DE2344936C3 - Nachlieferungs-Reaktions-Kathode für Elektronenröhren - Google Patents
Nachlieferungs-Reaktions-Kathode für ElektronenröhrenInfo
- Publication number
- DE2344936C3 DE2344936C3 DE2344936A DE2344936A DE2344936C3 DE 2344936 C3 DE2344936 C3 DE 2344936C3 DE 2344936 A DE2344936 A DE 2344936A DE 2344936 A DE2344936 A DE 2344936A DE 2344936 C3 DE2344936 C3 DE 2344936C3
- Authority
- DE
- Germany
- Prior art keywords
- cathode
- tungsten
- emission
- carbide
- metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052721 tungsten Inorganic materials 0.000 claims description 28
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 27
- 239000010937 tungsten Substances 0.000 claims description 27
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical group [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 claims description 12
- 229910052750 molybdenum Inorganic materials 0.000 claims description 12
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 11
- 239000011733 molybdenum Substances 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 3
- 239000008187 granular material Substances 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 238000005245 sintering Methods 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims 3
- 150000004706 metal oxides Chemical class 0.000 claims 3
- 239000003966 growth inhibitor Substances 0.000 claims 1
- 239000003870 refractory metal Substances 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 description 8
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 229910052746 lanthanum Inorganic materials 0.000 description 7
- 229910021193 La 2 O 3 Inorganic materials 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000002344 surface layer Substances 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 4
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 3
- 229910052776 Thorium Inorganic materials 0.000 description 3
- 239000011195 cermet Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 229910052761 rare earth metal Inorganic materials 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 150000001785 cerium compounds Chemical class 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000007731 hot pressing Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 229910001404 rare earth metal oxide Inorganic materials 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 229910000048 titanium hydride Inorganic materials 0.000 description 1
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 description 1
- QSGNKXDSTRDWKA-UHFFFAOYSA-N zirconium dihydride Chemical compound [ZrH2] QSGNKXDSTRDWKA-UHFFFAOYSA-N 0.000 description 1
- 229910000568 zirconium hydride Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/13—Solid thermionic cathodes
- H01J1/20—Cathodes heated indirectly by an electric current; Cathodes heated by electron or ion bombardment
- H01J1/26—Supports for the emissive material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/13—Solid thermionic cathodes
- H01J1/14—Solid thermionic cathodes characterised by the material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J9/00—Apparatus or processes specially adapted for the manufacture, installation, removal, maintenance of electric discharge tubes, discharge lamps, or parts thereof; Recovery of material from discharge tubes or lamps
- H01J9/02—Manufacture of electrodes or electrode systems
- H01J9/04—Manufacture of electrodes or electrode systems of thermionic cathodes
- H01J9/042—Manufacture, activation of the emissive part
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Solid Thermionic Cathode (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH994073A CH582951A5 (enExample) | 1973-07-09 | 1973-07-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2344936A1 DE2344936A1 (de) | 1975-02-06 |
| DE2344936B2 DE2344936B2 (de) | 1975-09-04 |
| DE2344936C3 true DE2344936C3 (de) | 1984-01-19 |
Family
ID=4357329
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2344936A Expired DE2344936C3 (de) | 1973-07-09 | 1973-09-06 | Nachlieferungs-Reaktions-Kathode für Elektronenröhren |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4083811A (enExample) |
| JP (1) | JPS5728176B2 (enExample) |
| AT (1) | AT377639B (enExample) |
| BR (1) | BR7405601D0 (enExample) |
| CH (1) | CH582951A5 (enExample) |
| DE (1) | DE2344936C3 (enExample) |
| FR (1) | FR2237303B1 (enExample) |
| GB (1) | GB1469554A (enExample) |
| HU (1) | HU169833B (enExample) |
| IN (1) | IN143037B (enExample) |
| NL (1) | NL179013C (enExample) |
| SE (1) | SE388717C (enExample) |
| YU (2) | YU185274A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56114664A (en) * | 1980-02-01 | 1981-09-09 | Disco Abrasive Sys Ltd | Manufacture of grindstone |
| US4273683A (en) * | 1977-12-16 | 1981-06-16 | Hitachi, Ltd. | Oxide cathode and process for production thereof |
| JPS5488059A (en) * | 1977-12-26 | 1979-07-12 | Hitachi Ltd | Thermion emission cathode |
| DE2822665A1 (de) * | 1978-05-05 | 1979-11-08 | Bbc Brown Boveri & Cie | Gluehkathodenmaterial |
| CH629033A5 (de) * | 1978-05-05 | 1982-03-31 | Bbc Brown Boveri & Cie | Gluehkathode. |
| JPS605424B2 (ja) * | 1978-11-09 | 1985-02-12 | 本田技研工業株式会社 | 研削整用半球形砥石の砥粒電着装置 |
| US4250428A (en) * | 1979-05-09 | 1981-02-10 | The United States Of America As Represented By The Secretary Of The Army | Bonded cathode and electrode structure with layered insulation, and method of manufacture |
| FR2498372A1 (fr) * | 1981-01-16 | 1982-07-23 | Thomson Csf | Cathode a chauffage direct, son procede de fabrication, et tube electronique incorporant une telle cathode |
| JPS58143957A (ja) * | 1982-02-23 | 1983-08-26 | Kurisutensen Maikai Kk | 砥石支持台の製造方法 |
| CN85100483B (zh) * | 1985-04-01 | 1988-10-19 | 上海灯泡厂 | 超声波换能器用背载材料 |
| JPS63187527A (ja) * | 1987-01-28 | 1988-08-03 | Hitachi Ltd | 電子管陰極構体 |
| DE4305558A1 (de) * | 1993-02-24 | 1994-08-25 | Asea Brown Boveri | Verfahren zur Herstellung von Drähten, welche insbesondere für Kathoden von Elektronenröhren geeignet sind |
| DE4421810C2 (de) * | 1994-06-22 | 1996-08-29 | Siemens Ag | Thermionischer Elektronenemitter und Verfahren zu dessen Herstellung |
| DE4421793A1 (de) * | 1994-06-22 | 1996-01-04 | Siemens Ag | Thermionischer Elektronenemitter für eine Elektronenröhre |
| KR100200661B1 (ko) * | 1994-10-12 | 1999-06-15 | 손욱 | 전자관용 음극 |
| US6815876B1 (en) * | 1999-06-23 | 2004-11-09 | Agere Systems Inc. | Cathode with improved work function and method for making the same |
| JP2012203998A (ja) * | 2011-03-23 | 2012-10-22 | Nippon Tungsten Co Ltd | タングステン陰極材料 |
| US20170330725A1 (en) | 2016-05-13 | 2017-11-16 | Axcelis Technologies, Inc. | Lanthanated tungsten ion source and beamline components |
| AT16409U1 (de) * | 2017-05-23 | 2019-08-15 | Plansee Se | Kathodenwerkstoff |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB182817A (en) * | 1921-07-11 | 1923-08-09 | Drahtlose Telegraphie Gmbh | Improvements in the cathodes of electric discharge tubes |
| US1794298A (en) * | 1926-09-21 | 1931-02-24 | Gen Electric | Thermionic cathode |
| DE559817C (de) * | 1927-12-17 | 1932-09-24 | Siemens & Halske Akt Ges | Gasgefuelltes Entladungsrohr |
| DE744453C (de) * | 1934-06-13 | 1944-01-15 | Hans Bodo Willers | Emissionselektrode mit einer aktiven Schicht aus stark elektronenemittierenden Stoffen mit einem Traegerdraht aus einer Nickellegierung |
| NL48128C (enExample) * | 1935-02-23 | |||
| NL149363C (enExample) * | 1940-01-24 | |||
| DE875689C (de) * | 1942-06-28 | 1953-05-04 | Lorenz C Ag | Sekundaeremissionsschicht fuer Prallelektroden |
| US2438732A (en) * | 1947-03-15 | 1948-03-30 | Eitel Mcculough Inc | Electron tube cathode |
| DE973336C (de) * | 1952-04-09 | 1960-01-28 | Philips Nv | Kathode fuer elektrische Entladungsroehren mit einem Vorrat an Erdalkalimetallverbindungen |
| BE526506A (enExample) * | 1953-02-16 | |||
| US3105290A (en) * | 1958-12-18 | 1963-10-01 | Westinghouse Electric Corp | Cathode for electron discharge device |
| NL266639A (enExample) * | 1960-07-05 | |||
| GB929668A (en) * | 1960-09-28 | 1963-06-26 | Gen Electric Co Ltd | Improvements in or relating to electrodes for electric discharge apparatus |
| US3290543A (en) * | 1963-06-03 | 1966-12-06 | Varian Associates | Grain oriented dispenser thermionic emitter for electron discharge device |
| DE1257980B (de) * | 1966-05-20 | 1968-01-04 | Telefunken Patent | Vorratskathode und Verfahren zu deren Herstellung |
| DE1614938A1 (de) * | 1966-09-26 | 1970-12-23 | Atomic Energy Authority Uk | Elektronen emittierende Kathode,insbesondere fuer Elektronen-Bestrahlungsmaschinen |
| NL6807899A (enExample) * | 1967-06-06 | 1968-12-09 | ||
| DE1614541A1 (de) * | 1967-06-21 | 1970-08-20 | Siemens Ag | Thorium-Film-Kathode fuer elektrische Entladungsgefaesse |
| JPS5134675B2 (enExample) * | 1971-09-03 | 1976-09-28 | ||
| CH579824A5 (enExample) * | 1974-10-25 | 1976-09-15 | Bbc Brown Boveri & Cie |
-
1973
- 1973-07-09 CH CH994073A patent/CH582951A5/xx not_active IP Right Cessation
- 1973-09-06 DE DE2344936A patent/DE2344936C3/de not_active Expired
-
1974
- 1974-05-27 AT AT0433974A patent/AT377639B/de not_active IP Right Cessation
- 1974-06-21 JP JP7122774A patent/JPS5728176B2/ja not_active Expired
- 1974-07-02 YU YU01852/74A patent/YU185274A/xx unknown
- 1974-07-05 SE SE7408863A patent/SE388717C/xx not_active IP Right Cessation
- 1974-07-08 US US05/486,396 patent/US4083811A/en not_active Expired - Lifetime
- 1974-07-08 NL NLAANVRAGE7409188,A patent/NL179013C/xx not_active IP Right Cessation
- 1974-07-08 FR FR7423728A patent/FR2237303B1/fr not_active Expired
- 1974-07-08 BR BR5601/74A patent/BR7405601D0/pt unknown
- 1974-07-08 GB GB3009874A patent/GB1469554A/en not_active Expired
- 1974-07-08 HU HUBO1507A patent/HU169833B/hu unknown
- 1974-09-04 IN IN/CAL/74A patent/IN143037B/en unknown
-
1980
- 1980-12-18 YU YU03207/80A patent/YU320780A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN143037B (enExample) | 1977-09-24 |
| SE388717C (sv) | 1983-05-02 |
| NL7409188A (nl) | 1975-01-13 |
| ATA433974A (de) | 1979-07-15 |
| DE2344936A1 (de) | 1975-02-06 |
| SE7408863L (enExample) | 1975-01-10 |
| NL179013C (nl) | 1988-04-18 |
| CH582951A5 (enExample) | 1976-12-15 |
| HU169833B (enExample) | 1977-02-28 |
| BR7405601D0 (pt) | 1975-05-13 |
| AT377639B (de) | 1985-04-10 |
| GB1469554A (en) | 1977-04-06 |
| YU320780A (en) | 1983-02-28 |
| DE2344936B2 (de) | 1975-09-04 |
| YU185274A (en) | 1982-05-31 |
| NL179013B (nl) | 1986-01-16 |
| FR2237303A1 (enExample) | 1975-02-07 |
| JPS5728176B2 (enExample) | 1982-06-15 |
| JPS5039868A (enExample) | 1975-04-12 |
| SE388717B (sv) | 1976-10-11 |
| FR2237303B1 (enExample) | 1977-10-07 |
| US4083811A (en) | 1978-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2344936C3 (de) | Nachlieferungs-Reaktions-Kathode für Elektronenröhren | |
| DE2945565C2 (de) | Poröse Anode für eine Hochtemperatur-Brennstoffzelle | |
| DE1015941B (de) | Vorratskathode und Verfahren zu ihrer Herstellung | |
| EP0143222B1 (de) | Glühkathode mit hohem Emissionsvermögen für eine Elektronenröhre und Verfahren zu deren Herstellung | |
| DE2245717A1 (de) | Elektrode mit einem poroesen sinterkoerper | |
| DE1181824B (de) | Verfahren zur Herstellung einer Vorratskathode fuer elektrische Entladnungsroehren | |
| DE2753039C2 (de) | Elektrode für eine Entladungslampe | |
| DE2635289C2 (de) | Metallene Trägerplatte der Oxidschicht direkt geheizter Oxidkathoden und Verfahren zu ihrer Herstellung | |
| EP0005279B1 (de) | Glühkathode | |
| DE1169593B (de) | Kathode hoher Elektronenemission | |
| DE69026032T2 (de) | Scandatkathode | |
| DE2454569C3 (de) | Reaktionskathode | |
| WO2013113049A1 (de) | Wolfram-verbundelektrode | |
| DE69010241T2 (de) | Scandatkathode. | |
| DE2947313C2 (de) | Elektronenröhrenkathode | |
| DE1026000B (de) | Kathode mit einer aus poroesem Metall bestehenden Emissionsoberflaeche und Verfahren zu ihrer Herstellung | |
| EP1189253B1 (de) | Kathodenstrahlröhre mit dotierter Oxidkathode | |
| DE2619866C3 (de) | Gasentladungsröhre, insbesondere Überspannungsableiter | |
| DD228393A5 (de) | Oxidkathode | |
| DE10254697A1 (de) | Vakuumelektronenröhre mit Oxidkathode | |
| DE19643157C1 (de) | Verfahren zur Herstellung eines Chrom-Werkstoffes | |
| DE965857C (de) | Verfahren zur Herstellung von nicht emittierenden Elektroden fuer elektrische Entladungsgefaesse | |
| DE7332370U (de) | Thermische Kathode für Elektronenröhren | |
| DE1284522B (de) | Vorratskatode und Verfahren zu ihrer Herstellung | |
| DE2738207A1 (de) | Basismetallplattenwerkstoff fuer eine direkt erhitzte oxidkathode |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8281 | Inventor (new situation) |
Free format text: BACHMANN, ROBERT, DR., DOETTINGEN, CH BUXBAUM, CHARLEY, DIPL.-ING., BADEN, CH GESSINGER, GERNOT, DIPL.-ING. DR., NIEDERROHRDORF, CH |
|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: BBC BROWN BOVERI AG, BADEN, AARGAU, CH |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: DERZEIT KEIN VERTRETER BESTELLT |
|
| 8339 | Ceased/non-payment of the annual fee |