DE2035903A1 - Verfahren zur Herstellung neuer hetero cyclischer Verbindungen - Google Patents
Verfahren zur Herstellung neuer hetero cyclischer VerbindungenInfo
- Publication number
- DE2035903A1 DE2035903A1 DE19702035903 DE2035903A DE2035903A1 DE 2035903 A1 DE2035903 A1 DE 2035903A1 DE 19702035903 DE19702035903 DE 19702035903 DE 2035903 A DE2035903 A DE 2035903A DE 2035903 A1 DE2035903 A1 DE 2035903A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- hydroxy
- methoxymethylindole
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000002391 heterocyclic compounds Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- QIWNOVRXWQPVIY-UHFFFAOYSA-N propylbenzene Chemical compound [CH2]CCC1=CC=CC=C1 QIWNOVRXWQPVIY-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- -1 trimethylene radical Chemical class 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- YFUIBNZDKHDJAM-UHFFFAOYSA-N 2-(methoxymethyl)-1h-indol-4-ol Chemical compound C1=CC=C2NC(COC)=CC2=C1O YFUIBNZDKHDJAM-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 235000002906 tartaric acid Nutrition 0.000 description 4
- 239000011975 tartaric acid Substances 0.000 description 4
- YZPMQHFEXAJCIY-UHFFFAOYSA-N (4-phenylmethoxy-1h-indol-2-yl)methanol Chemical compound C1=CC=C2NC(CO)=CC2=C1OCC1=CC=CC=C1 YZPMQHFEXAJCIY-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- VCDOTVCHBQPOPN-UHFFFAOYSA-N 1-[[2-(methoxymethyl)-1H-indol-4-yl]oxy]-3-(propan-2-ylamino)propan-2-ol Chemical compound OC(COC1=C2C=C(NC2=CC=C1)COC)CNC(C)C VCDOTVCHBQPOPN-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- IMHPUHMLCNLANZ-UHFFFAOYSA-N 1-[benzyl(propan-2-yl)amino]-3-chloropropan-2-ol Chemical compound ClCC(O)CN(C(C)C)CC1=CC=CC=C1 IMHPUHMLCNLANZ-UHFFFAOYSA-N 0.000 description 1
- FOIYYOCMAFKUFW-UHFFFAOYSA-N 1-amino-3-[[2-(methoxymethyl)-1H-indol-4-yl]oxy]propan-2-ol Chemical compound NCC(COC1=C2C=C(NC2=CC=C1)COC)O FOIYYOCMAFKUFW-UHFFFAOYSA-N 0.000 description 1
- OIFAHDAXIUURLN-UHFFFAOYSA-N 2-(fluoromethyl)oxirane Chemical compound FCC1CO1 OIFAHDAXIUURLN-UHFFFAOYSA-N 0.000 description 1
- AGIBHMPYXXPGAX-UHFFFAOYSA-N 2-(iodomethyl)oxirane Chemical compound ICC1CO1 AGIBHMPYXXPGAX-UHFFFAOYSA-N 0.000 description 1
- RFFZQDYNWFNOPI-UHFFFAOYSA-N 2-(methoxymethyl)-4-(oxiran-2-ylmethoxy)-1h-indole Chemical compound C1=CC=C2NC(COC)=CC2=C1OCC1CO1 RFFZQDYNWFNOPI-UHFFFAOYSA-N 0.000 description 1
- NUXGWYXZKDLOFZ-UHFFFAOYSA-N 2-(methoxymethyl)-4-phenylmethoxy-1H-indole Chemical compound C(C1=CC=CC=C1)OC1=C2C=C(NC2=CC=C1)COC NUXGWYXZKDLOFZ-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- WUCPCORZZJWVHG-UHFFFAOYSA-N 4-bromo-2-propylthiophene Chemical compound CCCC1=CC(Br)=CS1 WUCPCORZZJWVHG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000001142 anti-diarrhea Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000006793 arrhythmia Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 125000006440 butyl cyclopropyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 1
- 230000001834 epinephrinelike Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- LYBKPDDZTNUNNM-UHFFFAOYSA-N isopropylbenzylamine Chemical compound CC(C)NCC1=CC=CC=C1 LYBKPDDZTNUNNM-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000003716 rejuvenation Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/12—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1136569A CH513854A (de) | 1969-07-25 | 1969-07-25 | Verfahren zur Herstellung neuer Indolderivate |
| CH779570 | 1970-05-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2035903A1 true DE2035903A1 (de) | 1971-02-04 |
Family
ID=25702240
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702035903 Pending DE2035903A1 (de) | 1969-07-25 | 1970-07-20 | Verfahren zur Herstellung neuer hetero cyclischer Verbindungen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3696121A (enExample) |
| JP (1) | JPS5012435B1 (enExample) |
| BE (1) | BE753840A (enExample) |
| DE (1) | DE2035903A1 (enExample) |
| ES (1) | ES382074A1 (enExample) |
| FR (1) | FR2059558B1 (enExample) |
| GB (1) | GB1308029A (enExample) |
| SE (1) | SE371440B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR203991A1 (es) * | 1972-03-16 | 1975-11-12 | Rhone Poulenc Sa | Procedimiento para preparar derivados de(hidroxi-2-amino-3-propoxi)-3-isoindolinona-1 |
| US3882143A (en) * | 1972-12-19 | 1975-05-06 | Sandoz Ltd | 4-(2-hydroxy-3-aminopropoxy)oxindole derivatives |
| US4152446A (en) * | 1974-11-16 | 1979-05-01 | Boehringer Mannheim Gmbh | Aminopropanol compounds and compositions for the treatment of cardiac and circulatory diseases |
| US4076829A (en) * | 1974-11-16 | 1978-02-28 | Boehringer Mannheim Gmbh | Aminopropanol compounds and compositions for the treatment of cardiac and circulatory diseases |
| US4235919A (en) * | 1977-07-21 | 1980-11-25 | Sandoz Ltd. | 1-(Indol-4-yloxy)-3-(2-substituted amino)-2-propanols and pharmaceutical use thereof |
| JPS5746200Y2 (enExample) * | 1978-06-26 | 1982-10-12 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1129072A (en) * | 1966-02-01 | 1968-10-02 | Ici Ltd | Benzofuran and indole derivatives |
| US3471515A (en) * | 1965-02-01 | 1969-10-07 | Sandoz Ag | (2-hydroxy-3-substituted aminopropoxy)indoles |
| DE1948507C2 (de) * | 1969-09-25 | 1982-10-21 | Sandoz-Patent-GmbH, 7850 Lörrach | 4-(2-Hydroxy-3-aminopropoxy)-indolderivate, ihre Salze, Verfahren zu ihrer Herstellung und Heilmittel |
-
1970
- 1970-06-25 GB GB3081870A patent/GB1308029A/en not_active Expired
- 1970-07-17 US US55945A patent/US3696121A/en not_active Expired - Lifetime
- 1970-07-20 DE DE19702035903 patent/DE2035903A1/de active Pending
- 1970-07-22 FR FR7027018A patent/FR2059558B1/fr not_active Expired
- 1970-07-23 BE BE753840D patent/BE753840A/xx unknown
- 1970-07-23 ES ES382074A patent/ES382074A1/es not_active Expired
- 1970-07-24 JP JP45064919A patent/JPS5012435B1/ja active Pending
- 1970-07-24 SE SE7010217A patent/SE371440B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2059558B1 (enExample) | 1974-03-22 |
| SE371440B (enExample) | 1974-11-18 |
| US3696121A (en) | 1972-10-03 |
| ES382074A1 (es) | 1973-04-01 |
| BE753840A (fr) | 1971-01-25 |
| FR2059558A1 (enExample) | 1971-06-04 |
| JPS5012435B1 (enExample) | 1975-05-12 |
| GB1308029A (en) | 1973-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2929517A1 (de) | Pinenderivate, verfahren zu ihrer herstellung und sie enthaltende, pharmazeutische zubereitungen | |
| DE2062001C2 (de) | 1,2,3,4-Tetrahydro-4-phenylisochinolin-Derivate, deren Säureadditionssalze, Verfahren zu deren Herstellung und pharmazeutisches Präparat | |
| EP0678513B1 (de) | Verfahren zur selektiven Hydrierung von aromatischen Gruppen in Gegenwart von Epoxygruppen | |
| DE925472C (de) | Verfahren zur Herstellung von Cumarinderivaten | |
| DE2035903A1 (de) | Verfahren zur Herstellung neuer hetero cyclischer Verbindungen | |
| DE2038482A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| DE1670629A1 (de) | Verfahren zur Herstellung von neuen Aminoalkylpyridinderivaten | |
| DE2729816C2 (de) | 2-Oxy-5-isopropyliden-7-hydroxy-9-substituierte-2,6-methano-3,4,5,6-tetrahydro-2H-1-benzoxocine und Verfahren zu ihrer Herstellung | |
| DE1470102A1 (de) | 2-Hydroxymethyl-5-nitroimidazole und Verfahren zu deren Herstellung | |
| Szarek et al. | Lycopodium Alkaloids: XVI. Annotine | |
| DE2148552A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| DE2400658A1 (de) | Aminopropanolderivate des p-acetamidophenols und verfahren zu ihrer herstellung | |
| CH513854A (de) | Verfahren zur Herstellung neuer Indolderivate | |
| DE2025790A1 (de) | Verfahren zur Herstellung neuer tricyclischer Verbindungen | |
| AT244933B (de) | Verfahren zur Herstellung von neuen 1, 5-Diphenyl-3-azapentanolen-(1) und ihren Säureadditionssalzen | |
| DE1903035A1 (de) | Verfahren zur Herstellung einer neuen heterocyclischen Verbindung | |
| DE2228283C3 (de) | 10-Piperazinodibenzo eckige Klammer auf b,f eckige Klammer zu-thiepine, Verfahren zu ihrer Herstellung und pharmazeutische Mittel | |
| AT313893B (de) | Verfahren zur Herstellung neuer Indolderivate und ihrer Salze | |
| AT201580B (de) | Verfahren zur Herstellung neuer, sekundärer Amine | |
| CH638172A5 (de) | 1-phenyl-2-amino-1,3-propandiol-n-alkyl-derivate und verfahren zur herstellung derselben. | |
| DE3146373A1 (de) | 2-aminoaethanolverbindungen, verfahren zu ihrer herstellung und pharmazeutische mittel, die diese verbindungen enthalten | |
| DE1518654A1 (de) | Neue Cycloheptadiene | |
| DE1948507A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| AT230895B (de) | Verfahren zur Herstellung von neuen 6, 11-Dihydrodibenzo-[b, e]-thiazepin-[1, 4]-Derivaten | |
| DE2004818C3 (de) | Basisch substituierte Chinobenzazepine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |