DE2130919C3 - Substituierte Diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide - Google Patents
Substituierte Diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung als HerbizideInfo
- Publication number
- DE2130919C3 DE2130919C3 DE2130919A DE2130919A DE2130919C3 DE 2130919 C3 DE2130919 C3 DE 2130919C3 DE 2130919 A DE2130919 A DE 2130919A DE 2130919 A DE2130919 A DE 2130919A DE 2130919 C3 DE2130919 C3 DE 2130919C3
- Authority
- DE
- Germany
- Prior art keywords
- ether
- pale yellow
- crystals
- nitrodiphenyl
- nitro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 title claims description 40
- 238000000034 method Methods 0.000 title description 4
- 239000004009 herbicide Substances 0.000 title description 3
- 238000002360 preparation method Methods 0.000 title description 3
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- 239000013078 crystal Substances 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- OZBVAEZOKDPKIY-UHFFFAOYSA-N 3-propylbenzenethiol Chemical compound CCCC1=CC=CC(S)=C1 OZBVAEZOKDPKIY-UHFFFAOYSA-N 0.000 description 2
- 235000005474 African couch grass Nutrition 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241001520106 Eustachys Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NKCJTSDDCIJRLT-UHFFFAOYSA-N 2-chloro-4-methylsulfonylphenol Chemical compound CS(=O)(=O)C1=CC=C(O)C(Cl)=C1 NKCJTSDDCIJRLT-UHFFFAOYSA-N 0.000 description 1
- NWSIFTLPLKCTSX-UHFFFAOYSA-N 4-chloro-2-nitrophenol Chemical compound OC1=CC=C(Cl)C=C1[N+]([O-])=O NWSIFTLPLKCTSX-UHFFFAOYSA-N 0.000 description 1
- 240000002245 Acer pensylvanicum Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000218213 Morus <angiosperm> Species 0.000 description 1
- 235000008708 Morus alba Nutrition 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- MWOBKFYERIDQSZ-UHFFFAOYSA-N benzene;sodium Chemical compound [Na].C1=CC=CC=C1 MWOBKFYERIDQSZ-UHFFFAOYSA-N 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- IZMJMCDDWKSTTK-UHFFFAOYSA-N quinoline yellow Chemical compound C1=CC=CC2=NC(C3C(C4=CC=CC=C4C3=O)=O)=CC=C21 IZMJMCDDWKSTTK-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/16—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C317/22—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/10—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C323/18—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/20—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton with singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5352070 | 1970-06-22 | ||
| US00143187A US3813444A (en) | 1970-06-22 | 1971-05-13 | P-nitrodiphenyl ethers |
| US00311746A US3821312A (en) | 1970-06-22 | 1972-12-04 | Alkylthio nitrodiphenyl ethers |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2130919A1 DE2130919A1 (de) | 1971-12-30 |
| DE2130919B2 DE2130919B2 (de) | 1977-09-29 |
| DE2130919C3 true DE2130919C3 (de) | 1978-06-01 |
Family
ID=27294974
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2130919A Expired DE2130919C3 (de) | 1970-06-22 | 1971-06-22 | Substituierte Diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
Country Status (5)
| Country | Link |
|---|---|
| US (2) | US3813444A (enExample) |
| CA (1) | CA956974A (enExample) |
| DE (1) | DE2130919C3 (enExample) |
| FR (1) | FR2096410B1 (enExample) |
| GB (1) | GB1337860A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795355A (fr) * | 1972-02-14 | 1973-05-29 | Nippon Kayaku Kk | Procedes de preparation d'ethers diphenyliques et acaricides les renfermant |
| EG11593A (en) * | 1973-07-03 | 1980-07-31 | Bayer Ag | Halogenated 4-trifluiromethyl-4-cyano-diphenyl-ethers process for their preparation and their use as herbicides |
| US4091109A (en) * | 1976-06-18 | 1978-05-23 | Nippon Kayaku Kabushiki Kaisha | Diphenylether derivatives and use thereof as an acaricide |
| EP0000351A1 (de) * | 1977-07-07 | 1979-01-24 | Ciba-Geigy Ag | Phenoxy-phenylthio-alkancarbonsäurederivate, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und als Pflanzenwachstumsregulierungsmittel |
| EP0000359B1 (de) * | 1977-07-07 | 1981-10-21 | Ciba-Geigy Ag | Phenoxy-phenylsulfinyl- und -sulfonyl-alkancarbonsäure-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und als Pflanzenwachstumsregulierungsmittel. |
| JPS6058905B2 (ja) * | 1978-08-25 | 1985-12-23 | 日本化薬株式会社 | 新規2−ハイドロオキシベンズアミド誘導体および土壌殺菌剤 |
| US4254144A (en) * | 1980-01-25 | 1981-03-03 | The Dow Chemical Company | Substituted benzonitriles having antiviral activity |
| US4349568A (en) * | 1980-06-12 | 1982-09-14 | The Dow Chemical Company | Sulfur-substituted diphenyl ethers having antiviral activity |
| US4505929A (en) * | 1980-06-12 | 1985-03-19 | The Dow Chemical Company | Sulfur-substituted diphenyl ethers having antiviral activity |
| US4358308A (en) * | 1981-10-19 | 1982-11-09 | Rohm And Haas Company | Herbicidal 4-perfluoroacetyl-, 4-perfluoromethylthio-, 4-perfluoromethylsulfinyl-, and 4-perfluoromethylsulfonyl-4'-nitrodiphenyl ethers |
| US4806682A (en) * | 1982-09-17 | 1989-02-21 | Rohm And Haas Company | Sulfonium salts of diphenyl ethers |
| JPS6341451A (ja) * | 1986-08-06 | 1988-02-22 | Nippon Kayaku Co Ltd | エ−テル誘導体およびそれを有効成分とする殺ダニ、殺虫組成物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1290148B (de) * | 1967-05-13 | 1969-03-06 | Bayer Ag | Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether |
| GB1251389A (enExample) * | 1968-03-18 | 1971-10-27 |
-
1971
- 1971-04-27 CA CA111,426A patent/CA956974A/en not_active Expired
- 1971-05-13 US US00143187A patent/US3813444A/en not_active Expired - Lifetime
- 1971-06-04 GB GB1892171*[A patent/GB1337860A/en not_active Expired
- 1971-06-22 DE DE2130919A patent/DE2130919C3/de not_active Expired
- 1971-06-22 FR FR717122610A patent/FR2096410B1/fr not_active Expired
-
1972
- 1972-12-04 US US00311746A patent/US3821312A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CA956974A (en) | 1974-10-29 |
| FR2096410A1 (enExample) | 1972-02-18 |
| DE2130919B2 (de) | 1977-09-29 |
| FR2096410B1 (enExample) | 1974-06-21 |
| US3821312A (en) | 1974-06-28 |
| DE2130919A1 (de) | 1971-12-30 |
| US3813444A (en) | 1974-05-28 |
| GB1337860A (en) | 1973-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2130919C3 (de) | Substituierte Diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2414280C2 (de) | Verfahren zur Herstellung von 1-Methyl-5-nitroimidazolen | |
| DE2009960B2 (de) | Jodierte Formalverbindungen, Verfahren zu ihrer Herstellung und Verwendung derselben | |
| DE2334262B2 (de) | N-(p-Chlor- bzw. Bromphenyl)-carbaminsäure-beta-phenoxyalkylesterund Verfahren zu ihrer Herstellung | |
| DE812316C (de) | Verfahren zur Herstellung von 2-(p-Aminobenzolsulfonamido)-4-methylpyrimidin | |
| DE2305517C3 (de) | 2-Imino-13-dithiacyclobutane, Verfahren zu ihrer Herstellung und sie enthaltende Warmblüterschutzmittel gegen Schildzecken | |
| DE1078582B (de) | Verfahren zur Herstellung substituierter Thyropropionsaeuren | |
| DE2240298A1 (de) | Schmiermittelgemisch | |
| DE3044856A1 (de) | Pyridinderivate | |
| DE1200313B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-1, 2, 4-triazolidinen | |
| DE2118493C3 (de) | Verfahren zur Herstellung von Aminostilbenen | |
| DE1670973A1 (de) | Fluortriazinverbindungen | |
| CH407096A (de) | Verfahren zur Herstellung von aromatischen Diisothiocyanaten | |
| DE2345788A1 (de) | Verfahren zur herstellung eines alkylhalogennitrobenzoats in verbesserter ausbeute | |
| DE2514814A1 (de) | Lichtschutzmittel | |
| DE2734809A1 (de) | Verfahren zur herstellung von 2,3- dichlor-1-(c tief 1-7 )-alkoxybenzolen | |
| DE2118494B2 (de) | Verfahren zur Herstellung von Diarylverbindungen | |
| DE2307248C3 (de) | 4-NKrodiphenyläthersulfide, -sulfoxide und -sulfone, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1203272B (de) | Verfahren zur Herstellung von antiphlogistisch wirksamen 3, 5-Dioxo-1, 2, 4-triazolidinen | |
| DE1178052B (de) | Verfahren zur Herstellung von heterocyclischen Verbindungne, die mindestens ein einem Ringstickstoffatom benachbartes Chloratom enthalten. | |
| DE1135478B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-1, 2, 4-triazolidinen | |
| DE2218739A1 (de) | Verfahren zur Herstellung von Pyridinderivaten | |
| EP0123087A1 (de) | Verfahren zur Herstellung heterocyclischer Phenylether | |
| DE2328156A1 (de) | Verfahren zur herstellung von 2-hydroxynaphthalin-3-carbonsaeure | |
| DE1768130B2 (de) | Isocyan-diphenyl(-thio)-aether sowie verfahren zu ihrer herstellung und deren verwendung zur bekaempfung von akariden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |