DE2728772C2 - Vernetzbare Mischungen sowie Verfahren zur Vernetzung von halogenhaltigen Polymerisaten - Google Patents
Vernetzbare Mischungen sowie Verfahren zur Vernetzung von halogenhaltigen PolymerisatenInfo
- Publication number
- DE2728772C2 DE2728772C2 DE2728772A DE2728772A DE2728772C2 DE 2728772 C2 DE2728772 C2 DE 2728772C2 DE 2728772 A DE2728772 A DE 2728772A DE 2728772 A DE2728772 A DE 2728772A DE 2728772 C2 DE2728772 C2 DE 2728772C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- carbon atoms
- mercapto
- thiadiazole
- radicals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title claims description 39
- 238000004132 cross linking Methods 0.000 title claims description 30
- 238000000034 method Methods 0.000 title claims description 21
- 229910052736 halogen Inorganic materials 0.000 title claims description 20
- 150000002367 halogens Chemical class 0.000 title claims description 20
- 239000000203 mixture Substances 0.000 title description 41
- -1 basic metal salt Chemical class 0.000 claims description 40
- 239000000463 material Substances 0.000 claims description 24
- BIGYLAKFCGVRAN-UHFFFAOYSA-N 1,3,4-thiadiazolidine-2,5-dithione Chemical class S=C1NNC(=S)S1 BIGYLAKFCGVRAN-UHFFFAOYSA-N 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 229910052728 basic metal Inorganic materials 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 229910001038 basic metal oxide Inorganic materials 0.000 claims description 4
- 150000003818 basic metals Chemical class 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- 239000003431 cross linking reagent Substances 0.000 description 19
- 229910052757 nitrogen Inorganic materials 0.000 description 19
- 239000003963 antioxidant agent Substances 0.000 description 18
- 239000006229 carbon black Substances 0.000 description 18
- 229920001577 copolymer Polymers 0.000 description 18
- 230000000704 physical effect Effects 0.000 description 16
- 230000003078 antioxidant effect Effects 0.000 description 12
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 11
- 239000012141 concentrate Substances 0.000 description 11
- 229910052717 sulfur Inorganic materials 0.000 description 11
- 239000011593 sulfur Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000006057 Non-nutritive feed additive Substances 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 235000021355 Stearic acid Nutrition 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 8
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 8
- 239000004014 plasticizer Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000008117 stearic acid Substances 0.000 description 8
- 239000004709 Chlorinated polyethylene Substances 0.000 description 7
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000004073 vulcanization Methods 0.000 description 6
- 241001441571 Hiodontidae Species 0.000 description 5
- 239000000395 magnesium oxide Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 150000003751 zinc Chemical class 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 4
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 4
- 239000000920 calcium hydroxide Substances 0.000 description 4
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229920001084 poly(chloroprene) Polymers 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical compound C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- 239000006238 High Abrasion Furnace Substances 0.000 description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 3
- 239000006242 Semi-Reinforcing Furnace Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 3
- 239000000292 calcium oxide Substances 0.000 description 3
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 229920002681 hypalon Polymers 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- BLCKKNLGFULNRC-UHFFFAOYSA-L n,n-dimethylcarbamodithioate;nickel(2+) Chemical compound [Ni+2].CN(C)C([S-])=S.CN(C)C([S-])=S BLCKKNLGFULNRC-UHFFFAOYSA-L 0.000 description 3
- LPXPSTWBTULMJE-UHFFFAOYSA-N n-phenylbutan-1-imine Chemical compound CCCC=NC1=CC=CC=C1 LPXPSTWBTULMJE-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229920000915 polyvinyl chloride Polymers 0.000 description 3
- 239000005033 polyvinylidene chloride Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- BOXSVZNGTQTENJ-UHFFFAOYSA-L zinc dibutyldithiocarbamate Chemical compound [Zn+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC BOXSVZNGTQTENJ-UHFFFAOYSA-L 0.000 description 3
- 239000011787 zinc oxide Substances 0.000 description 3
- MGAXYKDBRBNWKT-UHFFFAOYSA-N (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC(=O)CC1 MGAXYKDBRBNWKT-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical class CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000006240 Fast Extruding Furnace Substances 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229920005557 bromobutyl Polymers 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 229940046892 lead acetate Drugs 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920002620 polyvinyl fluoride Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 1
- OPNUROKCUBTKLF-UHFFFAOYSA-N 1,2-bis(2-methylphenyl)guanidine Chemical compound CC1=CC=CC=C1N\C(N)=N\C1=CC=CC=C1C OPNUROKCUBTKLF-UHFFFAOYSA-N 0.000 description 1
- 150000004869 1,3,4-thiadiazoles Chemical class 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- BGPJLYIFDLICMR-UHFFFAOYSA-N 1,4,2,3-dioxadithiolan-5-one Chemical compound O=C1OSSO1 BGPJLYIFDLICMR-UHFFFAOYSA-N 0.000 description 1
- BPEBAKIFVVDXRW-UHFFFAOYSA-N 1-(1,3,4-thiadiazol-2-yl)nonan-1-ol Chemical compound OC(CCCCCCCC)C=1SC=NN1 BPEBAKIFVVDXRW-UHFFFAOYSA-N 0.000 description 1
- YUASUAGMSSGALF-UHFFFAOYSA-N 2-(1,3,4-thiadiazol-2-yl)propan-2-ol Chemical compound CC(C)(O)C1=NN=CS1 YUASUAGMSSGALF-UHFFFAOYSA-N 0.000 description 1
- ODLRUBVZRKFZMH-UHFFFAOYSA-N 2-[3,4-bis(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)thiophen-2-yl]propanedioic acid Chemical compound N=1NC(=S)SC=1C1=C(C(C(O)=O)C(=O)O)SC=C1C1=NNC(=S)S1 ODLRUBVZRKFZMH-UHFFFAOYSA-N 0.000 description 1
- HXIQYSLFEXIOAV-UHFFFAOYSA-N 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenol Chemical compound CC1=CC(O)=C(C(C)(C)C)C=C1SC1=CC(C(C)(C)C)=C(O)C=C1C HXIQYSLFEXIOAV-UHFFFAOYSA-N 0.000 description 1
- RIBQDSMHYKQHRC-UHFFFAOYSA-N 9-(1,3,4-thiadiazol-2-yl)heptadecan-9-ol Chemical compound OC(CCCCCCCC)(CCCCCCCC)C=1SC=NN=1 RIBQDSMHYKQHRC-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 229920000181 Ethylene propylene rubber Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 239000013032 Hydrocarbon resin Substances 0.000 description 1
- VHOQXEIFYTTXJU-UHFFFAOYSA-N Isobutylene-isoprene copolymer Chemical compound CC(C)=C.CC(=C)C=C VHOQXEIFYTTXJU-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 239000006244 Medium Thermal Substances 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- FMRLDPWIRHBCCC-UHFFFAOYSA-L Zinc carbonate Chemical compound [Zn+2].[O-]C([O-])=O FMRLDPWIRHBCCC-UHFFFAOYSA-L 0.000 description 1
- KQNKJJBFUFKYFX-UHFFFAOYSA-N acetic acid;trihydrate Chemical compound O.O.O.CC(O)=O KQNKJJBFUFKYFX-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical group 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- ZFMQKOWCDKKBIF-UHFFFAOYSA-N bis(3,5-difluorophenyl)phosphane Chemical compound FC1=CC(F)=CC(PC=2C=C(F)C=C(F)C=2)=C1 ZFMQKOWCDKKBIF-UHFFFAOYSA-N 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- JGIATAMCQXIDNZ-UHFFFAOYSA-N calcium sulfide Chemical compound [Ca]=S JGIATAMCQXIDNZ-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920005556 chlorobutyl Polymers 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 229920005561 epichlorohydrin homopolymer Polymers 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 229920006270 hydrocarbon resin Polymers 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000003879 lubricant additive Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- KCTVZKPLKCEUJF-UHFFFAOYSA-N methylcarbamothioic s-acid Chemical compound CNC(S)=O KCTVZKPLKCEUJF-UHFFFAOYSA-N 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 1
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 239000010690 paraffinic oil Substances 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000003340 retarding agent Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000013040 rubber vulcanization Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 150000004867 thiadiazoles Chemical class 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/45—Heterocyclic compounds having sulfur in the ring
- C08K5/46—Heterocyclic compounds having sulfur in the ring with oxygen or nitrogen in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB26832/76A GB1536593A (en) | 1976-06-28 | 1976-06-28 | Vulcanizing halogen-containing polymers |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2728772A1 DE2728772A1 (de) | 1977-12-29 |
| DE2728772C2 true DE2728772C2 (de) | 1986-04-03 |
Family
ID=10249981
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2728772A Expired DE2728772C2 (de) | 1976-06-28 | 1977-06-25 | Vernetzbare Mischungen sowie Verfahren zur Vernetzung von halogenhaltigen Polymerisaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4128510A (enExample) |
| JP (1) | JPS5921344B2 (enExample) |
| AT (1) | AT368541B (enExample) |
| BE (1) | BE856222A (enExample) |
| CA (1) | CA1112789A (enExample) |
| CH (1) | CH622273A5 (enExample) |
| DE (1) | DE2728772C2 (enExample) |
| DK (1) | DK159657C (enExample) |
| ES (1) | ES460115A1 (enExample) |
| FR (1) | FR2356687A1 (enExample) |
| GB (1) | GB1536593A (enExample) |
| IT (1) | IT1080768B (enExample) |
| NL (1) | NL190667C (enExample) |
| SE (1) | SE432432B (enExample) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1124445A (en) * | 1977-10-17 | 1982-05-25 | Hercules Incorporated | 2,5-dimercapto-1,3,4-thiadiazole as a cross-linker for saturated, halogen containing polymers |
| US4288576A (en) * | 1978-09-15 | 1981-09-08 | Hercules Incorporated | 2,5-Dimercapto-1,3,4-thiadiazole as a cross-linker for saturated, halogen-containing polymers |
| US4306988A (en) * | 1980-11-10 | 1981-12-22 | Olin Corporation | Selected poly(oxyalkylated) 1,3,4-thiadiazoles and their use as corrosion inhibitors |
| US4349458A (en) * | 1980-11-10 | 1982-09-14 | Olin Corporation | Selected poly(oxyalkylated) 1,3,4-thiadiazoles in acid baths and their use as corrosion inhibitors |
| US4329475A (en) * | 1980-11-10 | 1982-05-11 | Olin Corporation | Selected poly(oxyalkylated) 1,3,4-thiadiazoles and their use as corrosion inhibitors |
| US4482681A (en) * | 1981-10-22 | 1984-11-13 | Hercules Incorporated | Crosslinking halogen-containing polymers |
| US4399262A (en) * | 1982-04-12 | 1983-08-16 | The B. F. Goodrich Company | Acrylate rubber compositions |
| DE3336753A1 (de) * | 1983-10-08 | 1985-04-18 | Rhein-Chemie Rheinau Gmbh, 6800 Mannheim | Verfahren zum vernetzen von chloriertem polyethylen |
| US4594396A (en) * | 1984-12-05 | 1986-06-10 | Hercules Incorporated | Cross-linking halogenated polymers |
| JPS61238838A (ja) * | 1985-04-17 | 1986-10-24 | Kagakuhin Kensa Kyokai | ゴム加硫剤 |
| DE3535137A1 (de) * | 1985-10-02 | 1987-04-02 | Bayer Ag | Kautschukmischung und daraus hergestellte covulkanisate |
| IL78339A0 (en) * | 1986-03-30 | 1986-07-31 | Yeda Res & Dev | Stabilized polyvinylchloride |
| US4734457A (en) * | 1987-05-07 | 1988-03-29 | R. T. Vanderbilt Company, Inc. | Rubber compositions containing polymeric phenol derivatives of 1,3,4-thiadiazole |
| US4818778A (en) * | 1987-05-07 | 1989-04-04 | R. T. Vanderbilt Company, Inc. | Rubber compositions containing phenol derivatives of 1,3,4-thiadiazole |
| US4920165A (en) * | 1987-07-07 | 1990-04-24 | Mobay Corporation | Scorch retarder for halogenated elastomers |
| US4753971A (en) * | 1987-07-10 | 1988-06-28 | The Dow Chemical Company | Chlorinated polyethylene elastomer composition having enhanced resistance to ozone-induced cracking |
| US4978716A (en) * | 1988-04-07 | 1990-12-18 | The Dow Chemical Company | Thermoplastic elastomers based upon chlorinated polyethylene and a crystalline olefin polymer |
| US4910245A (en) * | 1988-04-07 | 1990-03-20 | The Dow Chemical Company | Thermoplastic elastomers based upon chlorinated polyethylene and a crystalline olefin polymer |
| US4978703A (en) * | 1990-01-04 | 1990-12-18 | The Dow Chemical Company | Thermoplastic elastomers based upon chlorinated polyethylene and a crystalline olefin polymer |
| US5286795A (en) * | 1990-01-04 | 1994-02-15 | The Dow Chemical Company | Thermoplastic elastomer based upon chlorosulfonated polyethylene and a crystalline olefin polymer |
| DE4013714A1 (de) * | 1990-04-28 | 1991-10-31 | Rhein Chemie Rheinau Gmbh | Verfahren zum vernetzen von halogenhaltigen polymeren |
| JPH06508308A (ja) * | 1991-05-24 | 1994-09-22 | ザ・ダウ・ケミカル・カンパニー | タイヤ用エラストマーバリヤーフィルム |
| DE69327002T2 (de) * | 1992-06-11 | 2000-07-06 | Zeon Chemicals L.P., Louisville | Härtbare mischungen aus halobutylgummi und epihalohydringummi |
| ATE169654T1 (de) * | 1993-09-10 | 1998-08-15 | Vanderbilt Co R T | Härtersystem für halogenierte elastomere |
| US5391621A (en) * | 1993-10-15 | 1995-02-21 | R. T. Vanderbilt Company, Inc. | 1,3,4-thiadiazole curing systems for chlorine containing polymers |
| CA2138004A1 (en) * | 1993-12-16 | 1995-06-17 | Jay B. Class | Controlling premature curing of vulcanizable halogen-containing polymers |
| CA2138002C (en) * | 1993-12-16 | 1998-11-24 | Jay B. Class | Controlling premature curing of vulcanizable halogen-containing polymers |
| CA2138003C (en) * | 1993-12-16 | 1999-04-27 | Jay B. Class | Controlling premature curing of vulcanizable halogen-containing polymers |
| US5665830A (en) * | 1993-12-16 | 1997-09-09 | Hercules Incorporated | Controlling premature curing of vulcanizable halogen-containing polymers |
| JP3496736B2 (ja) * | 1994-08-25 | 2004-02-16 | 株式会社トクヤマ | 接着用表面処理剤 |
| US5773523A (en) | 1995-12-14 | 1998-06-30 | R.T. Vanderbilt Company, Inc. | 1,3,4-thidiazole ether curing systems for chlorine containing polymers |
| EP0796890A1 (en) * | 1996-03-18 | 1997-09-24 | ENICHEM S.p.A. | Vulcanizable acrylic rubber composition |
| US6072970A (en) * | 1996-10-29 | 2000-06-06 | Lexmark International, Inc. | Charge roller |
| US5849925A (en) * | 1996-12-13 | 1998-12-15 | R. T. Vanderbilt Co. | Bis-1,3,4-thiadiazole compounds and lubricating compositions containing same |
| EP1144557A2 (en) | 1999-10-20 | 2001-10-17 | R.T. Vanderbilt Company, Inc. | Thiadiazole additives and lubricating compositions containing the same |
| US7041825B2 (en) * | 2000-12-01 | 2006-05-09 | R.T. Vanderbilt Company, Inc. | Additive compound for curing halogenated polymers |
| KR20070087617A (ko) * | 2004-12-21 | 2007-08-28 | 다우 글로벌 테크놀로지스 인크. | 가황성 할로겐화 탄성체 조성물 |
| US7750088B2 (en) * | 2005-03-14 | 2010-07-06 | Dow Global Technologies | Cure system for chlorinated elastomer compositions and a method of curing chlorinated elastomer compositions |
| WO2006098846A1 (en) | 2005-03-14 | 2006-09-21 | Dow Global Technologies Inc. | An improved cure system composition and a method for curing chlorinated elastomer compositions |
| WO2008027754A2 (en) * | 2006-08-30 | 2008-03-06 | Dow Global Technologies Inc. | A cure system for halogenated elastomer compositions, a curable halogenated elastomer composition, and a method for curing halogenated elastomer compositions |
| ATE455148T1 (de) * | 2006-08-30 | 2010-01-15 | Dow Global Technologies Inc | Härtungssystem für halogenierte elastomere zusammensetzungen, härtbare halogenierte elastomere zusammensetzung und verfahren zur härtung einer halogenierten elastomeren zusammensetzung |
| US9074073B2 (en) * | 2009-12-07 | 2015-07-07 | The Goodyear Tire & Rubber Company | Rubber composition containing silica reinforcement and functionalized crosslinks and products with component thereof |
| FR2974098B1 (fr) * | 2011-04-14 | 2013-04-19 | Michelin Soc Tech | Composition de caoutchouc comprenant un derive du thiadiazole |
| FR2975996B1 (fr) * | 2011-06-06 | 2013-05-24 | Mlpc Internat | Composition de vulcanisation pour polymeres insatures |
| SG11201504775WA (en) | 2012-12-26 | 2015-07-30 | Lanxess Butyl Pte Ltd | Sulfur-free, zinc-free cure system for halobutyl and halogen containing polymers |
| WO2014119517A1 (ja) * | 2013-01-30 | 2014-08-07 | 電気化学工業株式会社 | クロロプレンゴム組成物及び加硫成形体 |
| JP2014169378A (ja) * | 2013-03-04 | 2014-09-18 | Denki Kagaku Kogyo Kk | ゴム組成物及び加硫発泡成形体 |
| SI3006491T1 (sl) * | 2014-10-08 | 2017-03-31 | Armacell Enterprise Gmbh & Co. Kg | Malodimna gibka izolacijska pena |
| CN104387339A (zh) * | 2014-11-18 | 2015-03-04 | 天津理工大学 | 一种含有脂肪链的噻二唑衍生物及其制备方法 |
| US20240384016A1 (en) | 2021-11-18 | 2024-11-21 | Lg Chem, Ltd. | Polyethylene and vulcanizable chlorinated polyethylene compositions using the same |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2685588A (en) * | 1952-03-28 | 1954-08-03 | Sharples Chemicals Inc | Reaction products of 1, 3, 4-thiadiazole-2, 5-dithol and nu-substituted thiocarbamylhalides and their preparation |
| US2760933A (en) * | 1952-11-25 | 1956-08-28 | Standard Oil Co | Lubricants |
| DE953607C (de) * | 1953-08-20 | 1956-12-06 | Basf Ag | Verfahren zur Herstellung von Mono- oder Disubstitutionsprodukten des 2, 5-Dimercapto-1, 3, 4-thiadiazols |
| US2983715A (en) * | 1958-03-26 | 1961-05-09 | Standard Oil Co | Rubber vulcanization acceleration |
| US3026305A (en) * | 1960-02-10 | 1962-03-20 | Hercules Powder Co Ltd | Vulcanization of polymers and copolymers of epichlorohydrin |
| GB974915A (en) | 1962-09-18 | 1964-11-11 | Exxon Research Engineering Co | Improvement in curing of halogenated elastomers |
| US3341491A (en) * | 1963-09-10 | 1967-09-12 | Hercules Inc | Vulcanized epihalohydrin polymers |
| US3357956A (en) * | 1965-03-30 | 1967-12-12 | Du Pont | Polymeric 1, 3, 4-thiadiazoles and the process for their preparation |
| US3700650A (en) * | 1969-06-12 | 1972-10-24 | Asahi Glass Co Ltd | Vulcanization of epihalohydrin polymers |
| US3732191A (en) * | 1972-02-07 | 1973-05-08 | Goodrich Co B F | Polythiol vulcanization of epihalohydrin elastomers |
| US3898203A (en) * | 1973-11-05 | 1975-08-05 | Goodyear Tire & Rubber | Epihalohydrin cure regulators |
-
1976
- 1976-06-28 GB GB26832/76A patent/GB1536593A/en not_active Expired
-
1977
- 1977-04-18 US US05/788,395 patent/US4128510A/en not_active Expired - Lifetime
- 1977-05-12 CA CA278,272A patent/CA1112789A/en not_active Expired
- 1977-06-25 DE DE2728772A patent/DE2728772C2/de not_active Expired
- 1977-06-27 ES ES460115A patent/ES460115A1/es not_active Expired
- 1977-06-27 CH CH785577A patent/CH622273A5/fr not_active IP Right Cessation
- 1977-06-27 SE SE7707402A patent/SE432432B/xx not_active IP Right Cessation
- 1977-06-27 IT IT25100/77A patent/IT1080768B/it active
- 1977-06-27 JP JP52075667A patent/JPS5921344B2/ja not_active Expired
- 1977-06-27 AT AT0452677A patent/AT368541B/de not_active IP Right Cessation
- 1977-06-28 NL NL7707131A patent/NL190667C/xx not_active IP Right Cessation
- 1977-06-28 FR FR7719829A patent/FR2356687A1/fr active Granted
- 1977-06-28 DK DK286677A patent/DK159657C/da not_active IP Right Cessation
- 1977-06-28 BE BE178871A patent/BE856222A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2356687A1 (fr) | 1978-01-27 |
| IT1080768B (it) | 1985-05-16 |
| FR2356687B1 (enExample) | 1983-12-02 |
| NL190667C (nl) | 1994-06-16 |
| DK159657B (da) | 1990-11-12 |
| DE2728772A1 (de) | 1977-12-29 |
| SE432432B (sv) | 1984-04-02 |
| ATA452677A (de) | 1982-02-15 |
| DK286677A (da) | 1977-12-29 |
| AT368541B (de) | 1982-10-25 |
| SE7707402L (sv) | 1977-12-29 |
| GB1536593A (en) | 1978-12-20 |
| CH622273A5 (enExample) | 1981-03-31 |
| BE856222A (fr) | 1977-12-28 |
| NL7707131A (nl) | 1977-12-30 |
| NL190667B (nl) | 1994-01-17 |
| CA1112789A (en) | 1981-11-17 |
| JPS5921344B2 (ja) | 1984-05-19 |
| JPS533439A (en) | 1978-01-13 |
| ES460115A1 (es) | 1978-05-01 |
| US4128510A (en) | 1978-12-05 |
| DK159657C (da) | 1991-04-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2728772C2 (de) | Vernetzbare Mischungen sowie Verfahren zur Vernetzung von halogenhaltigen Polymerisaten | |
| DE1929928C3 (de) | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere | |
| DE2552617C2 (de) | Verfahren zur Herstellung eines modifizierten kautschukartigen Terpolymeren und seine Verwendung | |
| US4288576A (en) | 2,5-Dimercapto-1,3,4-thiadiazole as a cross-linker for saturated, halogen-containing polymers | |
| DE69610746T2 (de) | Fluorhaltige Elastomerzusammensetzung | |
| DE3688608T2 (de) | Vorvulkanisationsgehemmte, vernetzbare Zusammensetzung, welche eine Mischung aus Kupfer- und anderen Metalldithiocarbamaten enthält. | |
| DE19926986B9 (de) | Vulkanisierbare chloriertes Polyethylen-Zubereitung und daraus erhältliche vulkanisierte Produkte | |
| DE2938973C2 (de) | Härtbare Zusammensetzung auf Basis eines Halogen enthaltenden Polymeren | |
| DE3107941C2 (de) | "Härtbare Zusammensetzung eines Halogen enthaltenden Polymeren" | |
| DE2452915A1 (de) | Verfahren zur herstellung von brombutylkautschukzusammensetzungen | |
| DE2733657A1 (de) | Sesshafte sulfonylazid-antioxidationsmittel | |
| DE2545292B2 (de) | Azaadamantanverbindungen als Stabilisatoren für organische Polymerisatzusammensetzungen | |
| DE1180936B (de) | Verfahren zur Herstellung vulkanisierter synthetischer kautschukartiger Produkte | |
| DE3323151C2 (enExample) | ||
| DE69613468T2 (de) | Halogenierte elastomerzusammensetzungen | |
| DE3107940C2 (de) | Härtbare Zusammensetzung auf Basis von Halogen enthaltenden Polymeren | |
| DE2233122C3 (de) | 1,3,8-Triaza-7,7,9,9 -tetramethyl-spiro [4.5] decan-2,4-dione | |
| DE1048023B (de) | Verfahren zur Herstellung einer mit Schwefel vulkanisierbaren Formmasse | |
| EP0806449A1 (de) | Polymercompounds und ihre Verwendung für die Vulkanisation halogenhaltiger Kautschuke | |
| DE1163538B (de) | Verfahren zum Herstellen von Vulkanisaten von Butylkautschuk | |
| DE3247780A1 (de) | Haertbare zusammensetzung von epichlorhydrinkautschuk und acrylkautschuk und gehaertete zusammensetzung daraus | |
| DE2754060C2 (de) | Vernetzbare Mischungen und Verfahren zum Vernetzen | |
| DE1929742B2 (de) | Halogenhaltige polymere elastomere Massen | |
| EP0455030B1 (de) | Verfahren zum Vernetzen von halogenhaltigen Polymeren | |
| DE2845125A1 (de) | Verfahren zum vernetzen von gesaettigten, halogenhaltigen polymerisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |