DE2728732A1 - Landmaschine - Google Patents
LandmaschineInfo
- Publication number
- DE2728732A1 DE2728732A1 DE19772728732 DE2728732A DE2728732A1 DE 2728732 A1 DE2728732 A1 DE 2728732A1 DE 19772728732 DE19772728732 DE 19772728732 DE 2728732 A DE2728732 A DE 2728732A DE 2728732 A1 DE2728732 A1 DE 2728732A1
- Authority
- DE
- Germany
- Prior art keywords
- machine according
- machine
- tine
- support body
- prongs
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000005540 biological transmission Effects 0.000 claims description 3
- 230000001681 protective effect Effects 0.000 claims 7
- OCDRLZFZBHZTKQ-NMUBGGKPSA-N onetine Chemical compound C[C@@H](O)[C@@]1(O)C[C@@H](C)[C@@](C)(O)C(=O)OC\C2=C\CN(C)CC[C@@H](OC1=O)C2=O OCDRLZFZBHZTKQ-NMUBGGKPSA-N 0.000 claims 4
- 244000025254 Cannabis sativa Species 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 230000002441 reversible effect Effects 0.000 claims 1
- 210000002105 tongue Anatomy 0.000 description 8
- 230000005484 gravity Effects 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 3
- 239000004459 forage Substances 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D78/00—Haymakers with tines moving with respect to the machine
- A01D78/08—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels
- A01D78/10—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels the tines rotating about a substantially vertical axis
- A01D78/1078—Having only one row of rotors arranged on the same horizontal line perpendicular to the advance direction of the machine
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Soil Working Implements (AREA)
- Harvesting Machines For Specific Crops (AREA)
- Agricultural Machines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7607093A NL7607093A (nl) | 1976-06-29 | 1976-06-29 | Machine voor het bewerken van gewas. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2728732A1 true DE2728732A1 (de) | 1978-01-05 |
Family
ID=19826473
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772728732 Withdrawn DE2728732A1 (de) | 1976-06-29 | 1977-06-25 | Landmaschine |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4202160A (enExample) |
| BE (1) | BE856212A (enExample) |
| CH (1) | CH622669A5 (enExample) |
| DE (1) | DE2728732A1 (enExample) |
| DK (1) | DK277677A (enExample) |
| FR (2) | FR2356353A1 (enExample) |
| GB (1) | GB1578562A (enExample) |
| NL (1) | NL7607093A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004058461A1 (de) * | 2004-12-03 | 2006-06-14 | Maschinenfabrik Bernard Krone Gmbh | Heuwerbungsmaschine |
| EP3881670A1 (de) * | 2020-03-20 | 2021-09-22 | Kverneland Group Kerteminde A/S | Heuwerbungsmaschine |
| DE102024115522A1 (de) | 2024-06-04 | 2025-12-04 | Kverneland Group Gottmadingen N.V. | Frontanbau - Heuwerbungsmaschine |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK156531B (da) * | 1979-10-23 | 1989-09-11 | Lely Nv C Van Der | Rivemaskine |
| NL188013B (nl) * | 1981-12-22 | 1991-10-16 | Lely Nv C Van Der | Landbouwwerktuig. |
| NL8400715A (nl) * | 1984-03-06 | 1985-10-01 | Lely Nv C Van Der | Landbouwmachine. |
| US4685282A (en) * | 1985-07-29 | 1987-08-11 | Allen David R | Hay rake assembly |
| EP0427357B1 (en) * | 1986-12-23 | 1995-10-18 | C. van der Lely N.V. | An agricultural machine |
| DE3709097A1 (de) * | 1987-03-20 | 1988-09-29 | Khd Agrartechnik | Kreiselheuwerbungsmaschine |
| NL8800942A (nl) * | 1988-04-12 | 1989-11-01 | Lely Nv C Van Der | Landbouwmachine. |
| DE8807510U1 (de) * | 1988-06-09 | 1989-07-06 | Alois Pöttinger Landmaschinen-Gesellschaft mbH, 8900 Augsburg | Heuwerbungsmaschine |
| DE4042158A1 (de) * | 1990-12-28 | 1992-07-02 | Helmut Maier | Verfahren zum ernten von bodengewaechs und vorrichtung zur durchfuehrung des verfahrens |
| NL9100572A (nl) * | 1991-04-03 | 1992-11-02 | Lely Nv C Van Der | Landbouwmachine. |
| FR2682006A1 (fr) * | 1991-10-04 | 1993-04-09 | Kuhn Sa | Machine de fenaison, notamment une faneuse de vegetaux, avec au moins deux positions de travail. |
| EP0539662B1 (de) * | 1991-10-30 | 1996-12-04 | Claas Saulgau Gmbh | Zweikreisel-Schwader |
| FR2756137B1 (fr) * | 1996-11-26 | 1999-01-22 | Kuhn Sa | Machine de fenaison, notamment une andaineuse avec un deflecteur d'andainage reglage automatiquement dans differentes positions |
| NL1006397C2 (nl) * | 1997-06-25 | 1998-12-29 | Maasland Nv | Werkwijze, alsmede een inrichting voor het verstellen van een landbouwmachine, zoals een hooibouwmachine. |
| NL1009947C2 (nl) * | 1997-10-09 | 1999-04-12 | Maasland Nv | Inrichting voor het verplaatsen van op de grond liggend gewas. |
| US6272826B1 (en) | 1999-04-29 | 2001-08-14 | Sitrex S.R.L. | Method and apparatus for positioning a hay rake |
| US6497294B2 (en) | 1999-08-24 | 2002-12-24 | Clark Equipment Company | Soil conditioner implement |
| US6865873B2 (en) | 2002-06-21 | 2005-03-15 | Sitrex S.R.L. | Pull type V-shaped hay rake |
| US6834488B2 (en) | 2002-11-22 | 2004-12-28 | Sitrex S.R.L. | Towable hay rake with an automatic steering mechanism |
| US6951253B1 (en) * | 2004-03-16 | 2005-10-04 | Superior Attachments, Inc. | Animal bedding groomer |
| US8393040B2 (en) * | 2008-03-31 | 2013-03-12 | Superior Attachments, Inc. | Animal bedding removal apparatus |
| DE102021120403A1 (de) * | 2021-08-05 | 2023-02-09 | Carl Geringhoff Gmbh & Co. Kommanditgesellschaft | Schneidwerk mit seitlich klappbaren Haspelzinken |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL266452A (enExample) * | 1900-01-01 | |||
| FR1257784A (fr) * | 1960-02-25 | 1961-04-07 | Perfectionnements aux dispositifs de fixation des fraises et instruments de culture analogues sur les tracteurs agricoles | |
| FR1284983A (fr) * | 1961-03-27 | 1962-02-16 | Charrue à traction mécanique | |
| AT234424B (de) * | 1961-07-05 | 1964-07-10 | Agrar Fabrik Landw Maschinen A | Heuerntemaschine |
| GB997687A (en) * | 1962-11-24 | 1965-07-07 | Fella Werke Gmbh Fa | Improvements in hay-making machines |
| NL6501673A (enExample) * | 1965-02-11 | 1966-08-12 | ||
| FR1493619A (fr) * | 1966-07-01 | 1967-09-01 | Eberhardt Geb | Dispositif de réglage latéral de la coupe sur une charrue semi-portée |
| CH448597A (de) * | 1966-08-26 | 1967-12-15 | Bucher Guyer Ag Masch | Heuerntemaschine |
| NL6707618A (enExample) * | 1967-06-01 | 1968-12-02 | ||
| DE1929104C3 (de) * | 1968-08-13 | 1981-10-22 | Maschinenfabrik Fahr Ag Gottmadingen, 7702 Gottmadingen | Heuwerbungsmaschine |
| IE34222B1 (en) * | 1969-06-05 | 1975-03-05 | Zweegers P | Improvements in or relating to implements for working crop lying on the ground |
| DE1932785A1 (de) * | 1969-06-27 | 1971-01-07 | Fahr Ag Maschf | Vorrichtung zum Umstellen eines Kreiselzettwenders aus einer Transportstellung in eine Arbeitsstellung oder umgekehrt |
| FR2063497A5 (enExample) * | 1969-10-14 | 1971-07-09 | Kuhn Freres & Cie | |
| NL167834C (nl) * | 1971-11-05 | 1982-02-16 | Lely Nv C Van Der | Hooibouwmachine. |
| BE791020A (nl) * | 1971-11-09 | 1973-03-01 | Texas Industries Inc | Inrichting voor het verplaatsen van op de grond liggend gewas |
| NL169814C (nl) * | 1973-04-13 | 1985-07-16 | Lely Nv C Van Der | Inrichting voor het maaien respectievelijk harken of schudden van zich op de grond bevindend gewas. |
| NL7308694A (enExample) * | 1973-06-22 | 1974-12-24 | ||
| NL7309381A (nl) * | 1973-07-05 | 1975-01-07 | Lely Nv C Van Der | Roteerbaar harkorgaan. |
| US4023335A (en) * | 1973-10-12 | 1977-05-17 | Lely Cornelis V D | Rake machine |
| NL7400684A (nl) * | 1974-01-18 | 1975-07-22 | Lely Nv C Van Der | Hooibouwmachine. |
| DE2410150A1 (de) * | 1974-03-02 | 1975-09-11 | Weidtmann Rainer Dipl Ing Dipl | Heuwerbungsmaschine |
-
1976
- 1976-06-29 NL NL7607093A patent/NL7607093A/xx not_active Application Discontinuation
-
1977
- 1977-06-23 DK DK277677A patent/DK277677A/da not_active Application Discontinuation
- 1977-06-24 GB GB26695/77A patent/GB1578562A/en not_active Expired
- 1977-06-25 DE DE19772728732 patent/DE2728732A1/de not_active Withdrawn
- 1977-06-27 CH CH786877A patent/CH622669A5/de not_active IP Right Cessation
- 1977-06-27 US US05/810,614 patent/US4202160A/en not_active Expired - Lifetime
- 1977-06-28 BE BE178861A patent/BE856212A/xx unknown
- 1977-06-29 FR FR7719911A patent/FR2356353A1/fr active Pending
-
1978
- 1978-04-28 FR FR7812653A patent/FR2379244A1/fr active Pending
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004058461A1 (de) * | 2004-12-03 | 2006-06-14 | Maschinenfabrik Bernard Krone Gmbh | Heuwerbungsmaschine |
| EP3881670A1 (de) * | 2020-03-20 | 2021-09-22 | Kverneland Group Kerteminde A/S | Heuwerbungsmaschine |
| DE102024115522A1 (de) | 2024-06-04 | 2025-12-04 | Kverneland Group Gottmadingen N.V. | Frontanbau - Heuwerbungsmaschine |
| DE102024115522B4 (de) | 2024-06-04 | 2026-03-12 | Kverneland Group Gottmadingen N.V. | Frontanbau - Heuwerbungsmaschine |
Also Published As
| Publication number | Publication date |
|---|---|
| BE856212A (nl) | 1977-12-28 |
| NL7607093A (nl) | 1978-01-02 |
| DK277677A (da) | 1977-12-30 |
| US4202160A (en) | 1980-05-13 |
| GB1578562A (en) | 1980-11-05 |
| FR2379244A1 (fr) | 1978-09-01 |
| CH622669A5 (enExample) | 1981-04-30 |
| FR2356353A1 (fr) | 1978-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2728732A1 (de) | Landmaschine | |
| DE3050792C2 (enExample) | ||
| DE2448500C2 (de) | Kreiselheuwerbungsmaschine | |
| DE60210550T2 (de) | Heuwerbungsmaschine | |
| DE2652008A1 (de) | Heuwerbungsmaschine | |
| DE1782058A1 (de) | Geraet zur Bearbeitung am Boden liegenden Erntegutes | |
| DE2840632C2 (de) | Kreiselheuwerbungsmaschine | |
| DE4340384A1 (de) | Tragrahmen für eine antreibbare landwirtschaftliche Bearbeitungsmaschine | |
| DE3507413A1 (de) | Landmaschine, insbesondere kreiselheuwerbungsmaschine | |
| DE2715200A1 (de) | Kreiselheuwerbungsmaschine | |
| DE2449413A1 (de) | Heuwerbungsmaschine | |
| DE2160825A1 (de) | Heuwerbungsmaschine | |
| CH650638A5 (de) | Kreisel-heuwerbungsmaschine. | |
| DE1582461C3 (de) | Kreiselheuwerbungsmaschine | |
| DE4201881A1 (de) | Heuwerbungsmaschine | |
| DE2909729C2 (de) | Kreiselheuwerbungsmaschine | |
| EP0065672B1 (de) | Heuwerbungsmaschine | |
| EP0073900A2 (de) | Heuwerbungsmaschine | |
| DE2715361A1 (de) | Kreiselheuwerbungsmaschine | |
| DE2953786C2 (enExample) | ||
| DE2607072A1 (de) | Kreiselheuwerbungsmaschine | |
| AT204321B (de) | Vorrichtung zum seitlichen Zusammenrechen von auf der Erde liegendem Gras, Heu oder sonstigem Gut | |
| AT404535B (de) | Tragrahmen für eine antreibbare landwirtschaftliche bearbeitungsmaschine | |
| DE1407185C (de) | Vorrichtung zum seitlichen Versetzen auf dem Boden liegenden Erntegutes | |
| DE3123020A1 (de) | Heuwerbungsmaschine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |