DE2746834A1 - Verfahren zum herstellen substituierter bis(amidinoharnstoffen) - Google Patents
Verfahren zum herstellen substituierter bis(amidinoharnstoffen)Info
- Publication number
- DE2746834A1 DE2746834A1 DE19772746834 DE2746834A DE2746834A1 DE 2746834 A1 DE2746834 A1 DE 2746834A1 DE 19772746834 DE19772746834 DE 19772746834 DE 2746834 A DE2746834 A DE 2746834A DE 2746834 A1 DE2746834 A1 DE 2746834A1
- Authority
- DE
- Germany
- Prior art keywords
- isothiobiuret
- addition salt
- acid addition
- organic solvent
- hydroxyl groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 53
- SQSPRWMERUQXNE-UHFFFAOYSA-N Guanylurea Chemical compound NC(=N)NC(N)=O SQSPRWMERUQXNE-UHFFFAOYSA-N 0.000 title description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 63
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 63
- 239000002253 acid Substances 0.000 claims description 40
- 150000003839 salts Chemical class 0.000 claims description 38
- 125000001931 aliphatic group Chemical group 0.000 claims description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 19
- 125000003277 amino group Chemical group 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 14
- 125000002723 alicyclic group Chemical group 0.000 claims description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 239000003960 organic solvent Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 239000012458 free base Substances 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 235000021190 leftovers Nutrition 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 58
- -1 alicyclic amines Chemical group 0.000 description 34
- 230000015572 biosynthetic process Effects 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 12
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- XUSNPFGLKGCWGN-UHFFFAOYSA-N 3-[4-(3-aminopropyl)piperazin-1-yl]propan-1-amine Chemical compound NCCCN1CCN(CCCN)CC1 XUSNPFGLKGCWGN-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- LFXAECSQJSRSTP-UHFFFAOYSA-N hydron;methyl carbamimidothioate;iodide Chemical compound I.CSC(N)=N LFXAECSQJSRSTP-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000007790 scraping Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- PQKZBWFTAIFKKV-UHFFFAOYSA-N 1-carbamimidoyl-1-[3-[4-[3-[carbamimidoyl(2,4,4-trimethylpentan-2-ylcarbamoyl)amino]propyl]piperazin-1-yl]propyl]-3-(2,4,4-trimethylpentan-2-yl)urea Chemical compound CC(C)(C)CC(C)(C)NC(=O)N(C(N)=N)CCCN1CCN(CCCN(C(N)=N)C(=O)NC(C)(C)CC(C)(C)C)CC1 PQKZBWFTAIFKKV-UHFFFAOYSA-N 0.000 description 1
- XOHBENIMDRFUIH-UHFFFAOYSA-N 2-isocyanato-2,4,4-trimethylpentane Chemical compound CC(C)(C)CC(C)(C)N=C=O XOHBENIMDRFUIH-UHFFFAOYSA-N 0.000 description 1
- BHDCTKUOBUNTTP-UHFFFAOYSA-N 3-(isocyanatomethyl)heptane Chemical compound CCCCC(CC)CN=C=O BHDCTKUOBUNTTP-UHFFFAOYSA-N 0.000 description 1
- AXEUCRIEXMBJCE-UHFFFAOYSA-N CCCCCC.CS(O)(=O)=O.CS(O)(=O)=O Chemical compound CCCCCC.CS(O)(=O)=O.CS(O)(=O)=O AXEUCRIEXMBJCE-UHFFFAOYSA-N 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 1
- 238000005915 ammonolysis reaction Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical group 0.000 description 1
- FHUKASKVKWSLCY-UHFFFAOYSA-N bixlozone Chemical compound O=C1C(C)(C)CON1CC1=CC=C(Cl)C=C1Cl FHUKASKVKWSLCY-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ANJPRQPHZGHVQB-UHFFFAOYSA-N hexyl isocyanate Chemical compound CCCCCCN=C=O ANJPRQPHZGHVQB-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- DUDXQIXWPJMPRQ-UHFFFAOYSA-N isocyanatomethylcyclohexane Chemical compound O=C=NCC1CCCCC1 DUDXQIXWPJMPRQ-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- RSJDPRFLMBXMFO-UHFFFAOYSA-N methanesulfonic acid;piperazine Chemical compound CS(O)(=O)=O.CS(O)(=O)=O.C1CNCCN1 RSJDPRFLMBXMFO-UHFFFAOYSA-N 0.000 description 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 1
- BWKQVWQYYSAKHC-UHFFFAOYSA-N methylthiourea;hydroiodide Chemical compound I.CNC(N)=S BWKQVWQYYSAKHC-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- GJITZQJJXMCHBD-UHFFFAOYSA-N n,n'-dimethyl-n'-[2-[methyl-[2-(methylamino)ethyl]amino]ethyl]ethane-1,2-diamine Chemical compound CNCCN(C)CCN(C)CCNC GJITZQJJXMCHBD-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 125000006233 propoxy propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- MSXVEPNJUHWQHW-UHFFFAOYSA-N tertiary amyl alcohol Natural products CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/24—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/38—Isothioureas containing any of the groups, X being a hetero atom, Y being any atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/08—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73531876A | 1976-10-26 | 1976-10-26 | |
| US05/817,040 US4209624A (en) | 1976-10-26 | 1977-07-19 | Process for preparing substituted bis(amidinoureas) |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2746834A1 true DE2746834A1 (de) | 1978-04-27 |
Family
ID=27112869
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772746834 Withdrawn DE2746834A1 (de) | 1976-10-26 | 1977-10-14 | Verfahren zum herstellen substituierter bis(amidinoharnstoffen) |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4209624A (enExample) |
| JP (1) | JPS594425B2 (enExample) |
| AU (1) | AU518146B2 (enExample) |
| CA (1) | CA1086760A (enExample) |
| CH (1) | CH624667A5 (enExample) |
| DE (1) | DE2746834A1 (enExample) |
| ES (1) | ES462811A1 (enExample) |
| FR (1) | FR2369253A2 (enExample) |
| MX (1) | MX5410E (enExample) |
| NL (1) | NL7711673A (enExample) |
| PH (1) | PH16237A (enExample) |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE466879C (de) * | 1925-08-04 | 1928-10-17 | Schering Kahlbaum Ag | Verfahren zur Darstellung von Aminoguanidinen |
| GB935614A (en) * | 1960-03-18 | 1963-08-28 | Monsanto Canada Ltd | Diguanidine derivatives |
| US3657337A (en) * | 1967-12-04 | 1972-04-18 | Sandoz Ag | Benzylideneamino guanidines |
| DE1768867C3 (de) * | 1968-07-09 | 1973-12-20 | Boehringer Mannheim Gmbh, 6800 Mannheim | Aminoguanidin-Derivate, Verfahren zu deren Herstellung und deren Verwendung zur Herstellung von Arzneimitteln |
| US3960949A (en) * | 1971-04-02 | 1976-06-01 | Schering Aktiengesellschaft | 1,2-Biguanides |
| US4025652A (en) * | 1975-03-31 | 1977-05-24 | William H. Rorer, Inc. | Amidinoureas |
| US4022962A (en) * | 1975-02-03 | 1977-05-10 | Cooper Laboratories, Inc. | Carbamylguanidine antimicrobial compounds |
| DE2648858A1 (de) * | 1975-10-30 | 1977-05-18 | Cooper Lab | Antimikrobielle verbindungen auf der grundlage von bis-carbamylguanidinoazaalkanen |
-
1977
- 1977-07-19 US US05/817,040 patent/US4209624A/en not_active Expired - Lifetime
- 1977-09-27 CA CA287,620A patent/CA1086760A/en not_active Expired
- 1977-09-30 ES ES462811A patent/ES462811A1/es not_active Expired
- 1977-10-13 AU AU29679/77A patent/AU518146B2/en not_active Expired
- 1977-10-14 DE DE19772746834 patent/DE2746834A1/de not_active Withdrawn
- 1977-10-25 FR FR7732065A patent/FR2369253A2/fr active Granted
- 1977-10-25 JP JP52127324A patent/JPS594425B2/ja not_active Expired
- 1977-10-25 NL NL7711673A patent/NL7711673A/xx not_active Application Discontinuation
- 1977-10-26 CH CH1303277A patent/CH624667A5/fr not_active IP Right Cessation
- 1977-10-26 MX MX776505U patent/MX5410E/es unknown
- 1977-10-26 PH PH20368A patent/PH16237A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH624667A5 (enExample) | 1981-08-14 |
| US4209624A (en) | 1980-06-24 |
| PH16237A (en) | 1983-08-11 |
| MX5410E (es) | 1983-07-19 |
| NL7711673A (nl) | 1978-04-28 |
| ES462811A1 (es) | 1978-12-16 |
| AU2967977A (en) | 1979-04-26 |
| AU518146B2 (en) | 1981-09-17 |
| FR2369253B2 (enExample) | 1983-09-02 |
| JPS5359626A (en) | 1978-05-29 |
| JPS594425B2 (ja) | 1984-01-30 |
| CA1086760A (en) | 1980-09-30 |
| FR2369253A2 (fr) | 1978-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2505297B2 (de) | Verfahren zur Herstellung von in 2- und 6-Stellung des Phenylkerns substituierten 2-Phenylamino-2-imidazolin-Derivaten | |
| DD147846A5 (de) | Verfahren zur herstellung von 2-arylaminohexahydropyrimidinen und-imidazolinen | |
| DE2124907A1 (de) | 3 Amino 1,2,4 oxadiazole, Verfahren zu ihrer Herstellung und Arzneipraparate | |
| DE2746834A1 (de) | Verfahren zum herstellen substituierter bis(amidinoharnstoffen) | |
| DE3507579A1 (de) | Verfahren zur herstellung von 2-hydrazino-1,3-diazacycloalk-2-en-hydrohalolgeniden | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| DE1177142B (de) | Verfahren zur Herstellung von Sulfonsaeure-gruppen enthaltenden Dithiocarbaminsaeure-esterderivaten | |
| DE2536951C3 (de) | Triazapentadiene, Verfahren zu ihrer Herstellung und diese enthaltende insektizide Mittel | |
| DE632572C (de) | Verfahren zur Darstellung von Abkoemmlingen cyclischer AEther und Thioaether | |
| DE1177633B (de) | Verfahren zur Herstellung aminoalkylierter 9,10-Dihydroanthracene | |
| DE1620128A1 (de) | Verfahren zur Herstellung von neuen organischen Amiden | |
| DE3530061A1 (de) | Verfahren zur herstellung von guanidinothiazolderivaten | |
| DE1643487C3 (de) | Cysteaminderivate, Verfahren zur Herstellung und ihre Verwendung | |
| DE1543288A1 (de) | Verfahren zur Herstellung von Dibenzocycloheptenylaminen | |
| DE1545844C (de) | 3 Amino benzisothiazole und Verfah ren zu deren Hersteilung | |
| DE1097995B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| AT265308B (de) | Verfahren zur Herstellung von N-Benzyl-N',N"-dimethylguanidin oder seinen Säureadditionssalzen | |
| DE1102747B (de) | Verfahren zur Herstellung von spasmolytisch wirksamen 1-Alkyl-4-acylpiperazinen | |
| DE159692C (enExample) | ||
| DE2436897C2 (de) | Verfahren zur Herstellung von Trisaminopyridinen | |
| DE1643458C3 (de) | N-(2-Alkoxybenzoyl)-p-aminobenzoesäure-aminoalkylester sowie deren quartäre Methylammoniumderivate und Verfahren zu ihrer Herstellung | |
| CH398613A (de) | Verfahren zur Herstellung von neuen Piperazinen | |
| DE1018869B (de) | Verfahren zur Herstellung von Aminoalkylpurinderivaten | |
| DE1024954B (de) | Verfahren zur Herstellung von N-disubstituierten Dithiocarbaminsaeureestern, die im Alkoholrest Sulfonsaeuregruppen enthalten | |
| DE1695156C (de) | Tetrahydroisochinohn derivate Ausscheidung aus 1244788 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |