DE2502434A1 - Neue verbindungen der pyrazolinreihe - Google Patents
Neue verbindungen der pyrazolinreiheInfo
- Publication number
- DE2502434A1 DE2502434A1 DE19752502434 DE2502434A DE2502434A1 DE 2502434 A1 DE2502434 A1 DE 2502434A1 DE 19752502434 DE19752502434 DE 19752502434 DE 2502434 A DE2502434 A DE 2502434A DE 2502434 A1 DE2502434 A1 DE 2502434A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydrogen
- formula
- free acid
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 title description 17
- 150000001875 compounds Chemical class 0.000 claims description 52
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 35
- 239000002253 acid Substances 0.000 claims description 30
- 150000003839 salts Chemical class 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 150000002431 hydrogen Chemical class 0.000 claims description 20
- -1 -SOH Chemical group 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 13
- 230000003287 optical effect Effects 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 238000005282 brightening Methods 0.000 claims description 6
- 239000000835 fiber Substances 0.000 claims description 6
- 229920002292 Nylon 6 Polymers 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 4
- 229920002647 polyamide Polymers 0.000 claims description 4
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- 239000000758 substrate Substances 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- BQIKRTGTPBOIMK-UHFFFAOYSA-N [O]C[O] Chemical compound [O]C[O] BQIKRTGTPBOIMK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 239000004305 biphenyl Substances 0.000 claims description 2
- 235000010290 biphenyl Nutrition 0.000 claims description 2
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 2
- 239000002657 fibrous material Substances 0.000 claims description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 2
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 claims description 2
- 229940067157 phenylhydrazine Drugs 0.000 claims description 2
- 230000017105 transposition Effects 0.000 claims description 2
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 claims description 2
- 239000013543 active substance Substances 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 150000002780 morpholines Chemical class 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 239000007787 solid Substances 0.000 description 18
- 239000011734 sodium Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229920002302 Nylon 6,6 Polymers 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 125000002755 pyrazolinyl group Chemical group 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 239000004677 Nylon Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229920001778 nylon Polymers 0.000 description 3
- 150000003219 pyrazolines Chemical class 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- BWYYYTVSBPRQCN-UHFFFAOYSA-M sodium;ethenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=C BWYYYTVSBPRQCN-UHFFFAOYSA-M 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- IUSCIWAUZVKPPY-SSZFMOIBSA-N (z)-n-phenylbenzenecarbohydrazonoyl chloride Chemical compound C=1C=CC=CC=1C(/Cl)=N/NC1=CC=CC=C1 IUSCIWAUZVKPPY-SSZFMOIBSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HFBSYGDBSGZDKT-UHFFFAOYSA-N 4-(hydrazinylmethyl)benzoic acid Chemical compound NNCC1=CC=C(C(O)=O)C=C1 HFBSYGDBSGZDKT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- PLBVJJMEICHJAG-UHFFFAOYSA-N ClO.N1CCOCC1 Chemical compound ClO.N1CCOCC1 PLBVJJMEICHJAG-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000502522 Luscinia megarhynchos Species 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OIXJZPDLIPCTOG-UHFFFAOYSA-N [4-[(4-hydrazinylphenyl)methylsulfonylmethyl]phenyl]hydrazine Chemical compound C1=CC(NN)=CC=C1CS(=O)(=O)CC1=CC=C(NN)C=C1 OIXJZPDLIPCTOG-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- AOSJNFGVUJMQKB-UHFFFAOYSA-N hydrazine hypochlorous acid Chemical compound NN.ClO AOSJNFGVUJMQKB-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- VQIDGTFLGAAJGI-UHFFFAOYSA-M sodium;prop-1-ene-1-sulfonate Chemical compound [Na+].CC=CS([O-])(=O)=O VQIDGTFLGAAJGI-UHFFFAOYSA-M 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB408774A GB1493383A (en) | 1974-01-29 | 1974-01-29 | Diphenyl pyrazoline derivatives |
| GB1966374 | 1974-05-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2502434A1 true DE2502434A1 (de) | 1975-07-31 |
Family
ID=26238858
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752502434 Pending DE2502434A1 (de) | 1974-01-29 | 1975-01-22 | Neue verbindungen der pyrazolinreihe |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4036851A (enrdf_load_stackoverflow) |
| JP (1) | JPS50145425A (enrdf_load_stackoverflow) |
| DE (1) | DE2502434A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2259097B1 (enrdf_load_stackoverflow) |
| IT (1) | IT1026500B (enrdf_load_stackoverflow) |
| NL (1) | NL7500841A (enrdf_load_stackoverflow) |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL290832A (enrdf_load_stackoverflow) * | 1962-03-31 | |||
| CH471791A (de) * | 1966-11-21 | 1969-04-30 | Geigy Ag J R | Verfahren zur Herstellung von halogenierten Di- und Triarylpyrazolinsulfonsäuren |
| DE1900349A1 (de) * | 1969-01-04 | 1970-08-06 | Basf Ag | Neue Pyrazolinderivate |
| DE1904424C3 (de) * | 1969-01-30 | 1974-03-07 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verfahren zum optischen Aufhellen von Fasermaterialien aus Polyacrylnitril |
| ES388953A1 (es) | 1970-03-11 | 1975-03-16 | Farbwerke Hoechst A G V Meiste | Procedimiento para la preparacion de compuestos de pirazo- lina. |
| DE2050725C3 (de) * | 1970-10-15 | 1980-04-30 | Bayer Ag, 5090 Leverkusen | Aufhellungsmittel |
| BE788658R (fr) * | 1971-09-09 | 1973-03-12 | Hoechst Ag | Derives de 3-(3', 4'-dichloro-6'-alkylphenyl) -delta2-pyrazolines, leurpreparation et leur utilisation comme agents d'azurage |
-
1975
- 1975-01-22 DE DE19752502434 patent/DE2502434A1/de active Pending
- 1975-01-23 US US05/543,325 patent/US4036851A/en not_active Expired - Lifetime
- 1975-01-24 FR FR7502217A patent/FR2259097B1/fr not_active Expired
- 1975-01-24 NL NL7500841A patent/NL7500841A/xx unknown
- 1975-01-28 JP JP50011828A patent/JPS50145425A/ja active Pending
- 1975-01-28 IT IT47866/75A patent/IT1026500B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50145425A (enrdf_load_stackoverflow) | 1975-11-21 |
| FR2259097A1 (enrdf_load_stackoverflow) | 1975-08-22 |
| NL7500841A (nl) | 1975-07-31 |
| FR2259097B1 (enrdf_load_stackoverflow) | 1978-07-13 |
| US4036851A (en) | 1977-07-19 |
| IT1026500B (it) | 1978-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE944577C (de) | Verfahren zur Herstellung kupfer- oder nickelhaltiger Disazofarbstoffe | |
| DE939505C (de) | Verfahren zur Herstellung von neuen wasserloeslichen Derivaten von Imidazolen | |
| DE2145019A1 (de) | 3-eckige klammer auf 3',4'-dichlor6'alkyl-phenyl eckige klammer zu - delta 2-pyrazolin-derivate, verfahren zu ihrer herstellung und ihre verwendung als optische aufheller | |
| DE1470242C3 (de) | 7-Arenotriazolyl-3-phenyl-cumarine, deren Herstellung und Verwendung | |
| DE2451219B2 (de) | Verfahren zur herstellung konzentrierter loesungen von farbstoffen und farbstoffzwischenprodukten und verwendung der loesungen | |
| DE2502434A1 (de) | Neue verbindungen der pyrazolinreihe | |
| DE2852037C2 (enrdf_load_stackoverflow) | ||
| DE1794054B2 (de) | Photographisches Aufzeichnungsmaterial fur das Silberfarbbleichverfahren | |
| DE942395C (de) | Verfahren zur Herstellung von 2-Stilbyl-mononaphtho-1, 2, 3-triazolverbindungen | |
| DE1156311B (de) | Photographische Materialien fuer das Silberfarbbleichverfahren | |
| DE1225319B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2503654C2 (de) | Neuer sulfonierter Triazofarbstoff | |
| AT167616B (de) | Verfahren zur Herstellung von neuen Azofarbstoffen | |
| DE1019025B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE926506C (de) | Verfahren zur Herstellung metallhaltiger Azofarbstoffe der Stilbenreihe | |
| EP0198206A1 (de) | Azofarbstoffe | |
| DE899042C (de) | Verfahren zur Herstellung von neuen 4, 4'-Diaminostilbendisulfon- oder -dicarbonsaeuren | |
| DE2403308A1 (de) | Neue verbindungen der pyrazolinreihe | |
| DE1047163B (de) | Optische Aufhellungsmittel | |
| DE2434162A1 (de) | Pyrazolinverbindungen | |
| DE955686C (de) | Verfahren zur Herstellung von fluoreszierenden Benztriazolverbindungen | |
| AT235234B (de) | Optische Aufhellungsmittel | |
| DE2129855A1 (de) | Neue Styrole und ihre Verwendung als optische Aufheller | |
| AT162618B (de) | Verfahren zur Herstellung neuer Tetrakisazofarbstoffe | |
| DE1644186C3 (de) | Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken cellulosehaltiger Materialien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |