@H]1C(O)=O SPVZAYWHHVLPBN-XINAWCOVSA-N 0.000 claims description 4
- 229910014033 C-OH Inorganic materials 0.000 claims description 4
- 229910014570 C—OH Inorganic materials 0.000 claims description 4
- 241001465754 Metazoa Species 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 230000018044 dehydration Effects 0.000 claims description 4
- 238000006297 dehydration reaction Methods 0.000 claims description 4
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 claims description 4
- SRAKKNOEHFCVLC-XINAWCOVSA-N (1R,3R)-2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@H](C=C(C(F)(F)F)C(F)(F)F)[C@H]1C(O)=O SRAKKNOEHFCVLC-XINAWCOVSA-N 0.000 claims description 3
- IQJADVFBZGJGSI-UHFFFAOYSA-N 1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane Chemical compound FC(F)(Cl)C(F)(F)C(Cl)(Cl)Cl IQJADVFBZGJGSI-UHFFFAOYSA-N 0.000 claims description 3
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 claims description 3
- 239000012024 dehydrating agents Substances 0.000 claims description 3
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 claims description 3
- 239000003999 initiator Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- SFDHQPVAKUMKHZ-UJURSFKZSA-N (1S,3R)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound ClC(C(=C[C@@H]1C([C@H]1C(=O)O)(C)C)F)(F)F SFDHQPVAKUMKHZ-UJURSFKZSA-N 0.000 claims description 2
- CALRXIQBQWFLRG-UHFFFAOYSA-N 1,1,1-tribromo-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Br)(Br)Br CALRXIQBQWFLRG-UHFFFAOYSA-N 0.000 claims description 2
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 claims description 2
- PSVOCRUYXNEMNE-UHFFFAOYSA-N 1,1,3-trichloro-1,2,2,3,3-pentafluoropropane Chemical compound FC(F)(Cl)C(F)(F)C(F)(Cl)Cl PSVOCRUYXNEMNE-UHFFFAOYSA-N 0.000 claims description 2
- BAMUEXIPKSRTBS-UHFFFAOYSA-N 1,1-dichloro-1,2,2,2-tetrafluoroethane Chemical compound FC(F)(F)C(F)(Cl)Cl BAMUEXIPKSRTBS-UHFFFAOYSA-N 0.000 claims description 2
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 claims description 2
- RFCAUADVODFSLZ-UHFFFAOYSA-N 1-Chloro-1,1,2,2,2-pentafluoroethane Chemical compound FC(F)(F)C(F)(F)Cl RFCAUADVODFSLZ-UHFFFAOYSA-N 0.000 claims description 2
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 claims description 2
- WQDXTCBPMVZTOI-PKOBYXMFSA-N CC1([C@H]([C@@H]1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C=C(C(F)(F)F)C(F)(F)F)C Chemical compound CC1([C@H]([C@@H]1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C=C(C(F)(F)F)C(F)(F)F)C WQDXTCBPMVZTOI-PKOBYXMFSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 239000004340 Chloropentafluoroethane Substances 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000004703 alkoxides Chemical class 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 235000019406 chloropentafluoroethane Nutrition 0.000 claims description 2
- WMIYKQLTONQJES-UHFFFAOYSA-N hexafluoroethane Chemical compound FC(F)(F)C(F)(F)F WMIYKQLTONQJES-UHFFFAOYSA-N 0.000 claims description 2
- 150000003608 titanium Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims 2
- ZQLGLECESPYTLB-IONNQARKSA-N (1S,3R)-3-[2-bromo-4-fluoro-3,3-bis(fluoromethyl)but-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound BrC(=C[C@@H]1C([C@H]1C(=O)O)(C)C)C(CF)(CF)CF ZQLGLECESPYTLB-IONNQARKSA-N 0.000 claims 1
- RTRBHVOKZNZJDH-PKOBYXMFSA-N (3-phenoxyphenyl)methyl (1s,3r)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)C(F)(F)F)[C@@H]1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RTRBHVOKZNZJDH-PKOBYXMFSA-N 0.000 claims 1
- 241000283690 Bos taurus Species 0.000 claims 1
- FZUDIAIWGNYVPW-UJURSFKZSA-N BrC(=C[C@@H]1C([C@H]1C(=O)O)(C)C)C(F)(F)F Chemical compound BrC(=C[C@@H]1C([C@H]1C(=O)O)(C)C)C(F)(F)F FZUDIAIWGNYVPW-UJURSFKZSA-N 0.000 claims 1
- 230000000895 acaricidal effect Effects 0.000 claims 1
- 239000000642 acaricide Substances 0.000 claims 1
- 150000001299 aldehydes Chemical class 0.000 claims 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 claims 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 claims 1
- 239000003701 inert diluent Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 97
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- 238000005481 NMR spectroscopy Methods 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 238000012360 testing method Methods 0.000 description 19
- 235000015243 ice cream Nutrition 0.000 description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 241000257159 Musca domestica Species 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 241001608567 Phaedon cochleariae Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 235000013601 eggs Nutrition 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 241000256118 Aedes aegypti Species 0.000 description 4
- 241001124076 Aphididae Species 0.000 description 4
- 241001425390 Aphis fabae Species 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 241000488583 Panonychus ulmi Species 0.000 description 4
- 241000500437 Plutella xylostella Species 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000001640 fractional crystallisation Methods 0.000 description 4
- 239000011120 plywood Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- ALZFYKUYSWUHLE-UHFFFAOYSA-N 1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-4-en-2-ol Chemical compound CC(C)=CCC(O)(C(F)(F)F)C(F)(F)F ALZFYKUYSWUHLE-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241000171274 Megoura Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000131102 Oryzaephilus Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 241001481703 Rhipicephalus <genus> Species 0.000 description 3
- 241000256250 Spodoptera littoralis Species 0.000 description 3
- 241001454293 Tetranychus urticae Species 0.000 description 3
- 240000006677 Vicia faba Species 0.000 description 3
- 235000010749 Vicia faba Nutrition 0.000 description 3
- 235000002098 Vicia faba var. major Nutrition 0.000 description 3
- 244000309466 calf Species 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- ZLDOMUPTDYCDBS-UHFFFAOYSA-N ethyl 3,3-dimethylpent-4-enoate Chemical compound CCOC(=O)CC(C)(C)C=C ZLDOMUPTDYCDBS-UHFFFAOYSA-N 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 3
- 229960000490 permethrin Drugs 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- XUUFPIFEEKDLBP-UJURSFKZSA-N (1s,3s)-2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carbonyl chloride Chemical compound CC1(C)[C@@H](C=C(C(F)(F)F)C(F)(F)F)[C@@H]1C(Cl)=O XUUFPIFEEKDLBP-UJURSFKZSA-N 0.000 description 2
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- IHHQSGSISUUYDB-UHFFFAOYSA-N 2-(difluoromethyl)-1,1,1-trifluoro-5-methylhex-4-en-2-ol Chemical compound CC(C)=CCC(O)(C(F)F)C(F)(F)F IHHQSGSISUUYDB-UHFFFAOYSA-N 0.000 description 2
- JGZVUTYDEVUNMK-UHFFFAOYSA-N 5-carboxy-2',7'-dichlorofluorescein Chemical compound C12=CC(Cl)=C(O)C=C2OC2=CC(O)=C(Cl)C=C2C21OC(=O)C1=CC(C(=O)O)=CC=C21 JGZVUTYDEVUNMK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241001151957 Aphis aurantii Species 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 2
- 241000255969 Pieris brassicae Species 0.000 description 2
- 241000254179 Sitophilus granarius Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 235000015278 beef Nutrition 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 150000001942 cyclopropanes Chemical class 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- KWAYLNCTARQBJP-POYBYMJQSA-N ethyl (1S,3S)-2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carboxylate Chemical compound C(C)OC(=O)[C@@H]1C([C@H]1C=C(C(F)(F)F)C(F)(F)F)(C)C KWAYLNCTARQBJP-POYBYMJQSA-N 0.000 description 2
- PMLXHRSKPIZHNN-UHFFFAOYSA-N ethyl 4,6,6,7-tetrachloro-7,7-difluoro-3,3-dimethylheptanoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)C(F)(F)Cl PMLXHRSKPIZHNN-UHFFFAOYSA-N 0.000 description 2
- CINBGMPCJVKMPZ-UHFFFAOYSA-N ethyl 4,6,6-tribromo-7,7,7-trifluoro-3,3-dimethylheptanoate Chemical compound CCOC(=O)CC(C)(C)C(Br)CC(Br)(Br)C(F)(F)F CINBGMPCJVKMPZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000012447 hatching Effects 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- WLOJMNRJNOXKDV-MDMYCTLOSA-N (1S,3R)-3-[(Z)-2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical class CC1(C)[C@@H](\C=C(/Cl)C(F)(F)C(F)(F)Cl)[C@@H]1C(O)=O WLOJMNRJNOXKDV-MDMYCTLOSA-N 0.000 description 1
- CPSMSOOIKFILBP-RKDXNWHRSA-N (1S,3R)-3-[4-fluoro-3,3-bis(fluoromethyl)but-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1([C@@H]([C@@H]1C(=O)O)C=CC(CF)(CF)CF)C CPSMSOOIKFILBP-RKDXNWHRSA-N 0.000 description 1
- NARKOLOKVMIBAV-UJURSFKZSA-N (1s,3r)-3-(2,3-dichloro-3,3-difluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C=C(Cl)C(F)(F)Cl)[C@@H]1C(O)=O NARKOLOKVMIBAV-UJURSFKZSA-N 0.000 description 1
- ABALMDTULZCSTP-UJURSFKZSA-N (1s,3s)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)[C@@H](C=C(Cl)C(F)(F)F)[C@@H]1C(Cl)=O ABALMDTULZCSTP-UJURSFKZSA-N 0.000 description 1
- SPVZAYWHHVLPBN-INEUFUBQSA-N (1s,3s)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@H](C=C(Cl)C(F)(F)F)[C@@H]1C(O)=O SPVZAYWHHVLPBN-INEUFUBQSA-N 0.000 description 1
- IWWDJVKALSNUHO-NTSWFWBYSA-N (1s,3s)-3-[2-(difluoromethyl)-3,3-difluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C=C(C(F)F)C(F)F)[C@@H]1C(O)=O IWWDJVKALSNUHO-NTSWFWBYSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- SLGOCMATMKJJCE-UHFFFAOYSA-N 1,1,1,2-tetrachloro-2,2-difluoroethane Chemical compound FC(F)(Cl)C(Cl)(Cl)Cl SLGOCMATMKJJCE-UHFFFAOYSA-N 0.000 description 1
- WQAWXRFLNDAOON-UHFFFAOYSA-N 1,1,1,3,3-pentafluoropropan-2-one Chemical compound FC(F)C(=O)C(F)(F)F WQAWXRFLNDAOON-UHFFFAOYSA-N 0.000 description 1
- HJRXHKBZNQULJQ-UHFFFAOYSA-N 1,1,1-trichloro-2,2,3,3,3-pentafluoropropane Chemical compound FC(F)(F)C(F)(F)C(Cl)(Cl)Cl HJRXHKBZNQULJQ-UHFFFAOYSA-N 0.000 description 1
- XDXBCXDBFNODND-UHFFFAOYSA-N 1,1,1-trifluoro-2,5-dimethylhexa-2,4-diene Chemical compound CC(C)=CC=C(C)C(F)(F)F XDXBCXDBFNODND-UHFFFAOYSA-N 0.000 description 1
- IBHWVJDTSPHTJG-UHFFFAOYSA-N 1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hexa-2,4-diene Chemical compound CC(C)=CC=C(C(F)(F)F)C(F)(F)F IBHWVJDTSPHTJG-UHFFFAOYSA-N 0.000 description 1
- FHUDAMLDXFJHJE-UHFFFAOYSA-N 1,1,1-trifluoropropan-2-one Chemical compound CC(=O)C(F)(F)F FHUDAMLDXFJHJE-UHFFFAOYSA-N 0.000 description 1
- QAPXLUZMMFIIBI-UHFFFAOYSA-N 1,1,3,3-tetrafluoropropan-2-one Chemical compound FC(F)C(=O)C(F)F QAPXLUZMMFIIBI-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- QRKKTXWUDLJYCV-UHFFFAOYSA-N 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-one Chemical compound FC(F)(Cl)C(=O)C(F)(F)Cl QRKKTXWUDLJYCV-UHFFFAOYSA-N 0.000 description 1
- LOYZVRIHVZEDMW-UHFFFAOYSA-N 1-bromo-3-methylbut-2-ene Chemical compound CC(C)=CCBr LOYZVRIHVZEDMW-UHFFFAOYSA-N 0.000 description 1
- POZHVHBTFKOUEN-UHFFFAOYSA-N 1-ethylcyclopropane-1-carboxylic acid Chemical compound CCC1(C(O)=O)CC1 POZHVHBTFKOUEN-UHFFFAOYSA-N 0.000 description 1
- SRAKKNOEHFCVLC-UHFFFAOYSA-N 2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carboxylic acid Chemical compound CC1(C)C(C=C(C(F)(F)F)C(F)(F)F)C1C(O)=O SRAKKNOEHFCVLC-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical class CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- VEQMUQZKBLIXLT-UHFFFAOYSA-N 2,3-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1C(C)C1C(O)=O VEQMUQZKBLIXLT-UHFFFAOYSA-N 0.000 description 1
- GFMNEHCEZSAWPO-UHFFFAOYSA-N 2-(difluoromethyl)-1,1,1-trifluoro-5-methylhexa-2,4-diene Chemical compound CC(C)=CC=C(C(F)F)C(F)(F)F GFMNEHCEZSAWPO-UHFFFAOYSA-N 0.000 description 1
- NRZNTGUFHSJBTD-HKOYGPOVSA-N 2-[2-(2-methoxyethoxy)ethoxy]ethyl (e)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)prop-2-enoate Chemical compound C1=CC2=CC(/C=C(C(=O)OCCOCCOCCOC)\C#N)=CC=C2C=C1N1CCCCC1 NRZNTGUFHSJBTD-HKOYGPOVSA-N 0.000 description 1
- LEHNQGSPRXHYRT-UHFFFAOYSA-N 2-dodecyl-1h-imidazole Chemical compound CCCCCCCCCCCCC1=NC=CN1 LEHNQGSPRXHYRT-UHFFFAOYSA-N 0.000 description 1
- DARRKEPSYNBUBK-UHFFFAOYSA-N 2-hydroxy-2-(3-phenoxyphenyl)acetamide Chemical compound NC(=O)C(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 DARRKEPSYNBUBK-UHFFFAOYSA-N 0.000 description 1
- CBQDTCDOVVBGMN-UHFFFAOYSA-N 2-methyl-3-octylphenol Chemical compound CCCCCCCCC1=CC=CC(O)=C1C CBQDTCDOVVBGMN-UHFFFAOYSA-N 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- FTMCNCGWNJMMQS-UHFFFAOYSA-M 3-methylbut-2-enyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC=C(C)C)C1=CC=CC=C1 FTMCNCGWNJMMQS-UHFFFAOYSA-M 0.000 description 1
- VSBPRBXTUAKKSY-UHFFFAOYSA-N 5-(5-methyl-1,3-dioxan-4-yl)-1,3-benzodioxole Chemical compound CC1COCOC1C1=CC=C(OCO2)C2=C1 VSBPRBXTUAKKSY-UHFFFAOYSA-N 0.000 description 1
- 241000254032 Acrididae Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000238679 Amblyomma Species 0.000 description 1
- 241001414827 Aonidiella Species 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 241000238658 Blattella Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- BSCUMHLWIBIQDT-UHFFFAOYSA-N CC(C)=CC=C(Cl)C(F)(F)C(F)F Chemical compound CC(C)=CC=C(Cl)C(F)(F)C(F)F BSCUMHLWIBIQDT-UHFFFAOYSA-N 0.000 description 1
- SFDHQPVAKUMKHZ-MDMYCTLOSA-N CC1(C)[C@@H](\C=C(/F)C(F)(F)Cl)[C@@H]1C(O)=O Chemical compound CC1(C)[C@@H](\C=C(/F)C(F)(F)Cl)[C@@H]1C(O)=O SFDHQPVAKUMKHZ-MDMYCTLOSA-N 0.000 description 1
- FGTCTKJHSSBVRM-RHSSXRTQSA-N CC1([C@H]([C@@H]1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)/C=C(/C(F)(F)Cl)\F)C Chemical compound CC1([C@H]([C@@H]1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)/C=C(/C(F)(F)Cl)\F)C FGTCTKJHSSBVRM-RHSSXRTQSA-N 0.000 description 1
- UJJPFPDXEDDUAH-POYBYMJQSA-N CCOC(=O)[C@H]1[C@@H](C1(C)C)C=C(C(F)F)C(F)(F)F Chemical compound CCOC(=O)[C@H]1[C@@H](C1(C)C)C=C(C(F)F)C(F)(F)F UJJPFPDXEDDUAH-POYBYMJQSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- NARKOLOKVMIBAV-INEUFUBQSA-N ClC(=C[C@H]1C([C@H]1C(=O)O)(C)C)C(F)(F)Cl Chemical compound ClC(=C[C@H]1C([C@H]1C(=O)O)(C)C)C(F)(F)Cl NARKOLOKVMIBAV-INEUFUBQSA-N 0.000 description 1
- IFCIHMDXICWJFB-UHFFFAOYSA-N ClC(C(=C(C=C(C)C)C(F)F)Cl)(F)F Chemical compound ClC(C(=C(C=C(C)C)C(F)F)Cl)(F)F IFCIHMDXICWJFB-UHFFFAOYSA-N 0.000 description 1
- CJLCOHBWILJGLR-CRCLSJGQSA-N ClC(C(=C([C@@H]1C([C@H]1C(=O)O)(C)C)C(F)F)Cl)(F)F Chemical compound ClC(C(=C([C@@H]1C([C@H]1C(=O)O)(C)C)C(F)F)Cl)(F)F CJLCOHBWILJGLR-CRCLSJGQSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000022561 Cyclopis Species 0.000 description 1
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241001127120 Dysdercus fasciatus Species 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 241000238681 Ixodes Species 0.000 description 1
- 241000736227 Lucilia sericata Species 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- PNXRYSZDFWIEKI-UHFFFAOYSA-N O(C1=CC=CC=C1)C=1C=C(COC(=O)C2C(C2C)C)C=CC=1 Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(=O)C2C(C2C)C)C=CC=1 PNXRYSZDFWIEKI-UHFFFAOYSA-N 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000500439 Plutella Species 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 241000254113 Tribolium castaneum Species 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000001931 aliphatic group Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229920005550 ammonium lignosulfonate Polymers 0.000 description 1
- RNLQIBCLLYYYFJ-UHFFFAOYSA-N amrinone Chemical compound N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 RNLQIBCLLYYYFJ-UHFFFAOYSA-N 0.000 description 1
- 229960002105 amrinone Drugs 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 238000007068 beta-elimination reaction Methods 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- JIJAYWGYIDJVJI-UHFFFAOYSA-N butyl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OCCCC)=CC=CC2=C1 JIJAYWGYIDJVJI-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ANNHJHCLRBLWBB-POYBYMJQSA-N ethyl (1S,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound C(C)OC(=O)[C@@H]1C([C@H]1C=C(C(F)(F)F)Cl)(C)C ANNHJHCLRBLWBB-POYBYMJQSA-N 0.000 description 1
- KNYLKHUSDSMUBL-NKWVEPMBSA-N ethyl (1S,3S)-2,2-dimethyl-3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclopropane-1-carboxylate Chemical compound C(C)OC(=O)[C@@H]1C([C@H]1CC(C(F)(F)F)(C(F)(F)F)O)(C)C KNYLKHUSDSMUBL-NKWVEPMBSA-N 0.000 description 1
- KNYLKHUSDSMUBL-UHFFFAOYSA-N ethyl 2,2-dimethyl-3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclopropane-1-carboxylate Chemical class CCOC(=O)C1C(CC(O)(C(F)(F)F)C(F)(F)F)C1(C)C KNYLKHUSDSMUBL-UHFFFAOYSA-N 0.000 description 1
- DKPSGFILKRCOOW-UHFFFAOYSA-N ethyl 4,6,6,8-tetrachloro-7,7,8,8-tetrafluoro-3,3-dimethyloctanoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)C(F)(F)C(F)(F)Cl DKPSGFILKRCOOW-UHFFFAOYSA-N 0.000 description 1
- AMIBLBGLTDBYJJ-UHFFFAOYSA-N ethyl 4,6,6-trichloro-7,7,7-trifluoro-3,3-dimethylheptanoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)C(F)(F)F AMIBLBGLTDBYJJ-UHFFFAOYSA-N 0.000 description 1
- FRYDWUJTAPHKFN-UHFFFAOYSA-N ethyl 4,6,7-trichloro-6,7,7-trifluoro-3,3-dimethylheptanoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)CC(F)(Cl)C(F)(F)Cl FRYDWUJTAPHKFN-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- APPOKADJQUIAHP-UHFFFAOYSA-N hexa-2,4-diene Chemical compound CC=CC=CC APPOKADJQUIAHP-UHFFFAOYSA-N 0.000 description 1
- VBZWSGALLODQNC-UHFFFAOYSA-N hexafluoroacetone Chemical compound FC(F)(F)C(=O)C(F)(F)F VBZWSGALLODQNC-UHFFFAOYSA-N 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- ITNVWQNWHXEMNS-UHFFFAOYSA-N methanolate;titanium(4+) Chemical compound [Ti+4].[O-]C.[O-]C.[O-]C.[O-]C ITNVWQNWHXEMNS-UHFFFAOYSA-N 0.000 description 1
- MHNNAWXXUZQSNM-UHFFFAOYSA-N methylethylethylene Natural products CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- DYGBNAYFDZEYBA-UHFFFAOYSA-N n-(cyclopropylmethyl)-2-[4-(4-methoxybenzoyl)piperidin-1-yl]-n-[(4-oxo-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-2-yl)methyl]acetamide Chemical compound C1=CC(OC)=CC=C1C(=O)C1CCN(CC(=O)N(CC2CC2)CC=2NC(=O)C=3COCCC=3N=2)CC1 DYGBNAYFDZEYBA-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 238000001782 photodegradation Methods 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000006238 prop-1-en-1-yl group Chemical group [H]\C(*)=C(/[H])C([H])([H])[H] 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 125000002348 vinylic group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/26—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton
- C07C17/263—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions
- C07C17/2635—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions involving a phosphorus compound, e.g. Wittig synthesis
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/36—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal
- C07C29/38—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/40—Halogenated unsaturated alcohols
- C07C33/42—Halogenated unsaturated alcohols acyclic
- C07C33/423—Halogenated unsaturated alcohols acyclic containing only double bonds as unsaturation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C61/00—Compounds having carboxyl groups bound to carbon atoms of rings other than six-membered aromatic rings
- C07C61/16—Unsaturated compounds
- C07C61/40—Unsaturated compounds containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/32—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by aldehydo- or ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/54—Quaternary phosphonium compounds
- C07F9/5428—Acyclic unsaturated phosphonium compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/54—Quaternary phosphonium compounds
- C07F9/5442—Aromatic phosphonium compounds (P-C aromatic linkage)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- Dentistry (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Description
worin eines der Symbole R und R für eine Gruppe der Formel:
oder Brom oder eine Gruppe der Formel:
det, worin eines der Symbole R und R für eine Gruppe der Formel:
wobei W Wasserstoff, Fluor oder Chlor ist, steht und das andere
der Symbole R und R für eine Gruppe der Formel:
zugt, worin R und R beide für Trifluoromethyl stehen.
R für Chlor oder Brom steht.
1 | CF3 | CF3 | CN | eis |
2 | CF3 | CF3 | CN | trans |
3 | CF3 | CF3 | II | eis |
4 | PF üi3 |
CF3 | II | trans |
5 | CHF2 | CHF2 | H | cj.s |
6 | CIlF2 | CIlF2 | H | trans |
7 | CIlF2 | CHF2 | CN | eis |
8 | CHF2 | CIIF2 | CN | trans |
9 | CF2Cl | CF2Cl | H | eis |
10 | CF2Cl | CF2Cl | H | trans |
11 | CF2Cl | CF2Cl | CN | eis |
12 | CF2Cl | CF2Cl | CN | trans |
LZ | ϋ | f- | (Z | 'Λ | f. | υ | cn | cn | W | cn | |
C | 2 | -Η | "Z | C | -H | ||||||
O | U | —' | Ü | U | τ» | CJ | O | ||||
Z | ■z | i-i | |||||||||
OJ | η | U | U | O | ro | +J | 33 | ||||
-H | U | fa | 2 | ||||||||
Hi | U | CN | η | O | U | O | U | cn | |||
α | CN | fa | fa | fa | η | fa | |||||
ro | fa | U | U | ;n | U | fa | cn | ro | U | O | |
fa | HJ | m | CN | Γ. . | U | fa | ro | ro | |||
O | O | U | *" * | U | O | fa | |||||
LT) | α | ro | U | O | ro | en | U | U | |||
fa | Γ-i | O | fa | CN | fa | ||||||
υ | r- | U | CT. | U | O | ro | ■τ | ||||
I—! | I—I | CN | CN | ||||||||
■«Ξ | co | r-i | CN | ||||||||
ι—ι | c—l | CN | CN | ||||||||
Ü | |||||||||||
CH | |||||||||||
Hi | |||||||||||
U | |||||||||||
ΓΟ | |||||||||||
fa | |||||||||||
U | |||||||||||
η | |||||||||||
fa | |||||||||||
U | |||||||||||
ro | |||||||||||
25 | CH3 | CF3 | H | trans |
26 | TF Ct3 |
CH3 | H | trans |
27 | CIIF2 | CF2Cl | CN | eis |
28 | CF2Cl | CHF2 | CN | eis |
29 | CHF2 | CF2Cl | CN | trans |
30 | CF2Cl | CHF2 | CN | trans |
31 | CF3 | Cl | CN | eis |
32 | Cl | CF3 | CN | eis |
33 | CF Ui3 |
Cl | CN | trans |
34 | Cl | CF3 | CN | trans |
35 | CF3 | Cl | H | eis |
36 | Cl | CF3 | H | eis |
cn | cn | cn | cn | ω | W |
C | C | •Η | •Η | C | C |
ta | Π3 | ϋ | ϋ | (3 | (O |
U | U | U | 1-1 | ||
-P | +j | ■Ρ | ■Ρ | ||
cn | cn | cn | cn |
C | C | -H | C |
(3 | 03 | O | <c |
!-I | |||
P | ■Ρ | ||
2 | 2 | 2 |
U | U | U |
rH | rH | |
U | U | |
CN | rH | CN |
fa | O | fa |
U | C) |
rH | rH |
U | U |
CN | C |
fa | fa |
U | O |
O | rH | CN | ·<*■ | ■"3· | m | |
en | ■«a* | ■«a* | •«τ . | ■«a· | ||
49 | CF2Cl | F | II | els |
50 | CF2Cl | F | II | trans |
51 | ClCF2CF2 | Cl | CN | eis |
52 | ClCF2CF2 | Cl | CN | trans |
53 | CF3CF2 | Cl | CN | trans |
54 | CF3 | Br | CN | eis |
55 | Br | CF, | CN | eis |
56 | PF ^3 |
Br | CN | trans |
57 | Br | CF3 | CN | trans |
58 | CF3 | Cl | C=CH | eis |
59 | Cl | CF3 | C=CH | eis |
60 | CF3 | Cl | C=CH | trans |
61 | Cl | CF, | C=CH | trans |
worin R und R die oben angegebenen Bedeutungen besitzen,
wie z.B. Natriummethoxid, oder eines alkylierten Titanderivats, wie z.B. Tetramethyltitanat.
durch herkömmliche Isonertrennungstechniken von Isomergemischen
erhalten werden. So können eis- und trans-Isomere durch fraktionierte Kristallisation der Carbonsäuren oder der Salze derselben getrennt werden, während die verschiedenen optisch aktiven Arten durch fraktionierte Kristallisation von Salzen der Säuren mit optisch aktiven Aminen und anschließende Regenerierung der optisch reinen Säure erhalten werden können.
ct-Cyano-3-phenoxybenzyl-alkohol wird das Produkt ein Gemisch aus zwei Isomeren sein, da es nicht möglich ist, optisch reinen a-
worin eines der Symbole R und R für eine Gruppe der Formel:
der Symbole R und R für Fluor, Chlr-r oder Brom steht und Q für Hydroxy, Niederalkoxy mit 1 bis 3 Kohlenstoffatomen, Chlor oder Brom steht. Besonders bevorzugte Verbindungen innerhalb dieser
worin R und R die Bedeutungen besitzen, die in der Tabelle I oben für die entsprechenden Verbindungen der Formel I angegeben wurden, worin Q für Chlor, Hydroxy oder Äthoxy steht.
r2 CH3 (V)
bole R und R für Halogen steht, ist aber sehr nützlich für die
R1 | R2 |
CF3 | CF3 |
CHF2 | CHF2 |
CF3 | CHF2 |
CF3 | CH3 |
CF2Cl | CF2Cl |
CHF2 | CF2Cl |
worin R und R eine der oben angegebenen Bedeutungen besitzen, Q für Alkoxy steht und W1 und W beide entweder für Fluor, Chlor
genatom steht.
aufweist, worin R , R und Q" die oben angegebenen Bedeutungen besitzen und Q für Alkoxy steht, kann durch herkömmliche Hydrolyse- und Veresterungsverfahren in die gewünschten Produkte der Formel II überführt werden.
CH3 | \ | CH3 | C=CH-CH=C | / | CF- | ,Cl |
\ | ||||||
CF2 | Cl |
bis 4,4 (ni,2H); 5,4 bis 7,2 (m,2H).
von Beispiel 5, wurden die folgenden Äthylester der Formel II aus den angegebenen Dienen durch Umsetzung mit Diazoessigsäure-äthylester erhalten.
1,25 bis 1,44 (m,9H); 1,60 bis 2,40 (m,2H); 4,0 bis 4,30 (m,2H); 5,53 bis 7,34 (komplex, 3H).
1H).
2,60 (m,2H); 4,08 bis 4,26 (in,2H); 6,20 und 7,16 (dd, 1H).
KHR (CCl4) p.p.m. 1,24 bis 1,52 (m,9H); 1,64 bis 2,50 (m,2H);
3,90 bis 4,30 (m,2H); 5,50 bis 7,04 (m,2H).
42 " 2802Sb^
das Indium behandelt wurden, und "Resttest" besagt, daß das Mediun vor der Infizierung mit den Schädlingen behandelt wurde.
Schädling | Medium | Tabelle II | Aufbringungsrate (ppm) 1000 500 125 |
3 | 3 | 62,5 | |
TetranychuD telarius rote Spinne, ausgewachsen |
Feuer bohne |
Anzahl der Tage |
3 | 3 | 3 | 3 | |
Aphis fabae schwarze Blattlaus |
Sau bohne |
3 | 3 | 3 | 3 | 3 | |
Megoura viceae grüne Blattlaus |
Saubohne | 2 | 3 | 3 | VM | 3 | |
Aedes aegypti Moskito, ausgewachsen |
Sperrholz | 2 | 3 | 3 | 3 | 3 | |
Musca domestica Hausfliege - Kontakttest |
Milch/ Zucker |
1 | 3 | 3 | 3 | 3 | |
608 | Plutella maculipennis Raupenrückenmotte, Larve - Kontakttest |
Senf | 2 | 3 | 3 | 3 | 3 '^ |
830/ | Phaedon cochleariae Senfkäfer - Resttest |
Korn | 3 | 3 | 3 | 3 | -P 3 N |
ο co σ> |
Musca domestica Hausfliege - Resttest |
Sperrholz | 3 | 3 | 3 | 3 | 3 |
co | Calandra granaria Kornkäfer - Resttest |
Korn | 3 | 3 | |||
3 | |||||||
Schädling | Ilodiun | Tabelle | III | Aufbri 50 |
ngurt^srate 25 |
(ppm) 12,5 |
3 | 3 | 6,25 | σ r |
|
Tetranychus telarius rote Spinne, ausgev/achsen |
Feuer bohne |
Anzahl der Tage |
2 | 2 | 2 | 1 | |||||
Aphis fabae schwarze Blattlaus |
Saubohne | 3 | 3 | 3 | 3 | 3 | |||||
Megoura viceae grüne Blattlaus |
Saubohne | 2 | 3 | 3 | 3 | 3 | |||||
co | Aedes aegypti Moskito, ausgewachsen |
Sperrholz | 2 | 3 | 3 | 2 | 2 | ||||
098 | Musca domestica Hausfliege - Kontakttest |
Milch/ Zucker |
1 | 3 | 3 | 3 | |||||
co O |
Plutella raaculipennis Raupenrückenmotte, Larve - Kontakttest |
Senf | 2 | 3 | 3 | 3 | |||||
O OT «9 |
3 | ||||||||||
Senfkäfer - Resttest
Hausfliege - Resttest
2 | ι | I | I | I | I | 1 | I | I | I | I | I | I |
r-l |
in
CVJ |
VD
ro |
in | 83* | 19* |
in
ro |
r-l | I | O | I | O | |
in
CN |
100 |
O
co |
in
co |
100 | 100 |
cn
vo |
r-l
CN |
1 |
in
CN |
I |
CO
CN |
|
*
O |
60* | O | O |
O
CO |
100 | 100 | 50* |
*
O |
I |
*
O |
*
O |
|
M |
O
co |
οοτ | O | I | I | 1 | I | 0OT | I | vo |
O
co |
I |
ic
O |
80* |
O
in |
100 | 100 | 100 | 100 | 80* | 100 | 20* | O | 100 | |
O | O | 60* |
O
CN |
100 |
O
VO |
100 | 100 | 100 |
O
CN |
O | O | O |
O | 100 |
O
O |
100 | 100 | 60* |
O
cn |
O
in |
0OT | 100 | 100 | 100 | |
O
CO |
100 | 100 | 100 | 100 | 100 | 100 | 100 |
t—
ro |
in
CN |
VO
VO |
ro
PO |
|
Q | loo | 100 | 100 |
O
O r-l |
100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 |
O | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 |
O
cn |
100 | 100 | 100 |
cn | O |
O
cn |
O | O | 100 | O | O | O | O | O | O | O |
O
LI |
100 | 100 |
O
σι |
I |
O
VO |
co
CTi |
σ
CO |
O
CN |
O
CN |
O
CN |
O | |
Rate |
O
in |
0OT | 100 | 100 |
O
in |
O
m |
100 | 100 |
in
CN |
L.0
CN |
in
CN |
m
CN |
• | ||||||||||||
•ζ | r-l | CN | ro | Ti* | m | VO | co | CTi | O |
r-l
H |
CVI
r-i |
P Nr. | Rate | Λ | B | C | D | E | F | G | H | I J | K | L | M |
13 | 25 | 50 | O | 100 | 100 | 100 | 70* | O | 20* | 10* | 35 | O | 100 |
14 | 25 | O | O | 90 | 90 | 100 | 40 | O | 70* | O* | O | O | 100 |
15 | 25 | 60 | O | 100 | 100 | 100 | 40 | O | 70* | O* | O | O | 100 |
16 | 25 | 20 | O | 95 | 40 | 40 | 30* | O | 50* | O* | O | O | 100 |
19 | 25 | 20 | O | 100 | 100 | 30 | 30* | - | 40* | O* | O | O | 100 |
20 | 25 | O | O | 95 | 100 | 20 | 50* | O | 10* | O* | O | O | 100 |
21 | 50 | 60 | O | 100 | 100 | 100 | 90* | 20* | 100 | 100 100 | 85 | 100 | 60 |
22 | 25 | 50 | 100 | 100 | 100 | O | 20* | O | 80* | 90 80* | O | O | 20 |
23 | 25 | O | O | 100 | 100 | O | 100 | O | 100 | 50* | O | O | O |
26 | 250 | O | O | 100 | 100 | - | 100 | - | 10 | 20 | - | - | O |
27 | 25 | 99 | 95 | 100 | 100 | - | 100 | - | 100 | 100 | - | - | 100 |
28 | 50 | O | 100 | 100 | 100 | - | 73 | - | 100 | 90 | - | - | 100 |
29 | 50 | O | 100 | 100 | 100 | - | 56 | - | 90 | 100 | - | - | 80 |
% aktiver Bestandteil |
Mortalität | unreife ausgGwach- soiiG Exem- |
Nymphen* | |
Produkt | 0,05 0,025 0,02 0,01 0,005 0,0025 0jO2 0,01 0,005 0,0025 0,1 0,05 0,01 |
vollgesaugte ausge wachsene Exemplare (%; 24 h/24 h/48 h) |
5 5 5 5 5 4 5 5 5 5 5 5 3 |
5 5 4 5 4 3 5 5 5/4 5/4 5 5 1 |
2 2 2 2 2 2 6 6 6 6 Permethrin Permethrin Permethrin |
-/-/- -/-/- -/-/- -/-/- -/-/- -/-/- -/-/- -/-/- —/—/— -/-/- "■/—/·" 20/60/- |
Claims (1)
worin eines der Symbole R und R für Halogenoalkyl mit 1 bis 2 Koh-
C
R und R für eine Gruppe der Formel:
ist.
Säure der Formel:
umsetzt, wobei R , R und R" die in Anspruch 3 angegebenenBedeutungen besitzen und R für Niederalkyl mit bis zu 6 Kohlenstoffatomen steht.
worin eines der Symbole R und R für eine Gruppe der Formel:
Symbole R und R für eine Gruppe der Formel:
R und R für eine Gruppe der Formel:
Il
,,-CH-CH-C-Q
Methyl stehen kann.,
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB276377 | 1977-01-24 | ||
GB1221077 | 1977-03-23 | ||
GB3671577 | 1977-09-02 | ||
GB3671477 | 1977-09-02 |
Publications (2)
Publication Number | Publication Date |
---|---|
DE2802962A1 true DE2802962A1 (de) | 1978-07-27 |
DE2802962C2 DE2802962C2 (de) | 1985-10-03 |
Family
ID=27447244
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2858248A Expired DE2858248C2 (de) | 1977-01-24 | 1978-01-24 | |
DE2802962A Expired DE2802962C2 (de) | 1977-01-24 | 1978-01-24 | Cyclopropancarbonsäureesterderivate und sie enthaltende insektizide Zusammensetzungen |
Family Applications Before (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2858248A Expired DE2858248C2 (de) | 1977-01-24 | 1978-01-24 |
Country Status (27)
Country | Link |
---|---|
US (2) | US4183948A (de) |
JP (2) | JPS5395945A (de) |
AR (1) | AR218651A1 (de) |
BE (1) | BE863151A (de) |
BR (1) | BR7800422A (de) |
CA (1) | CA1246094A (de) |
CH (1) | CH638171A5 (de) |
DD (1) | DD138544A5 (de) |
DE (2) | DE2858248C2 (de) |
DK (1) | DK158784C (de) |
EG (1) | EG13028A (de) |
ES (3) | ES466281A1 (de) |
FR (2) | FR2392964A1 (de) |
GR (1) | GR65619B (de) |
HU (1) | HU184685B (de) |
IL (3) | IL53832A (de) |
IT (1) | IT1092969B (de) |
LU (1) | LU78930A1 (de) |
NL (3) | NL189087C (de) |
NZ (1) | NZ186256A (de) |
PH (2) | PH13451A (de) |
PL (1) | PL113130B1 (de) |
PT (1) | PT67574B (de) |
SE (3) | SE437263B (de) |
TR (1) | TR20462A (de) |
YU (1) | YU15078A (de) |
ZM (1) | ZM1078A1 (de) |
Cited By (20)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2907609A1 (de) * | 1978-02-28 | 1979-09-13 | Montedison Spa | Neue pyrethroide, deren herstellung und verwendung |
EP0008340A1 (de) * | 1978-07-15 | 1980-03-05 | Bayer Ag | Fluoralkenylsubstituierte Cyclopropancarbonsäureester, Zwischenprodukte dafür, Herstellung der Verbindungen und ihre Verwendung als Insektizide und/oder Akarizide |
EP0009709A1 (de) * | 1978-09-29 | 1980-04-16 | Bayer Ag | Fluoralkenylsubstituierte Cyclopropancarbonsäureester (I), Verfahren zu ihrer Herstellung , hierbei erhaltene Zwischenprodukte und deren Herstellung, die Ester (I) enthaltende Mittel und die Verwendung der Ester (I) zur Bekämpfung von Insekten und/oder Spinnentieren |
EP0010859A1 (de) * | 1978-10-31 | 1980-05-14 | Imperial Chemical Industries Plc | Verfahren zum Herstellen von Cyclopropancarbonsäure-Estern |
US4258202A (en) | 1978-02-28 | 1981-03-24 | Montedison S.P.A. | Cyclopropanecarboxylic acids and esters |
DE3045768A1 (de) * | 1979-12-07 | 1981-06-11 | CIBA-GEIGY AG, 4002 Basel | 2-(2',2'-dichlor-3',3',3'-trifluorpropyl)- und 2-(2',2',3'-trichlor-3',3'-difluorporpyl)-4-chlorcyclobutan-1-one |
US4328237A (en) | 1978-02-28 | 1982-05-04 | Montedison S.P.A. | Pyrethroids |
EP0050776A1 (de) * | 1980-10-23 | 1982-05-05 | Bayer Ag | Verfahren zur Herstellung von chlor-fluoralkenyl-substituierten Cyclopropancarbonsäureestern |
DE3225130A1 (de) * | 1981-07-10 | 1983-01-27 | National Research Development Corp., London | Benzylalkoholderivate, verfahren zu deren herstellung und pestizide unter deren verwendung |
EP1955592A2 (de) | 2004-01-08 | 2008-08-13 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden Eigenschaften |
DE102007045953A1 (de) | 2007-09-26 | 2009-04-02 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
DE102009028001A1 (de) | 2009-07-24 | 2011-01-27 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
WO2011134964A1 (de) | 2010-04-28 | 2011-11-03 | Bayer Cropscience Ag | Synergistische wirkstoffkombinationen |
WO2012150206A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue cyclopropansäureeesterderivate als schädlingsbekämpfungsmittel |
WO2012150223A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue pyridinmethylester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
WO2012150208A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Verwendung von substituierten benzylalkoholestern der cyclopropancarbonsäure zur bekämpfung von insektizid-resistenten insekten |
WO2012150207A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Verwendung von cyclopropancarbonsäureeesterderivaten zur bekämpfung von insektizid-resistenten insekten |
WO2012150221A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue halogenierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
WO2012150205A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue substituierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
Families Citing this family (55)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4183948A (en) * | 1977-01-24 | 1980-01-15 | Imperial Chemical Industries Limited | Halogenated esters |
IN150399B (de) * | 1978-01-20 | 1982-09-25 | Fmc Corp | |
US4243677A (en) * | 1978-01-20 | 1981-01-06 | Fmc Corporation | Insecticidal perhaloalkylvinylcyclopropanecarboxylates |
US4235927A (en) * | 1978-01-20 | 1980-11-25 | Fmc Corporation | Insecticidal benzylfurylmethyl perhaloalkylvinylcyclopropanecarboxylates |
US4238505A (en) | 1978-01-20 | 1980-12-09 | Fmc Corporation | Insecticidal biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates |
DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
DE2965744D1 (en) * | 1978-10-27 | 1983-07-28 | Ici Plc | Process for separating optical isomers of substituted cyclopropane carboxylic acids; amine salts of substituted cyclopropane carboxylic acids; a substituted cyclopropane carboxylic acid |
GB2046732A (en) * | 1979-02-14 | 1980-11-19 | Ici Ltd | Halogenated cyclopropane carboxylic acid esters |
DE2916357A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbonsaeureestern und neue zwischenprodukte dafuer |
AU531541B2 (en) * | 1979-05-11 | 1983-08-25 | Pitman-Moore Australia Limited | Tickicidal composition |
US4333950A (en) * | 1979-05-24 | 1982-06-08 | Fmc Corporation | (+)-4-Substituted-2-indanol insecticidal ester derivatives |
US4335252A (en) * | 1979-05-24 | 1982-06-15 | Fmc Corporation | Insecticidal pyrethroid enantiomer pair |
US4332815A (en) * | 1979-06-25 | 1982-06-01 | Fmc Corporation | Insecticidal perhaloalkylvinylcyclopropanecarboxylates |
US4341796A (en) | 1979-06-25 | 1982-07-27 | Fmc Corporation | Control of acarids with biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates |
DE3064018D1 (en) * | 1979-07-13 | 1983-08-11 | Ici Plc | Process for the preparation of cyclopropane carboxylic acid esters |
DE2939913A1 (de) * | 1979-10-02 | 1981-04-30 | Bayer Ag, 5090 Leverkusen | 3-(2,3-dichlor-3,3-difluor-prop-1-en-1-yl)-2,2-dimethyl-cyclopropancarbonsaeure-fluor-benzylester, verfahren zu ihrer herstellung sowie ihre verwendung in schaedlingsbekaempfungsmitteln |
OA06786A (fr) * | 1980-04-16 | 1982-12-31 | Roussel Uclaf | Nouveaux dérivés de l'acide cyclopropane, leur préparation, leur application à la lutte contre les parasites des végétaux et des animaux, les compositions les renfermant et les nouveaux intermediaires obtenus. |
DE3019552A1 (de) * | 1980-05-22 | 1981-11-26 | Bayer Ag, 5090 Leverkusen | 3-(2-chlor-3,3,4,4,4-pentafluor-1-butenyl)-2,2-dimethyl-cyclopropancarbonsaeureester, verfahren zu deren herstellung und deren verwendung in schaedlingsbekaempfungsmitteln |
IT1150963B (it) * | 1980-07-29 | 1986-12-17 | Montedison Spa | Piretroidi |
US4368205A (en) * | 1980-10-31 | 1983-01-11 | Fmc Corporation | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives |
US4417078A (en) * | 1980-12-31 | 1983-11-22 | Fmc Corporation | Process for producing (+)-4-substituted-2-indanols |
US4423255A (en) * | 1980-12-31 | 1983-12-27 | Fmc Corporation | (+)-4-Substituted-2-indanols |
US4362744A (en) * | 1981-03-19 | 1982-12-07 | Fmc Corporation | Trans-3-substituted-1-indanol insecticidal ester derivatives |
DE3127752A1 (de) * | 1981-07-14 | 1983-02-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von permethrinsaeurementhylester |
US4415748A (en) * | 1981-08-06 | 1983-11-15 | Fmc Corporation | Intermediates for insecticidal synthetic pyrethroids |
AU550754B2 (en) * | 1981-11-27 | 1986-04-10 | Pitman-Moore Australia Limited | Levamisole and cyhalothrin compositions |
DE3309227A1 (de) * | 1982-03-16 | 1983-10-13 | Wellcome Australia Ltd., 2137 Cabarita, New South Wales | Rueckenbegiessungsformulierung |
LV5122A3 (lv) * | 1982-10-11 | 1993-06-10 | Ici Plc | Panemiens (1R,Cis)-3-(Z-hlor-3,3,3-trifluorprop-1-en-1-il)-2,2-dimetilciklopropionskabes un (R)-alpha-ciano-3-(Z-2-hlor-3,3,3-trifluor-prop-1-en-1-il)-2,2-dimetilciklopropionskabes (S)-alpha-ciano-3-fenoksibenzilestera izomeru kristaliska enantiomeru para iegusanai |
ZA836964B (en) * | 1982-10-11 | 1984-05-30 | Ici Plc | Insecticidal product and preparation thereof |
GB8308507D0 (en) * | 1983-03-28 | 1983-05-05 | Ici Plc | Insecticidal product |
EP0106469B1 (de) * | 1982-10-11 | 1987-01-14 | Imperial Chemical Industries Plc | Insektizides Produkt und seine Herstellung |
DE3372480D1 (en) * | 1982-10-18 | 1987-08-20 | Ici Plc | Insecticidal product and preparation thereof |
USH49H (en) | 1983-01-10 | 1986-04-01 | Fmc Corporation | Process for producing 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylates |
GB8418331D0 (en) * | 1984-07-18 | 1984-08-22 | Ici Plc | Insecticidal ester |
JPH0674238B2 (ja) * | 1985-09-30 | 1994-09-21 | 財団法人相模中央化学研究所 | 2,2−ジメチルシクロプロパンカルボン酸誘導体 |
DE3900275A1 (de) * | 1989-01-07 | 1990-07-12 | Basf Ag | Substituierte cyclopropancarbonsaeurepropargylester, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
GB9311054D0 (en) * | 1993-05-28 | 1993-07-14 | Zeneca Ltd | Preparation of cyclopropane esters |
FR2708930B1 (fr) * | 1993-08-10 | 1995-09-08 | Roussel Uclaf | Nouveaux esters dérivés de l'acide 2,2-diméthyl 3-(3,3,3-trifluoro-1-propényl) cyclopropane carboxylique, leur procédé de préparation et leur application comme pesticides. |
IL115833A (en) * | 1994-11-25 | 1998-10-27 | Zeneca Ltd | Acids 6, 6 - Dihalo - 3, 3 - Dimethyl - 5 - Hydroxy - 7, 7, 7 Triplooroheptanoics and their alkaline esters useful as an intermediate product Insecticides |
DE19953775A1 (de) | 1999-11-09 | 2001-05-10 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
DE10007411A1 (de) | 2000-02-18 | 2001-08-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
AR029677A1 (es) * | 2000-06-29 | 2003-07-10 | Bayer Ag | Combinaciones de compuestos activos con propiedades insecticidas y acaricidas |
GB0118137D0 (en) * | 2001-07-25 | 2001-09-19 | Syngenta Ltd | Insecticidal mixture |
AR036872A1 (es) | 2001-08-13 | 2004-10-13 | Du Pont | Compuesto de antranilamida, composicion que lo comprende y metodo para controlar una plaga de invertebrados |
US20040058605A1 (en) * | 2002-09-19 | 2004-03-25 | Hansen Michael R. | Polysaccharide treated cellulose fibers |
GB0229803D0 (en) * | 2002-12-20 | 2003-01-29 | Syngenta Ltd | Chemical process |
DE102004006324A1 (de) * | 2004-02-10 | 2005-08-25 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
US20090281157A1 (en) * | 2006-07-11 | 2009-11-12 | Bayer Cropscience Ag | Active Ingredient Combinations With Insecticidal and Acaricidal Properties |
DE102007007750A1 (de) * | 2006-08-17 | 2008-02-21 | Bayer Cropscience Ag | Avermectinderivate |
DE102006046688B3 (de) * | 2006-09-29 | 2008-01-24 | Siemens Ag | Kälteanlage mit einem warmen und einem kalten Verbindungselement und einem mit den Verbindungselementen verbundenen Wärmerohr |
BRPI0717239A2 (pt) * | 2006-09-30 | 2013-10-08 | Bayer Cropscience Ag | Concentrados de suspensão para melhorar a absorção da raiz de substâncias ativas agroquímicas |
MX2010012024A (es) * | 2008-05-07 | 2010-12-07 | Bayer Cropscience Ag | Combinaciones sinergicas de compuestos activos. |
GB0808767D0 (en) * | 2008-05-14 | 2008-06-18 | Syngenta Ltd | Process |
BRPI0924839B1 (pt) | 2009-03-25 | 2018-03-20 | Bayer Intellectual Property Gmbh | Combinações de substâncias ativas com propriedades inseticidas e acaricidas, seus usos e método para o controle de praga animais |
MX2014010998A (es) * | 2012-03-13 | 2014-10-13 | Redx Pharma Ltd | Productos quimicos para agricultura. |
Citations (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2231312B2 (de) * | 1971-06-29 | 1974-03-14 | Sumitomo Chemical Co., Ltd., Osaka (Japan) |
Family Cites Families (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS5163158A (en) * | 1972-05-25 | 1976-06-01 | Nat Res Dev | 33 chikanshikuropuropankarubonsan oyobi sonojudotainoseiho |
US4024163A (en) * | 1972-05-25 | 1977-05-17 | National Research Development Corporation | Insecticides |
US3862174A (en) * | 1972-06-26 | 1975-01-21 | Sumitomo Chemical Co | Cyclopropanecarboxylates |
JPS5813522B2 (ja) * | 1974-10-24 | 1983-03-14 | 住友化学工業株式会社 | 新しいシクロプロパンカルボン酸エステルを含有する殺虫、殺ダニ剤 |
JPS51131857A (en) * | 1975-05-08 | 1976-11-16 | Kuraray Co Ltd | Process for preparation of substituted cyclopropanecarboxylic acid est ers |
US4183948A (en) * | 1977-01-24 | 1980-01-15 | Imperial Chemical Industries Limited | Halogenated esters |
GB1572669A (en) * | 1977-05-26 | 1980-08-28 | Ici Ltd | Manufacture of esters |
US4332815A (en) * | 1979-06-25 | 1982-06-01 | Fmc Corporation | Insecticidal perhaloalkylvinylcyclopropanecarboxylates |
-
1978
- 1978-01-16 US US05/869,615 patent/US4183948A/en not_active Expired - Lifetime
- 1978-01-17 IL IL53832A patent/IL53832A/xx unknown
- 1978-01-18 NZ NZ186256A patent/NZ186256A/xx unknown
- 1978-01-18 HU HU78IE821A patent/HU184685B/hu unknown
- 1978-01-19 CA CA000295309A patent/CA1246094A/en not_active Expired
- 1978-01-20 BE BE184513A patent/BE863151A/xx not_active IP Right Cessation
- 1978-01-23 IT IT19536/78A patent/IT1092969B/it active Protection Beyond IP Right Term
- 1978-01-23 YU YU00150/78A patent/YU15078A/xx unknown
- 1978-01-23 SE SE7800789A patent/SE437263B/sv not_active IP Right Cessation
- 1978-01-23 LU LU78930A patent/LU78930A1/xx active Protection Beyond IP Right Term
- 1978-01-23 GR GR55242A patent/GR65619B/el unknown
- 1978-01-23 PL PL1978204165A patent/PL113130B1/pl unknown
- 1978-01-23 FR FR7801831A patent/FR2392964A1/fr active Granted
- 1978-01-24 BR BR7800422A patent/BR7800422A/pt unknown
- 1978-01-24 DE DE2858248A patent/DE2858248C2/de not_active Expired
- 1978-01-24 PH PH20703A patent/PH13451A/en unknown
- 1978-01-24 DD DD78203378A patent/DD138544A5/de unknown
- 1978-01-24 ES ES466281A patent/ES466281A1/es not_active Expired
- 1978-01-24 CH CH74278A patent/CH638171A5/de not_active IP Right Cessation
- 1978-01-24 EG EG43/78A patent/EG13028A/xx active
- 1978-01-24 DE DE2802962A patent/DE2802962C2/de not_active Expired
- 1978-01-24 DK DK034778A patent/DK158784C/da active
- 1978-01-24 NL NLAANVRAGE7800824,A patent/NL189087C/xx not_active IP Right Cessation
- 1978-01-24 JP JP588278A patent/JPS5395945A/ja active Granted
- 1978-01-24 PT PT67574A patent/PT67574B/pt unknown
- 1978-01-24 ZM ZM10/78A patent/ZM1078A1/xx unknown
- 1978-01-24 TR TR20462A patent/TR20462A/xx unknown
- 1978-04-05 ES ES468566A patent/ES468566A1/es not_active Expired
- 1978-04-05 ES ES468567A patent/ES468567A1/es not_active Expired
- 1978-06-15 FR FR7817922A patent/FR2383914A1/fr active Granted
-
1979
- 1979-11-06 PH PH23248A patent/PH15508A/en unknown
-
1980
- 1980-01-01 AR AR21863580D patent/AR218651A1/es active
- 1980-05-05 IL IL59997A patent/IL59997A0/xx unknown
- 1980-05-05 IL IL59996A patent/IL59996A0/xx unknown
-
1982
- 1982-09-22 SE SE8205420A patent/SE445735B/sv not_active IP Right Cessation
- 1982-09-22 SE SE8205421A patent/SE445736B/sv not_active IP Right Cessation
- 1982-12-30 US US06/454,863 patent/US4970330A/en not_active Expired - Fee Related
-
1986
- 1986-02-01 JP JP61019209A patent/JPS61178949A/ja active Granted
-
1993
- 1993-06-30 NL NL930122C patent/NL930122I1/nl unknown
-
1997
- 1997-07-10 NL NL971011C patent/NL971011I2/nl unknown
Patent Citations (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2231312B2 (de) * | 1971-06-29 | 1974-03-14 | Sumitomo Chemical Co., Ltd., Osaka (Japan) |
Cited By (22)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2907609A1 (de) * | 1978-02-28 | 1979-09-13 | Montedison Spa | Neue pyrethroide, deren herstellung und verwendung |
US4258202A (en) | 1978-02-28 | 1981-03-24 | Montedison S.P.A. | Cyclopropanecarboxylic acids and esters |
US4328237A (en) | 1978-02-28 | 1982-05-04 | Montedison S.P.A. | Pyrethroids |
EP0008340A1 (de) * | 1978-07-15 | 1980-03-05 | Bayer Ag | Fluoralkenylsubstituierte Cyclopropancarbonsäureester, Zwischenprodukte dafür, Herstellung der Verbindungen und ihre Verwendung als Insektizide und/oder Akarizide |
US4252820A (en) | 1978-07-15 | 1981-02-24 | Bayer Aktiengesellschaft | Arthropodicidal 2,2-dimethyl-3-(2-perfluoroalkyl-2-perhaloalkyl-vinyl)-cyclopropanecarboxylic acid esters |
EP0009709A1 (de) * | 1978-09-29 | 1980-04-16 | Bayer Ag | Fluoralkenylsubstituierte Cyclopropancarbonsäureester (I), Verfahren zu ihrer Herstellung , hierbei erhaltene Zwischenprodukte und deren Herstellung, die Ester (I) enthaltende Mittel und die Verwendung der Ester (I) zur Bekämpfung von Insekten und/oder Spinnentieren |
EP0010859A1 (de) * | 1978-10-31 | 1980-05-14 | Imperial Chemical Industries Plc | Verfahren zum Herstellen von Cyclopropancarbonsäure-Estern |
DE3045768A1 (de) * | 1979-12-07 | 1981-06-11 | CIBA-GEIGY AG, 4002 Basel | 2-(2',2'-dichlor-3',3',3'-trifluorpropyl)- und 2-(2',2',3'-trichlor-3',3'-difluorporpyl)-4-chlorcyclobutan-1-one |
EP0050776A1 (de) * | 1980-10-23 | 1982-05-05 | Bayer Ag | Verfahren zur Herstellung von chlor-fluoralkenyl-substituierten Cyclopropancarbonsäureestern |
DE3225130A1 (de) * | 1981-07-10 | 1983-01-27 | National Research Development Corp., London | Benzylalkoholderivate, verfahren zu deren herstellung und pestizide unter deren verwendung |
EP1955592A2 (de) | 2004-01-08 | 2008-08-13 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden Eigenschaften |
DE102007045953A1 (de) | 2007-09-26 | 2009-04-02 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
DE102007045953B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
DE102009028001A1 (de) | 2009-07-24 | 2011-01-27 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
WO2011134964A1 (de) | 2010-04-28 | 2011-11-03 | Bayer Cropscience Ag | Synergistische wirkstoffkombinationen |
WO2012150206A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue cyclopropansäureeesterderivate als schädlingsbekämpfungsmittel |
WO2012150223A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue pyridinmethylester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
WO2012150208A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Verwendung von substituierten benzylalkoholestern der cyclopropancarbonsäure zur bekämpfung von insektizid-resistenten insekten |
WO2012150207A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Verwendung von cyclopropancarbonsäureeesterderivaten zur bekämpfung von insektizid-resistenten insekten |
WO2012150221A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue halogenierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
WO2012150205A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue substituierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2802962A1 (de) | Halogenierte ester, verfahren zu ihrer herstellung und sie enthaltende insektizide zusammensetzungen | |
US4385070A (en) | Halogenated esters | |
DE2653189A1 (de) | Cyclopropanverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende insektizide | |
DE2810881A1 (de) | Substituierte pyridylmethylester von cyclopropancarbonsaeuren und ihre verwendung als insektizide | |
DE1543805B1 (de) | Substituierte 3-Furylmethylester und Verfahren zu deren Herstellung sowie deren Verwendung als Insekticide | |
DD147196A5 (de) | Insektizide mittel | |
US4551546A (en) | Halogenated esters | |
DE2348930B2 (de) | Insektizide Mittel auf Basis von Chrysanthemumsäureestern | |
DE2949342C2 (de) | ||
DE2757066A1 (de) | Phenylalkansaeure-m-phenoxybenzylester, verfahren zu ihrer herstellung und deren verwendung | |
EP0001064A2 (de) | Fluorsubstituierte Phenoxybenzyl-oxycarbonylderivate,-alkohole und -halogenide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
DE3788861T2 (de) | Fluorbenzylester. | |
DE2907609C2 (de) | ||
DE2706184A1 (de) | Cyclopropancarbonsaeureester, verfahren zu ihrer herstellung und ihre verwendung | |
DE2554634C3 (de) | Cyclopropancarbonsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Pestizide | |
US4330675A (en) | Halogenated esters | |
DE69006751T2 (de) | Insektizide Verbindungen. | |
DE3327292A1 (de) | Neue verbindungen, verfahren zu ihrer herstellung und die verwendung dieser verbindungen | |
US4378316A (en) | Halogenated esters | |
CH647224A5 (de) | Substituierter benzylester einer 2,2-dimethyl-3-(2,2-dihalogenvinyl)cyclopropancarbonsaeure. | |
DE2633551A1 (de) | Cyclopropankarbonsaeure-3-(2,2- dichlorvinyloxy)-benzylester, verfahren zu ihrer herstellung und ihre verwendung | |
DE3006922A1 (de) | Cyclopropancarbonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und/oder akarizide | |
DE3318572A1 (de) | Neue pestizide und verfahren zu ihrer herstellung | |
DE2810031A1 (de) | Alpha- oder beta- substituierte isovaleriansaeureester enthaltendes schaedlingsbekaempfungsmittel | |
AT375242B (de) | Insektizides mittel |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
8110 | Request for examination paragraph 44 | ||
8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2858248 Format of ref document f/p: P |
|
Q171 | Divided out to: |
Ref country code: DE Ref document number: 2858248 |
|
8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2858249 Format of ref document f/p: P |
|
Q171 | Divided out to: |
Ref country code: DE Ref document number: 2858249 |
|
8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2858263 Format of ref document f/p: P Ref country code: DE Ref document number: 2858264 Format of ref document f/p: P |
|
Q171 | Divided out to: |
Ref country code: DE Ref document number: 2858263 Ref country code: DE Ref document number: 2858264 |
|
D2 | Grant after examination | ||
8364 | No opposition during term of opposition | ||
AH | Division in |
Ref country code: DE Ref document number: 2858264 Format of ref document f/p: P |
|
AH | Division in |
Ref country code: DE Ref document number: 2858263 Format of ref document f/p: P |
|
AH | Division in |
Ref country code: DE Ref document number: 2858249 Format of ref document f/p: P |
|
AH | Division in |
Ref country code: DE Ref document number: 2858248 Format of ref document f/p: P |
|
8327 | Change in the person/name/address of the patent owner |
Owner name: ZENECA LTD., LONDON, GB |
|
8328 | Change in the person/name/address of the agent |
Free format text: ANDRAE, S., DIPL.-CHEM. DR.RER.NAT., 81541 MUENCHEN FLACH, D., DIPL.-PHYS., 83022 ROSENHEIM HAUG, D., DIPL.-ING. KNEISSL, R., DIPL.-CHEM. DR.RER.NAT., PAT.-ANWAELTE, 81541 MUENCHEN |
|
V448 | Application of spc |
Free format text: PRODUCT NAME: LAMBDA-CYHALOTHRIN; REGISTRATION NO/DATE: 03809-00, 19890614; 23809-00, 19921110 Spc suppl protection certif: 197 75 045 Filing date: 19970731 |
|
V457 | Spc granted |
Free format text: PRODUCT NAME: LAMBDA-CYHALOTHRIN; REGISTRATION NO/DATE: 03809-00, 19890614; 23809-00, 19921110 Spc suppl protection certif: 197 75 045 Filing date: 19970731 |
|
V464 | Spc expired |
Free format text: PRODUCT NAME: LAMBDA-CYHALOTHRIN; REGISTRATION NO/DATE: 03809-00, 19890614; 23809-00, 19921110 Spc suppl protection certif: 197 75 045 Filing date: 19970731 |