DE2609104A1 - Verfahren zur herstellung von styrol-suspensionspolymerisaten - Google Patents
Verfahren zur herstellung von styrol-suspensionspolymerisatenInfo
- Publication number
- DE2609104A1 DE2609104A1 DE19762609104 DE2609104A DE2609104A1 DE 2609104 A1 DE2609104 A1 DE 2609104A1 DE 19762609104 DE19762609104 DE 19762609104 DE 2609104 A DE2609104 A DE 2609104A DE 2609104 A1 DE2609104 A1 DE 2609104A1
- Authority
- DE
- Germany
- Prior art keywords
- suspension
- polymers according
- styrene polymers
- styrene
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 title claims description 62
- 239000000725 suspension Substances 0.000 title claims description 37
- 238000000034 method Methods 0.000 title claims description 26
- 238000004519 manufacturing process Methods 0.000 title claims description 16
- 229920000642 polymer Polymers 0.000 claims description 45
- 239000000178 monomer Substances 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 20
- 239000006185 dispersion Substances 0.000 claims description 18
- 239000003381 stabilizer Substances 0.000 claims description 18
- 238000006116 polymerization reaction Methods 0.000 claims description 15
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 14
- 229920001519 homopolymer Polymers 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000001506 calcium phosphate Substances 0.000 claims description 10
- 235000011010 calcium phosphates Nutrition 0.000 claims description 10
- 150000002736 metal compounds Chemical class 0.000 claims description 10
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 229940126062 Compound A Drugs 0.000 claims description 7
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 claims description 7
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 7
- 229910019142 PO4 Inorganic materials 0.000 claims description 5
- -1 acrylic ester Chemical class 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 5
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 4
- 239000004604 Blowing Agent Substances 0.000 claims description 4
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 4
- 229920001567 vinyl ester resin Polymers 0.000 claims description 4
- 239000004793 Polystyrene Substances 0.000 claims description 3
- 239000008346 aqueous phase Substances 0.000 claims description 3
- 239000010452 phosphate Substances 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 239000004908 Emulsion polymer Substances 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 239000011324 bead Substances 0.000 description 10
- 238000010557 suspension polymerization reaction Methods 0.000 description 10
- 239000002270 dispersing agent Substances 0.000 description 8
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 6
- 239000004815 dispersion polymer Substances 0.000 description 6
- 239000003999 initiator Substances 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- 150000002484 inorganic compounds Chemical class 0.000 description 4
- 229910010272 inorganic material Inorganic materials 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000019400 benzoyl peroxide Nutrition 0.000 description 3
- 238000007720 emulsion polymerization reaction Methods 0.000 description 3
- 150000002763 monocarboxylic acids Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000011049 pearl Substances 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 239000002351 wastewater Substances 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229920006248 expandable polystyrene Polymers 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000005029 sieve analysis Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 235000020681 well water Nutrition 0.000 description 2
- 239000002349 well water Substances 0.000 description 2
- NQQRXZOPZBKCNF-NSCUHMNNSA-N (e)-but-2-enamide Chemical compound C\C=C\C(N)=O NQQRXZOPZBKCNF-NSCUHMNNSA-N 0.000 description 1
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 1
- HLOUDBQOEJSUPI-UHFFFAOYSA-N 1-ethenyl-2,3-dimethylbenzene Chemical class CC1=CC=CC(C=C)=C1C HLOUDBQOEJSUPI-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- FEUFEGJTJIHPOF-UHFFFAOYSA-N 2-butyl acrylic acid Chemical compound CCCCC(=C)C(O)=O FEUFEGJTJIHPOF-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical class ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- JGBOVFKUKBGAJQ-UHFFFAOYSA-N 2-methylidenebutanediamide Chemical compound NC(=O)CC(=C)C(N)=O JGBOVFKUKBGAJQ-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 241000033695 Sige Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- PQYJRMFWJJONBO-UHFFFAOYSA-N Tris(2,3-dibromopropyl) phosphate Chemical compound BrCC(Br)COP(=O)(OCC(Br)CBr)OCC(Br)CBr PQYJRMFWJJONBO-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- AFYPFACVUDMOHA-UHFFFAOYSA-N chlorotrifluoromethane Chemical compound FC(F)(F)Cl AFYPFACVUDMOHA-UHFFFAOYSA-N 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- NGPZJQXXJCDBDS-UHFFFAOYSA-N dodecane-1-sulfonic acid;sodium Chemical compound [Na].CCCCCCCCCCCCS(O)(=O)=O NGPZJQXXJCDBDS-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical class CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 1
- AFSIMBWBBOJPJG-UHFFFAOYSA-N ethenyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC=C AFSIMBWBBOJPJG-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012766 organic filler Substances 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical class C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940067741 sodium octyl sulfate Drugs 0.000 description 1
- WFRKJMRGXGWHBM-UHFFFAOYSA-M sodium;octyl sulfate Chemical compound [Na+].CCCCCCCCOS([O-])(=O)=O WFRKJMRGXGWHBM-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- OPQYOFWUFGEMRZ-UHFFFAOYSA-N tert-butyl 2,2-dimethylpropaneperoxoate Chemical compound CC(C)(C)OOC(=O)C(C)(C)C OPQYOFWUFGEMRZ-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BWSZXUOMATYHHI-UHFFFAOYSA-N tert-butyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(C)(C)C BWSZXUOMATYHHI-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F12/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring
- C08F12/02—Monomers containing only one unsaturated aliphatic radical
- C08F12/04—Monomers containing only one unsaturated aliphatic radical containing one ring
- C08F12/06—Hydrocarbons
- C08F12/08—Styrene
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S526/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S526/91—Suspending agents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762609104 DE2609104A1 (de) | 1976-03-05 | 1976-03-05 | Verfahren zur herstellung von styrol-suspensionspolymerisaten |
| AU21652/77A AU2165277A (en) | 1976-03-05 | 1977-01-26 | Styrene suspension polymers |
| FR7704902A FR2342997A1 (fr) | 1976-03-05 | 1977-02-21 | Procede de preparation de polymeres du styrene par polymerisation en suspension |
| IT48258/77A IT1083701B (it) | 1976-03-05 | 1977-03-01 | Procedimento per la produzione di polimeri dello stirolo in sospensione |
| NL7702380A NL7702380A (nl) | 1976-03-05 | 1977-03-04 | Werkwijze ter bereiding van styreen-suspensie- polymeren. |
| GB9158/77A GB1569631A (en) | 1976-03-05 | 1977-03-04 | Manufacture of styrene suspension polymers |
| JP2333377A JPS52108476A (en) | 1976-03-05 | 1977-03-05 | Preparation of styrol suspension polymer |
| US05/963,327 US4241191A (en) | 1976-03-05 | 1978-11-24 | Manufacture of styrene suspension polymers |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762609104 DE2609104A1 (de) | 1976-03-05 | 1976-03-05 | Verfahren zur herstellung von styrol-suspensionspolymerisaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2609104A1 true DE2609104A1 (de) | 1977-09-15 |
Family
ID=5971594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762609104 Withdrawn DE2609104A1 (de) | 1976-03-05 | 1976-03-05 | Verfahren zur herstellung von styrol-suspensionspolymerisaten |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4241191A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS52108476A (cg-RX-API-DMAC7.html) |
| AU (1) | AU2165277A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2609104A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2342997A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1569631A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1083701B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7702380A (cg-RX-API-DMAC7.html) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993000374A1 (fr) * | 1991-06-25 | 1993-01-07 | Okhtinskoe Nauchno-Proizvodstvennoe Obiedinenie 'plastpolimer' | Procede d'obtention de matiere plastique polystyrenique |
| WO2007006765A1 (de) * | 2005-07-14 | 2007-01-18 | Basf Aktiengesellschaft | Wässrige monomeremulsionen enthaltend hydrophobin |
| US7799741B2 (en) | 2005-04-01 | 2010-09-21 | Basf Se | Drilling mud containing hydrophobin |
| US7892788B2 (en) | 2005-02-07 | 2011-02-22 | Basf Se | Hydrophobin fusion products, production and use thereof |
| US7910699B2 (en) | 2005-06-10 | 2011-03-22 | Basf Se | Cysteine-depleted hydrophobin fusion proteins, their production and use thereof |
| US8038740B2 (en) | 2005-10-12 | 2011-10-18 | Basf Se | Use of proteins as an antifoaming constituent in fuels |
| US8096484B2 (en) | 2006-08-15 | 2012-01-17 | Basf Se | Method for the production of dry free-flowing hydrophobin preparations |
| US8535535B2 (en) | 2005-04-01 | 2013-09-17 | Basf Se | Use of hydrophobin as a phase stabilizer |
| US8859106B2 (en) | 2005-03-31 | 2014-10-14 | Basf Se | Use of polypeptides in the form of adhesive agents |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4367320A (en) * | 1980-12-31 | 1983-01-04 | Mobil Oil Corporation | Process for suspension polymerization of styrenic monomers |
| DE3125446A1 (de) * | 1981-06-27 | 1983-01-20 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von styrol-suspensionspolymerisaten |
| US4361656A (en) * | 1981-08-03 | 1982-11-30 | American Hoechst Corporation | Method of making expandable styrene-type polymer beads |
| DE3728044A1 (de) * | 1987-08-22 | 1989-03-02 | Huels Chemische Werke Ag | Verfahren zur herstellung von styrolpolymerisaten mit enger korngroessenverteilung |
| US5051452A (en) * | 1990-02-13 | 1991-09-24 | The Dow Chemical Company | Process for preparing foamed vinylaromatic polymer products |
| US5045611A (en) * | 1990-06-25 | 1991-09-03 | Xerox Corporation | Processes for the preparation of polymers |
| US5155189A (en) * | 1990-10-26 | 1992-10-13 | The B. F. Goodrich Company | Vinyl halide aqueous polymerization dispersant system |
| US5109033A (en) * | 1991-05-16 | 1992-04-28 | Arco Chemical Technology, L.P. | Vinyl aromatic monomer/vinyl phosphonate copolymer compositions and foamed articles derived therefrom |
| US5116882A (en) * | 1991-05-16 | 1992-05-26 | Arco Chemical Technology, L.P. | Process for making copolymers of vinyl aromatic monomers and vinyl phosphonic acid derivatives and foamed articles therefrom |
| US6084044A (en) * | 1994-12-14 | 2000-07-04 | The Dow Chemical Company | Catalyzed process for producing high molecular weight monovinylidene aromatic polymers |
| WO1996018663A1 (en) * | 1994-12-14 | 1996-06-20 | The Dow Chemical Company | High molecular weight polystyrene production by vinylacid catalyzed free radical polymerization |
| DE19816469C1 (de) * | 1998-04-14 | 1999-12-09 | Buna Sow Leuna Olefinverb Gmbh | Verfahren und Vorrichtung zur Herstellung von expandierbaren Styrolpolymerisaten |
| DE19816461C1 (de) * | 1998-04-14 | 1999-12-09 | Buna Sow Leuna Olefinverb Gmbh | Verfahren und Vorrichtung zur Herstellung von expandierbaren Styrolpolymerisaten |
| DE19816464C1 (de) * | 1998-04-14 | 1999-12-09 | Buna Sow Leuna Olefinverb Gmbh | Verfahren und Vorrichtung zur Herstellung von expandierbaren Styrolpolymerisaten |
| US9506001B2 (en) | 2004-04-05 | 2016-11-29 | Kanagawa University | Emulsification dispersants, a method for emulsification and dispersion using the emulsification dispersants, emulsions, and emulsion fuels |
| EP1848734A2 (de) * | 2005-02-07 | 2007-10-31 | Basf Aktiengesellschaft | Verfahren zum beschichten von oberflächen mit hydrophobinen |
| BRPI0609545A2 (pt) * | 2005-03-30 | 2011-10-18 | Basf Ag | uso de hidrofobinas, processo para tratar superfìcies, e, superfìcie revestida com pelo menos uma hidrofobina |
| WO2006103215A1 (de) * | 2005-03-30 | 2006-10-05 | Basf Aktiengesellschaft | Verwendung von hydrophobinen zur schmutzabweisenden behandlung von harten oberflächen |
| DE102005027039A1 (de) * | 2005-06-10 | 2006-12-21 | Basf Ag | Hydrophobin als Beschichtungsmittel für expandierbare oder expandierte, thermoplastische Polymerpartikel |
| DE102005029704A1 (de) * | 2005-06-24 | 2007-01-11 | Basf Ag | Verwendung von Hydrophobin-Polypeptiden sowie Konjugaten aus Hydrophobin-Polypeptiden mit Wirk-oder Effektstoffen und ihre Herstellung sowie deren Einsatz in der Kosmetik |
| KR100674427B1 (ko) | 2005-12-08 | 2007-01-25 | 엘지엠엠에이 주식회사 | 광 산란 기능을 갖는 메틸메타크릴레이트 현탁 중합체 및그의 제조방법 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1151117B (de) * | 1954-08-19 | 1963-07-04 | Basf Ag | Verfahren zur Herstellung von expandierbaren Perlpolymerisaten in waessriger Suspension |
| DE1007061B (de) * | 1955-08-20 | 1957-04-25 | Basf Ag | Verfahren zur Herstellung von Vinylpolymerisaten in waessriger Suspension |
| NL215205A (cg-RX-API-DMAC7.html) * | 1956-03-10 | |||
| US3047534A (en) * | 1959-10-07 | 1962-07-31 | Cosden Petroleum Corp | Graft polymerization on a rubbery polymer in aqueous suspension employing polyvinyl alcohol and a metal phosphate as suspending agents, and product obtained thereby |
| GB948747A (en) * | 1960-08-03 | 1964-02-05 | Cosden Petroleum Corp | Improvements in or relating to the production of polymer beads |
| US3243419A (en) * | 1961-10-30 | 1966-03-29 | Koppers Co Inc | In situ generation of suspending agent in the suspension polymerization of styrene |
| DE1570238B2 (de) * | 1965-01-16 | 1975-03-20 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung feinteiliger expandierbarer Styrolpolymerisate |
| GB1095410A (cg-RX-API-DMAC7.html) * | 1966-01-11 | 1900-01-01 | ||
| US3462380A (en) * | 1966-03-24 | 1969-08-19 | Dow Chemical Co | Suspension polymerization process for vinyl aryl monomers |
| US3696172A (en) * | 1970-10-19 | 1972-10-03 | Nihon Polystyrene Kogyo Kk | Process for preparing styrene polymers having a high impact strength |
| DE2056217A1 (de) * | 1970-11-16 | 1972-05-25 | Hoechst Ag | Verfahren zur Herstellung von verschäumbaren Styrolpolymerisaten |
| US3786115A (en) * | 1970-12-23 | 1974-01-15 | Nihon Polystyrene Kogyo K K | Suspension polymerization process |
| FR2207146B1 (cg-RX-API-DMAC7.html) * | 1972-11-21 | 1976-04-23 | Labofina Sa | |
| US3919355A (en) * | 1974-08-15 | 1975-11-11 | Galina Dmitrievna Ballova | Method for preparing shock-resistant grafted copolymers of styrene or vinyltoluene with synthetic rubber |
| AU503543B2 (en) * | 1975-02-27 | 1979-09-06 | Goodyear Tire And Rubber Company, The | Thermoplastic polymer |
| DE2548524A1 (de) * | 1975-10-30 | 1977-05-05 | Basf Ag | Verfahren zur herstellung expandierbarer styrolpolymerisate |
| US4141932A (en) * | 1977-10-03 | 1979-02-27 | Borg-Warner Corporation | Combined emulsion and suspension process for producing graft ABS bead-like particles |
-
1976
- 1976-03-05 DE DE19762609104 patent/DE2609104A1/de not_active Withdrawn
-
1977
- 1977-01-26 AU AU21652/77A patent/AU2165277A/en not_active Expired
- 1977-02-21 FR FR7704902A patent/FR2342997A1/fr active Granted
- 1977-03-01 IT IT48258/77A patent/IT1083701B/it active
- 1977-03-04 GB GB9158/77A patent/GB1569631A/en not_active Expired
- 1977-03-04 NL NL7702380A patent/NL7702380A/xx not_active Application Discontinuation
- 1977-03-05 JP JP2333377A patent/JPS52108476A/ja active Pending
-
1978
- 1978-11-24 US US05/963,327 patent/US4241191A/en not_active Expired - Lifetime
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993000374A1 (fr) * | 1991-06-25 | 1993-01-07 | Okhtinskoe Nauchno-Proizvodstvennoe Obiedinenie 'plastpolimer' | Procede d'obtention de matiere plastique polystyrenique |
| US7892788B2 (en) | 2005-02-07 | 2011-02-22 | Basf Se | Hydrophobin fusion products, production and use thereof |
| US8859106B2 (en) | 2005-03-31 | 2014-10-14 | Basf Se | Use of polypeptides in the form of adhesive agents |
| US7799741B2 (en) | 2005-04-01 | 2010-09-21 | Basf Se | Drilling mud containing hydrophobin |
| US8535535B2 (en) | 2005-04-01 | 2013-09-17 | Basf Se | Use of hydrophobin as a phase stabilizer |
| US7910699B2 (en) | 2005-06-10 | 2011-03-22 | Basf Se | Cysteine-depleted hydrophobin fusion proteins, their production and use thereof |
| WO2007006765A1 (de) * | 2005-07-14 | 2007-01-18 | Basf Aktiengesellschaft | Wässrige monomeremulsionen enthaltend hydrophobin |
| US8038740B2 (en) | 2005-10-12 | 2011-10-18 | Basf Se | Use of proteins as an antifoaming constituent in fuels |
| US8096484B2 (en) | 2006-08-15 | 2012-01-17 | Basf Se | Method for the production of dry free-flowing hydrophobin preparations |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1569631A (en) | 1980-06-18 |
| FR2342997B1 (cg-RX-API-DMAC7.html) | 1983-09-23 |
| NL7702380A (nl) | 1977-09-07 |
| FR2342997A1 (fr) | 1977-09-30 |
| JPS52108476A (en) | 1977-09-10 |
| AU2165277A (en) | 1978-08-03 |
| IT1083701B (it) | 1985-05-25 |
| US4241191A (en) | 1980-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2609104A1 (de) | Verfahren zur herstellung von styrol-suspensionspolymerisaten | |
| DE69116804T2 (de) | Expandierbare thermoplastische Mikrokugeln und ein Verfahren zu Herstellung und ihre Verwendung | |
| DE2638839A1 (de) | Verfahren zur herstellung von styrol-suspensionspolymerisaten | |
| DE69703742T2 (de) | Verfahren zur herstellung polymerer teilchen | |
| US3663655A (en) | Polymerisation process | |
| DE2800520A1 (de) | Verfahren zur herstellung eines wasserloeslichen perlenpolymeren | |
| DE2511680A1 (de) | Verfahren zur herstellung von verschaeumbaren aethylenisch ungesaettigten polymerisatteilchen | |
| EP0048320A1 (de) | Emulgiermittelfreie wässrige Kunststoffdispersion | |
| DE2150090B2 (de) | Verfahren zum Koagulieren eines Dienkautschuklatex | |
| EP0778288B1 (de) | Verfahren zur Herstellung einer wässrigen Polymerisatdispersion | |
| CH631464A5 (de) | Emulsionspolymerisationsverfahren zur herstellung von vinylchlorid-homo- oder copolymeren unter verwendung eines vorhomogenisierten gemischten emulgatorsystems. | |
| DE2830470A1 (de) | Verfahren zur herstellung von emulgatorfreien kautschuklatices | |
| DE1720058A1 (de) | Verfahren zum Agglomerieren von waessrigen Synthesekautschuk-Dispersionen | |
| DE3331569A1 (de) | Verfahren zum steuern der groesse der perlen bei der herstellung von expandierbaren styrolpolymerisaten durch suspensionspolymerisation | |
| EP0304582B1 (de) | Verfahren zur Herstellung von Styrolpolymerisaten mit enger Korngrössenverteilung | |
| DE2548524A1 (de) | Verfahren zur herstellung expandierbarer styrolpolymerisate | |
| EP0137916A2 (de) | Verfahren zum Steuern der Grösse der Perlen bei der Herstellung von expandierbaren Styrolpolymerisaten durch Suspensionspolymerisation | |
| EP0073296A1 (de) | Verfahren zur Herstellung von Acrylkunststoffdispersionen | |
| DE3448010A1 (de) | Teilchenfoermiges polymer und verfahren zu dessen herstellung | |
| DE2640999A1 (de) | Verfahren zur herstellung von styrol-suspensionspolymerisaten | |
| DE2021398A1 (de) | Verfahren zur Koagulation von Pfropfpolymer-Latices | |
| DE69411125T2 (de) | Verfahren zur Herstellung von Polymer-Partikeln | |
| EP0068298B1 (de) | Verfahren zur Herstellung von Styrol-Suspensionspolymerisaten | |
| DE2225788A1 (de) | Polymerlatices und -suspensionen auf Basis von Vinylchloridhomopolymeren und -copolymeren | |
| DE69318322T2 (de) | Polymerisationsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |