DE2209127A1 - Modifizierte nematische phasen - Google Patents
Modifizierte nematische phasenInfo
- Publication number
- DE2209127A1 DE2209127A1 DE2209127A DE2209127A DE2209127A1 DE 2209127 A1 DE2209127 A1 DE 2209127A1 DE 2209127 A DE2209127 A DE 2209127A DE 2209127 A DE2209127 A DE 2209127A DE 2209127 A1 DE2209127 A1 DE 2209127A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- nematic
- salts
- formula
- phases
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 p-methoxyphenylazoxy Chemical group 0.000 claims description 28
- 239000005711 Benzoic acid Substances 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 22
- 150000001735 carboxylic acids Chemical class 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000004423 acyloxy group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 10
- 239000000374 eutectic mixture Substances 0.000 claims description 7
- 235000010233 benzoic acid Nutrition 0.000 claims description 6
- 230000005496 eutectics Effects 0.000 claims description 5
- 150000004714 phosphonium salts Chemical class 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- LWPWICQRCLMVST-UHFFFAOYSA-N (4-butylphenyl)-(4-methoxyphenyl)imino-oxidoazanium Chemical compound C1=CC(CCCC)=CC=C1[N+]([O-])=NC1=CC=C(OC)C=C1 LWPWICQRCLMVST-UHFFFAOYSA-N 0.000 claims 1
- MCKGGSQKOSKNHA-UHFFFAOYSA-N (4-ethylphenyl)-(4-methoxyphenyl)imino-oxidoazanium Chemical compound C1=CC(CC)=CC=C1[N+]([O-])=NC1=CC=C(OC)C=C1 MCKGGSQKOSKNHA-UHFFFAOYSA-N 0.000 claims 1
- XOYRWKCDSZLZOT-UHFFFAOYSA-N C(C)OC1=CC=C(C=C1)[N+]([O-])=NC1=CC=C(C(=O)O)C=C1 Chemical compound C(C)OC1=CC=C(C=C1)[N+]([O-])=NC1=CC=C(C(=O)O)C=C1 XOYRWKCDSZLZOT-UHFFFAOYSA-N 0.000 claims 1
- 125000005605 benzo group Chemical group 0.000 claims 1
- 229940037201 oris Drugs 0.000 claims 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 1
- 239000011521 glass Substances 0.000 description 13
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 150000001629 stilbenes Chemical class 0.000 description 4
- JTTNHFBAKVNVQB-UHFFFAOYSA-N (4-carboxyphenyl)imino-(4-methoxyphenyl)-oxidoazanium Chemical compound C1=CC(OC)=CC=C1[N+]([O-])=NC1=CC=C(C(O)=O)C=C1 JTTNHFBAKVNVQB-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 3
- GAUZCKBSTZFWCT-UHFFFAOYSA-N azoxybenzene Chemical class C=1C=CC=CC=1[N+]([O-])=NC1=CC=CC=C1 GAUZCKBSTZFWCT-UHFFFAOYSA-N 0.000 description 3
- 125000000649 benzylidene group Chemical class [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 235000013985 cinnamic acid Nutrition 0.000 description 3
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid group Chemical class C(C=CC1=CC=CC=C1)(=O)O WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000004973 liquid crystal related substance Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000021286 stilbenes Nutrition 0.000 description 3
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 150000003935 benzaldehydes Chemical class 0.000 description 2
- JRXXLCKWQFKACW-UHFFFAOYSA-N biphenylacetylene Chemical class C1=CC=CC=C1C#CC1=CC=CC=C1 JRXXLCKWQFKACW-UHFFFAOYSA-N 0.000 description 2
- 230000003098 cholesteric effect Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 150000002832 nitroso derivatives Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000001564 phenyl benzoates Chemical class 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- JADPEWPCRDLJQM-UHFFFAOYSA-N (4-butylphenyl) benzoate Chemical compound C1=CC(CCCC)=CC=C1OC(=O)C1=CC=CC=C1 JADPEWPCRDLJQM-UHFFFAOYSA-N 0.000 description 1
- SDRMKDDTXNQKSU-UHFFFAOYSA-N (4-methoxyphenyl) 4-butanoyloxybenzoate Chemical compound C1=CC(OC(=O)CCC)=CC=C1C(=O)OC1=CC=C(OC)C=C1 SDRMKDDTXNQKSU-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- SPHVZQKQCZKQGX-UHFFFAOYSA-N 1-butylcyclohexa-2,4-dien-1-amine Chemical compound CCCCC1(N)CC=CC=C1 SPHVZQKQCZKQGX-UHFFFAOYSA-N 0.000 description 1
- WHKXKUJYCQCFGW-UHFFFAOYSA-N 3-(4-decanoyloxyphenyl)prop-2-enoic acid Chemical compound C(CCCCCCCCC)(=O)OC1=CC=C(C=CC(=O)O)C=C1 WHKXKUJYCQCFGW-UHFFFAOYSA-N 0.000 description 1
- ZQZOVFQJZLBPET-UHFFFAOYSA-N 3-(4-octadecoxyphenyl)prop-2-enoic acid Chemical compound CCCCCCCCCCCCCCCCCCOC1=CC=C(C=CC(O)=O)C=C1 ZQZOVFQJZLBPET-UHFFFAOYSA-N 0.000 description 1
- ROJSHRRZPUIDTL-UHFFFAOYSA-N 4-(4-butoxybenzoyl)oxybenzoic acid Chemical compound C1=CC(OCCCC)=CC=C1C(=O)OC1=CC=C(C(O)=O)C=C1 ROJSHRRZPUIDTL-UHFFFAOYSA-N 0.000 description 1
- OXPZAJCHZHFVJF-UHFFFAOYSA-N 4-(4-heptoxybenzoyl)oxybenzoic acid Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=O)OC1=CC=C(C(O)=O)C=C1 OXPZAJCHZHFVJF-UHFFFAOYSA-N 0.000 description 1
- FDCMZOYSEHNDCP-UHFFFAOYSA-N 4-(4-methoxybenzoyl)oxybenzoic acid Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=C(C(O)=O)C=C1 FDCMZOYSEHNDCP-UHFFFAOYSA-N 0.000 description 1
- DKXFKIBLLRRYGF-UHFFFAOYSA-N 4-[(4-pentoxyphenyl)diazenyl]benzoic acid Chemical compound C1=CC(OCCCCC)=CC=C1N=NC1=CC=C(C(O)=O)C=C1 DKXFKIBLLRRYGF-UHFFFAOYSA-N 0.000 description 1
- BYHBHNKBISXCEP-QPJJXVBHSA-N 4-acetoxycinnamic acid Chemical compound CC(=O)OC1=CC=C(\C=C\C(O)=O)C=C1 BYHBHNKBISXCEP-QPJJXVBHSA-N 0.000 description 1
- AFWLZUDFOYMCBF-UHFFFAOYSA-N 4-butanoyloxybenzoic acid Chemical compound CCCC(=O)OC1=CC=C(C(O)=O)C=C1 AFWLZUDFOYMCBF-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- OZPPUPJQRJYTNY-UHFFFAOYSA-N 4-pentoxybenzoic acid Chemical compound CCCCCOC1=CC=C(C(O)=O)C=C1 OZPPUPJQRJYTNY-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229920002160 Celluloid Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000723347 Cinnamomum Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- 239000004988 Nematic liquid crystal Substances 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- 150000001559 benzoic acids Chemical group 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000003446 memory effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- DNYZBFWKVMKMRM-UHFFFAOYSA-N n-benzhydrylidenehydroxylamine Chemical class C=1C=CC=CC=1C(=NO)C1=CC=CC=C1 DNYZBFWKVMKMRM-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- BYHBHNKBISXCEP-UHFFFAOYSA-N p-acetoxy-cinnamic acid Natural products CC(=O)OC1=CC=C(C=CC(O)=O)C=C1 BYHBHNKBISXCEP-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical group 0.000 description 1
- OZHURMZGJMUOGP-UHFFFAOYSA-N phenyl 3-phenylprop-2-ynoate Chemical class C=1C=CC=CC=1C#CC(=O)OC1=CC=CC=C1 OZHURMZGJMUOGP-UHFFFAOYSA-N 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- YFZDLRVCXDBOPH-UHFFFAOYSA-N tetraheptylazanium Chemical compound CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC YFZDLRVCXDBOPH-UHFFFAOYSA-N 0.000 description 1
- DTIFFPXSSXFQCJ-UHFFFAOYSA-N tetrahexylazanium Chemical compound CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC DTIFFPXSSXFQCJ-UHFFFAOYSA-N 0.000 description 1
- GJSGYPDDPQRWPK-UHFFFAOYSA-N tetrapentylammonium Chemical compound CCCCC[N+](CCCCC)(CCCCC)CCCCC GJSGYPDDPQRWPK-UHFFFAOYSA-N 0.000 description 1
- USFPINLPPFWTJW-UHFFFAOYSA-N tetraphenylphosphonium Chemical compound C1=CC=CC=C1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 USFPINLPPFWTJW-UHFFFAOYSA-N 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N trans-stilbene Chemical class C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- PMJCFMOHKYAWDN-UHFFFAOYSA-N tributyl(octadecyl)phosphanium Chemical compound CCCCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC PMJCFMOHKYAWDN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/52—Liquid crystal materials characterised by components which are not liquid crystals, e.g. additives with special physical aspect: solvents, solid particles
- C09K19/54—Additives having no specific mesophase characterised by their chemical composition
- C09K19/56—Aligning agents
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal Substances (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE795849D BE795849A (fr) | 1972-02-26 | Phases nematiques modifiees | |
| DE2209127A DE2209127A1 (de) | 1972-02-26 | 1972-02-26 | Modifizierte nematische phasen |
| GB399573A GB1376115A (en) | 1972-02-26 | 1973-01-26 | Nematogenic compositions |
| IL41423A IL41423A (en) | 1972-02-26 | 1973-01-30 | Modified nematic phases |
| NL7301300A NL7301300A (cg-RX-API-DMAC10.html) | 1972-02-26 | 1973-01-30 | |
| CH245573A CH585256A5 (cg-RX-API-DMAC10.html) | 1972-02-26 | 1973-02-21 | |
| AT164173A AT326191B (de) | 1972-02-26 | 1973-02-23 | Modifizierte nematische phasen |
| SU1888507A SU469264A3 (ru) | 1972-02-26 | 1973-02-23 | Способ получени нормальных слоев нематических жидких кристаллов |
| DD169051A DD106762A5 (cg-RX-API-DMAC10.html) | 1972-02-26 | 1973-02-26 | |
| IT20854/73A IT979477B (it) | 1972-02-26 | 1973-02-26 | Fasi nematiche modificate |
| FR7306674A FR2173301B1 (cg-RX-API-DMAC10.html) | 1972-02-26 | 1973-02-26 | |
| JP48022292A JPS4899085A (cg-RX-API-DMAC10.html) | 1972-02-26 | 1973-02-26 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2209127A DE2209127A1 (de) | 1972-02-26 | 1972-02-26 | Modifizierte nematische phasen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2209127A1 true DE2209127A1 (de) | 1973-09-06 |
Family
ID=5837180
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2209127A Pending DE2209127A1 (de) | 1972-02-26 | 1972-02-26 | Modifizierte nematische phasen |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS4899085A (cg-RX-API-DMAC10.html) |
| AT (1) | AT326191B (cg-RX-API-DMAC10.html) |
| BE (1) | BE795849A (cg-RX-API-DMAC10.html) |
| CH (1) | CH585256A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD106762A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2209127A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2173301B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1376115A (cg-RX-API-DMAC10.html) |
| IL (1) | IL41423A (cg-RX-API-DMAC10.html) |
| IT (1) | IT979477B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7301300A (cg-RX-API-DMAC10.html) |
| SU (1) | SU469264A3 (cg-RX-API-DMAC10.html) |
Cited By (171)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2918775A1 (de) | 1979-05-10 | 1980-11-20 | Merck Patent Gmbh | Diketone, verfahren zu ihrer herstellung und ihre verwendung als komponenten fluessigkristalliner dielektrika |
| EP0154849A2 (de) | 1984-02-27 | 1985-09-18 | MERCK PATENT GmbH | Cyclohexanderivate |
| WO1987004158A2 (fr) | 1986-01-03 | 1987-07-16 | MERCK Patent Gesellschaft mit beschränkter Haftung | Composes heterocycliques utilises comme composants de phases de cristaux liquides |
| EP0361532A2 (de) | 1986-01-20 | 1990-04-04 | MERCK PATENT GmbH | Ethanderivate |
| US6740369B2 (en) | 2001-07-31 | 2004-05-25 | Merck Patent Gmbh | Liquid-crystalline medium |
| DE102008006875A1 (de) | 2007-02-13 | 2008-08-14 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102008005751A1 (de) | 2007-02-19 | 2008-08-21 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102008031518A1 (de) | 2007-07-30 | 2009-02-05 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102008036808A1 (de) | 2007-08-15 | 2009-02-19 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2031040A1 (de) | 2007-08-30 | 2009-03-04 | Merck Patent GmbH | Flüssigkristallines Medium |
| DE102008035718A1 (de) | 2007-08-29 | 2009-03-05 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102008036248A1 (de) | 2007-08-30 | 2009-03-05 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2033707A1 (de) | 2007-09-07 | 2009-03-11 | MERCK PATENT GmbH | Verfahren zur Herstellung einer homogenen flüssigen Mischung |
| DE102008035889A1 (de) | 2007-08-30 | 2009-03-19 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102008050375A1 (de) | 2007-10-22 | 2009-04-23 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2065361A2 (de) | 2007-11-30 | 2009-06-03 | Merck Patent GmbH | Polymerisierbare Verbindungen |
| DE102009011652A1 (de) | 2008-03-25 | 2009-10-01 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2182046A1 (en) | 2008-10-30 | 2010-05-05 | Merck Patent GmbH | Liquid-crystalline medium and liquid crystal display |
| DE102009043436A1 (de) | 2008-10-29 | 2010-05-06 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2199363A2 (de) | 2004-07-02 | 2010-06-23 | Merck Patent GmbH | Flüssigkristallines Medium |
| DE102009055829A1 (de) | 2008-12-22 | 2010-06-24 | Merck Patent Gmbh | Flüssigkristallanzeige |
| WO2010072370A1 (de) | 2008-12-22 | 2010-07-01 | Merck Patent Gmbh | Flüssigkristallines medium |
| WO2010089092A1 (de) | 2009-02-06 | 2010-08-12 | Merck Patent Gmbh | Flüssigkristallines medium und flüssigkristallanzeige |
| EP2243812A2 (de) | 2009-04-23 | 2010-10-27 | Merck Patent GmbH | Flüssigkristallanzeige |
| EP2251397A2 (de) | 2002-04-12 | 2010-11-17 | Merck Patent GmbH | Flüssigkristallmedium und dieses enthaltende elektrooptische Anzeige |
| DE102009022309A1 (de) | 2009-05-22 | 2010-11-25 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2292720A1 (en) | 2009-09-08 | 2011-03-09 | Merck Patent GmbH | Liquid-crystal display |
| WO2011035842A1 (de) | 2009-09-28 | 2011-03-31 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| DE102010047409A1 (de) | 2009-10-28 | 2011-05-05 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallanzeigen |
| DE102011009691A1 (de) | 2010-02-09 | 2011-08-11 | Merck Patent GmbH, 64293 | Flüssigkristallines Medium |
| DE102011010851A1 (de) | 2010-03-04 | 2011-09-08 | Merck Patent Gmbh | Flüssigkristallines Medium |
| WO2011110287A1 (de) | 2010-03-09 | 2011-09-15 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallmedien und flüssigkristallanzeigen |
| EP2380945A1 (de) | 2010-04-26 | 2011-10-26 | Merck Patent GmbH | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallmedien und Flüssigkristallanzeigen |
| WO2011160764A1 (de) | 2010-06-25 | 2011-12-29 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| WO2011160765A1 (de) | 2010-06-25 | 2011-12-29 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| DE102011105930A1 (de) | 2010-07-21 | 2012-01-26 | Merck Patent Gmbh | Polymerisierbare Mischungen und ihre Verwendung in Flüssigkristallanzeigen |
| WO2012055473A1 (en) | 2010-10-26 | 2012-05-03 | Merck Patent Gmbh | Liquid-crystal medium and process for preparing a liquid-crystal device |
| WO2012079710A1 (de) | 2010-12-17 | 2012-06-21 | Merck Patent Gmbh | Flüssigkristallines medium |
| WO2012097858A1 (en) | 2011-01-20 | 2012-07-26 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| DE102012003796A1 (de) | 2011-03-18 | 2012-09-20 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102012004871A1 (de) | 2011-03-29 | 2012-10-04 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2508588A2 (en) | 2011-04-07 | 2012-10-10 | Merck Patent GmbH | Liquid-crystalline medium and liquid-crystal display |
| DE102012009631A1 (de) | 2011-05-27 | 2012-11-29 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallmedien und Flüssigkristallanzeigen |
| WO2013004372A1 (en) | 2011-07-07 | 2013-01-10 | Merck Patent Gmbh | Liquid-crystalline medium |
| DE102012024126A1 (de) | 2011-12-20 | 2013-06-20 | Merck Patent Gmbh | Flüssigkristallines Medium |
| WO2013124040A1 (en) | 2012-02-22 | 2013-08-29 | Merck Patent Gmbh | Liquid crystalline medium |
| WO2013178333A1 (en) | 2012-06-02 | 2013-12-05 | Merck Patent Gmbh | Liquid crystal medium |
| EP2682448A2 (en) | 2012-07-05 | 2014-01-08 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2014079517A1 (en) | 2012-11-21 | 2014-05-30 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| US8778466B2 (en) | 2006-10-12 | 2014-07-15 | Merck Patent Gmbh | Liquid-crystal display |
| EP2818531A1 (en) | 2013-06-25 | 2014-12-31 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP2848676A2 (en) | 2013-09-12 | 2015-03-18 | Merck Patent GmbH | Liquid crystal medium |
| DE102013018094A1 (de) | 2013-12-03 | 2015-06-03 | Merck Patent Gmbh | Mischvorrichtung und deren Verwendung |
| DE102013020400A1 (de) | 2013-12-10 | 2015-06-11 | Merck Patent Gmbh | Reinigungsvorrichtung |
| EP2883934A1 (en) | 2013-12-16 | 2015-06-17 | Merck Patent GmbH | Liquid-crystalline medium |
| DE102013020638A1 (de) | 2013-12-16 | 2015-06-18 | Merck Patent Gmbh | Abfüllvorrichtung und deren Verwendung zur Abfüllung eines Fluids |
| DE102013021279A1 (de) | 2013-12-18 | 2015-06-18 | Merck Patent Gmbh | Verfahren zum Reinigen einer Flüssigkristallmischung |
| EP2886627A1 (de) | 2013-12-19 | 2015-06-24 | Merck Patent GmbH | Flüssigkristallines Medium |
| EP2896678A1 (en) | 2014-01-21 | 2015-07-22 | Merck Patent GmbH | Liquid crystal display |
| DE102015003411A1 (de) | 2014-03-17 | 2015-09-17 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2921545A2 (en) | 2014-03-21 | 2015-09-23 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| DE102015004479A1 (de) | 2014-04-22 | 2015-10-22 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102015006246A1 (de) | 2014-05-27 | 2015-12-03 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102015006621A1 (de) | 2014-06-17 | 2015-12-17 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2980062A2 (en) | 2014-07-30 | 2016-02-03 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP2985334A1 (en) | 2014-08-15 | 2016-02-17 | Merck Patent GmbH | Liquid-crystalline medium |
| DE102015009924A1 (de) | 2014-08-22 | 2016-02-25 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2990461A1 (en) | 2014-08-25 | 2016-03-02 | Merck Patent GmbH | Liquid crystal medium |
| EP2990459A1 (en) | 2014-08-25 | 2016-03-02 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3020785A1 (en) | 2014-11-14 | 2016-05-18 | Merck Patent GmbH | Liquid crystal medium |
| DE102015014955A1 (de) | 2014-11-25 | 2016-05-25 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3029127A1 (en) | 2014-12-01 | 2016-06-08 | Merck Patent GmbH | Liquid crystal medium |
| DE102015015108A1 (de) | 2014-12-17 | 2016-06-23 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3048159A1 (en) | 2015-01-22 | 2016-07-27 | Merck Patent GmbH | Liquid crystal medium |
| EP3067406A1 (de) | 2015-03-10 | 2016-09-14 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3067405A1 (de) | 2015-03-10 | 2016-09-14 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3103855A1 (en) | 2015-06-11 | 2016-12-14 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2016206772A1 (en) | 2015-06-26 | 2016-12-29 | Merck Patent Gmbh | Liquid crystal medium containing polymerisable compounds |
| WO2016206774A1 (en) | 2015-06-26 | 2016-12-29 | Merck Patent Gmbh | Liquid crystal medium containing polymerisable compounds |
| EP3112440A1 (en) | 2015-07-02 | 2017-01-04 | Merck Patent GmbH | Liquid-crystal medium |
| EP3121247A1 (en) | 2015-06-09 | 2017-01-25 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3130650A1 (en) | 2015-08-10 | 2017-02-15 | Merck Patent GmbH | Liquid-crystalline medium |
| EP3162875A1 (en) | 2015-10-30 | 2017-05-03 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2017071793A1 (en) | 2015-10-30 | 2017-05-04 | Merck Patent Gmbh | Liquid-crystal medium |
| EP3214154A1 (en) | 2016-03-01 | 2017-09-06 | Merck Patent GmbH | Liquid-crystal media and light modulation element |
| EP3235894A2 (de) | 2016-04-21 | 2017-10-25 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3246377A1 (en) | 2016-05-18 | 2017-11-22 | Merck Patent GmbH | Liquid-crystal medium |
| EP3246374A2 (en) | 2016-05-19 | 2017-11-22 | Merck Patent GmbH | Liquid-crystal medium |
| EP3263673A1 (en) | 2016-06-30 | 2018-01-03 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2018015323A2 (en) | 2016-07-20 | 2018-01-25 | Merck Patent Gmbh | Switching layer for use in an optical switching element |
| EP3284803A1 (en) | 2016-08-12 | 2018-02-21 | Merck Patent GmbH | Liquid-crystal medium |
| WO2018046421A1 (en) | 2016-09-07 | 2018-03-15 | Merck Patent Gmbh | Liquid-crystal media and light modulation element |
| WO2018073158A1 (en) | 2016-10-19 | 2018-04-26 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2018073159A2 (en) | 2016-10-19 | 2018-04-26 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2018073160A1 (en) | 2016-10-19 | 2018-04-26 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP3333243A1 (en) | 2016-12-08 | 2018-06-13 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2018153838A1 (en) | 2017-02-21 | 2018-08-30 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2018162454A1 (en) | 2017-03-09 | 2018-09-13 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3375844A1 (en) | 2017-03-16 | 2018-09-19 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2018206538A1 (en) | 2017-05-11 | 2018-11-15 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2018219841A1 (de) | 2017-05-30 | 2018-12-06 | Merck Patent Gmbh | Flüssigkristallines medium |
| WO2019025398A1 (en) | 2017-08-02 | 2019-02-07 | Merck Patent Gmbh | LIQUID CRYSTAL MEDIUM |
| WO2019063585A1 (en) | 2017-09-29 | 2019-04-04 | Merck Patent Gmbh | POLYMERIZABLE COMPOUNDS AND THEIR USE IN LIQUID CRYSTAL DISPLAY DEVICES |
| WO2019092231A1 (de) | 2017-11-13 | 2019-05-16 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP3489329A1 (de) | 2017-11-24 | 2019-05-29 | Merck Patent GmbH | Flüssigkristallines medium |
| WO2019110636A1 (en) | 2017-12-08 | 2019-06-13 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2019110473A1 (en) | 2017-12-04 | 2019-06-13 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2019115485A1 (en) | 2017-12-14 | 2019-06-20 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP3502210A1 (en) | 2017-12-20 | 2019-06-26 | Merck Patent GmbH | Liquid-crystal medium |
| WO2019121648A1 (en) | 2017-12-22 | 2019-06-27 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2019154740A1 (en) | 2018-02-06 | 2019-08-15 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2019233913A1 (en) | 2018-06-04 | 2019-12-12 | Merck Patent Gmbh | Liquid-crystal medium |
| DE102019003615A1 (de) | 2018-06-21 | 2019-12-24 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP3604481A1 (en) | 2018-07-31 | 2020-02-05 | Merck Patent GmbH | Liquid-crystal medium |
| WO2020048946A1 (en) | 2018-09-06 | 2020-03-12 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3628721A1 (en) | 2018-09-27 | 2020-04-01 | Merck Patent GmbH | Liquid-crystal medium |
| WO2020083807A1 (en) | 2018-10-25 | 2020-04-30 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2020094540A1 (en) | 2018-11-07 | 2020-05-14 | Merck Patent Gmbh | Liquid crystal media comprising polymerisable compounds |
| EP3666853A1 (en) | 2018-12-10 | 2020-06-17 | Merck Patent GmbH | Liquid-crystal medium |
| WO2020127528A1 (en) | 2018-12-20 | 2020-06-25 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2020165394A1 (en) | 2019-02-15 | 2020-08-20 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3730591A1 (en) | 2019-04-26 | 2020-10-28 | Merck Patent GmbH | Liquid-crystal medium |
| EP3757192A1 (en) | 2019-06-28 | 2020-12-30 | Merck Patent GmbH | Liquid crystalline medium |
| WO2021037877A1 (en) | 2019-08-30 | 2021-03-04 | Merck Patent Gmbh | Lc medium |
| EP3789470A1 (en) | 2018-09-06 | 2021-03-10 | Merck Patent GmbH | Liquid crystal media comprising polymerisable compounds |
| EP3816264A1 (en) | 2018-10-31 | 2021-05-05 | Merck Patent GmbH | Liquid crystal media comprising polymerisable compounds |
| EP3848436A1 (en) | 2020-01-07 | 2021-07-14 | Merck Patent GmbH | Liquid-crystal medium |
| WO2021148421A1 (en) | 2020-01-23 | 2021-07-29 | Merck Patent Gmbh | Liquid-crystal medium |
| EP3892706A2 (en) | 2020-04-09 | 2021-10-13 | Merck Patent GmbH | Liquid-crystalline medium |
| EP3926023A1 (en) | 2020-06-10 | 2021-12-22 | Merck Patent GmbH | Liquid crystal media comprising polymerizable compounds |
| EP3944011A1 (en) | 2018-08-07 | 2022-01-26 | Merck Patent GmbH | Liquid-crystal display |
| EP3985085A2 (en) | 2020-10-19 | 2022-04-20 | Merck Patent GmbH | Liquid-crystal medium |
| WO2022084168A1 (en) | 2020-10-19 | 2022-04-28 | Merck Patent Gmbh | 4,6-difluorodibenzothiophene derivatives and liquid-crystal medium containing these |
| WO2022096483A1 (en) | 2020-11-06 | 2022-05-12 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| WO2022101151A1 (en) | 2020-11-12 | 2022-05-19 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| EP4001378A1 (en) | 2020-11-17 | 2022-05-25 | Merck Patent GmbH | Liquid-crystal medium |
| WO2022136231A1 (en) | 2020-12-22 | 2022-06-30 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2022184604A1 (en) | 2021-03-02 | 2022-09-09 | Merck Patent Gmbh | Liquid-crystal medium |
| EP4086325A1 (en) | 2021-05-04 | 2022-11-09 | Merck Patent GmbH | Dye-doped liquid-crystal medium comprising polymerizable compounds |
| WO2023066953A1 (en) | 2021-10-20 | 2023-04-27 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| WO2023094404A1 (en) | 2021-11-24 | 2023-06-01 | Merck Patent Gmbh | Liquid crystal medium and liquid crystal display |
| EP4194529A1 (en) | 2021-12-10 | 2023-06-14 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
| EP4249570A1 (en) | 2022-03-21 | 2023-09-27 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2023198673A1 (en) | 2022-04-12 | 2023-10-19 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2023198669A1 (en) | 2022-04-12 | 2023-10-19 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2023198671A1 (en) | 2022-04-12 | 2023-10-19 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2023203043A1 (en) | 2022-04-22 | 2023-10-26 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2023209049A1 (en) | 2022-04-29 | 2023-11-02 | Merck Patent Gmbh | Liquid-crystal medium |
| EP4286493A1 (en) | 2022-06-02 | 2023-12-06 | Merck Patent GmbH | Liquid-crystal medium |
| EP4299694A1 (en) | 2022-07-01 | 2024-01-03 | Merck Patent GmbH | Liquid-crystal medium |
| EP4306614A1 (en) | 2022-07-15 | 2024-01-17 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4357438A1 (en) | 2022-10-19 | 2024-04-24 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
| EP4382586A1 (en) | 2022-12-07 | 2024-06-12 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2024126567A1 (en) | 2022-12-16 | 2024-06-20 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2024132893A1 (en) | 2022-12-19 | 2024-06-27 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP4400561A1 (en) | 2023-01-12 | 2024-07-17 | Merck Patent GmbH | Liquid-crystal medium |
| WO2024175518A1 (en) | 2023-02-20 | 2024-08-29 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2024189051A1 (en) | 2023-03-16 | 2024-09-19 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2024223484A1 (en) | 2023-04-24 | 2024-10-31 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compound |
| EP4516879A1 (en) | 2023-08-29 | 2025-03-05 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4527907A1 (en) | 2023-09-19 | 2025-03-26 | Merck Patent GmbH | Liquid-crystal medium |
| WO2025068290A1 (en) | 2023-09-28 | 2025-04-03 | Merck Patent Gmbh | Liquid-crystal display |
| EP4538349A1 (en) | 2023-10-13 | 2025-04-16 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4563674A1 (en) | 2023-11-29 | 2025-06-04 | Merck Patent GmbH | Liquid-crystal medium |
| EP4574923A1 (en) | 2023-12-19 | 2025-06-25 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4574924A1 (en) | 2023-12-21 | 2025-06-25 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
| EP4582510A1 (en) | 2024-01-05 | 2025-07-09 | Merck Patent GmbH | Liquid-crystal medium |
| EP4610332A1 (en) | 2024-02-29 | 2025-09-03 | Merck Patent GmbH | Liquid-crystal medium |
| WO2025190996A1 (en) | 2024-03-15 | 2025-09-18 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2025219502A1 (en) | 2024-04-19 | 2025-10-23 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP4656703A1 (en) | 2024-05-28 | 2025-12-03 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS498262A (cg-RX-API-DMAC10.html) * | 1972-05-11 | 1974-01-24 | ||
| JPS4986279A (cg-RX-API-DMAC10.html) * | 1972-12-23 | 1974-08-19 | ||
| JPS6024152B2 (ja) * | 1976-12-28 | 1985-06-11 | シャープ株式会社 | 液晶組成物 |
| DE2832112C2 (de) * | 1978-07-21 | 1985-06-05 | Merck Patent Gmbh, 6100 Darmstadt | Flüssigkristallines Dielektrikum |
| US4528114A (en) * | 1981-12-18 | 1985-07-09 | Hoffmann-La Roche Inc. | Acetylenes |
| US4577931A (en) * | 1982-05-26 | 1986-03-25 | Epson Corporation | Liquid crystal composition |
| US7217445B2 (en) * | 2003-12-15 | 2007-05-15 | Nitto Denko Corporation | Aligned liquid crystal layer containing Lewis acids and process for increasing the tilt |
| US20070003709A1 (en) * | 2005-06-29 | 2007-01-04 | Nano Loa, Inc. | Liquid crystal display device |
| EP1764405A1 (en) * | 2005-09-20 | 2007-03-21 | Rolic AG | Functionalized photoreactive compounds |
| US20130004887A1 (en) * | 2011-06-29 | 2013-01-03 | Sabic Innovative Plastics Ip B.V. | Holographic recording medium |
-
0
- BE BE795849D patent/BE795849A/xx unknown
-
1972
- 1972-02-26 DE DE2209127A patent/DE2209127A1/de active Pending
-
1973
- 1973-01-26 GB GB399573A patent/GB1376115A/en not_active Expired
- 1973-01-30 NL NL7301300A patent/NL7301300A/xx unknown
- 1973-01-30 IL IL41423A patent/IL41423A/en unknown
- 1973-02-21 CH CH245573A patent/CH585256A5/xx not_active IP Right Cessation
- 1973-02-23 SU SU1888507A patent/SU469264A3/ru active
- 1973-02-23 AT AT164173A patent/AT326191B/de not_active IP Right Cessation
- 1973-02-26 JP JP48022292A patent/JPS4899085A/ja active Pending
- 1973-02-26 IT IT20854/73A patent/IT979477B/it active
- 1973-02-26 DD DD169051A patent/DD106762A5/xx unknown
- 1973-02-26 FR FR7306674A patent/FR2173301B1/fr not_active Expired
Cited By (230)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2918775A1 (de) | 1979-05-10 | 1980-11-20 | Merck Patent Gmbh | Diketone, verfahren zu ihrer herstellung und ihre verwendung als komponenten fluessigkristalliner dielektrika |
| EP0154849A2 (de) | 1984-02-27 | 1985-09-18 | MERCK PATENT GmbH | Cyclohexanderivate |
| WO1987004158A2 (fr) | 1986-01-03 | 1987-07-16 | MERCK Patent Gesellschaft mit beschränkter Haftung | Composes heterocycliques utilises comme composants de phases de cristaux liquides |
| EP0361532A2 (de) | 1986-01-20 | 1990-04-04 | MERCK PATENT GmbH | Ethanderivate |
| US6740369B2 (en) | 2001-07-31 | 2004-05-25 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP2251397A2 (de) | 2002-04-12 | 2010-11-17 | Merck Patent GmbH | Flüssigkristallmedium und dieses enthaltende elektrooptische Anzeige |
| EP2199363A2 (de) | 2004-07-02 | 2010-06-23 | Merck Patent GmbH | Flüssigkristallines Medium |
| EP2208773A2 (de) | 2004-07-02 | 2010-07-21 | Merck Patent GmbH | Flüssigkristallines Medium |
| EP2208774A2 (de) | 2004-07-02 | 2010-07-21 | Merck Patent GmbH | Flüssigkristallines Medium |
| US8778466B2 (en) | 2006-10-12 | 2014-07-15 | Merck Patent Gmbh | Liquid-crystal display |
| EP1958999A1 (de) | 2007-02-13 | 2008-08-20 | MERCK PATENT GmbH | Flüssigkristallines Medium |
| DE102008006875A1 (de) | 2007-02-13 | 2008-08-14 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102008005751A1 (de) | 2007-02-19 | 2008-08-21 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102008031518A1 (de) | 2007-07-30 | 2009-02-05 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102008036808A1 (de) | 2007-08-15 | 2009-02-19 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102008035718A1 (de) | 2007-08-29 | 2009-03-05 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102008035889A1 (de) | 2007-08-30 | 2009-03-19 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2031040A1 (de) | 2007-08-30 | 2009-03-04 | Merck Patent GmbH | Flüssigkristallines Medium |
| DE102008036248A1 (de) | 2007-08-30 | 2009-03-05 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102008035890A1 (de) | 2007-08-30 | 2009-03-05 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2033707A1 (de) | 2007-09-07 | 2009-03-11 | MERCK PATENT GmbH | Verfahren zur Herstellung einer homogenen flüssigen Mischung |
| DE102008039745A1 (de) | 2007-09-07 | 2009-03-12 | Merck Patent Gmbh | Verfahren zur Herstellung einer homogenen flüssigen Mischung |
| DE102008050375A1 (de) | 2007-10-22 | 2009-04-23 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2065361A2 (de) | 2007-11-30 | 2009-06-03 | Merck Patent GmbH | Polymerisierbare Verbindungen |
| DE102008056221A1 (de) | 2007-11-30 | 2009-06-04 | Merck Patent Gmbh | Polymerisierbare Verbindungen |
| DE102009011652A1 (de) | 2008-03-25 | 2009-10-01 | Merck Patent Gmbh | Flüssigkristallanzeige |
| DE102009043436A1 (de) | 2008-10-29 | 2010-05-06 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2182046A1 (en) | 2008-10-30 | 2010-05-05 | Merck Patent GmbH | Liquid-crystalline medium and liquid crystal display |
| WO2010072370A1 (de) | 2008-12-22 | 2010-07-01 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP2677018A2 (de) | 2008-12-22 | 2013-12-25 | Merck Patent GmbH | Flüssigkristallines Medium |
| EP2677019A2 (de) | 2008-12-22 | 2013-12-25 | Merck Patent GmbH | Flüssigkristallines Medium |
| DE102008064171A1 (de) | 2008-12-22 | 2010-07-01 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102009055829A1 (de) | 2008-12-22 | 2010-06-24 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP3246375A1 (de) | 2008-12-22 | 2017-11-22 | Merck Patent GmbH | Flüssigkristallines medium |
| DE102010006691A1 (de) | 2009-02-06 | 2010-10-28 | Merck Patent Gmbh | Flüssigkristallines Medium und Flüssigkristallanzeige |
| WO2010089092A1 (de) | 2009-02-06 | 2010-08-12 | Merck Patent Gmbh | Flüssigkristallines medium und flüssigkristallanzeige |
| EP2484743A2 (de) | 2009-04-23 | 2012-08-08 | Merck Patent GmbH | Flüssigkristallanzeige |
| EP2471892A2 (de) | 2009-04-23 | 2012-07-04 | Merck Patent GmbH | Flüssigkristallanzeige |
| DE102010012900A1 (de) | 2009-04-23 | 2010-11-25 | Merck Patent Gmbh | Flüssigkristallanzeige |
| EP2243812A2 (de) | 2009-04-23 | 2010-10-27 | Merck Patent GmbH | Flüssigkristallanzeige |
| DE102009022309A1 (de) | 2009-05-22 | 2010-11-25 | Merck Patent Gmbh | Flüssigkristallanzeige |
| WO2011029510A1 (en) | 2009-09-08 | 2011-03-17 | Merck Patent Gmbh | Liquid-crystal display |
| EP2540802A2 (en) | 2009-09-08 | 2013-01-02 | Merck Patent GmbH | Liquid-crystel display |
| EP2292720A1 (en) | 2009-09-08 | 2011-03-09 | Merck Patent GmbH | Liquid-crystal display |
| WO2011035842A1 (de) | 2009-09-28 | 2011-03-31 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| DE102010035730A1 (de) | 2009-09-28 | 2011-04-07 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallanzeigen |
| WO2011050893A1 (de) | 2009-10-28 | 2011-05-05 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| DE102010047409A1 (de) | 2009-10-28 | 2011-05-05 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallanzeigen |
| WO2011098224A1 (de) | 2010-02-09 | 2011-08-18 | Merck Patent Gmbh | Flüssigkristallines medium |
| DE102011009691A1 (de) | 2010-02-09 | 2011-08-11 | Merck Patent GmbH, 64293 | Flüssigkristallines Medium |
| WO2011107213A1 (de) | 2010-03-04 | 2011-09-09 | Merck Patent Gmbh | Flüssigkristallines medium |
| DE102011010851A1 (de) | 2010-03-04 | 2011-09-08 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102011011836A1 (de) | 2010-03-09 | 2011-09-15 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallmedien und Flüssigkristallanzeigen |
| WO2011110287A1 (de) | 2010-03-09 | 2011-09-15 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallmedien und flüssigkristallanzeigen |
| EP2380945A1 (de) | 2010-04-26 | 2011-10-26 | Merck Patent GmbH | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallmedien und Flüssigkristallanzeigen |
| DE102011015546A1 (de) | 2010-04-26 | 2012-01-26 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallmedien und Flüssigkristallanzeigen |
| WO2011160765A1 (de) | 2010-06-25 | 2011-12-29 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| DE102011103025A1 (de) | 2010-06-25 | 2012-01-05 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallanzeigen |
| DE102011103182A1 (de) | 2010-06-25 | 2011-12-29 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallanzeigen |
| WO2011160764A1 (de) | 2010-06-25 | 2011-12-29 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallanzeigen |
| WO2012022391A2 (de) | 2010-07-21 | 2012-02-23 | Merck Patent Gmbh | Polymerisierbare mischungen und ihre verwendung in flüssigkristallanzeigen |
| DE102011105930A1 (de) | 2010-07-21 | 2012-01-26 | Merck Patent Gmbh | Polymerisierbare Mischungen und ihre Verwendung in Flüssigkristallanzeigen |
| WO2012055473A1 (en) | 2010-10-26 | 2012-05-03 | Merck Patent Gmbh | Liquid-crystal medium and process for preparing a liquid-crystal device |
| DE102011120112A1 (de) | 2010-12-17 | 2012-06-21 | Merck Patent Gmbh | Flüssigkristallines Medium |
| WO2012079710A1 (de) | 2010-12-17 | 2012-06-21 | Merck Patent Gmbh | Flüssigkristallines medium |
| WO2012097858A1 (en) | 2011-01-20 | 2012-07-26 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2012126562A1 (de) | 2011-03-18 | 2012-09-27 | Merck Patent Gmbh | Flüssigkristallines medium |
| DE102012003796A1 (de) | 2011-03-18 | 2012-09-20 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3257916A1 (de) | 2011-03-29 | 2017-12-20 | Merck Patent GmbH | Flüssigkristallines medium |
| DE102012004871A1 (de) | 2011-03-29 | 2012-10-04 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3260518A1 (de) | 2011-03-29 | 2017-12-27 | Merck Patent GmbH | Flüssigkristallines medium |
| WO2012130380A1 (de) | 2011-03-29 | 2012-10-04 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP2508588A2 (en) | 2011-04-07 | 2012-10-10 | Merck Patent GmbH | Liquid-crystalline medium and liquid-crystal display |
| WO2012163478A1 (de) | 2011-05-27 | 2012-12-06 | Merck Patent Gmbh | Polymerisierbare verbindungen und ihre verwendung in flüssigkristallmedien und flüssigkristallanzeigen |
| DE102012009631A1 (de) | 2011-05-27 | 2012-11-29 | Merck Patent Gmbh | Polymerisierbare Verbindungen und ihre Verwendung in Flüssigkristallmedien und Flüssigkristallanzeigen |
| WO2013004372A1 (en) | 2011-07-07 | 2013-01-10 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP2607451A1 (de) | 2011-12-20 | 2013-06-26 | Merck Patent GmbH | Flüssigkristallines Medium |
| DE102012024126A1 (de) | 2011-12-20 | 2013-06-20 | Merck Patent Gmbh | Flüssigkristallines Medium |
| US9982194B2 (en) | 2011-12-20 | 2018-05-29 | Mereck Patent Gmbh | Liquid-crystalline media |
| US10072209B2 (en) | 2011-12-20 | 2018-09-11 | Merck Patent Gmbh | Liquid-crystalline media |
| US11377596B2 (en) | 2011-12-20 | 2022-07-05 | Merck Patent Gmbh | Liquid-crystalline media |
| WO2013124040A1 (en) | 2012-02-22 | 2013-08-29 | Merck Patent Gmbh | Liquid crystalline medium |
| WO2013178333A1 (en) | 2012-06-02 | 2013-12-05 | Merck Patent Gmbh | Liquid crystal medium |
| EP2682448A2 (en) | 2012-07-05 | 2014-01-08 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2014079517A1 (en) | 2012-11-21 | 2014-05-30 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP2818531A1 (en) | 2013-06-25 | 2014-12-31 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP2848676A2 (en) | 2013-09-12 | 2015-03-18 | Merck Patent GmbH | Liquid crystal medium |
| EP2881383A2 (de) | 2013-12-03 | 2015-06-10 | Merck Patent GmbH | Mischvorrichtung und deren Verwendung |
| DE102013018094A1 (de) | 2013-12-03 | 2015-06-03 | Merck Patent Gmbh | Mischvorrichtung und deren Verwendung |
| DE102013020400A1 (de) | 2013-12-10 | 2015-06-11 | Merck Patent Gmbh | Reinigungsvorrichtung |
| WO2015086125A1 (de) | 2013-12-10 | 2015-06-18 | Merck Patent Gmbh | Reinigungsvorrichtung |
| DE102013020638A1 (de) | 2013-12-16 | 2015-06-18 | Merck Patent Gmbh | Abfüllvorrichtung und deren Verwendung zur Abfüllung eines Fluids |
| EP2883934A1 (en) | 2013-12-16 | 2015-06-17 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2015090565A1 (de) | 2013-12-18 | 2015-06-25 | Merck Patent Gmbh | Verfahren zum reinigen einer flüssigkristallmischung |
| DE102013021279A1 (de) | 2013-12-18 | 2015-06-18 | Merck Patent Gmbh | Verfahren zum Reinigen einer Flüssigkristallmischung |
| DE102013021683A1 (de) | 2013-12-19 | 2015-06-25 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2886627A1 (de) | 2013-12-19 | 2015-06-24 | Merck Patent GmbH | Flüssigkristallines Medium |
| EP2896678A1 (en) | 2014-01-21 | 2015-07-22 | Merck Patent GmbH | Liquid crystal display |
| DE102015003411A1 (de) | 2014-03-17 | 2015-09-17 | Merck Patent Gmbh | Flüssigkristallines Medium |
| WO2015139827A1 (de) | 2014-03-17 | 2015-09-24 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP3677659A1 (de) | 2014-03-17 | 2020-07-08 | Merck Patent GmbH | Flüssigkristallines medium |
| EP2921545A2 (en) | 2014-03-21 | 2015-09-23 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| DE102015004479A1 (de) | 2014-04-22 | 2015-10-22 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2937401A1 (de) | 2014-04-22 | 2015-10-28 | Merck Patent GmbH | Flüssigkristallines medium |
| DE102015006246A1 (de) | 2014-05-27 | 2015-12-03 | Merck Patent Gmbh | Flüssigkristallines Medium |
| DE102015006621A1 (de) | 2014-06-17 | 2015-12-17 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3421569A1 (de) | 2014-06-17 | 2019-01-02 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3428246A1 (de) | 2014-06-17 | 2019-01-16 | Merck Patent GmbH | Flüssigkristallines medium |
| EP2980062A2 (en) | 2014-07-30 | 2016-02-03 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3124465A1 (en) | 2014-07-30 | 2017-02-01 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP2985334A1 (en) | 2014-08-15 | 2016-02-17 | Merck Patent GmbH | Liquid-crystalline medium |
| EP2990460A1 (de) | 2014-08-22 | 2016-03-02 | Merck Patent GmbH | Flüssigkristallines medium |
| DE102015009924A1 (de) | 2014-08-22 | 2016-02-25 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP2990461A1 (en) | 2014-08-25 | 2016-03-02 | Merck Patent GmbH | Liquid crystal medium |
| EP2990459A1 (en) | 2014-08-25 | 2016-03-02 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3372655A1 (en) | 2014-08-25 | 2018-09-12 | Merck Patent GmbH | Liquid-crystal medium |
| EP3020785A1 (en) | 2014-11-14 | 2016-05-18 | Merck Patent GmbH | Liquid crystal medium |
| DE102015014955A1 (de) | 2014-11-25 | 2016-05-25 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3663378A1 (de) | 2014-11-25 | 2020-06-10 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3660128A1 (de) | 2014-11-25 | 2020-06-03 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3029127A1 (en) | 2014-12-01 | 2016-06-08 | Merck Patent GmbH | Liquid crystal medium |
| DE102015015108A1 (de) | 2014-12-17 | 2016-06-23 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3048159A1 (en) | 2015-01-22 | 2016-07-27 | Merck Patent GmbH | Liquid crystal medium |
| EP3067405A1 (de) | 2015-03-10 | 2016-09-14 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3067406A1 (de) | 2015-03-10 | 2016-09-14 | Merck Patent GmbH | Flüssigkristallines medium |
| EP3121247A1 (en) | 2015-06-09 | 2017-01-25 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3103855A1 (en) | 2015-06-11 | 2016-12-14 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2016206774A1 (en) | 2015-06-26 | 2016-12-29 | Merck Patent Gmbh | Liquid crystal medium containing polymerisable compounds |
| WO2016206772A1 (en) | 2015-06-26 | 2016-12-29 | Merck Patent Gmbh | Liquid crystal medium containing polymerisable compounds |
| EP3112440A1 (en) | 2015-07-02 | 2017-01-04 | Merck Patent GmbH | Liquid-crystal medium |
| EP3130650A1 (en) | 2015-08-10 | 2017-02-15 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2017071793A1 (en) | 2015-10-30 | 2017-05-04 | Merck Patent Gmbh | Liquid-crystal medium |
| EP3162875A1 (en) | 2015-10-30 | 2017-05-03 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3214154A1 (en) | 2016-03-01 | 2017-09-06 | Merck Patent GmbH | Liquid-crystal media and light modulation element |
| DE102017002925A1 (de) | 2016-04-21 | 2017-10-26 | Merck Patent Gmbh | Flüssigkristallines Medium |
| EP3235894A2 (de) | 2016-04-21 | 2017-10-25 | Merck Patent GmbH | Flüssigkristallines medium |
| US11453824B2 (en) | 2016-04-21 | 2022-09-27 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP3246377A1 (en) | 2016-05-18 | 2017-11-22 | Merck Patent GmbH | Liquid-crystal medium |
| EP3246374A2 (en) | 2016-05-19 | 2017-11-22 | Merck Patent GmbH | Liquid-crystal medium |
| EP3263673A1 (en) | 2016-06-30 | 2018-01-03 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2018015323A2 (en) | 2016-07-20 | 2018-01-25 | Merck Patent Gmbh | Switching layer for use in an optical switching element |
| EP3284803A1 (en) | 2016-08-12 | 2018-02-21 | Merck Patent GmbH | Liquid-crystal medium |
| WO2018046421A1 (en) | 2016-09-07 | 2018-03-15 | Merck Patent Gmbh | Liquid-crystal media and light modulation element |
| WO2018073158A1 (en) | 2016-10-19 | 2018-04-26 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2018073160A1 (en) | 2016-10-19 | 2018-04-26 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2018073159A2 (en) | 2016-10-19 | 2018-04-26 | Merck Patent Gmbh | Liquid-crystal medium |
| EP3333243A1 (en) | 2016-12-08 | 2018-06-13 | Merck Patent GmbH | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2018153838A1 (en) | 2017-02-21 | 2018-08-30 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2018162454A1 (en) | 2017-03-09 | 2018-09-13 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3375845A1 (en) | 2017-03-16 | 2018-09-19 | Merck Patent GmbH | Liquid-crystalline medium |
| EP3375844A1 (en) | 2017-03-16 | 2018-09-19 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2018206538A1 (en) | 2017-05-11 | 2018-11-15 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2018219841A1 (de) | 2017-05-30 | 2018-12-06 | Merck Patent Gmbh | Flüssigkristallines medium |
| WO2019025398A1 (en) | 2017-08-02 | 2019-02-07 | Merck Patent Gmbh | LIQUID CRYSTAL MEDIUM |
| WO2019063585A1 (en) | 2017-09-29 | 2019-04-04 | Merck Patent Gmbh | POLYMERIZABLE COMPOUNDS AND THEIR USE IN LIQUID CRYSTAL DISPLAY DEVICES |
| WO2019092231A1 (de) | 2017-11-13 | 2019-05-16 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP3489329A1 (de) | 2017-11-24 | 2019-05-29 | Merck Patent GmbH | Flüssigkristallines medium |
| WO2019110473A1 (en) | 2017-12-04 | 2019-06-13 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2019110636A1 (en) | 2017-12-08 | 2019-06-13 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2019115485A1 (en) | 2017-12-14 | 2019-06-20 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP3502210A1 (en) | 2017-12-20 | 2019-06-26 | Merck Patent GmbH | Liquid-crystal medium |
| WO2019121648A1 (en) | 2017-12-22 | 2019-06-27 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2019154740A1 (en) | 2018-02-06 | 2019-08-15 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2019233913A1 (en) | 2018-06-04 | 2019-12-12 | Merck Patent Gmbh | Liquid-crystal medium |
| EP3587536A1 (de) | 2018-06-21 | 2020-01-01 | Merck Patent GmbH | Flüssigkristallines medium |
| DE102019003615A1 (de) | 2018-06-21 | 2019-12-24 | Merck Patent Gmbh | Flüssigkristallines medium |
| EP3604481A1 (en) | 2018-07-31 | 2020-02-05 | Merck Patent GmbH | Liquid-crystal medium |
| EP3944011A1 (en) | 2018-08-07 | 2022-01-26 | Merck Patent GmbH | Liquid-crystal display |
| WO2020048946A1 (en) | 2018-09-06 | 2020-03-12 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3789470A1 (en) | 2018-09-06 | 2021-03-10 | Merck Patent GmbH | Liquid crystal media comprising polymerisable compounds |
| EP3628721A1 (en) | 2018-09-27 | 2020-04-01 | Merck Patent GmbH | Liquid-crystal medium |
| EP4209567A1 (en) | 2018-09-27 | 2023-07-12 | Merck Patent GmbH | Liquid-crystal medium |
| EP4209568A1 (en) | 2018-09-27 | 2023-07-12 | Merck Patent GmbH | Liquid-crystal medium |
| WO2020083807A1 (en) | 2018-10-25 | 2020-04-30 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP3816264A1 (en) | 2018-10-31 | 2021-05-05 | Merck Patent GmbH | Liquid crystal media comprising polymerisable compounds |
| WO2020094540A1 (en) | 2018-11-07 | 2020-05-14 | Merck Patent Gmbh | Liquid crystal media comprising polymerisable compounds |
| EP3666853A1 (en) | 2018-12-10 | 2020-06-17 | Merck Patent GmbH | Liquid-crystal medium |
| WO2020127528A1 (en) | 2018-12-20 | 2020-06-25 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2020165394A1 (en) | 2019-02-15 | 2020-08-20 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| EP3730591A1 (en) | 2019-04-26 | 2020-10-28 | Merck Patent GmbH | Liquid-crystal medium |
| EP3757192A1 (en) | 2019-06-28 | 2020-12-30 | Merck Patent GmbH | Liquid crystalline medium |
| WO2021037877A1 (en) | 2019-08-30 | 2021-03-04 | Merck Patent Gmbh | Lc medium |
| EP3848436A1 (en) | 2020-01-07 | 2021-07-14 | Merck Patent GmbH | Liquid-crystal medium |
| WO2021148421A1 (en) | 2020-01-23 | 2021-07-29 | Merck Patent Gmbh | Liquid-crystal medium |
| EP4428213A1 (en) | 2020-04-09 | 2024-09-11 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4428214A1 (en) | 2020-04-09 | 2024-09-11 | Merck Patent GmbH | Liquid-crystalline medium |
| EP3892706A2 (en) | 2020-04-09 | 2021-10-13 | Merck Patent GmbH | Liquid-crystalline medium |
| EP3926023A1 (en) | 2020-06-10 | 2021-12-22 | Merck Patent GmbH | Liquid crystal media comprising polymerizable compounds |
| EP3985085A2 (en) | 2020-10-19 | 2022-04-20 | Merck Patent GmbH | Liquid-crystal medium |
| WO2022084168A1 (en) | 2020-10-19 | 2022-04-28 | Merck Patent Gmbh | 4,6-difluorodibenzothiophene derivatives and liquid-crystal medium containing these |
| WO2022096483A1 (en) | 2020-11-06 | 2022-05-12 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| US12492344B2 (en) | 2020-11-06 | 2025-12-09 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| WO2022101151A1 (en) | 2020-11-12 | 2022-05-19 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| EP4001378A1 (en) | 2020-11-17 | 2022-05-25 | Merck Patent GmbH | Liquid-crystal medium |
| WO2022136231A1 (en) | 2020-12-22 | 2022-06-30 | Merck Patent Gmbh | Polymerisable compounds and the use thereof in liquid-crystal displays |
| WO2022184604A1 (en) | 2021-03-02 | 2022-09-09 | Merck Patent Gmbh | Liquid-crystal medium |
| EP4086325A1 (en) | 2021-05-04 | 2022-11-09 | Merck Patent GmbH | Dye-doped liquid-crystal medium comprising polymerizable compounds |
| WO2023066953A1 (en) | 2021-10-20 | 2023-04-27 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compounds |
| WO2023094404A1 (en) | 2021-11-24 | 2023-06-01 | Merck Patent Gmbh | Liquid crystal medium and liquid crystal display |
| EP4194529A1 (en) | 2021-12-10 | 2023-06-14 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
| EP4249570A1 (en) | 2022-03-21 | 2023-09-27 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2023198669A1 (en) | 2022-04-12 | 2023-10-19 | Merck Patent Gmbh | Liquid-crystalline medium |
| US12516245B2 (en) | 2022-04-12 | 2026-01-06 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2023198671A1 (en) | 2022-04-12 | 2023-10-19 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2023198673A1 (en) | 2022-04-12 | 2023-10-19 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2023203043A1 (en) | 2022-04-22 | 2023-10-26 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2023209049A1 (en) | 2022-04-29 | 2023-11-02 | Merck Patent Gmbh | Liquid-crystal medium |
| EP4286493A1 (en) | 2022-06-02 | 2023-12-06 | Merck Patent GmbH | Liquid-crystal medium |
| EP4299694A1 (en) | 2022-07-01 | 2024-01-03 | Merck Patent GmbH | Liquid-crystal medium |
| EP4306614A1 (en) | 2022-07-15 | 2024-01-17 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4357438A1 (en) | 2022-10-19 | 2024-04-24 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
| EP4382586A1 (en) | 2022-12-07 | 2024-06-12 | Merck Patent GmbH | Liquid-crystalline medium |
| WO2024126567A1 (en) | 2022-12-16 | 2024-06-20 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2024132893A1 (en) | 2022-12-19 | 2024-06-27 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP4400561A1 (en) | 2023-01-12 | 2024-07-17 | Merck Patent GmbH | Liquid-crystal medium |
| WO2024175518A1 (en) | 2023-02-20 | 2024-08-29 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2024189051A1 (en) | 2023-03-16 | 2024-09-19 | Merck Patent Gmbh | Liquid-crystal medium |
| WO2024223484A1 (en) | 2023-04-24 | 2024-10-31 | Merck Patent Gmbh | Liquid-crystal medium comprising polymerizable compound |
| EP4516879A1 (en) | 2023-08-29 | 2025-03-05 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4527907A1 (en) | 2023-09-19 | 2025-03-26 | Merck Patent GmbH | Liquid-crystal medium |
| WO2025068290A1 (en) | 2023-09-28 | 2025-04-03 | Merck Patent Gmbh | Liquid-crystal display |
| EP4538349A1 (en) | 2023-10-13 | 2025-04-16 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4563674A1 (en) | 2023-11-29 | 2025-06-04 | Merck Patent GmbH | Liquid-crystal medium |
| EP4574923A1 (en) | 2023-12-19 | 2025-06-25 | Merck Patent GmbH | Liquid-crystalline medium |
| EP4574924A1 (en) | 2023-12-21 | 2025-06-25 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
| EP4582510A1 (en) | 2024-01-05 | 2025-07-09 | Merck Patent GmbH | Liquid-crystal medium |
| EP4610332A1 (en) | 2024-02-29 | 2025-09-03 | Merck Patent GmbH | Liquid-crystal medium |
| WO2025190996A1 (en) | 2024-03-15 | 2025-09-18 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2025219502A1 (en) | 2024-04-19 | 2025-10-23 | Merck Patent Gmbh | Liquid-crystalline medium |
| EP4656703A1 (en) | 2024-05-28 | 2025-12-03 | Merck Patent GmbH | Liquid-crystal medium comprising polymerizable compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| IL41423A (en) | 1976-01-30 |
| AT326191B (de) | 1975-11-25 |
| FR2173301A1 (cg-RX-API-DMAC10.html) | 1973-10-05 |
| JPS4899085A (cg-RX-API-DMAC10.html) | 1973-12-15 |
| BE795849A (fr) | 1973-08-23 |
| DD106762A5 (cg-RX-API-DMAC10.html) | 1974-06-20 |
| FR2173301B1 (cg-RX-API-DMAC10.html) | 1976-06-11 |
| NL7301300A (cg-RX-API-DMAC10.html) | 1973-08-28 |
| SU469264A3 (ru) | 1975-04-30 |
| IL41423A0 (en) | 1973-03-30 |
| GB1376115A (en) | 1974-12-04 |
| ATA164173A (de) | 1975-02-15 |
| CH585256A5 (cg-RX-API-DMAC10.html) | 1977-02-28 |
| IT979477B (it) | 1974-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2209127A1 (de) | Modifizierte nematische phasen | |
| DE2639838C2 (cg-RX-API-DMAC10.html) | ||
| DE2814737C2 (cg-RX-API-DMAC10.html) | ||
| DE2348193C3 (de) | Hydrochinonderivate und deren Verwendung als nematische kristallin-flüssige Substanzen | |
| DE2356085C2 (de) | Flüssigkristalline 4'-substituierte 4-Cyanodiphenyle und flüssigkristalline 4"-substituierte 4-Cyanoterphenyle, daraus bestehende flüssigkristalline Materialien und Flüssigkristallgemische und ihre Verwendung | |
| DE2702598A1 (de) | Cyclohexylcyclohexane | |
| DE3627443C2 (cg-RX-API-DMAC10.html) | ||
| DE2636684B2 (de) | Phenylcyclohexanderivate und ihre Verwendung in flüssigkristallinen Dielektrika | |
| DE60317346T2 (de) | Dotierstoffe für flüssigkristalle | |
| DE3783213T2 (de) | Optisch aktive fluessigkristallverbindungen mit einer cyanogruppe. | |
| DE2548360A1 (de) | Fluessigkristalline materialien mit verminderter viskositaet | |
| DE69705183T2 (de) | Verbindungen enthaltend ein Schwalbenschwanz-Endstück und sie enthaltende ferrielektrische flüssigkristalline Zusammensetzung | |
| DE2456083C2 (de) | Nematisches Flüssigkristallgemisch | |
| DE3883366T2 (de) | Flüssigkristall-Verbindung und Verfahren zu deren Herstellung, dieselbe enthaltende Flüssigkristallzusammensetzung und Flüssigkristall-Anzeigevorrichtung. | |
| DE2504564C3 (cg-RX-API-DMAC10.html) | ||
| US3790498A (en) | Memory liquid crystal compositions | |
| DE69630156T2 (de) | Naphtholverbindung sowie Flüssigkristallzusammensetzung und Flüssigkristallelement, die diese Verbindung enthalten | |
| DE2456804A1 (de) | Fluessigkristalline verbindungen und gemische | |
| DE69004188T2 (de) | Carboxylatverbindungen, diese Verbindungen enthaltende flüssigkristalline Zusammensetzungen und flüssigkristalliner Bauteil. | |
| DE19526395A1 (de) | Antiferroelektrische Flüssigkristallzusammensetzung und Flüssigkristallanzeige-Element unter Verwendung derselben | |
| DE1764645B2 (de) | Elektrooptische Vorrichtung mit einer Schicht eines nematischen Flüssigkristallmaterials. Ausscheidung aus: 1618827 | |
| DE69309198T2 (de) | Flüssigkristallverbindung | |
| DE2544577C2 (de) | 4-substituierte Benzoesäure-4'-substituierte-phenylester sowie deren Verwendung | |
| DE3886692T2 (de) | Biphenylverbindung. | |
| DE3881425T2 (de) | Mesomorphe Verbindung und diese enthaltende Flüssigkristallzusammensetzung. |