DE2129423C3 - Verfahren zur Herstellung von Acrylamid - Google Patents
Verfahren zur Herstellung von AcrylamidInfo
- Publication number
- DE2129423C3 DE2129423C3 DE2129423A DE2129423A DE2129423C3 DE 2129423 C3 DE2129423 C3 DE 2129423C3 DE 2129423 A DE2129423 A DE 2129423A DE 2129423 A DE2129423 A DE 2129423A DE 2129423 C3 DE2129423 C3 DE 2129423C3
- Authority
- DE
- Germany
- Prior art keywords
- oxide
- catalyst
- copper
- mixture
- reduction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 title claims description 18
- 238000000034 method Methods 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title description 8
- 239000003054 catalyst Substances 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 37
- 238000006243 chemical reaction Methods 0.000 claims description 31
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 25
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 22
- 239000005751 Copper oxide Substances 0.000 claims description 22
- 229910000431 copper oxide Inorganic materials 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- 239000010949 copper Substances 0.000 claims description 15
- 229910052802 copper Inorganic materials 0.000 claims description 13
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 12
- 229910044991 metal oxide Inorganic materials 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 150000004706 metal oxides Chemical class 0.000 claims description 9
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 239000007791 liquid phase Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052745 lead Inorganic materials 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910052814 silicon oxide Inorganic materials 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- 230000027939 micturition Effects 0.000 claims 1
- 239000003638 chemical reducing agent Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 239000003708 ampul Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- -1 benzamide copper chloride Chemical compound 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- 229910001431 copper ion Inorganic materials 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000002638 heterogeneous catalyst Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000011949 solid catalyst Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- GFCDJPPBUCXJSC-UHFFFAOYSA-N [O-2].[Zn+2].[Cu]=O Chemical compound [O-2].[Zn+2].[Cu]=O GFCDJPPBUCXJSC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- SOYFYCJCFAHQDV-UHFFFAOYSA-J copper zinc dicarbonate Chemical compound [Cu++].[Zn++].[O-]C([O-])=O.[O-]C([O-])=O SOYFYCJCFAHQDV-UHFFFAOYSA-J 0.000 description 1
- VODBHXZOIQDDST-UHFFFAOYSA-N copper zinc oxygen(2-) Chemical compound [O--].[O--].[Cu++].[Zn++] VODBHXZOIQDDST-UHFFFAOYSA-N 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- GQLSFFZMZXULSF-UHFFFAOYSA-N copper;oxotungsten Chemical compound [Cu].[W]=O GQLSFFZMZXULSF-UHFFFAOYSA-N 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J37/00—Processes, in general, for preparing catalysts; Processes, in general, for activation of catalysts
- B01J37/16—Reducing
- B01J37/18—Reducing with gases containing free hydrogen
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/70—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper
- B01J23/72—Copper
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US4716670A | 1970-06-17 | 1970-06-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2129423A1 DE2129423A1 (de) | 1971-12-30 |
| DE2129423B2 DE2129423B2 (de) | 1981-07-30 |
| DE2129423C3 true DE2129423C3 (de) | 1982-05-13 |
Family
ID=21947409
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2129423A Expired DE2129423C3 (de) | 1970-06-17 | 1971-06-14 | Verfahren zur Herstellung von Acrylamid |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3696152A (enExample) |
| JP (1) | JPS5241241B1 (enExample) |
| BE (1) | BE768658A (enExample) |
| CA (1) | CA975005A (enExample) |
| DE (1) | DE2129423C3 (enExample) |
| FR (1) | FR2096309A5 (enExample) |
| GB (1) | GB1351949A (enExample) |
| NL (1) | NL170279C (enExample) |
| ZA (1) | ZA712602B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4329500A (en) * | 1970-11-19 | 1982-05-11 | The Dow Chemical Company | Catalysts for the hydration of nitriles to amides |
| US3966810A (en) * | 1972-09-02 | 1976-06-29 | Tokuzo Kurata | Process for hydrating a nitrile to the corresponding amide |
| GB1404532A (en) * | 1972-09-02 | 1975-09-03 | Mitsubishi Chem Ind | Process for hydrating a nitrile to the corresponding amide |
| US3884975A (en) * | 1972-10-05 | 1975-05-20 | American Cyanamid Co | Rhodium catalyst for hydration of acrylonitrile |
| US3956387A (en) * | 1973-04-19 | 1976-05-11 | Basf Aktiengesellschaft | Manufacture of concentrated aqueous (meth)acrylamide solutions by catalytic addition of water to (meth)acrylonitrile |
| DE2320060C2 (de) * | 1973-04-19 | 1982-10-14 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Carbonsäureamiden |
| US3944609A (en) * | 1973-06-01 | 1976-03-16 | American Cyanamid Company | Catalyst preparation method |
| US3900516A (en) * | 1973-11-01 | 1975-08-19 | Nalco Chemical Co | Process for making acrylamide |
| US3929421A (en) * | 1973-12-26 | 1975-12-30 | Nalco Chemical Co | Tubular catalytic reactor with premixing means for multiple reactants of different densities |
| US4178310A (en) * | 1975-03-17 | 1979-12-11 | American Cyanamid Company | Catalyst for hydration of nitriles |
| US4096184A (en) * | 1976-01-19 | 1978-06-20 | Sumitomo Chemical Company, Limited | Process for preparing acid amides |
| US4250111A (en) * | 1976-07-12 | 1981-02-10 | Nalco Chemical Company | Mixed catalyst for the hydrolysis of nitriles to amides |
| US4365091A (en) * | 1980-11-06 | 1982-12-21 | Sumitomo Chemical Company, Limited | Method for the production of acrylamide |
| US4322532A (en) * | 1980-11-17 | 1982-03-30 | Nalco Chemical Company | Solvents for the catalytic production of acrylamide from acrylonitrile and water |
| DE3767365D1 (de) * | 1986-05-21 | 1991-02-21 | Allied Colloids Ltd | Katalysatoren und ihre verwendung fuer die hydrolyse von nitrilen. |
| JPS62203093U (enExample) * | 1986-06-14 | 1987-12-24 | ||
| GB8727379D0 (en) * | 1987-11-23 | 1987-12-23 | Allied Colloids Ltd | Catalysts |
| TW316852B (enExample) * | 1994-08-02 | 1997-10-01 | Mitsui Toatsu Chemicals | |
| TW340063B (en) * | 1996-04-25 | 1998-09-11 | Kao Corp | Electrostatic powder coating gun |
| DE10161674A1 (de) * | 2001-12-14 | 2003-06-26 | Basf Ag | Katalysatoren zur Herstellung von Carbonsäuresalzen |
| CN111196763B (zh) * | 2018-11-16 | 2021-06-01 | 中国科学院大连化学物理研究所 | 一种3-羟基丙腈加氢生产3-氨基丙醇的催化剂及其制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB203812A (en) * | 1922-06-20 | 1923-09-20 | Basf Ag | An improved process for producing formic acid derivatives |
| DE1154086B (de) * | 1961-11-10 | 1963-09-12 | Basf Ag | Verfahren zur Herstellung von Glycidamid |
| US3381034A (en) * | 1965-06-30 | 1968-04-30 | Standard Oil Co | Process for hydrolyzing nitriles |
| US3597481A (en) * | 1969-01-16 | 1971-08-03 | Dow Chemical Co | Heterogeneous catalyst for the liquid phase hydrolysis of nitriles to amides |
-
1970
- 1970-06-17 US US47166A patent/US3696152A/en not_active Expired - Lifetime
-
1971
- 1971-04-20 CA CA110,870A patent/CA975005A/en not_active Expired
- 1971-04-22 ZA ZA712602A patent/ZA712602B/xx unknown
- 1971-05-07 NL NLAANVRAGE7106295,A patent/NL170279C/xx not_active IP Right Cessation
- 1971-06-14 DE DE2129423A patent/DE2129423C3/de not_active Expired
- 1971-06-14 FR FR7121554A patent/FR2096309A5/fr not_active Expired
- 1971-06-17 GB GB2853271A patent/GB1351949A/en not_active Expired
- 1971-06-17 JP JP46043032A patent/JPS5241241B1/ja active Pending
- 1971-06-17 BE BE768658A patent/BE768658A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2129423B2 (de) | 1981-07-30 |
| ZA712602B (en) | 1972-01-26 |
| US3696152A (en) | 1972-10-03 |
| NL170279C (nl) | 1982-10-18 |
| GB1351949A (en) | 1974-05-15 |
| DE2129423A1 (de) | 1971-12-30 |
| NL7106295A (enExample) | 1971-12-21 |
| CA975005A (en) | 1975-09-23 |
| BE768658A (fr) | 1971-12-17 |
| JPS5241241B1 (enExample) | 1977-10-17 |
| NL170279B (nl) | 1982-05-17 |
| FR2096309A5 (enExample) | 1972-02-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129423C3 (de) | Verfahren zur Herstellung von Acrylamid | |
| WO2001087809A1 (de) | Verfahren zur herstellung von gesättigten c3-c20-alkoholen | |
| EP0190617B1 (de) | Verfahren zur Herstellung eines Kupfer und Siliciumoxid enthaltenden Katalysators | |
| DE2321101A1 (de) | Kobaltkatalysator | |
| WO1999044982A2 (de) | Verfahren zur hydrierung von aliphatischen alpha, omega-dinitrilen | |
| EP0796839B1 (de) | Verfahren zur Herstellung eines Gemisches von Amino-methyl-cyclohexanen und Diamino-methyl-cyclohexanen | |
| DE2202733A1 (de) | Verfahren zur herstellung von acrolein und acrylsaeure | |
| DE2536273A1 (de) | Katalysator zur hydrierung von acetylenalkoholen | |
| DE4203220A1 (de) | Verfahren zur herstellung von cyclohexen durch partielle hydrierung von benzol | |
| DE2447952A1 (de) | Verfahren zur katalytischen ammoxidation von olefinen zu nitrilen | |
| DE2520893A1 (de) | Verfahren zur herstellung von diphenylamin | |
| DE69800312T2 (de) | Verfahren zur Herstellung von Acrylsäuren aus Acrolein durch Redox-Reaktion | |
| DE2506348C3 (de) | Hydrierkatalysator | |
| DE2353131C3 (de) | Katalysator fur die Gasphasenoxydation von ungesättigten Aldehyden zu ungesättigten Carbonsäuren | |
| DE3007139C2 (de) | Kupferchromit-Katalysator, Verfahren zu seiner Herstellung und seine Verwendung zur Herstellung von Alkoholen aus ungesättigten Aldehyden | |
| DE2543520A1 (de) | Katalysatorzusammensetzungen | |
| DE69520175T2 (de) | Kupferkatalysator für die Hydratierung von Nitrilen und Verfahren zu dessen Herstellung | |
| DE2161471C3 (de) | Verfahren zur Herstellung von Acrolein und Acrylsäure | |
| DE828540C (de) | Verfahren zur Herstellung aliphatischer Ketone | |
| DE2646733C3 (de) | Verfahren zur Herstellung von Acrylamid | |
| DE2042396A1 (de) | Verfahren zur Herstellung von Äthylenoxyd | |
| DE3880272T2 (de) | Katalysatoren und deren verwendung in der hydrolyse von nitrilen. | |
| DE2038641B2 (de) | Durch ionisierende strahlung haertbare anstrichmittel sowie deren verwendung | |
| DE4221604A1 (de) | Verfahren zur Herstellung von 5-Cyanvaleriansäureamid | |
| DE3346415C1 (de) | Verfahren zur Herstellung von ss-Hydroxypropionsaeureamid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |