DE2363322C2 - Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterials - Google Patents
Verfahren zur Herstellung eines elektrophotographischen AufzeichnungsmaterialsInfo
- Publication number
- DE2363322C2 DE2363322C2 DE2363322A DE2363322A DE2363322C2 DE 2363322 C2 DE2363322 C2 DE 2363322C2 DE 2363322 A DE2363322 A DE 2363322A DE 2363322 A DE2363322 A DE 2363322A DE 2363322 C2 DE2363322 C2 DE 2363322C2
- Authority
- DE
- Germany
- Prior art keywords
- benzene
- solvent
- blue
- tetrahydrofuran
- pigment
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 23
- 238000000034 method Methods 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 68
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 61
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 36
- 239000000049 pigment Substances 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 25
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 25
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 18
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 11
- 239000002245 particle Substances 0.000 claims description 10
- 239000011248 coating agent Substances 0.000 claims description 9
- 238000000576 coating method Methods 0.000 claims description 9
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 8
- 239000006185 dispersion Substances 0.000 claims description 8
- FKNIDKXOANSRCS-UHFFFAOYSA-N 2,3,4-trinitrofluoren-1-one Chemical compound C1=CC=C2C3=C([N+](=O)[O-])C([N+]([O-])=O)=C([N+]([O-])=O)C(=O)C3=CC2=C1 FKNIDKXOANSRCS-UHFFFAOYSA-N 0.000 claims description 6
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 claims description 6
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 claims description 4
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 20
- 230000035945 sensitivity Effects 0.000 description 14
- 239000013557 residual solvent Substances 0.000 description 10
- 206010034972 Photosensitivity reaction Diseases 0.000 description 9
- 230000036211 photosensitivity Effects 0.000 description 9
- 239000001055 blue pigment Substances 0.000 description 8
- 239000000853 adhesive Substances 0.000 description 6
- 230000001070 adhesive effect Effects 0.000 description 6
- 239000003973 paint Substances 0.000 description 6
- 229910000831 Steel Inorganic materials 0.000 description 5
- 239000010959 steel Substances 0.000 description 5
- 238000000227 grinding Methods 0.000 description 3
- 239000012046 mixed solvent Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 206010034960 Photophobia Diseases 0.000 description 1
- -1 Polyethylene terephthalate Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/09—Sensitisors or activators, e.g. dyestuffs
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/001—Electric or magnetic imagery, e.g., xerography, electrography, magnetography, etc. Process, composition, or product
- Y10S430/10—Donor-acceptor complex photoconductor
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31789372A | 1972-12-26 | 1972-12-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2363322A1 DE2363322A1 (de) | 1974-06-27 |
| DE2363322C2 true DE2363322C2 (de) | 1981-10-15 |
Family
ID=23235715
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2363322A Expired DE2363322C2 (de) | 1972-12-26 | 1973-12-19 | Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterials |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3775105A (show.php) |
| JP (1) | JPS5122381B2 (show.php) |
| AR (1) | AR198329A1 (show.php) |
| BR (1) | BR7308123D0 (show.php) |
| CA (1) | CA997196A (show.php) |
| CH (1) | CH588722A5 (show.php) |
| DE (1) | DE2363322C2 (show.php) |
| ES (1) | ES421509A1 (show.php) |
| FR (1) | FR2211680B1 (show.php) |
| GB (1) | GB1412318A (show.php) |
| IT (1) | IT995928B (show.php) |
| NL (1) | NL7315422A (show.php) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3898084A (en) * | 1971-03-30 | 1975-08-05 | Ibm | Electrophotographic processes using disazo pigments |
| US4018606A (en) * | 1974-05-03 | 1977-04-19 | Eastman Kodak Company | Organic azo pigment sensitizers for photoconductive layers |
| US4018607A (en) * | 1974-05-03 | 1977-04-19 | Eastman Kodak Company | Crystalline organic pigment sensitizers for photoconductive layers |
| US4293628A (en) * | 1977-01-27 | 1981-10-06 | Ricoh Co., Ltd. | Electrophotographic elements containing disazo compounds |
| US4279981A (en) * | 1977-04-22 | 1981-07-21 | Ricoh Company, Ltd. | Electrophotographic elements containing trisazo compounds |
| US4251614A (en) * | 1977-07-05 | 1981-02-17 | Ricoh Company, Ltd. | Novel disazo compounds, process for the preparation of same and application of said disazo compounds and analogues thereof to electrophotographic sensitive materials |
| US4314015A (en) * | 1977-07-18 | 1982-02-02 | Ricoh Co., Ltd. | Electrophotographic sensitive materials containing disazo compounds |
| US4299896A (en) * | 1977-07-18 | 1981-11-10 | Ricoh Co., Ltd. | Electrophotographic sensitive materials containing a disazo pigment |
| JPS6058467B2 (ja) * | 1977-10-22 | 1985-12-20 | 株式会社リコー | 電子写真用感光体 |
| JPS5546760A (en) * | 1978-09-29 | 1980-04-02 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS5569147A (en) * | 1978-11-20 | 1980-05-24 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS5573057A (en) * | 1978-11-27 | 1980-06-02 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS6029944B2 (ja) * | 1978-12-13 | 1985-07-13 | 株式会社リコー | 積層型電子写真感光体及びその製造方法 |
| JPS55151645A (en) * | 1979-05-15 | 1980-11-26 | Ricoh Co Ltd | Laminate type electrophotographic receptor |
| JPS561944A (en) * | 1979-06-20 | 1981-01-10 | Ricoh Co Ltd | Electrophotographic receptor |
| JPS562353A (en) * | 1979-06-20 | 1981-01-12 | Ricoh Co Ltd | Novel disazo compound and its preparation |
| JPS562352A (en) * | 1979-06-20 | 1981-01-12 | Ricoh Co Ltd | Novel disazo compound and its preparation |
| JPS5799648A (en) * | 1980-12-13 | 1982-06-21 | Copyer Co Ltd | Electrophotographic receptor |
| US4423129A (en) * | 1980-12-17 | 1983-12-27 | Canon Kabushiki Kaisha | Electrophotographic member having layer containing methylidenyl hydrazone compound |
| US4446217A (en) * | 1981-02-03 | 1984-05-01 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member having a hydrazone containing layer |
| DE3110953A1 (de) * | 1981-03-20 | 1982-09-30 | Basf Ag, 6700 Ludwigshafen | Elektrophotografisches aufzeichnungsmaterial |
| DE3110958A1 (de) * | 1981-03-20 | 1982-09-30 | Basf Ag, 6700 Ludwigshafen | Elektrophotographisches aufzeichnungsmaterial |
| US4418133A (en) * | 1981-03-27 | 1983-11-29 | Canon Kabushiki Kaisha | Disazo photoconductive material and electrophotographic photosensitive member having disazo pigment layer |
| JPS57195255A (en) * | 1981-05-26 | 1982-11-30 | Canon Inc | Electrophotographic receptor |
| US4427753A (en) | 1981-06-02 | 1984-01-24 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member with disazo or trisazo compound |
| US4456671A (en) * | 1981-12-23 | 1984-06-26 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member having a photosensitive layer containing a hydrazone compound |
| JPS58199353A (ja) * | 1982-05-17 | 1983-11-19 | Canon Inc | 電子写真感光体 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB964875A (en) * | 1959-02-26 | 1964-07-22 | Gevaert Photo Prod Nv | Improvements in or relating to electrophotography |
| BE585507A (show.php) * | 1960-03-31 | |||
| FR1296136A (fr) * | 1960-06-01 | 1962-06-15 | Agfa Ag | Sensibilisation de couches électrophotographiques |
| US3287121A (en) * | 1961-07-24 | 1966-11-22 | Azoplate Corp | Process for the sensitization of photoconductors |
| US3384632A (en) * | 1965-04-02 | 1968-05-21 | Xerox Corp | Arylazo-4-isopropoxy-1-naphthol compounds |
| US3484237A (en) * | 1966-06-13 | 1969-12-16 | Ibm | Organic photoconductive compositions and their use in electrophotographic processes |
| FR1547196A (fr) * | 1966-12-20 | 1968-11-22 | Agfa Gevaert Nv | Compositions photoconductrices spectralement sensibilisées |
| CH494419A (fr) * | 1967-04-25 | 1970-07-31 | Eastman Kodak Co | Couche électrophotographique |
| BE754283A (fr) * | 1969-08-01 | 1970-12-31 | Rca Corp | Materiaux electrophotographiques rendus spectralement sensibles |
| US3634079A (en) * | 1969-12-22 | 1972-01-11 | Ibm | Substrate layer for dichroic photoconductors |
-
1972
- 1972-12-26 US US00317893A patent/US3775105A/en not_active Expired - Lifetime
-
1973
- 1973-10-16 AR AR250553A patent/AR198329A1/es active
- 1973-10-17 IT IT30204/73A patent/IT995928B/it active
- 1973-10-17 BR BR8123/73A patent/BR7308123D0/pt unknown
- 1973-11-06 FR FR7340558A patent/FR2211680B1/fr not_active Expired
- 1973-11-12 NL NL7315422A patent/NL7315422A/xx not_active Application Discontinuation
- 1973-11-13 JP JP48126852A patent/JPS5122381B2/ja not_active Expired
- 1973-11-15 GB GB5295973A patent/GB1412318A/en not_active Expired
- 1973-11-20 CA CA186,248A patent/CA997196A/en not_active Expired
- 1973-12-12 CH CH1739473A patent/CH588722A5/xx not_active IP Right Cessation
- 1973-12-15 ES ES421509A patent/ES421509A1/es not_active Expired
- 1973-12-19 DE DE2363322A patent/DE2363322C2/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3775105A (en) | 1973-11-27 |
| JPS4991648A (show.php) | 1974-09-02 |
| AR198329A1 (es) | 1974-06-14 |
| BR7308123D0 (pt) | 1974-08-15 |
| DE2363322A1 (de) | 1974-06-27 |
| IT995928B (it) | 1975-11-20 |
| JPS5122381B2 (show.php) | 1976-07-09 |
| NL7315422A (show.php) | 1974-06-28 |
| FR2211680A1 (show.php) | 1974-07-19 |
| ES421509A1 (es) | 1976-05-01 |
| CA997196A (en) | 1976-09-21 |
| FR2211680B1 (show.php) | 1977-06-03 |
| CH588722A5 (show.php) | 1977-06-15 |
| GB1412318A (en) | 1975-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2363322C2 (de) | Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterials | |
| DE3138999C2 (show.php) | ||
| DE69308855T2 (de) | Elektrisch stabilisierter flüssigentwickler | |
| DE3119044A1 (de) | "toner fuer die elektrophotographie" | |
| DE3110955A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2737516A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2421753A1 (de) | Elektrostatische druckfarben | |
| DE2528339B2 (de) | Elektrophotographischer Suspensionsentwickler | |
| DE3110954A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2844691A1 (de) | Uebertragungsblatt und verfahren zur herstellung desselben | |
| DE1522562C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2040378A1 (de) | Fotoleitendes UEberzugsmaterial | |
| DE2030119A1 (de) | Verfahren zur Herstellung von lichtelektrisch-leitenden Elementen für die Elektrophotographie* | |
| DE2822761A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE1522721C3 (show.php) | ||
| DE1921246B2 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2932272A1 (de) | Verfahren zur herstellung eines elektrofotografischen elementes | |
| DE2409108A1 (de) | Polymere massen | |
| DE2016354B2 (de) | Verfahren zur Verbesserung von photoleitfähigem Zinkoxid | |
| DE69124786T2 (de) | Multiaktives elektrophotographisches Umkehrelement | |
| DE1497178A1 (de) | Elektrofotografische Materialien,Aufzeichnungstraeger und Verfahren zu deren Herstellung | |
| DE3220209A1 (de) | Photoleitfaehige zusammensetzung und ein diese verwendendes elektrophotographisches lichtempfangsmaterial | |
| DE2745733C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2100158B2 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer Photoleiter-Bindemittel-Schicht | |
| DE1814644A1 (de) | Elektrophotographisches lichtempfindliches Material |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |