DE2362568C2 - Alkanolaminderivate und sie enthaltende pharmazeutische Zusammensetzungen - Google Patents
Alkanolaminderivate und sie enthaltende pharmazeutische ZusammensetzungenInfo
- Publication number
- DE2362568C2 DE2362568C2 DE2362568A DE2362568A DE2362568C2 DE 2362568 C2 DE2362568 C2 DE 2362568C2 DE 2362568 A DE2362568 A DE 2362568A DE 2362568 A DE2362568 A DE 2362568A DE 2362568 C2 DE2362568 C2 DE 2362568C2
- Authority
- DE
- Germany
- Prior art keywords
- ethyl acetate
- mixture
- propanol
- ethanol
- residue
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000008194 pharmaceutical composition Substances 0.000 title description 4
- -1 alkylene radical Chemical class 0.000 claims description 73
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 279
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 207
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 111
- 239000000203 mixture Substances 0.000 description 92
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 74
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 64
- 229960004592 isopropanol Drugs 0.000 description 48
- 239000000243 solution Substances 0.000 description 48
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 45
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 238000002425 crystallisation Methods 0.000 description 32
- 230000008025 crystallization Effects 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- 241001233037 catfish Species 0.000 description 30
- 238000000034 method Methods 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 230000008018 melting Effects 0.000 description 27
- 238000002844 melting Methods 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 23
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 23
- 239000007858 starting material Substances 0.000 description 23
- 239000002904 solvent Substances 0.000 description 22
- 238000000354 decomposition reaction Methods 0.000 description 21
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 20
- 239000007787 solid Substances 0.000 description 20
- 150000003839 salts Chemical class 0.000 description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 18
- 239000001257 hydrogen Substances 0.000 description 18
- 229910052739 hydrogen Inorganic materials 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 17
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 15
- 239000003208 petroleum Substances 0.000 description 14
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 235000006408 oxalic acid Nutrition 0.000 description 12
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 230000000903 blocking effect Effects 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 5
- 101150065749 Churc1 gene Proteins 0.000 description 5
- 102100038239 Protein Churchill Human genes 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 230000001800 adrenalinergic effect Effects 0.000 description 5
- 230000000747 cardiac effect Effects 0.000 description 5
- WDAXFOBOLVPGLV-UHFFFAOYSA-N ethyl isobutyrate Chemical compound CCOC(=O)C(C)C WDAXFOBOLVPGLV-UHFFFAOYSA-N 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 229960001317 isoprenaline Drugs 0.000 description 5
- UCYJVNBJCIZMTJ-UHFFFAOYSA-N 1-(ethylamino)propan-2-ol Chemical compound CCNCC(C)O UCYJVNBJCIZMTJ-UHFFFAOYSA-N 0.000 description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 230000000638 stimulation Effects 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229940124630 bronchodilator Drugs 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000011549 crystallization solution Substances 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 239000000401 methanolic extract Substances 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 2
- XLHUBROMZOAQMV-UHFFFAOYSA-N 1,4-benzosemiquinone Chemical group [O]C1=CC=C(O)C=C1 XLHUBROMZOAQMV-UHFFFAOYSA-N 0.000 description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 2
- MGYGFNQQGAQEON-UHFFFAOYSA-N 4-tolyl isocyanate Chemical compound CC1=CC=C(N=C=O)C=C1 MGYGFNQQGAQEON-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- UCTWMZQNUQWSLP-UHFFFAOYSA-N adrenaline Chemical compound CNCC(O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-UHFFFAOYSA-N 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000496 cardiotonic agent Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- CJBSBWHRTPMXSJ-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO.CCO CJBSBWHRTPMXSJ-UHFFFAOYSA-N 0.000 description 2
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 2
- 150000003947 ethylamines Chemical class 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- BHIWKHZACMWKOJ-UHFFFAOYSA-N methyl isobutyrate Chemical compound COC(=O)C(C)C BHIWKHZACMWKOJ-UHFFFAOYSA-N 0.000 description 2
- OIRGFQCXUNWNRF-UHFFFAOYSA-N n-(2-aminopropyl)acetamide Chemical compound CC(N)CNC(C)=O OIRGFQCXUNWNRF-UHFFFAOYSA-N 0.000 description 2
- XETWPZRFZHJXAF-UHFFFAOYSA-N n-(2-aminopropyl)benzenesulfonamide Chemical compound CC(N)CNS(=O)(=O)C1=CC=CC=C1 XETWPZRFZHJXAF-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000005702 oxyalkylene group Chemical group 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 239000011833 salt mixture Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- SODPIMGUZLOIPE-UHFFFAOYSA-N (4-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- AWZHBDDTQUVXJK-UHFFFAOYSA-N 1-(2-aminopropyl)-3-phenylurea Chemical compound CC(N)CNC(=O)NC1=CC=CC=C1 AWZHBDDTQUVXJK-UHFFFAOYSA-N 0.000 description 1
- HCTDRZMGZRHFJV-UHFFFAOYSA-N 1-chloro-3-phenoxypropan-2-ol Chemical compound ClCC(O)COC1=CC=CC=C1 HCTDRZMGZRHFJV-UHFFFAOYSA-N 0.000 description 1
- CNDHHGUSRIZDSL-UHFFFAOYSA-N 1-chlorooctane Chemical compound CCCCCCCCCl CNDHHGUSRIZDSL-UHFFFAOYSA-N 0.000 description 1
- ZQQSYPZAPHRXRY-UHFFFAOYSA-N 1-hydroxyazetidine Chemical class ON1CCC1 ZQQSYPZAPHRXRY-UHFFFAOYSA-N 0.000 description 1
- SSPPPAZRFYTOFD-UHFFFAOYSA-N 1-methylcyclohexa-2,4-diene-1-sulfonamide Chemical compound NS(=O)(=O)C1(C)CC=CC=C1 SSPPPAZRFYTOFD-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- MWBXCWLRASBZFB-UHFFFAOYSA-M 2-(2,4-dimethylphenyl)acetate Chemical compound CC1=CC=C(CC([O-])=O)C(C)=C1 MWBXCWLRASBZFB-UHFFFAOYSA-M 0.000 description 1
- GBXSQWANKOUAGI-UHFFFAOYSA-N 2-(methoxymethoxy)-2-oxoacetic acid Chemical compound COCOC(=O)C(=O)O GBXSQWANKOUAGI-UHFFFAOYSA-N 0.000 description 1
- QYYCPWLLBSSFBW-UHFFFAOYSA-N 2-(naphthalen-1-yloxymethyl)oxirane Chemical compound C=1C=CC2=CC=CC=C2C=1OCC1CO1 QYYCPWLLBSSFBW-UHFFFAOYSA-N 0.000 description 1
- XFORQVOFSGYRFZ-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxy]-2-oxoacetic acid Chemical compound CC(C)(C)OC(=O)C(O)=O XFORQVOFSGYRFZ-UHFFFAOYSA-N 0.000 description 1
- RJNAMETVIBKNEQ-UHFFFAOYSA-N 2-[[3,4-bis(phenylmethoxy)phenoxy]methyl]oxirane Chemical compound C1OC1COC(C=C1OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 RJNAMETVIBKNEQ-UHFFFAOYSA-N 0.000 description 1
- WJNDOILQGZZRMB-UHFFFAOYSA-N 2-butylperoxy-2-oxoacetic acid Chemical compound CCCCOOC(=O)C(O)=O WJNDOILQGZZRMB-UHFFFAOYSA-N 0.000 description 1
- FGPWYCKELFZGGE-UHFFFAOYSA-N 2-cyanato-2-oxoacetic acid Chemical compound OC(=O)C(=O)OC#N FGPWYCKELFZGGE-UHFFFAOYSA-N 0.000 description 1
- WPHUUIODWRNJLO-UHFFFAOYSA-N 2-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1S(Cl)(=O)=O WPHUUIODWRNJLO-UHFFFAOYSA-N 0.000 description 1
- SXZMAVLCDKNPTD-UHFFFAOYSA-N 2-oxo-2-propan-2-yloxyacetic acid Chemical compound CC(C)OC(=O)C(O)=O SXZMAVLCDKNPTD-UHFFFAOYSA-N 0.000 description 1
- DMXBZAANBCMUMR-UHFFFAOYSA-N 2-oxo-2-propoxyacetic acid Chemical compound CCCOC(=O)C(O)=O DMXBZAANBCMUMR-UHFFFAOYSA-N 0.000 description 1
- CCZCXFHJMKINPE-UHFFFAOYSA-N 2-phenylmethoxyphenol Chemical compound OC1=CC=CC=C1OCC1=CC=CC=C1 CCZCXFHJMKINPE-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- JBYVNJSQTCGHEU-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-2-ylmethanol Chemical compound OCC1=NCCN1 JBYVNJSQTCGHEU-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 208000009079 Bronchial Spasm Diseases 0.000 description 1
- 208000014181 Bronchial disease Diseases 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- JLJPTRFOIVLHEJ-UHFFFAOYSA-N CC(C)O.C(C(=O)O)(=O)O.CC(C)O Chemical compound CC(C)O.C(C(=O)O)(=O)O.CC(C)O JLJPTRFOIVLHEJ-UHFFFAOYSA-N 0.000 description 1
- 206010007556 Cardiac failure acute Diseases 0.000 description 1
- 206010007558 Cardiac failure chronic Diseases 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000006148 High Cardiac Output Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- KPIGINNDBIOFJG-UHFFFAOYSA-N O.O.ClCCCC Chemical compound O.O.ClCCCC KPIGINNDBIOFJG-UHFFFAOYSA-N 0.000 description 1
- 239000005700 Putrescine Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000000674 adrenergic antagonist Substances 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 229920001577 copolymer Chemical group 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- RQYIRKHQEDSXSF-UHFFFAOYSA-N cyclopentanecarboxylic acid;methane Chemical compound C.OC(=O)C1CCCC1 RQYIRKHQEDSXSF-UHFFFAOYSA-N 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- OUAQKVIBEFYQDD-UHFFFAOYSA-N ethanamine;oxalic acid Chemical compound CCN.OC(=O)C(O)=O OUAQKVIBEFYQDD-UHFFFAOYSA-N 0.000 description 1
- HJOIHNLVBSAZKR-UHFFFAOYSA-N ethanamine;propan-2-ol Chemical compound CCN.CC(C)O HJOIHNLVBSAZKR-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZANNOFHADGWOLI-UHFFFAOYSA-N ethyl 2-hydroxyacetate Chemical compound CCOC(=O)CO ZANNOFHADGWOLI-UHFFFAOYSA-N 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000006207 intravenous dosage form Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- BCVXHSPFUWZLGQ-UHFFFAOYSA-N mecn acetonitrile Chemical compound CC#N.CC#N BCVXHSPFUWZLGQ-UHFFFAOYSA-N 0.000 description 1
- BZCKRPHEZOHHBK-UHFFFAOYSA-N methyl 2-phenoxyacetate Chemical compound COC(=O)COC1=CC=CC=C1 BZCKRPHEZOHHBK-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- HADMBZJXXDTJOG-UHFFFAOYSA-N n-(12-aminododecyl)benzenesulfonamide Chemical compound NCCCCCCCCCCCCNS(=O)(=O)C1=CC=CC=C1 HADMBZJXXDTJOG-UHFFFAOYSA-N 0.000 description 1
- WRJPJZTWQTUPQK-UHFFFAOYSA-N n-(6-aminohexyl)acetamide Chemical compound CC(=O)NCCCCCCN WRJPJZTWQTUPQK-UHFFFAOYSA-N 0.000 description 1
- FVLVBVSILSHUAF-UHFFFAOYSA-N n-benzyl-3,5-dimethyl-n-propan-2-ylbenzamide Chemical compound C=1C(C)=CC(C)=CC=1C(=O)N(C(C)C)CC1=CC=CC=C1 FVLVBVSILSHUAF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- AMZORBZSQRUXNC-UHFFFAOYSA-N o-Tolyl acetate Chemical compound CC(=O)OC1=CC=CC=C1C AMZORBZSQRUXNC-UHFFFAOYSA-N 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 1
- ZDYUUBIMAGBMPY-UHFFFAOYSA-N oxalic acid;hydrate Chemical compound O.OC(=O)C(O)=O ZDYUUBIMAGBMPY-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000000810 peripheral vasodilating agent Substances 0.000 description 1
- 229960002116 peripheral vasodilator Drugs 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- DURULFYMVIFBIR-UHFFFAOYSA-N practolol Chemical compound CC(C)NCC(O)COC1=CC=C(NC(C)=O)C=C1 DURULFYMVIFBIR-UHFFFAOYSA-N 0.000 description 1
- 229960001749 practolol Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- ZNZJJSYHZBXQSM-UHFFFAOYSA-N propane-2,2-diamine Chemical compound CC(C)(N)N ZNZJJSYHZBXQSM-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000001975 sympathomimetic effect Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 210000005090 tracheal smooth muscle Anatomy 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/02—Drugs for disorders of the nervous system for peripheral neuropathies
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/20—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/04—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms
- C07C275/06—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C275/14—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
Description
R2
<^~%—OH
die Zwischenverbindang der Formel
Z1CH2-CH-CH2- NR6- A—NR7- X—Y—R1
Methyl | H | H | 103-105 | Athylacetat |
Äthyl | H | H | 126-127 | Acetonitril |
n-i ropyi | U | U | 86- 87 | Äthylacetat |
Isopropyl | H | H | 125-126 | Athylacetat |
n-Octyl | H | H | 95- 96 | Athylacetat |
Cyclopropyl | H | H | 125-126 | Athylacetat |
Cvclopentyl | H | H | 133-135 | Athylacetat |
Cyclohexyl | H | H | 138-139 | Acetonitril |
2-Chlorophenyl | H | H | Hydrochlorid 182-183 | Acetonitril |
4-Tolyl | H | H | Hydrochlorid 211-212 | Acetonitril |
2-Nitrophenyl | H | H | 131-132 | Athylacetat/ |
Petroläther | ||||
2-Methoxyphenyl | H | H | Hydrogenoxalat 164-165 | Äthanol |
Isopropyl | 2-Cyano | H | 109-110 | Athylacetat |
Isopropyl | 2-Nitro | H | 108-110 | Athylacetat |
Isobutyl | H | H | 114-115 | Athylacetat |
t-Butyl | H | H | Hydrogenoxalat 167-168 | Äthanol |
n-Pentyl | H | H | 101-102 | Athylacetat |
Äthyl | 2-Cyano | H | 96- 97 | Athylacetat/ |
Petroläther | ||||
Isopropyl | 2-Chloro | H | 129-130 | Athylacetat |
Isopropyl | 2-Methyl | H | 120-122 | Athylacetat |
Isopropyl | 2-Methoxy | H | 142-143 | Acetonitril |
Isopropyl | 2-Chloro | 4-Methyl | 119-120 | Athylacetat |
Isopropyl | 2-Chloro | 5-Chloro | 152-153 | Acetonitril |
Isopropyl | 2-Nitro | 4-Methoxy | 122-124 | Athylacetat |
Methyl | 3-Cyano | H | 121-122 | Athylacetat |
147-149
154-155
164-166
163-164
133-134
120-121
130-131
100-102
R1 | R2 | Fp. (0C) | Kristallisationslösungs mittel |
Methyl | H | 155-156 | Methanol |
4-Tolyl | H | 145-148 | Äthanol |
4-Chlorophenyl | H | 166-169 | Äthanol |
2-Nitrophenyl | H | 186-188 | Acetonitril |
3-Nitrophenyl | H | 166-167 | Methanol |
Isopropyl | H | Oxalat 181-183 | Äthanol |
n-Propyl | H | 87- 88 | Äthylacetat/Petroläther |
Phenyl | 2-Cyano | Hydrogenoxalat- mcnohydrat 136-138 (mit Zersetzung) |
Äthanol |
4-Aminophenyl | H | Oxalat 158-160 (mit Zersetzung) |
Äthanol |
R1 | Y | R2 | Fp. (0C) | KLristallisations- JÖsungsmittel |
4-Chlorophenyl | -CH2- | H | 119-120 | Acetonitril |
2-Chlorophenyl | -CH2- | H | 137-138 | Äthylacetat |
Phenyl | - CH2CH2 - | H | 112-113 | Äthylacetat/ Petroläther |
4-Chlorophenyl | - CH2O - | H | 163-164 | Methanol |
Phenyl | - CH2CH2CH2O - | H | 89- 91 | Äthylacetat/ Petroläther |
Äthyl | -O- | H | 87- 88 | Äthylacetat/ Petroläther |
H | - CH2O - | H | Hydrogenoxalat | 128-129 Äthanol |
Methyl | - CH2O - | H | Hydrogenoxalat (mit Zersetzung) |
135-137 Äthanol |
2-Nitrophenyl | -CH2- | H | 130-131 | Äthylacetat |
4-Niirophenyl | -CH2- | H | 135-136 | Äthylacetat |
4-Methoxyphenyl | -CH2- | H | 122-123 | Äthylacetat |
2-Chlorophenyl | -CH2 | 2-Cyano | 120-122 | Acetonitril |
2-Chlorophenyl | -CH2 | 2-Chloro | 144-146 | Äthylacetat |
4-Chlorophenyl | - C(CH3)2O - | H | Hydrogenoxalat | 172-174 Äthanol |
2-Methoxyphenyl | - CH2O - | H | Hydrogenoxalat | 156-158 Acetonitril |
R!-Y- | SaIz | Fp. (0C) | Kristallisa tionslösungs- |
mittel | |||
4-Chlorophenyl-CH2- | Hydrochlorid | 194-196 | Äthanol/Äthylacetat |
2-Chlorophenyl-CH2 | Hydrochlorid | 162-163 | Äthanol/Äthylacetat |
Phenyl-CH2CH2- | Hydrochlorid | 134-137 | Äthanol/Äthylacetat |
4-Chlorophenyl-OCHr | p-Chlorophenoxyacetat | 147-148 | Acetonitril |
Phenyl-OCHzCHzCH^ | Hydrochlorid | 137-140 | Acetonitril |
Methyl-OCH.r | Hydrogenoxalat | 137-138 | Äthanol |
4-Methoxyphenyl-CHj- | (freie Base) | 130-140 | Toluol |
4-C;ilorophenyl-OC(CH3)2- | Hydrochlorid | 98-100 | Acetonitril |
R' | R* | Fp. (0C) | Kristallisations |
lösungsmittel | |||
Äthyl | H | 118-120 | Äthylacetat |
Isopropyl | H | 145-147 | Acetonitril |
n-Butyl | H | 116-117 | Äthylacetat |
Allyl | H | 131-132 | Äthylacetat |
4-Tolyl | H | 147-149 | Äthylacetat |
4-Methoxyphenyl | H | 126-128 | Äthylacetat |
Phenyl | 2-Chloro | 157-158 | Acetonitril |
Phenyl | 2-Nitro | 159-161 | Acetonitril |
Phenyl | 2-Methyl | 160-161 | Acetonitril |
Phenyl | 2-Cyano | 155-156 | Acetonitril |
η-Butyl | 2-Chloro | 149-150 | Acetonitril |
η-Butyl | 2-Methyl | 136-137 | Acetonitril |
η-Butyl | 2-Cyano | 145-147 | Acetonitril |
23 | VH2 | 62 568 | 18 | |
17 | Salz | |||
R^NHCONH-CH2Ch2] | Hydrochlorid | Kristallisationslösungsmittel | ||
R1 | Hydrogenoxalat | Fp. (0C) | Isopropanol/Äthylacetat | |
Äthyl | Hydrochlorid | 122-124 | Äthanol/Acetonitril | |
Isopropyl | Hydrochlorid | 146-148 | Isopropanol | |
Allyl | (freie Base) | 128-130 | Äthylacetat | |
4-Tolyl | 234-236 | Äthylacetat | ||
4-Methoxyphenyl | 104-106 | das entsprechende /?-Carboxaml | ||
Beispiel 10 | r, propan und | |||
R1 | Y | A | RJ | Fp. (0C) |
Kristallisations
lösungsmittel |
Isopropyl | direkt | -(CHj)4- | H |
Hydrogenoxalat
128-130 |
Acetonitril |
Methyl | direkt | -(CH2J6- | H |
Hydrogenoxalat
111-113 |
Acetonitril |
Phenyl | -CH2- | - CHCH2 - I |
H | 124-126 | Äthylacetat |
CH3 | |||||
Phenyl | -CH2- | - CHCH2 - I |
2-Cyano | 124-128 | Äthylacetat |
CHj | |||||
Isopropyl | direkt | - CHCH2 - I |
H | 124-126 | Äthylacetat |
CH, | |||||
n-Pentyl | direkt |
- CHCH2 -
I |
H | 102-103 | Äthylacetat |
CH3 | |||||
Isopropyl | direkt | - (CH2)3 - | H | 94- 95 | Äthylacetat |
n-Pentyl | direkt | -(CHj)6- | H | 85- 86 | Äthylacetat |
Phenyl | -CH2- |
-CHCH2-
I |
2-Nitro | 115-117 | Äthylacetat |
CH3 | |||||
Phenyl | -CH2- | - CHCH2 - I |
2-Allyloxy | 102-105 | Äthylacetat |
CH, |
Stellung des | R'-Y- | Base odes Salz | Fp. (0C) | Kristallisations- |
HO-Substi- | lösungsmittel | |||
tuenten | ||||
2- | Pheryl-NH- | Base | 154 | Äthanol |
4- | Äthyl- | Hemioxalat | 149 | Äthanol/Äther |
4- | Methoxy-CH2- | Oxalat | 199 | Äthanol |
(mit Zersetzung) | ||||
4- | Phenyl- | Acetat | 145-146 | Äthanol |
4- | Phenyl-CH2- | Hemioxalathydrat | 110 | Äthanol |
(mit Zersetzung) | ||||
3- | Isopropyl- | Base | (Öl) | - |
2- | Isopropyl | Hydrogenoxalat | 168-170 | Äthanol/Acetonitril |
Stellung des | R1 | Base oder Salz | Fp- (0C) | Kristallisations |
HO-Substi- | lösungsmittel | |||
tuenten | ||||
4- | Phenyl | Hemioxalat | 158-159 | Methanol |
3- | Phenyl | Oxalathydrat | (Glas) | - |
4- | Methyl | Oxalat | 119,5-120 | Äthanol |
(mit Zersetzung) |
R' | Base oder Salz | Fp. (0C) | Kristallisations |
lösungsmittel | |||
Isopropyl | Hemioxalathemihydrat | 192-193 | Methanol/Wasser/ |
(mit Zersetzung) | Äther | ||
n-Butyl | Hydrochloriddihydrat | 151-152 | Äthanol/Äther |
n-Octyl | Hydrochloridhemihydrat | 117 | Äthanol/Äther |
Cyclohexyl | Hydrochloridtetrahydrat | 145-150 | Äthanol/Äther |
R1 | R2 | Fp. (0C) | Kristallisationslösungs |
mittel | |||
t-Butyl | 2-Cyano | 152-154 | Acetonitril |
t-Butyl | 2-Nitro | 165-166 | Acetonitril |
Isopropyl | 2-AUyI | 112-113 | Äthylacetat/Cyclohexan |
Isopropyl | 2-Allyloxy | 119-120 | Athylacetat |
Acetonitril
R' | -X-Y- | R3 | Fp. (0C) |
Kristallisations
lösungsmittel |
Phenyl | - COCH2 - | 3-Methyl | Hydrogenfumarat 87- 90 |
Acetonitril |
Phenyl | - COCH2 - | 3-Bromo | 118-119 | Äthylacetat |
2-Chlorophenyl | - COCH2 - | 2-Nitro | 98-101 | Toluol |
Phenyl | - COCH2 - | 3-Methoxy | Hydrogenfumarat 85- 90 |
Äthylacetat |
2-Nitrophenyl | -SO2- | H | (Öl) | - |
n-Butvi | - CONH - | U | (Öl) | _ |
Phenyl
(Öl)
R1 | -X-Y- | A | Fp. (0C) |
Kristallisations
lösungsmittel |
Isopropyl | -CO- | - CH2CH2 - | Hemioxalat-viertelhydrat 213 |
Äthanol |
I sop ropy I | -CO | CH3 -CH-CH2 |
Hemioxalat-viertelhydrat 220 (unter Zersetzung) |
Wasser |
Äthyl Methyl |
-CO-O- -SO2- |
- CH2CH2 - - CH2CH2 - |
Hemioxalat 189 Oxalat 119,5-120 |
wäßriges Äthanol wäßriges Äthanol |
R | Base oder Salz | Fp. (0C) | Kristallisations |
lösungsmittel | |||
t-Butyl | Oxalat-hemihydrat | 133-135 | Äthanol/Äther |
(mit Zersetzung) | |||
o-Tolyl | Acetat | 109-111 | Petroläther |
(Kp. 60-80° C) | |||
o-Methoxyphenyl | Oxalat-sesquihydrat | 68- 71 | Äthanol |
(mit Zersetzung) | |||
2,4-Dimethylphenyl | Acetat-viertelhydrat | 133-135 | Isopropanol |
1-Naphthyl | Hemioxalat-hydrat | 159-162 | Äthanol |
4-Biphenyl | Hemioxalat-hemihydrat | 211 | Methanol |
(mit Zersetzung) | |||
Methoxymethyl | Oxalat | (hygroskop) | Äthanol/Äther |
n-Butyloxy- | Oxalat | (hygroskop) | - |
carbonylmethyl |
R' | -X-Y- | R2 | 4-Hydroxy | Fp. (0C) | Kristallisations |
lösungsmittel | |||||
Phenyl | -SO2- | 3-Methoxy | 4-Hydroxy | Oxalat-hemihydrat | Äthanol |
127-130 | |||||
Phenyl | - CONH - | 3-Methoxy | Hemioxalat- | Wasser | |
viertelhydrat | |||||
4-Hydroxy | 167-168 | ||||
(mit Zersetzung) | |||||
Isopropyl | -CO- | 3-Hydroxy | Hemioxalat | Isopropanol/ | |
5-Hydroxy | 1 £0 IUU |
Msihan"! | |||
(mit Zersetzung) | |||||
Isopropyl | -CO- | 3-Hydroxy | 4-Hydroxy | Hydrochlorid | - |
(Öl) | |||||
Phenyl | -SO2- | 3-Hydroxy | Oxalat-hemihydrat | Äthanol/ | |
134 | Isopropanol | ||||
(mit Zersetzung) | |||||
Claims (1)
- Patentansprüche: 1. Alkanolamlnderivate der allgemeinen FormelR2 ^^-OCH2-CHOH-CH2NH-A—NH—X—Y—R1R3worin A für ein Alkylenradlkal mit 2 bis 6 Kohlenstoffatomen steht, worin R1 für ein WasserstofTatom oder ein Alkyl-, Halogenalkyl-, Alkenyl- oder Cycloalkylradlkal mit jeweils bis zu 10 Kohlenstoffatomen oder für ein Arylradlkal der Formel
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB5797072 | 1972-12-15 | ||
GB4347873A GB1455116A (en) | 1972-12-15 | 1973-09-17 | Pharmaceutical compositions |
Publications (2)
Publication Number | Publication Date |
---|---|
DE2362568A1 DE2362568A1 (de) | 1974-06-20 |
DE2362568C2 true DE2362568C2 (de) | 1983-11-03 |
Family
ID=26265164
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2362568A Expired DE2362568C2 (de) | 1972-12-15 | 1973-12-17 | Alkanolaminderivate und sie enthaltende pharmazeutische Zusammensetzungen |
Country Status (28)
Country | Link |
---|---|
US (2) | US3928412A (de) |
JP (1) | JPS5919090B2 (de) |
AR (2) | AR213930A1 (de) |
AT (3) | AT345791B (de) |
BE (1) | BE808666A (de) |
CA (1) | CA1031362A (de) |
CH (4) | CH605666A5 (de) |
CS (1) | CS187389B2 (de) |
DD (1) | DD113349A5 (de) |
DE (1) | DE2362568C2 (de) |
DK (1) | DK158466C (de) |
ES (1) | ES421538A1 (de) |
FI (1) | FI61027C (de) |
FR (1) | FR2210407B1 (de) |
GB (1) | GB1455116A (de) |
HK (1) | HK24480A (de) |
HU (1) | HU169087B (de) |
IE (1) | IE38602B1 (de) |
IL (1) | IL43795A (de) |
IN (1) | IN139418B (de) |
KE (1) | KE3030A (de) |
LU (1) | LU68997A1 (de) |
MY (1) | MY8100035A (de) |
NL (1) | NL179203C (de) |
NO (1) | NO138335C (de) |
SE (1) | SE408794B (de) |
SU (2) | SU576917A3 (de) |
YU (2) | YU40097B (de) |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4425362A (en) | 1980-11-06 | 1984-01-10 | Sandoz Ltd. | 3-Aminopropoxyphenyl derivatives and pharmaceutical compositions containing them |
Families Citing this family (34)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4038313A (en) * | 1970-01-08 | 1977-07-26 | Ciba-Geigy Corporation | Cycloalkylureido phenoxy propanolamines |
US4167581A (en) * | 1972-12-15 | 1979-09-11 | Imperial Chemical Industries Limited | Alkanolamine derivatives and pharmaceutical compositions and uses thereof |
US4171374A (en) * | 1972-12-15 | 1979-10-16 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
US4034112A (en) * | 1973-06-22 | 1977-07-05 | Imperial Chemical Industries Limited | Ethanolamine derivatives having β-adrenergic blocking activity |
US4117157A (en) * | 1973-06-22 | 1978-09-26 | Imperial Chemical Industries Limited | Ethanolamine derivatives having β-adrenergic blocking activity |
US4041074A (en) * | 1973-07-19 | 1977-08-09 | Imperial Chemical Industries Limited | 1-Hydroxyaryl-2-amidoalkylaminoethanol derivatives |
GB1573359A (en) * | 1977-12-20 | 1980-08-20 | Ici Ltd | Alkanolamine derivatives |
GB1509527A (en) * | 1974-06-05 | 1978-05-04 | Ici Ltd | 1-(aryl-or heteroaryl)oxy-3-(substituted-amino)propan-2-ol derivatives processes for their manufacture and pharmaceutical compositions containing them |
US4041075A (en) * | 1973-12-12 | 1977-08-09 | Imperial Chemical Industries Limited | Phenoxy-alkanolamine derivatives |
AT334385B (de) * | 1973-12-20 | 1976-01-10 | Chemie Linz Ag | Verfahren zur herstellung von neuen phenoxypropylaminderivaten und deren salzen |
US4141987A (en) * | 1974-06-05 | 1979-02-27 | Imperial Chemical Industries Limited | 1-Aryloxy-3-thenamidoalkylamino-2-propanol derivatives |
US4162331A (en) * | 1975-06-17 | 1979-07-24 | Nippon Shinyaku Co., Ltd. | Substituted N-(carboxymethyl)-3-aminopropan-2-ol derivatives |
GB1540463A (en) * | 1976-10-07 | 1979-02-14 | Ici Ltd | Alkanolamine derivatives |
IE47053B1 (en) * | 1977-05-23 | 1983-12-14 | Ici Ltd | Cardiac stimulants |
US4172150A (en) * | 1977-05-23 | 1979-10-23 | Imperial Chemical Industries Limited | Cardiac stimulants |
US4219561A (en) * | 1977-09-22 | 1980-08-26 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
US4239700A (en) * | 1978-10-10 | 1980-12-16 | Texaco Development Corp. | Isatoic anhydride derivatives and use as chain-extenders |
US4301300A (en) * | 1979-09-06 | 1981-11-17 | Hoffmann-La Roche Inc. | Sulfonamide intermediates for adrenergic blocking agents |
US4281189A (en) * | 1979-09-06 | 1981-07-28 | Hoffmann-La Roche Inc. | Sulfonamide intermediates for adrenergic blocking agents |
FR2477537A1 (fr) * | 1980-03-07 | 1981-09-11 | Francaise Sucrerie | Nouvelles guanidines acylees, urees et urees substituees, leur procede de fabrication et leur application en tant que medicaments |
ATE19510T1 (de) * | 1981-12-17 | 1986-05-15 | Haessle Ab | Para-substituierte 3-phenoxy-1carbonylaminoalkylaminopropan-2-ole mit blockierenden wirkungen bei betarezeptoren. |
US5238962A (en) * | 1983-03-03 | 1993-08-24 | Hoffmann-La Roche Inc. | Benzamide derivatives |
CH653670A5 (de) * | 1983-03-03 | 1986-01-15 | Hoffmann La Roche | Benzamid-derivate. |
US4593039A (en) * | 1984-04-02 | 1986-06-03 | Merck & Co., Inc. | 1-aryloxy-3-(substituted aminoalkylamino)-2-propanols |
DE3427309A1 (de) * | 1984-07-25 | 1986-01-30 | Boehringer Ingelheim KG, 6507 Ingelheim | Neue 1-aryloxypropanolamine, verfahren zu ihrer herstellung und ihre verwendung |
DE3512627A1 (de) * | 1985-04-06 | 1986-10-09 | Boehringer Mannheim Gmbh, 6800 Mannheim | Amino-propanol-derivate, verfahren zu deren herstellung, verwendung derselben und diese enthaltende arzneimittel |
ATE81850T1 (de) * | 1985-05-14 | 1992-11-15 | William John Louis | 3-aminopropyloxyphenylabkoemmlinge, herstellung und arzneitmittel die sie enthalten. |
EP0207036A1 (de) * | 1985-06-20 | 1986-12-30 | Aktiebolaget Hässle | Neue para-substituierte 3-Phenoxy-1-piperidincarbonylaminoalkylaminopropanole-2 mit Betablockerwirkung |
GB8607312D0 (en) * | 1986-03-25 | 1986-04-30 | Ici Plc | Therapeutic agents |
GB8607313D0 (en) * | 1986-03-25 | 1986-04-30 | Ici Plc | Pharmaceutical compositions |
DE3880628T2 (de) * | 1987-11-13 | 1993-08-05 | Glaxo Group Ltd | Phenethanolamin-derivate. |
JP2004137284A (ja) * | 1997-06-17 | 2004-05-13 | Kaken Pharmaceut Co Ltd | 2−スルファモイル安息香酸誘導体 |
GB0417802D0 (en) * | 2004-08-10 | 2004-09-15 | Novartis Ag | Organic compounds |
CN106977426A (zh) * | 2017-05-27 | 2017-07-25 | 哈尔滨师范大学 | 一种腰果酚苯基脲及其制备方法 |
Family Cites Families (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3459782A (en) * | 1963-08-26 | 1969-08-05 | Boehringer Sohn Ingelheim | 1-substituted phenoxy-2-hydroxy-3-isopropylamino-propanes |
GB1199037A (en) * | 1967-09-27 | 1970-07-15 | Ici Ltd | Alkanolamine Derivatives |
GB1285038A (en) * | 1969-02-21 | 1972-08-09 | Ici Ltd | Alkanolamine derivatives |
BE754604A (fr) * | 1969-08-08 | 1971-02-08 | Boehringer Sohn Ingelheim | Le 1-(2-nitrilophenoxy)-2-hydroxy-3-ethyl-aminopropane et ses sels |
-
1973
- 1973-09-17 GB GB4347873A patent/GB1455116A/en not_active Expired
- 1973-12-03 IE IE2183/73A patent/IE38602B1/xx unknown
- 1973-12-04 US US421669A patent/US3928412A/en not_active Expired - Lifetime
- 1973-12-04 CA CA187,289A patent/CA1031362A/en not_active Expired
- 1973-12-06 IN IN2664/CAL/73A patent/IN139418B/en unknown
- 1973-12-10 IL IL43795A patent/IL43795A/xx unknown
- 1973-12-11 FI FI3789/73A patent/FI61027C/fi active
- 1973-12-13 NL NLAANVRAGE7317096,A patent/NL179203C/xx not_active IP Right Cessation
- 1973-12-13 LU LU68997A patent/LU68997A1/xx unknown
- 1973-12-13 SE SE7316863A patent/SE408794B/sv unknown
- 1973-12-14 AR AR251531A patent/AR213930A1/es active
- 1973-12-14 BE BE138894A patent/BE808666A/xx not_active IP Right Cessation
- 1973-12-14 DK DK681673A patent/DK158466C/da not_active IP Right Cessation
- 1973-12-14 CH CH1759473A patent/CH605666A5/xx not_active IP Right Cessation
- 1973-12-14 DD DD175410A patent/DD113349A5/xx unknown
- 1973-12-14 CH CH1340377A patent/CH611876A5/xx not_active IP Right Cessation
- 1973-12-14 SU SU7301981054A patent/SU576917A3/ru active
- 1973-12-14 CH CH1340177A patent/CH605667A5/xx not_active IP Right Cessation
- 1973-12-14 YU YU3246/73A patent/YU40097B/xx unknown
- 1973-12-14 NO NO4794/73A patent/NO138335C/no unknown
- 1973-12-14 HU HUIE600A patent/HU169087B/hu unknown
- 1973-12-14 CH CH1340277A patent/CH605668A5/xx not_active IP Right Cessation
- 1973-12-14 FR FR7344780A patent/FR2210407B1/fr not_active Expired
- 1973-12-15 ES ES421538A patent/ES421538A1/es not_active Expired
- 1973-12-15 JP JP48141162A patent/JPS5919090B2/ja not_active Expired
- 1973-12-17 CS CS738727A patent/CS187389B2/cs unknown
- 1973-12-17 AT AT581577A patent/AT345791B/de not_active IP Right Cessation
- 1973-12-17 DE DE2362568A patent/DE2362568C2/de not_active Expired
-
1975
- 1975-08-26 US US05/607,995 patent/US4010189A/en not_active Expired - Lifetime
-
1976
- 1976-04-12 AT AT266376A patent/AT344144B/de not_active IP Right Cessation
- 1976-04-21 AR AR262359A patent/AR214288A1/es active
-
1977
- 1977-07-26 SU SU772504510A patent/SU695555A3/ru active
- 1977-07-29 AT AT566077A patent/AT351557B/de not_active IP Right Cessation
-
1980
- 1980-03-03 KE KE3030A patent/KE3030A/xx unknown
- 1980-05-08 HK HK244/80A patent/HK24480A/xx unknown
- 1980-11-03 YU YU2806/80A patent/YU42539B/xx unknown
-
1981
- 1981-12-30 MY MY35/81A patent/MY8100035A/xx unknown
Non-Patent Citations (1)
Title |
---|
NICHTS-ERMITTELT |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4425362A (en) | 1980-11-06 | 1984-01-10 | Sandoz Ltd. | 3-Aminopropoxyphenyl derivatives and pharmaceutical compositions containing them |
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2362568C2 (de) | Alkanolaminderivate und sie enthaltende pharmazeutische Zusammensetzungen | |
DE69627852T2 (de) | Verbindungen, die an einer neuen stelle auf rezeptor-stimulierten kalziumkanälen wirksam sind, verwendbar zur behandlung von neurologischen krankheiten | |
DE69630319T2 (de) | Neue trizyklische verbindungen und arzneimittelzusammensetzungen die diese enthalten | |
DE1957706A1 (de) | Neue Propanolamin-Derivate und deren Verwendung zur Behandlung von Herzkrankheiten | |
DE2430237C2 (de) | Äthanolaminoderivate und sie enthaltende pharmazeutische Zusammensetzungen | |
DE2907217C2 (de) | 3-Phenyl-3-phenoxypropylamin-Derivate und deren Salze, deren Herstellung und diese enthaltende Arzneimittel | |
DE2434911C2 (de) | Phenyläthylamin-Derivate und pharmazeutische Zusammensetzungen | |
DE1493955A1 (de) | Verfahren zur Herstellung substituierter Sulfonanilide | |
EP0375791A1 (de) | Neue Phenylethanolamine, deren Verwendung als Arzneimittel und als Leistungsförderer bei Tieren sowie Verfahren zu ihrer Herstellung | |
DE1443599A1 (de) | Ungesaettigte Amine | |
EP0026848A1 (de) | Tetralinderivate, ihre Herstellung und Heilmittel, welche diese Verbindungen enthalten | |
DE60315973T2 (de) | Hydroxy-tetrahydro-naphthalinylharnstoff-derivate | |
DD235065A5 (de) | Verfahren zur herstellung von n-(2-(4-fluorphenyl)-1-methyl)-n-methyl-n-propinylamin | |
DE2317710A1 (de) | Dopaminderivate | |
DE3411993A1 (de) | Substituierte benzopyrane, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimittel | |
DE2445811A1 (de) | Alkanolaminderivate | |
DE2458908C2 (de) | Alkanolaminderivate und sie enthaltende pharmazeutische Zusammensetzungen | |
DE3320394A1 (de) | Optisch aktive n-arylierte oxazolidinon-(2)-derivate, deren verwendung als spezifische und reversible inhibitoren von monoaminooxydase des b-typs sowie verfahren zu deren herstellung | |
DE2723051A1 (de) | N-(acyl)-p-amino-n'-(monosubstit.)- benzamide sowie diese enthaltende arzneimittel | |
CH558784A (de) | Verfahren zur herstellung von sulfonaniliden. | |
DE2623314A1 (de) | Neue 1-aryloxy-2-hydroxy-3- aminopropane und verfahren zu ihrer herstellung | |
WO1996004245A1 (de) | N-substituierte azabicycloheptan-derivate als neuroleptika usw. | |
CH512436A (de) | Verfahren zur Herstellung basisch substituierter Amide von N-substituierten Anthranilsäuren und ihrer Salze | |
DE2227846C3 (de) | Substituierte Phenoxyessigsäureamide, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzung | |
DE2062055C3 (de) | Propanolamin-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OD | Request for examination | ||
8125 | Change of the main classification |
Ipc: C07C103/44 |
|
8126 | Change of the secondary classification |
Free format text: C07C103/82 C07C103/737 C07C127/00 C07C143/72 C07C121/75 A61K 31/16 |
|
AG | Has addition no. |
Ref country code: DE Ref document number: 2655195 Format of ref document f/p: P Ref country code: DE Ref document number: 2458908 Format of ref document f/p: P |
|
D2 | Grant after examination | ||
AG | Has addition no. |
Ref country code: DE Ref document number: 2458908 Format of ref document f/p: P |
|
8364 | No opposition during term of opposition |