DE2200346C2 - Härtbare Formmasse - Google Patents
Härtbare FormmasseInfo
- Publication number
- DE2200346C2 DE2200346C2 DE2200346A DE2200346A DE2200346C2 DE 2200346 C2 DE2200346 C2 DE 2200346C2 DE 2200346 A DE2200346 A DE 2200346A DE 2200346 A DE2200346 A DE 2200346A DE 2200346 C2 DE2200346 C2 DE 2200346C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- silane
- molding compound
- carbon atoms
- titanium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000465 moulding Methods 0.000 title claims description 66
- 150000001875 compounds Chemical class 0.000 title claims description 39
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 28
- 229910000077 silane Inorganic materials 0.000 claims description 28
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 14
- 125000005375 organosiloxane group Chemical group 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims 1
- -1 glycol titanium ester Chemical class 0.000 description 137
- 239000000203 mixture Substances 0.000 description 52
- 239000010936 titanium Substances 0.000 description 47
- 229930195733 hydrocarbon Natural products 0.000 description 31
- 239000004215 Carbon black (E152) Substances 0.000 description 30
- 125000004432 carbon atom Chemical group C* 0.000 description 29
- 229910052719 titanium Inorganic materials 0.000 description 26
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 24
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 23
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 21
- 239000013522 chelant Substances 0.000 description 19
- 150000003254 radicals Chemical group 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000945 filler Substances 0.000 description 12
- 229910052751 metal Inorganic materials 0.000 description 12
- 239000002184 metal Substances 0.000 description 12
- 150000003839 salts Chemical class 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000002156 mixing Methods 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000000377 silicon dioxide Substances 0.000 description 9
- 239000011133 lead Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 150000004756 silanes Chemical class 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 229920001971 elastomer Polymers 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 238000007789 sealing Methods 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 4
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 4
- 229940093858 ethyl acetoacetate Drugs 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 4
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 4
- 239000005060 rubber Substances 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 150000003377 silicon compounds Chemical class 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 239000004205 dimethyl polysiloxane Substances 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- BFXIKLCIZHOAAZ-UHFFFAOYSA-N methyltrimethoxysilane Chemical compound CO[Si](C)(OC)OC BFXIKLCIZHOAAZ-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 3
- 125000005372 silanol group Chemical group 0.000 description 3
- 239000010703 silicon Substances 0.000 description 3
- 229920002379 silicone rubber Polymers 0.000 description 3
- 239000004945 silicone rubber Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000005159 cyanoalkoxy group Chemical group 0.000 description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 2
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- JTQPTNQXCUMDRK-UHFFFAOYSA-N propan-2-olate;titanium(2+) Chemical compound CC(C)O[Ti]OC(C)C JTQPTNQXCUMDRK-UHFFFAOYSA-N 0.000 description 2
- 230000001698 pyrogenic effect Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000013638 trimer Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- OVSGBKZKXUMMHS-VGKOASNMSA-L (z)-4-oxopent-2-en-2-olate;propan-2-olate;titanium(4+) Chemical compound [Ti+4].CC(C)[O-].CC(C)[O-].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O OVSGBKZKXUMMHS-VGKOASNMSA-L 0.000 description 1
- ZBBLRPRYYSJUCZ-GRHBHMESSA-L (z)-but-2-enedioate;dibutyltin(2+) Chemical compound [O-]C(=O)\C=C/C([O-])=O.CCCC[Sn+2]CCCC ZBBLRPRYYSJUCZ-GRHBHMESSA-L 0.000 description 1
- ABCRPTLWTHYNMI-UHFFFAOYSA-M 1-O-ethyl 3-O-triphenylplumbyl propanedioate Chemical compound C(CC(=O)[O-])(=O)OCC.C1(=CC=CC=C1)[Pb+](C1=CC=CC=C1)C1=CC=CC=C1 ABCRPTLWTHYNMI-UHFFFAOYSA-M 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RWLALWYNXFYRGW-UHFFFAOYSA-N 2-Ethyl-1,3-hexanediol Chemical compound CCCC(O)C(CC)CO RWLALWYNXFYRGW-UHFFFAOYSA-N 0.000 description 1
- ZYXNLVMBIHVDRH-UHFFFAOYSA-N 2-Methylpropyl 3-oxobutanoate Chemical compound CC(C)COC(=O)CC(C)=O ZYXNLVMBIHVDRH-UHFFFAOYSA-N 0.000 description 1
- MMEDJBFVJUFIDD-UHFFFAOYSA-N 2-[2-(carboxymethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1CC(O)=O MMEDJBFVJUFIDD-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- BOZRCGLDOHDZBP-UHFFFAOYSA-N 2-ethylhexanoic acid;tin Chemical compound [Sn].CCCCC(CC)C(O)=O BOZRCGLDOHDZBP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- SPBNTELQIUYJEK-UHFFFAOYSA-N C1CCCC1[Pb]C1CCCC1 Chemical compound C1CCCC1[Pb]C1CCCC1 SPBNTELQIUYJEK-UHFFFAOYSA-N 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 101000913968 Ipomoea purpurea Chalcone synthase C Proteins 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 101000907988 Petunia hybrida Chalcone-flavanone isomerase C Proteins 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- NSJFNSBWVWFNHJ-UHFFFAOYSA-L [acetyloxy-bis(ethenyl)stannyl] acetate Chemical compound CC([O-])=O.CC([O-])=O.C=C[Sn+2]C=C NSJFNSBWVWFNHJ-UHFFFAOYSA-L 0.000 description 1
- LHFURYICKMKJHJ-UHFFFAOYSA-L [benzoyloxy(dibutyl)stannyl] benzoate Chemical compound CCCC[Sn+2]CCCC.[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 LHFURYICKMKJHJ-UHFFFAOYSA-L 0.000 description 1
- HAAANJSJNWKVMX-UHFFFAOYSA-L [butanoyloxy(dimethyl)stannyl] butanoate Chemical compound CCCC(=O)O[Sn](C)(C)OC(=O)CCC HAAANJSJNWKVMX-UHFFFAOYSA-L 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- KPMOFDIAYWNUGA-UHFFFAOYSA-L bis(3-methylbutyl)tin(2+);2,3,4-trichlorobenzoate Chemical compound CC(C)CC[Sn+2]CCC(C)C.[O-]C(=O)C1=CC=C(Cl)C(Cl)=C1Cl.[O-]C(=O)C1=CC=C(Cl)C(Cl)=C1Cl KPMOFDIAYWNUGA-UHFFFAOYSA-L 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- RGCPMRIOBZXXBR-UHFFFAOYSA-N butan-1-olate;dibutyltin(2+) Chemical compound CCCCO[Sn](CCCC)(CCCC)OCCCC RGCPMRIOBZXXBR-UHFFFAOYSA-N 0.000 description 1
- CEYLPYBDQDCTPB-UHFFFAOYSA-L butanedioate;lead(2+) Chemical compound [Pb+2].[O-]C(=O)CCC([O-])=O CEYLPYBDQDCTPB-UHFFFAOYSA-L 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- RPBPCPJJHKASGQ-UHFFFAOYSA-K chromium(3+);octanoate Chemical compound [Cr+3].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O.CCCCCCCC([O-])=O RPBPCPJJHKASGQ-UHFFFAOYSA-K 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- FQMNUIZEFUVPNU-UHFFFAOYSA-N cobalt iron Chemical compound [Fe].[Co].[Co] FQMNUIZEFUVPNU-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- NDQMQLQVNMZQJB-UHFFFAOYSA-N dibenzyllead Chemical compound C=1C=CC=CC=1C[Pb]CC1=CC=CC=C1 NDQMQLQVNMZQJB-UHFFFAOYSA-N 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- ZXDVQYBUEVYUCG-UHFFFAOYSA-N dibutyltin(2+);methanolate Chemical compound CCCC[Sn](OC)(OC)CCCC ZXDVQYBUEVYUCG-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- DWGCJJZWHKUSLC-UHFFFAOYSA-N diethoxy(dimethyl)stannane Chemical compound CCO[Sn](C)(C)OCC DWGCJJZWHKUSLC-UHFFFAOYSA-N 0.000 description 1
- PWEVMPIIOJUPRI-UHFFFAOYSA-N dimethyltin Chemical compound C[Sn]C PWEVMPIIOJUPRI-UHFFFAOYSA-N 0.000 description 1
- VITHRHRYZSQDDQ-UHFFFAOYSA-N diphenyllead Chemical compound C=1C=CC=CC=1[Pb]C1=CC=CC=C1 VITHRHRYZSQDDQ-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229960005082 etohexadiol Drugs 0.000 description 1
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- YAVJSVDUZGIQPQ-UHFFFAOYSA-N heptyl 3-oxobutanoate Chemical compound CCCCCCCOC(=O)CC(C)=O YAVJSVDUZGIQPQ-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- QNZLAXONNWOLJY-UHFFFAOYSA-N hexyl 3-oxobutanoate Chemical compound CCCCCCOC(=O)CC(C)=O QNZLAXONNWOLJY-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- GIWKOZXJDKMGQC-UHFFFAOYSA-L lead(2+);naphthalene-2-carboxylate Chemical compound [Pb+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 GIWKOZXJDKMGQC-UHFFFAOYSA-L 0.000 description 1
- VQPKAMAVKYTPLB-UHFFFAOYSA-N lead;octanoic acid Chemical compound [Pb].CCCCCCCC(O)=O VQPKAMAVKYTPLB-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- KJGLZJQPMKQFIK-UHFFFAOYSA-N methanolate;tributylstannanylium Chemical compound CCCC[Sn](CCCC)(CCCC)OC KJGLZJQPMKQFIK-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- IKYDDBGYKFPTGF-UHFFFAOYSA-N octyl 3-oxobutanoate Chemical compound CCCCCCCCOC(=O)CC(C)=O IKYDDBGYKFPTGF-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-M p-toluate Chemical compound CC1=CC=C(C([O-])=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-M 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- IDZAUPYMMSSVHP-UHFFFAOYSA-N pentyl 3-oxobutanoate Chemical compound CCCCCOC(=O)CC(C)=O IDZAUPYMMSSVHP-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- CCTFOFUMSKSGRK-UHFFFAOYSA-N propan-2-olate;tin(4+) Chemical compound [Sn+4].CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-] CCTFOFUMSKSGRK-UHFFFAOYSA-N 0.000 description 1
- DHGFMVMDBNLMKT-UHFFFAOYSA-N propyl 3-oxobutanoate Chemical compound CCCOC(=O)CC(C)=O DHGFMVMDBNLMKT-UHFFFAOYSA-N 0.000 description 1
- 239000002510 pyrogen Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004819 silanols Chemical class 0.000 description 1
- WSFQLUVWDKCYSW-UHFFFAOYSA-M sodium;2-hydroxy-3-morpholin-4-ylpropane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC(O)CN1CCOCC1 WSFQLUVWDKCYSW-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- TUCCZSRGFGBTOQ-UHFFFAOYSA-J terephthalate;tin(4+) Chemical compound [Sn+4].[O-]C(=O)C1=CC=C(C([O-])=O)C=C1.[O-]C(=O)C1=CC=C(C([O-])=O)C=C1 TUCCZSRGFGBTOQ-UHFFFAOYSA-J 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- TWRYZRQZQIBEIE-UHFFFAOYSA-N tetramethoxystannane Chemical compound [Sn+4].[O-]C.[O-]C.[O-]C.[O-]C TWRYZRQZQIBEIE-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 150000003609 titanium compounds Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- PWBHRVGYSMBMIO-UHFFFAOYSA-M tributylstannanylium;acetate Chemical compound CCCC[Sn](CCCC)(CCCC)OC(C)=O PWBHRVGYSMBMIO-UHFFFAOYSA-M 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- GLAUZTOWUMJVND-UHFFFAOYSA-M tricyclohexylstannyl prop-2-enoate Chemical compound C1CCCCC1[Sn](C1CCCCC1)(OC(=O)C=C)C1CCCCC1 GLAUZTOWUMJVND-UHFFFAOYSA-M 0.000 description 1
- CPRPKIMXLHBUGA-UHFFFAOYSA-N triethyltin Chemical compound CC[Sn](CC)CC CPRPKIMXLHBUGA-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- QPVPLZOVPDMOEL-UHFFFAOYSA-N tripropyllead Chemical compound CCC[Pb](CCC)CCC QPVPLZOVPDMOEL-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- CHJMFFKHPHCQIJ-UHFFFAOYSA-L zinc;octanoate Chemical compound [Zn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O CHJMFFKHPHCQIJ-UHFFFAOYSA-L 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0091—Complexes with metal-heteroatom-bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/003—Compounds containing elements of Groups 4 or 14 of the Periodic Table without C-Metal linkages
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S528/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S528/901—Room temperature curable silicon-containing polymer
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10448871A | 1971-01-06 | 1971-01-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2200346A1 DE2200346A1 (de) | 1972-07-20 |
| DE2200346C2 true DE2200346C2 (de) | 1985-05-30 |
Family
ID=22300774
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2200346A Expired DE2200346C2 (de) | 1971-01-06 | 1972-01-05 | Härtbare Formmasse |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3689454A (enExample) |
| JP (1) | JPS5523865B1 (enExample) |
| BE (1) | BE777755A (enExample) |
| CA (1) | CA943680A (enExample) |
| DE (1) | DE2200346C2 (enExample) |
| FR (1) | FR2121631B1 (enExample) |
| GB (1) | GB1354423A (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5139673B2 (enExample) * | 1972-07-14 | 1976-10-29 | ||
| NL154542C (nl) * | 1973-03-07 | Rhone Poulenc Sa | Werkwijze voor de bereiding van organopolysiloxanmengsels die bij kamertemperatuur tot bruikbare elastomeren harden, alsmede geheel of gedeeltelijk door middel van deze stoffen beschermde voorwerpen voor elektrische of elektronische doeleinden. | |
| DE2313218B2 (de) * | 1973-03-16 | 1977-02-17 | Wacker-Chemie GmbH, 8000 München | Vernetzungsmittel und kondensationskatalysator enthaltende pasten fuer zweikomponenten-organopolysiloxanmassen |
| US3936686A (en) * | 1973-05-07 | 1976-02-03 | Moore Donald W | Reflector lamp cooling and containing assemblies |
| DE2333966C3 (de) * | 1973-07-04 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unter Wasserausschluß lagerfähige plastische fungicid wirkende Organopolysiloxanformmassen |
| CA1063288A (en) * | 1973-11-21 | 1979-09-25 | Melvin D. Beers | Curable compositions and process |
| DE2413850C3 (de) * | 1974-03-22 | 1979-01-11 | Bayer Ag, 5090 Leverkusen | Bei Zutritt von Wasser oder Wasserdampf zu transparenten Elastomeren vernetzbare Polysüoxanforrrurtasse |
| US3960802A (en) * | 1974-11-27 | 1976-06-01 | General Electric Company | Process for the manufacture of a one-component room-temperature vulcanizable silicone composition |
| US4036813A (en) * | 1975-11-26 | 1977-07-19 | General Electric Company | Composition for promoting adhesion of curable silicones to substrates |
| FR2345491A1 (fr) * | 1976-03-24 | 1977-10-21 | Rhone Poulenc Ind | Compositions organosiliciques stables au stockage, durcissant rapidement en presence d'eau en plastomeres auto-adherents |
| US4257932A (en) * | 1978-06-27 | 1981-03-24 | General Electric Company | Curable compositions and process |
| US4247445A (en) * | 1979-02-28 | 1981-01-27 | General Electric Company | Paintable one-component RTV systems |
| US4293616A (en) * | 1979-02-28 | 1981-10-06 | General Electric Company | Paintable one-component RTV systems |
| US4273698A (en) * | 1979-02-28 | 1981-06-16 | General Electric Company | Self-bonding room temperature vulcanizable silicone rubber compositions |
| US4308372A (en) * | 1979-06-25 | 1981-12-29 | General Electric Company | Shelf-stable one-part room temperature vulcanizable silicone rubber compositions |
| DE2929635A1 (de) | 1979-07-21 | 1981-02-12 | Bayer Ag | Polysiloxanformmassen |
| US4438039A (en) | 1980-07-02 | 1984-03-20 | General Electric Company | Titanium chelate catalyst for silicone compositions |
| US4722967A (en) * | 1980-07-02 | 1988-02-02 | General Electric Company | Titanium chelate catalyst for silicone compositions |
| DE3032707A1 (de) * | 1980-08-30 | 1982-05-06 | Hoechst Ag, 6000 Frankfurt | Thermoplastische masse mit erhoehter kohaesion und geringer fliessneigung und verfahren zu ihrer herstellung |
| US4330637A (en) * | 1981-01-05 | 1982-05-18 | Western Electric Company, Inc. | Encapsulated electronic devices and encapsulating compositions |
| US4395526A (en) * | 1981-06-26 | 1983-07-26 | General Electric Company | One package, stable, moisture curable, polyalkoxy-terminated organopolysiloxane compositions and method for making |
| US4391937A (en) * | 1981-10-05 | 1983-07-05 | Dow Corning Corporation | Color stable chelated titanate compositions |
| US4482498A (en) * | 1981-10-05 | 1984-11-13 | Dow Corning Corporation | Color stable chelated titanate compositions |
| US4424157A (en) | 1982-01-11 | 1984-01-03 | General Electric Co. | Silicon containing lactams |
| US4417042A (en) * | 1982-02-17 | 1983-11-22 | General Electric Company | Scavengers for one-component alkoxy-functional RTV compositions and processes |
| US4513115A (en) * | 1982-02-17 | 1985-04-23 | General Electric Company | Low modulus one component RTV compositions processes |
| US4483973A (en) * | 1982-02-17 | 1984-11-20 | General Electric Company | Adhesion promoters for one-component RTV silicone compositions |
| US4523001A (en) * | 1983-03-17 | 1985-06-11 | General Electric Company | Scavengers for one component alkoxy-functional RTV compositions |
| US4477625A (en) * | 1983-04-01 | 1984-10-16 | General Electric Company | One package, stable, moisture curable, alkoxy-terminated organopolysiloxane compositions |
| US4472564A (en) * | 1983-04-01 | 1984-09-18 | General Electric Company | Method for making an enoxy stabilized room temperature vulcanizable organopolysiloxane composition which resists color change upon aging |
| US4472551A (en) * | 1983-04-01 | 1984-09-18 | General Electric Company | One package, stable, moisture curable, alkoxy-terminated organopolysiloxane compositions |
| US4467063A (en) * | 1983-04-01 | 1984-08-21 | General Electric Company | One package, stable, moisture curable, alkoxy-terminated organopolysiloxane compositions |
| US4499230A (en) * | 1983-04-01 | 1985-02-12 | General Electric Company | One package, stable, moisture curable, alkoxy-terminated organopolysiloxane compositions containing a zeolite |
| US4499229A (en) * | 1983-04-01 | 1985-02-12 | General Electric Company | One package, stable, moisture curable, alkoxy-terminated organopolysiloxane compositions |
| US4489199A (en) * | 1983-08-08 | 1984-12-18 | General Electric Company | Room temperature vulcanizable organopolysiloxane compositions |
| US4675304A (en) * | 1985-07-18 | 1987-06-23 | General Electric Company | Method for modifying polycarbonate formation catalysts |
| CA1284544C (en) * | 1986-08-22 | 1991-05-28 | General Electric Company | Preparation of high strength, high application rate silicone rtv rubber |
| US4830688A (en) * | 1987-11-19 | 1989-05-16 | Minnesota Mining And Manufacturing Company | Moisture resistant splice assembly |
| US4889903A (en) * | 1988-08-03 | 1989-12-26 | Basf Corporation | Fast-cure polyurethane sealant composition containing titanium ester accelerators |
| DE3836916A1 (de) * | 1988-10-29 | 1990-05-10 | Bayer Ag | Unter ausschluss von feuchtigkeit lagerfaehige rtv-1k-massen, die ueberstreichbare elastomere bilden |
| GB9116267D0 (en) * | 1991-07-27 | 1991-09-11 | Tioxide Chemicals Limited | Aqueous compositions |
| DE4210349A1 (de) * | 1992-03-30 | 1993-10-07 | Nuenchritz Chemie Gmbh | Verfahren zur Herstellung eines bei Raumtemperatur durch Kondensationsreaktionen vernetzenden Silikonkautschukes |
| EP0718369A1 (en) | 1994-12-22 | 1996-06-26 | Dow Corning Corporation | Method of reducing hot hydrocarbon oil swell of filled silicone sealant gaskets |
| US5514827A (en) * | 1995-01-25 | 1996-05-07 | Osi Specialties, Inc. | Silylated cyclic hydrocarbons and their uses |
| FR2736060B1 (fr) * | 1995-06-30 | 1998-10-23 | Gen Electric | Compositions a base de silicone elastomere, durcissables par la chaleur, et articles obtenus a partir de ces compositions |
| GB9607897D0 (en) * | 1996-04-17 | 1996-06-19 | Dow Corning Sa | Organosiloxane compositions |
| US5698653A (en) * | 1996-05-10 | 1997-12-16 | General Electric Company | Non-corrosive translucent RTV compositions |
| US5674936A (en) * | 1996-05-10 | 1997-10-07 | General Electric Company | Non-corrosive translucent RTV compositions having good rheology |
| US6034171A (en) * | 1997-04-02 | 2000-03-07 | Dow Corning S.A. | Organosiloxane compositions |
| DE10103421A1 (de) * | 2001-01-26 | 2002-08-14 | Ge Bayer Silicones Gmbh & Co | Polyorganosiloxan-Zusammensetzung |
| DE10156918A1 (de) * | 2001-11-21 | 2003-06-05 | Ge Bayer Silicones Gmbh & Co | Anstrichverträgliche bis überstreichbare Polyorganosiloxan-Zusammensetzungen |
| JP2004204146A (ja) * | 2002-12-26 | 2004-07-22 | Henkel Loctite Corp | シリコーン樹脂組成物 |
| EP1620491B1 (en) * | 2003-04-03 | 2007-04-25 | Dow Corning Corporation | Moisture curable organosiloxane compositions |
| DE102004046179A1 (de) * | 2004-09-23 | 2006-03-30 | Wacker Chemie Ag | Vernetzbare Massen auf der Basis von Organosiliciumverbindungen |
| EP1818368B1 (en) * | 2004-11-11 | 2012-12-26 | Kaneka Corporation | Curable composition |
| CN101932546A (zh) | 2007-12-20 | 2010-12-29 | 蓝星有机硅法国公司 | 在环境温度下可硫化成弹性体的有机聚硅氧烷组合物以及新的有机聚硅氧烷缩聚催化剂 |
| FR2946656A1 (fr) | 2009-06-12 | 2010-12-17 | Bluestar Silicones France | Procede d'etancheification et d'assemblage de composants d'un groupe moto-propulseur |
| FR2946657A1 (fr) | 2009-06-12 | 2010-12-17 | Bluestar Silicones France | Procede d'etancheification et d'assemblage de composants d'un groupe moto-propulseur |
| FR2946654A1 (fr) | 2009-06-15 | 2010-12-17 | Bluestar Silicones France | Procede d'enduction d'une composition silicone ne contenant pas d'etain sur un support souple. |
| FR2946655A1 (fr) | 2009-06-15 | 2010-12-17 | Bluestar Silicones France | Procede d'enduction d'une composition silicone ne contenant pas d'etain sur un support souple. |
| HUE029487T2 (en) | 2010-03-16 | 2017-02-28 | Bluestar Silicones France | Methods and compositions for sealing and assembling engine groups |
| JP5860473B2 (ja) | 2010-11-08 | 2016-02-16 | モメンティブ パフォーマンス マテリアルズ インコーポレイテッド | 流体塗布式シリコーン空気及び水バリアシステム、並びにそのプロセス |
| HUE045094T2 (hu) | 2011-09-16 | 2019-12-30 | Elkem Silicones France Sas | Eljárás és kompozíció hajtáslánc komponenseinek tömítésére és összeállítására |
| WO2013050579A1 (en) | 2011-10-06 | 2013-04-11 | Delphi Connection Systems Holding France | Controlled-healing polysiloxanes, process for their preparation and use of said polysiloxanes |
| WO2014051674A1 (en) * | 2012-09-26 | 2014-04-03 | Dow Corning Corporation | Rubber article with elastomeric silicone coating |
| WO2014096566A1 (fr) | 2012-12-20 | 2014-06-26 | Bluestar Silicones France Sas | Composition organopolysiloxanique vulcanisable a temperature ambiante en elastomere et nouveaux catalyseurs de polycondensation d'organopolysiloxanes |
| FR2999980A1 (fr) | 2012-12-20 | 2014-06-27 | Bluestar Silicones France | Article presentant des proprietes antisalissures et destine a etre utilise dans des applications aquatiques en particulier marines |
| FR3000090A1 (fr) | 2012-12-20 | 2014-06-27 | Bluestar Silicones France | Procede et compositions utiles pour l'etancheification et l'assemblage de composants d'un groupe moto-propulseur |
| CN105008473B (zh) | 2012-12-20 | 2017-04-19 | 蓝星有机硅法国两合公司 | 用于水应用并且尤其是海洋应用的具有防污性能的制品 |
| JP6072296B2 (ja) | 2012-12-20 | 2017-02-01 | ブルースター・シリコーンズ・フランス・エスアエス | 室温におけるエラストマーへの加硫に適したオルガノポリシロキサン組成物及び新規のオルガノポリシロキサン重縮合触媒 |
| FR3014107A1 (fr) | 2013-12-03 | 2015-06-05 | Bluestar Silicones France | Article presentant des proprietes antisalissures et destine a etre utilise dans des applications aquatiques en particulier marines |
| FR3014106B1 (fr) | 2013-12-03 | 2017-03-10 | Bluestar Silicones France | Composition silicone durcissable en presence d'eau ou d'humidite de l'air |
| FR3020067A1 (fr) | 2014-04-18 | 2015-10-23 | Bluestar Silicones France | Procede d'enduction d'un composition silicone sur un support souple |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1266528A (fr) * | 1960-05-30 | 1961-07-17 | Rhone Poulenc Sa | Compositions organopolysiloxaniques vulcanisables à température ambiante |
| US3334067A (en) * | 1966-04-08 | 1967-08-01 | Dow Corning | Method of making one component room temperature curing siloxane rubbers |
-
1971
- 1971-01-06 US US104488A patent/US3689454A/en not_active Expired - Lifetime
- 1971-12-22 GB GB5961371A patent/GB1354423A/en not_active Expired
- 1971-12-27 JP JP724017A patent/JPS5523865B1/ja active Pending
-
1972
- 1972-01-05 DE DE2200346A patent/DE2200346C2/de not_active Expired
- 1972-01-05 CA CA131,685A patent/CA943680A/en not_active Expired
- 1972-01-06 FR FR727200365A patent/FR2121631B1/fr not_active Expired
- 1972-01-06 BE BE777755A patent/BE777755A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2200346A1 (de) | 1972-07-20 |
| BE777755A (fr) | 1972-05-02 |
| JPS5523865B1 (enExample) | 1980-06-25 |
| CA943680A (en) | 1974-03-12 |
| FR2121631A1 (enExample) | 1972-08-25 |
| US3689454A (en) | 1972-09-05 |
| GB1354423A (en) | 1974-06-05 |
| FR2121631B1 (enExample) | 1974-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2200346C2 (de) | Härtbare Formmasse | |
| DE2228883C2 (de) | Flüssige, in Gegenwart von Feuchtigkeit zu einem elastischen Festkörper aushärtende Organopolysiloxan-Zusammensetzung | |
| DE2644555A1 (de) | Kalt haertende silikonkautschuk- massen | |
| DE2422846A1 (de) | An verschiedensten unterlagen haftende, schon bei raumtemperatur zu elastomeren vulkanisierende organopolysiloxanzusammensetzungen | |
| DE2200347C2 (de) | Titanchelate und ihre Verwendung als Katalysatoren zum Vulkanisieren von Polysiloxanen | |
| DE10259613A1 (de) | Organopolysiloxanzusammensetzungen und deren Einsatz in bei Raumtemperatur vernetzbaren niedermoduligen Massen | |
| DE2700990A1 (de) | Organopolysiloxangemisch und seine verwendung | |
| EP3841167B1 (de) | Zusammensetzung für silikonkautschukmassen | |
| DE69921688T2 (de) | Bei raumtemperatur in gegenwart von feuchtigkeit zu lichtdurchlässigen kautschuken härtende organopolysiloxanzusammensetzungen | |
| DE2631889C3 (de) | Verfahren zur Herstellung einer härtenden Organopolysiloxanmasse | |
| DE2059111B2 (de) | Verfahren zur Herstellung in Abwesenheit von Wasserfeuchtigkeit stabiler, bei Zutritt von Wasserfeuchtigkeit bei Raumtemperatur härtender Organopolysüoxane | |
| DE2631957A1 (de) | Verfahren zum polymerisieren eines hydroxylendblockierten polydiorganosiloxans | |
| EP0885915A2 (de) | Polyorganosiloxane mit Dialkoxyorganosiloxy-Gruppen | |
| DE3939176A1 (de) | Siliconkautschukmasse und daraus erhaltenes gehaertetes produkt | |
| EP3484970A1 (de) | Zusammensetzung für silikonkautschukmassen | |
| DE2011704A1 (de) | Kaltvulkanisierbare Massen | |
| EP0033891B1 (de) | Verfahren zur Herstellung von Organosiloxanblockmischpolymerisat | |
| EP3269723A1 (de) | Härter für silikonkautschukmassen | |
| DE2522193A1 (de) | Kalt haertende silikonkautschuk- zusammensetzung | |
| DE19957336A1 (de) | Vernetzbare Organopolysiloxanmassen | |
| EP2367868B1 (de) | Vernetzbare massen auf der basis von organosiliciumverbindungen | |
| DE2229216C2 (de) | Zu einem selbstbindenden Elastomeren härtbare Masse | |
| DE2911301B1 (de) | Bei Raumtemperatur zu Elastomeren vernetzbare Formmassen | |
| DE1186625B (de) | Verfahren zur Herstellung von elastomeren Formkoerpern oder UEberzuegen auf Organopolysiloxangrundlage | |
| DE2332571A1 (de) | Haertbare zusammensetzungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OI | Miscellaneous see part 1 | ||
| Q176 | The application caused the suspense of an application |
Ref document number: 2341218 Country of ref document: DE |
|
| AG | Has addition no. |
Ref country code: DE Ref document number: 2341218 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |