DE2639558C2 - Verfahren zur Herstellung farbphotographischer Bilder - Google Patents
Verfahren zur Herstellung farbphotographischer BilderInfo
- Publication number
- DE2639558C2 DE2639558C2 DE2639558A DE2639558A DE2639558C2 DE 2639558 C2 DE2639558 C2 DE 2639558C2 DE 2639558 A DE2639558 A DE 2639558A DE 2639558 A DE2639558 A DE 2639558A DE 2639558 C2 DE2639558 C2 DE 2639558C2
- Authority
- DE
- Germany
- Prior art keywords
- cobalt
- image
- dye
- color
- iii
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 155
- 230000008569 process Effects 0.000 title claims description 79
- 229910052709 silver Inorganic materials 0.000 claims description 145
- 239000004332 silver Substances 0.000 claims description 145
- 239000000463 material Substances 0.000 claims description 138
- 238000006243 chemical reaction Methods 0.000 claims description 89
- -1 silver halide Chemical class 0.000 claims description 85
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 75
- 150000001875 compounds Chemical class 0.000 claims description 75
- 150000002978 peroxides Chemical class 0.000 claims description 72
- 238000003199 nucleic acid amplification method Methods 0.000 claims description 65
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 64
- 239000003795 chemical substances by application Substances 0.000 claims description 63
- 239000007800 oxidant agent Substances 0.000 claims description 63
- 229910017052 cobalt Inorganic materials 0.000 claims description 62
- 239000010941 cobalt Substances 0.000 claims description 62
- 230000003321 amplification Effects 0.000 claims description 60
- JAWGVVJVYSANRY-UHFFFAOYSA-N cobalt(3+) Chemical compound [Co+3] JAWGVVJVYSANRY-UHFFFAOYSA-N 0.000 claims description 60
- 239000003638 chemical reducing agent Substances 0.000 claims description 53
- 239000007795 chemical reaction product Substances 0.000 claims description 36
- 239000003446 ligand Substances 0.000 claims description 36
- 239000000839 emulsion Substances 0.000 claims description 32
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical group OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 21
- 238000004519 manufacturing process Methods 0.000 claims description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 14
- 238000006479 redox reaction Methods 0.000 claims description 9
- 230000009467 reduction Effects 0.000 claims description 6
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 claims description 2
- 238000005859 coupling reaction Methods 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000006722 reduction reaction Methods 0.000 claims 1
- 239000000975 dye Substances 0.000 description 166
- 239000000243 solution Substances 0.000 description 57
- 238000005728 strengthening Methods 0.000 description 55
- 230000002787 reinforcement Effects 0.000 description 46
- 238000011161 development Methods 0.000 description 45
- 230000018109 developmental process Effects 0.000 description 45
- 239000003054 catalyst Substances 0.000 description 40
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- 239000002904 solvent Substances 0.000 description 19
- 238000012360 testing method Methods 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 239000011734 sodium Substances 0.000 description 15
- 229920000159 gelatin Polymers 0.000 description 14
- 235000019322 gelatine Nutrition 0.000 description 14
- 108010010803 Gelatin Proteins 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 13
- 239000008273 gelatin Substances 0.000 description 13
- 235000011852 gelatine desserts Nutrition 0.000 description 13
- 238000007254 oxidation reaction Methods 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 9
- 230000003647 oxidation Effects 0.000 description 9
- 238000004061 bleaching Methods 0.000 description 8
- 238000009826 distribution Methods 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 8
- 125000004434 sulfur atom Chemical group 0.000 description 8
- 239000012190 activator Substances 0.000 description 7
- 229920000126 latex Polymers 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical group [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 7
- 238000012546 transfer Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000012670 alkaline solution Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000007844 bleaching agent Substances 0.000 description 5
- 239000002738 chelating agent Substances 0.000 description 5
- 150000003142 primary aromatic amines Chemical class 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 230000009286 beneficial effect Effects 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000000084 colloidal system Substances 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 229910000510 noble metal Inorganic materials 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- SUVZGLSQFGNBQI-UHFFFAOYSA-N 2,5-bis(sulfanyl)hexanedioic acid Chemical compound OC(=O)C(S)CCC(S)C(O)=O SUVZGLSQFGNBQI-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 235000003434 Sesamum indicum Nutrition 0.000 description 3
- 244000000231 Sesamum indicum Species 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000004700 cobalt complex Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000005562 fading Methods 0.000 description 3
- 239000002638 heterogeneous catalyst Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 238000001429 visible spectrum Methods 0.000 description 3
- 239000012224 working solution Substances 0.000 description 3
- KSUHQKZEXUIPRP-UHFFFAOYSA-N 2,6-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol Chemical compound CC(C)(C)CC(C)(C)C1=CC(O)=CC(C(C)(C)CC(C)(C)C)=C1O KSUHQKZEXUIPRP-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 230000001186 cumulative effect Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- HQHCYKULIHKCEB-UHFFFAOYSA-N tetradecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCC(O)=O HQHCYKULIHKCEB-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- NPOMAIJXMCXWGP-UHFFFAOYSA-N (cyanatodisulfanyl) cyanate Chemical compound N#COSSOC#N NPOMAIJXMCXWGP-UHFFFAOYSA-N 0.000 description 1
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
- WMVJWKURWRGJCI-UHFFFAOYSA-N 2,4-bis(2-methylbutan-2-yl)phenol Chemical compound CCC(C)(C)C1=CC=C(O)C(C(C)(C)CC)=C1 WMVJWKURWRGJCI-UHFFFAOYSA-N 0.000 description 1
- WYMDDFRYORANCC-UHFFFAOYSA-N 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)CN(CC(O)=O)CC(O)=O WYMDDFRYORANCC-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- MZZYGYNZAOVRTG-UHFFFAOYSA-N 2-hydroxy-n-(1h-1,2,4-triazol-5-yl)benzamide Chemical compound OC1=CC=CC=C1C(=O)NC1=NC=NN1 MZZYGYNZAOVRTG-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- MOMKYJPSVWEWPM-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=NC(CCl)=CS1 MOMKYJPSVWEWPM-UHFFFAOYSA-N 0.000 description 1
- HFYPXERYZGFDBD-UHFFFAOYSA-N 4-amino-2,6-dibromophenol Chemical compound NC1=CC(Br)=C(O)C(Br)=C1 HFYPXERYZGFDBD-UHFFFAOYSA-N 0.000 description 1
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 1
- XTBFKMDOQMQYPP-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine;hydron;chloride Chemical compound Cl.CCN(CC)C1=CC=C(N)C=C1 XTBFKMDOQMQYPP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 101100532679 Caenorhabditis elegans scc-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Natural products CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000152447 Hades Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CWNSVVHTTQBGQB-UHFFFAOYSA-N N,N-Diethyldodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CC)CC CWNSVVHTTQBGQB-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- VWYAICBFTAKVGG-UHFFFAOYSA-N O.OS(O)(=O)=O.Nc1ccccc1 Chemical compound O.OS(O)(=O)=O.Nc1ccccc1 VWYAICBFTAKVGG-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- ZGDKVKUWTCGYOA-URGPHPNLSA-N [4-[4-[(z)-c-(4-bromophenyl)-n-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)methanone Chemical compound C=1C=C(Br)C=CC=1C(=N/OCC)\C(CC1)CCN1C(CC1)(C)CCN1C(=O)C1=C(C)C=C[N+]([O-])=C1C ZGDKVKUWTCGYOA-URGPHPNLSA-N 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- YHFXJKYHUWPWSJ-UHFFFAOYSA-L [Na+].[Na+].OS([O-])=O.OS([O-])=O Chemical compound [Na+].[Na+].OS([O-])=O.OS([O-])=O YHFXJKYHUWPWSJ-UHFFFAOYSA-L 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 235000010633 broth Nutrition 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000005591 charge neutralization Effects 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000001046 green dye Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000007210 heterogeneous catalysis Methods 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- TVHALOSDPLTTSR-UHFFFAOYSA-H hexasodium;[oxido-[oxido(phosphonatooxy)phosphoryl]oxyphosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O TVHALOSDPLTTSR-UHFFFAOYSA-H 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 210000003041 ligament Anatomy 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- YOUKHKXMLCZXRK-UHFFFAOYSA-N n-[2-amino-5-(diethylamino)phenyl]acetamide Chemical compound CCN(CC)C1=CC=C(N)C(NC(C)=O)=C1 YOUKHKXMLCZXRK-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000011165 process development Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 230000003716 rejuvenation Effects 0.000 description 1
- 238000010405 reoxidation reaction Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- 235000019983 sodium metaphosphate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 239000000984 vat dye Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/3017—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials with intensification of the image by oxido-reduction
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60988075A | 1975-09-02 | 1975-09-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2639558A1 DE2639558A1 (de) | 1977-03-10 |
| DE2639558C2 true DE2639558C2 (de) | 1982-03-18 |
Family
ID=24442728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2639558A Expired DE2639558C2 (de) | 1975-09-02 | 1976-09-02 | Verfahren zur Herstellung farbphotographischer Bilder |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4097278A (Direct) |
| JP (1) | JPS5230430A (Direct) |
| BE (1) | BE845784A (Direct) |
| CA (1) | CA1064311A (Direct) |
| DE (1) | DE2639558C2 (Direct) |
| FR (1) | FR2323172A1 (Direct) |
| GB (1) | GB1560572A (Direct) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5837867B2 (ja) * | 1975-03-07 | 1983-08-19 | 新日本製鐵株式会社 | キンゾクカンナイメンプラスチツクヒフクセツビ |
| JPS5820672B2 (ja) * | 1975-03-10 | 1983-04-25 | 新日本製鐵株式会社 | キンゾクカンナイメンプラスチツクヒフクセツビ |
| JPS5838216B2 (ja) * | 1975-08-12 | 1983-08-22 | 新日本製鐵株式会社 | カンタイナイメンヒフクセツビニオケル カンタンブシ−ルホジソウチ |
| FR2408857A2 (fr) * | 1977-10-21 | 1979-06-08 | Eastman Kodak Co | Procede de formation d'image en couleurs qui met en oeuvre des reactions d'amplification par systeme redox |
| JPS57105738A (en) * | 1980-12-23 | 1982-07-01 | Konishiroku Photo Ind Co Ltd | Photographic sensitive element |
| JPS5818629A (ja) * | 1981-07-28 | 1983-02-03 | Fuji Photo Film Co Ltd | 画像形成方法 |
| GB8909578D0 (en) * | 1989-04-26 | 1989-06-14 | Kodak Ltd | Method of photographic processing |
| GB9008750D0 (en) * | 1990-04-18 | 1990-06-13 | Kodak Ltd | Method and apparatus for photographic processing solution replenishment |
| GB9016472D0 (en) * | 1990-07-26 | 1990-09-12 | Kodak Ltd | Photographic bleach compositions |
| GB9022781D0 (en) * | 1990-10-19 | 1990-12-05 | Kodak Ltd | Photographic processing apparatus |
| GB9022779D0 (en) * | 1990-10-19 | 1990-12-05 | Kodak Ltd | Photographic processing apparatus |
| GB9024783D0 (en) * | 1990-11-14 | 1991-01-02 | Kodak Ltd | Method of processing a photographic silver halide colour material |
| GB9114090D0 (en) * | 1991-06-29 | 1991-08-14 | Kodak Ltd | Photographic processing apparatus |
| GB9114933D0 (en) * | 1991-07-11 | 1991-08-28 | Kodak Ltd | Method for forming a photographic colour image |
| GB9118299D0 (en) * | 1991-08-24 | 1991-10-09 | Kodak Ltd | Method of photographic processing |
| US5702873A (en) * | 1991-12-03 | 1997-12-30 | Eastman Kodak Company | Redox amplification solutions containing metal ion sequestering agents |
| GB9126386D0 (en) * | 1991-12-12 | 1992-02-12 | Kodak Ltd | Method of making stable colour photographic prints |
| EP0620495A1 (en) * | 1993-04-13 | 1994-10-19 | Kodak Limited | Photographic processing apparatus |
| GB9317035D0 (en) * | 1993-08-16 | 1993-09-29 | Kodak Ltd | Photographic colour couplers and photographic materials containing them |
| GB9423381D0 (en) | 1994-11-19 | 1995-01-11 | Kodak Ltd | Photographic developer/amplifier compositions |
| GB9423382D0 (en) | 1994-11-19 | 1995-01-11 | Kodak Ltd | Photographic developer/amplifier compositions |
| GB9426275D0 (en) * | 1994-12-24 | 1995-02-22 | Kodak Ltd | Photographic silver halide material having improved spectral characteristics |
| EP0718686B1 (en) * | 1994-12-24 | 2002-02-20 | Eastman Kodak Company | Photographic silver halide material having improved granularity and dye hue |
| GB2302596B (en) * | 1995-06-22 | 1999-02-03 | Kodak Ltd | Method of photographic processing with solution replenishment |
| GB9516578D0 (en) | 1995-08-12 | 1995-10-11 | Kodak Ltd | Method of processing photographic silver halide materials |
| GB9525771D0 (en) | 1995-12-16 | 1996-02-14 | Kodak Ltd | Treatment method for treating effluents from a photographic development process |
| GB9600112D0 (en) | 1996-01-04 | 1996-03-06 | Kodak Ltd | Improvements in or relating to photographic processsing apparatus |
| KR100803186B1 (ko) * | 2000-12-15 | 2008-02-14 | 디 아리조나 보드 오브 리전츠 | 나노입자 함유 전구체를 사용한 금속의 패턴형성 방법 |
| EP1565747B1 (en) * | 2001-03-29 | 2013-11-27 | Cellect Technologies Corp. | Method and system for separating and sorting particles |
| JP6980406B2 (ja) * | 2017-04-25 | 2021-12-15 | 株式会社日立ハイテク | 半導体製造装置及び半導体装置の製造方法 |
| WO2020165990A1 (ja) | 2019-02-14 | 2020-08-20 | 株式会社日立ハイテクノロジーズ | 半導体製造装置 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE536212A (Direct) | 1954-03-11 | |||
| BE756833A (nl) | 1969-10-04 | 1971-03-30 | Agfa Gevaert Nv | Werkwijze voor het maken van fotografische beelden |
| BE759080A (nl) * | 1969-12-05 | 1971-05-18 | Agfa Gevaert Nv | Procede voor de vervaardiging van foto's |
| DE2056360A1 (de) * | 1970-11-17 | 1972-05-18 | Agfa-Gevaert Ag, 5090 Leverkusen | Verfahren zur Herstellung photographischer Bilder |
| US3862842A (en) * | 1971-06-07 | 1975-01-28 | Eastman Kodak Co | Image-forming processes and compositions |
| JPS561627B1 (Direct) * | 1971-06-07 | 1981-01-14 | ||
| US3834907A (en) * | 1971-06-07 | 1974-09-10 | Eastman Kodak Co | Photographic elements containing color-providing layer units for amplification processes |
| US3826652A (en) * | 1971-10-14 | 1974-07-30 | Eastman Kodak Co | Process for developing radiation-sensitive elements |
| US3773510A (en) * | 1971-06-26 | 1973-11-20 | Minnesota Mining & Mfg | Additives to bleach/fix baths |
| US3856524A (en) * | 1971-10-14 | 1974-12-24 | Eastman Kodak Co | Photographic elements and processes for providing tanned image records |
| BE790101A (fr) * | 1971-10-14 | 1973-04-13 | Eastman Kodak Co | Produit photographique aux halogenures d'argent et procede pourformer une image avec ce produit |
| US3748138A (en) * | 1971-10-14 | 1973-07-24 | Eastman Kodak Co | Metal complex in silver halide development |
| US3772020A (en) * | 1971-11-19 | 1973-11-13 | Eastman Kodak Co | Persulfate bleach-fix solution |
| US3764490A (en) * | 1972-04-20 | 1973-10-09 | W Chambers | Method of recovering metals |
| US3765891A (en) * | 1972-05-23 | 1973-10-16 | Eastman Kodak Co | Process for developing photographic elements |
| US3847619A (en) * | 1972-11-20 | 1974-11-12 | Eastman Kodak Co | Ion-paired cobaltic complexes and photographic elements containing same |
| US3846130A (en) * | 1973-05-21 | 1974-11-05 | Eastman Kodak Co | Process for developing photographic elements |
| US3841873A (en) * | 1973-05-21 | 1974-10-15 | Eastman Kodak Co | Cobalt (iii) complex amplifier baths in color photographic processes |
-
1976
- 1976-04-01 CA CA249,375A patent/CA1064311A/en not_active Expired
- 1976-08-27 FR FR7625984A patent/FR2323172A1/fr active Granted
- 1976-09-02 BE BE170298A patent/BE845784A/xx not_active IP Right Cessation
- 1976-09-02 GB GB36425/76A patent/GB1560572A/en not_active Expired
- 1976-09-02 JP JP51105383A patent/JPS5230430A/ja active Pending
- 1976-09-02 DE DE2639558A patent/DE2639558C2/de not_active Expired
- 1976-10-08 US US05/730,914 patent/US4097278A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5230430A (en) | 1977-03-08 |
| BE845784A (fr) | 1977-03-02 |
| DE2639558A1 (de) | 1977-03-10 |
| FR2323172B1 (Direct) | 1979-06-08 |
| CA1064311A (en) | 1979-10-16 |
| GB1560572A (en) | 1980-02-06 |
| FR2323172A1 (fr) | 1977-04-01 |
| US4097278A (en) | 1978-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2639558C2 (de) | Verfahren zur Herstellung farbphotographischer Bilder | |
| DE3302741C2 (Direct) | ||
| DE2635330C2 (de) | Verfahren zur Herstellung farbphotographischer Bilder | |
| DE2357694C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE69227301T2 (de) | Verfahren zur herstellung eines photographischen farbbildes | |
| DE2321400A1 (de) | Verfahren zur entwicklung von farbphotographischen materialien | |
| DE2317412B2 (de) | Wäßriges photographisches Bleichbad | |
| DE3516417C2 (de) | Verfahren zur Verarbeitung eines farbphotographischen Silberhalogenidmaterials | |
| DE2650601C2 (de) | Verfahren zur Herstellung eines Farbumkehrbildes | |
| DE2264986A1 (de) | Entwicklerloesung fuer die farbumkehrentwicklung von photographischen aufzeichnungsmaterialien, die mindestens eine halogensilberemulsionsschicht enthalten | |
| DE69604632T2 (de) | Verfahren zur Verarbeitung photographischer Silberhalogenidmaterialien | |
| DE2657438C2 (de) | Verfahren zur Erzeugung eines farbigen Bildes in einem silberhalogenidhaltigen, farbphotographischen Aufzeichnungsmaterial | |
| DE69227657T2 (de) | Photographisches Verarbeitungsverfahren | |
| DE2735262A1 (de) | Verfahren zur erzeugung eines photographischen bildes | |
| DE2738190A1 (de) | Verfahren zur erzeugung von photographischen bildern | |
| DE2524431B2 (de) | Silberfarbbleichverfahren | |
| DE69719476T2 (de) | Fotografische aufzeichnungsmaterialien und ihre verwendung in der redoxverstärkung | |
| DE2101344A1 (de) | Verfahren zur Herstellung von Färb kopiermaterial | |
| DE2709054C2 (de) | Verstärkerlösung für die Bildvertärkung eines farbphotographischen Aufzeichnungsmaterials | |
| DE2531067C3 (de) | Farbphotographisches Entwicklungsverfahren | |
| DE2734655A1 (de) | Farbphotographisches umkehrverfahren | |
| DE2945368A1 (de) | Verfahren zur erzeugung von farbbildern | |
| DE2745955A1 (de) | Verfahren zur erzeugung von farbbildern | |
| DE69502913T2 (de) | Photographische Entwickler/Verstärker-Zusammensetzungen | |
| DE1145487B (de) | Verfahren zur Herstellung eines der Vorlage gegenlaeufigen Farbbildes nach dem Silberfarbbleichverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |