DE2206498A1 - Feuchtwerk mit im Walzenspalt ange stauter Befeuchtungsflussigkeit - Google Patents
Feuchtwerk mit im Walzenspalt ange stauter BefeuchtungsflussigkeitInfo
- Publication number
- DE2206498A1 DE2206498A1 DE19722206498 DE2206498A DE2206498A1 DE 2206498 A1 DE2206498 A1 DE 2206498A1 DE 19722206498 DE19722206498 DE 19722206498 DE 2206498 A DE2206498 A DE 2206498A DE 2206498 A1 DE2206498 A1 DE 2206498A1
- Authority
- DE
- Germany
- Prior art keywords
- roller
- cylinder
- plate
- press
- forme cylinder
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000012530 fluid Substances 0.000 title 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 36
- 238000007654 immersion Methods 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 5
- 239000012858 resilient material Substances 0.000 claims description 2
- 239000003566 sealing material Substances 0.000 claims description 2
- 238000003860 storage Methods 0.000 claims description 2
- 230000000712 assembly Effects 0.000 claims 2
- 238000000429 assembly Methods 0.000 claims 2
- 238000004140 cleaning Methods 0.000 claims 1
- 238000000465 moulding Methods 0.000 claims 1
- 239000013589 supplement Substances 0.000 claims 1
- 238000010276 construction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 244000062730 Melissa officinalis Species 0.000 description 1
- 235000010654 Melissa officinalis Nutrition 0.000 description 1
- 240000007313 Tilia cordata Species 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000000865 liniment Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41F—PRINTING MACHINES OR PRESSES
- B41F7/00—Rotary lithographic machines
- B41F7/20—Details
- B41F7/24—Damping devices
- B41F7/26—Damping devices using transfer rollers
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Rotary Presses (AREA)
- Inking, Control Or Cleaning Of Printing Machines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00122965A US3769909A (en) | 1971-03-10 | 1971-03-10 | Wet nip dampener |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2206498A1 true DE2206498A1 (de) | 1972-09-21 |
Family
ID=22405936
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722206498 Withdrawn DE2206498A1 (de) | 1971-03-10 | 1972-02-11 | Feuchtwerk mit im Walzenspalt ange stauter Befeuchtungsflussigkeit |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3769909A (OSRAM) |
| JP (1) | JPS5438524B1 (OSRAM) |
| CA (1) | CA960082A (OSRAM) |
| CH (1) | CH549468A (OSRAM) |
| DE (1) | DE2206498A1 (OSRAM) |
| FR (1) | FR2128370B1 (OSRAM) |
| GB (1) | GB1342211A (OSRAM) |
| IT (1) | IT949656B (OSRAM) |
| SE (1) | SE383617B (OSRAM) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3132223A1 (de) * | 1980-08-14 | 1982-04-15 | Komori Printing Machinery Co., Ltd., Tokyo | Feuchtwerk fuer eine druckpresse |
| DE3722519A1 (de) * | 1986-10-01 | 1988-04-14 | Polygraph Leipzig | Kombiniertes feuchtwerk |
| DE3813826A1 (de) * | 1987-06-25 | 1989-01-05 | Heidelberger Druckmasch Ag | Feuchtwerk fuer eine offsetdruckmaschine |
| DE3813827A1 (de) * | 1987-06-25 | 1989-01-05 | Heidelberger Druckmasch Ag | Feuchtwerk fuer eine offsetdruckmaschine |
| DE3813829A1 (de) * | 1987-06-25 | 1989-01-05 | Heidelberger Druckmasch Ag | Feuchtwerk fuer eine offsetdruckmaschine |
| EP0296394A3 (en) * | 1987-06-25 | 1990-01-31 | Heidelberger Druckmaschinen Aktiengesellschaft | Damping unit for an offset printing machine |
| DE3914647A1 (de) * | 1989-05-03 | 1990-11-08 | Heidelberger Druckmasch Ag | Dichtungsanordnung an einer offset-druckmaschine |
| FR2646635A1 (fr) * | 1989-05-03 | 1990-11-09 | Heidelberger Druckmasch Ag | Dispositif d'etancheite |
| DE19722076A1 (de) * | 1996-06-06 | 1998-01-08 | Ryobi Ltd | Befeuchtungsvorrichtung für eine Druckmaschine |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3991674A (en) * | 1971-03-19 | 1976-11-16 | Petri Nello J | Dampening apparatus for a lithograph offset printing plate |
| US4041864A (en) * | 1972-05-09 | 1977-08-16 | Dahlgren Manufacturing Company | Method and apparatus for inking printing plates |
| US4088074A (en) * | 1974-11-25 | 1978-05-09 | Dahlgren Harold P | Apparatus for inking printing plates |
| US4043265A (en) * | 1976-01-29 | 1977-08-23 | Molins Macine Company, Inc. | Ink level warning system |
| US4233898A (en) * | 1978-06-23 | 1980-11-18 | Dahlgren Manufacturing Company | Reversible newspaper press |
| DE2845932A1 (de) * | 1978-10-21 | 1980-04-24 | Heidelberger Druckmasch Ag | Kombiniertes feucht-farbwerk fuer offsetdruckwerke |
| US4455938A (en) * | 1979-05-22 | 1984-06-26 | Graph Tech Inc. | Dampening apparatus for lithographic press |
| JPS55161652A (en) * | 1979-06-05 | 1980-12-16 | Mitsubishi Heavy Ind Ltd | Flexographic press |
| FR2480627A1 (fr) * | 1980-04-16 | 1981-10-23 | Dcm | Dispositif pour appliquer une couche d'enduction sur une bande de materiau circulant en continu |
| DE3069766D1 (en) * | 1980-09-10 | 1985-01-17 | Varn Products Company Limited | Dampening feed apparatus |
| DE3146223C2 (de) * | 1981-11-21 | 1985-03-21 | Heidelberger Druckmaschinen Ag, 6900 Heidelberg | Feucht-Farbwerk für Offsetdruckmaschinen |
| IT1205429B (it) * | 1981-12-15 | 1989-03-23 | Luigi Ghisalberti | Metodo e dispositivo di bagnatura nella stampa offset |
| US4518167A (en) * | 1983-06-08 | 1985-05-21 | A. B. Dick Company | Sealing means |
| DE3427898C1 (de) * | 1984-07-28 | 1985-11-14 | M.A.N.- Roland Druckmaschinen AG, 6050 Offenbach | Vorrichtung zum Auftragen von Fluessigkeiten,insbesondere Lackiereinheit fuer eine Druckmaschine |
| US4981077A (en) * | 1988-06-06 | 1991-01-01 | Varn Products Company | Dampening apparatus for lithographic press |
| EP0345716A3 (en) * | 1988-06-06 | 1990-12-19 | Varn Products Company, Inc. | Dampening apparatus for lithographic press |
| US5182989A (en) * | 1989-05-03 | 1993-02-02 | Heidelberg Druckmaschinen Ag | Sealing device |
| US5134935A (en) * | 1989-10-12 | 1992-08-04 | Yarn Products Company, Inc. | Lithograhic dampener |
| US5694846A (en) * | 1991-06-06 | 1997-12-09 | Baldwin Graphics Systems, Inc. | Fountain solution supply system |
| DE517462T1 (de) * | 1991-06-06 | 1993-04-29 | Baldwin Graphic Systems, Inc., Stamford, Conn. | Zufuehrungssystem fuer anfeuchtfluessigkeit. |
| ES2054572B1 (es) * | 1992-05-06 | 1997-04-16 | Imer S A | Dispositivo para el control de la humectacion en maquinas impresoras offset. |
| JP2906951B2 (ja) * | 1993-08-11 | 1999-06-21 | ボールドウィン アジア パシフィック コーポレーション | オフセット印刷機の湿し水供給装置 |
| US5551338A (en) * | 1995-05-01 | 1996-09-03 | Varn Products Company, Inc. | Drive disengaging device for an offset lithographic seal-type dampening system |
| US6347585B1 (en) * | 1998-08-04 | 2002-02-19 | Goss Graphic Systems, Inc. | Variable gap stabilizer |
| US6675706B2 (en) * | 2001-01-19 | 2004-01-13 | Dean A. Barker | Dampening assembly having air seal apparatus for sealing dampening solution |
| US6796228B2 (en) | 2002-12-27 | 2004-09-28 | Day International, Inc. | Dampener metering device |
| WO2010090203A1 (ja) | 2009-02-04 | 2010-08-12 | 株式会社トクヤマ | 多結晶シリコンの製造法 |
| US12005471B2 (en) * | 2021-10-27 | 2024-06-11 | Kompac Technologies, Llc | System with sealing chamber |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2049495A (en) * | 1931-08-24 | 1936-08-04 | Vogel Freuder Corp | Printing apparatus |
| DE678543C (de) * | 1937-10-06 | 1939-07-17 | Carl Einar Larsen | Verfahren und Vorrichtung zum Feuchten der Flachdruckformen einer Druckmaschine, namentlich beim Offsetdruck |
| US2385169A (en) * | 1944-06-02 | 1945-09-18 | Nat Lock Co | Metal cabinet hinge |
| US2406057A (en) * | 1944-11-30 | 1946-08-20 | Minnesota & Ontario Paper Co | Coating apparatus |
| US2614492A (en) * | 1947-12-17 | 1952-10-21 | Fred K H Levey Co Inc | Method of and apparatus for printing |
| US2676563A (en) * | 1949-02-05 | 1954-04-27 | Champion Paper & Fibre Co | Apparatus for coating paper |
| GB715278A (en) * | 1950-09-04 | 1954-09-08 | Roland Offsetmaschf | Improvements in printing machines |
| US2857840A (en) * | 1956-11-13 | 1958-10-28 | Carl O Bachman | Inking and watering mechanism for printing presses |
| US3094065A (en) * | 1959-04-06 | 1963-06-18 | Harris Intertype Corp | Dampening mechanism for lithographic printing press |
| US3343484A (en) * | 1964-12-16 | 1967-09-26 | Harold P Dahlgren | Lithographic dampener with skewed metering roller |
| US3404625A (en) * | 1965-07-26 | 1968-10-08 | Bemis Co Inc | Dampening mechanism for rotary planographic printing presses |
| US3433155A (en) * | 1965-09-13 | 1969-03-18 | Harris Intertype Corp | Mechanism for applying a coating to a plate |
| US3613575A (en) * | 1968-05-27 | 1971-10-19 | Kantor Press Kontrols Inc | Oscillator roller for printing presses |
-
1971
- 1971-03-10 US US00122965A patent/US3769909A/en not_active Expired - Lifetime
-
1972
- 1972-01-03 GB GB15372A patent/GB1342211A/en not_active Expired
- 1972-01-04 CA CA131,658A patent/CA960082A/en not_active Expired
- 1972-01-15 IT IT47761/72A patent/IT949656B/it active
- 1972-02-11 DE DE19722206498 patent/DE2206498A1/de not_active Withdrawn
- 1972-02-17 CH CH228372A patent/CH549468A/xx not_active IP Right Cessation
- 1972-02-17 JP JP1689472A patent/JPS5438524B1/ja active Pending
- 1972-02-28 FR FR727206653A patent/FR2128370B1/fr not_active Expired
- 1972-03-02 SE SE7202674A patent/SE383617B/xx unknown
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3132223A1 (de) * | 1980-08-14 | 1982-04-15 | Komori Printing Machinery Co., Ltd., Tokyo | Feuchtwerk fuer eine druckpresse |
| DE3722519A1 (de) * | 1986-10-01 | 1988-04-14 | Polygraph Leipzig | Kombiniertes feuchtwerk |
| DE3722519C2 (de) * | 1986-10-01 | 1998-03-19 | Kba Planeta Ag | Kombiniertes Feuchtwerk für Druckmaschinen |
| EP0296393A3 (en) * | 1987-06-25 | 1990-02-07 | Heidelberger Druckmaschinen Aktiengesellschaft | Damping unit for an offset printing machine |
| DE3813829A1 (de) * | 1987-06-25 | 1989-01-05 | Heidelberger Druckmasch Ag | Feuchtwerk fuer eine offsetdruckmaschine |
| EP0296394A3 (en) * | 1987-06-25 | 1990-01-31 | Heidelberger Druckmaschinen Aktiengesellschaft | Damping unit for an offset printing machine |
| DE3813827A1 (de) * | 1987-06-25 | 1989-01-05 | Heidelberger Druckmasch Ag | Feuchtwerk fuer eine offsetdruckmaschine |
| US4962705A (en) * | 1987-06-25 | 1990-10-16 | Heidelberger Druckmaschinen Ag | Dampener for an offset printing machine |
| DE3813826A1 (de) * | 1987-06-25 | 1989-01-05 | Heidelberger Druckmasch Ag | Feuchtwerk fuer eine offsetdruckmaschine |
| DE3914647A1 (de) * | 1989-05-03 | 1990-11-08 | Heidelberger Druckmasch Ag | Dichtungsanordnung an einer offset-druckmaschine |
| FR2646635A1 (fr) * | 1989-05-03 | 1990-11-09 | Heidelberger Druckmasch Ag | Dispositif d'etancheite |
| EP0395911A3 (de) * | 1989-05-03 | 1991-06-12 | Heidelberger Druckmaschinen Aktiengesellschaft | Dichtungsanordnung an einer Offset-Druckmaschine |
| DE19722076A1 (de) * | 1996-06-06 | 1998-01-08 | Ryobi Ltd | Befeuchtungsvorrichtung für eine Druckmaschine |
| DE19722076C2 (de) * | 1996-06-06 | 2000-01-13 | Ryobi Ltd | Feuchtwerk für eine Druckmaschine |
Also Published As
| Publication number | Publication date |
|---|---|
| US3769909A (en) | 1973-11-06 |
| CH549468A (de) | 1974-05-31 |
| GB1342211A (en) | 1974-01-03 |
| SE383617B (sv) | 1976-03-22 |
| FR2128370B1 (OSRAM) | 1973-06-29 |
| JPS5438524B1 (OSRAM) | 1979-11-21 |
| IT949656B (it) | 1973-06-11 |
| CA960082A (en) | 1974-12-31 |
| FR2128370A1 (OSRAM) | 1972-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2206498A1 (de) | Feuchtwerk mit im Walzenspalt ange stauter Befeuchtungsflussigkeit | |
| DE2718299C2 (de) | Mehrfarben-Rotations-Druckmaschine | |
| DE1786507A1 (de) | Rotationsdruckmaschine mit endlosem druckband | |
| DE1923475A1 (de) | Feuchtwerk fuer Druckmaschinen | |
| EP0028420A1 (de) | Verfahren und Vorrichtung zum Dosieren von Druckfarbe sowie umsetzbares Farbreservoir | |
| DE7815407U1 (de) | Feuchtwerk fuer flachdruckmaschinen | |
| DE10008488A1 (de) | Feuchtwerk einer Flachdruckmaschine | |
| EP0338278B1 (de) | Rotationsdruckmaschine mit einem endlosen Klischeeband | |
| DE2639898C2 (de) | Farbwerk für Druckmaschinen | |
| DE3008980A1 (de) | Umstellbares heber-/filmfarbwerk | |
| DE3433446C2 (OSRAM) | ||
| DE4435991A1 (de) | Verfahren und Vorrichtung zum Umstellen eines Farbwerks von Druckmaschinen | |
| DE19515726A1 (de) | Vorrichtung zum An- und Abstellen von Walzen | |
| DE3324382A1 (de) | Vorrichtung zum entfernen von gasblasen | |
| DE2215935C3 (de) | Verfahren zur Erstellung einer Mischung von auf ein Drucktuch einer Offsetdruckmaschine aufzutragendem Feuchtmittel und Farbe | |
| EP0984860B1 (de) | Walze mit einem gummibelag | |
| DE2824430C2 (de) | Vorrichtung zum Dämpfen der stoßartigen Druckspannung zwischen Gummi- und Druckzylinder an Rotationsdruckmaschinen, insbesondere Bogenrotationsdruckmaschinen | |
| DE3046989A1 (de) | Vorrichtung zum druckan- und druckabstellen und zum ausfuehren einer fuer den zylinderwechsel notwendigen weithubbewegung eines auf den formzylinder einer tiefdruckrotationsmaschine wirkenden presseurs | |
| DE8510718U1 (de) | Vorrichtung zum leichteren Einsetzen und Herausnehmen der Walze bei Umkehr-Tiefdruckmaschinen | |
| DE3412496A1 (de) | Tampon-rotationsdruckmaschine | |
| DE2343102C3 (de) | Rotations-Druckmaschine für indirekten Druck | |
| DE1236528B (de) | Feuchtwerk fuer Rotationsflachdruckmaschinen | |
| DE4214709C2 (de) | Verreibhubantrieb für Reibzylinder | |
| DE1411118C (de) | Befeuchtungseinrichtung fur die Druckplatte einer Offset Druckmaschine | |
| DE2365668A1 (de) | Vorrichtung fuer druckmaschinen zum bedrucken von bahnfoermigem material |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |