DE2016587C3 - Farbentwickler - Google Patents
FarbentwicklerInfo
- Publication number
- DE2016587C3 DE2016587C3 DE2016587A DE2016587A DE2016587C3 DE 2016587 C3 DE2016587 C3 DE 2016587C3 DE 2016587 A DE2016587 A DE 2016587A DE 2016587 A DE2016587 A DE 2016587A DE 2016587 C3 DE2016587 C3 DE 2016587C3
- Authority
- DE
- Germany
- Prior art keywords
- color
- coupler
- developer
- couplers
- pyrazolone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims description 6
- 150000003142 primary aromatic amines Chemical class 0.000 claims description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 238000010521 absorption reaction Methods 0.000 description 17
- 238000000034 method Methods 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 12
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000000975 dye Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000003595 spectral effect Effects 0.000 description 7
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- -1 nitroanilino group Chemical group 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 235000010265 sodium sulphite Nutrition 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 229940051250 hexylene glycol Drugs 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- QPGMGQPOZHCYTF-UHFFFAOYSA-N 2-(2,6-dichloro-4-methoxyphenyl)-5-(4-nitrophenyl)iminopyrazolidin-3-one Chemical compound ClC1=C(C(=CC(=C1)OC)Cl)N1N=C(CC1=O)NC1=CC=C(C=C1)[N+](=O)[O-] QPGMGQPOZHCYTF-UHFFFAOYSA-N 0.000 description 2
- UKCALYZKRZRVGG-UHFFFAOYSA-N 2-(2,6-dichloro-4-methylphenyl)-5-(4-nitrophenyl)iminopyrazolidin-3-one Chemical compound ClC1=C(C(=CC(=C1)C)Cl)N1N=C(CC1=O)NC1=CC=C(C=C1)[N+](=O)[O-] UKCALYZKRZRVGG-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000834 fixative Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JCHCJUVKFAZHFX-UHFFFAOYSA-N (2,6-dichloro-4-methylphenyl)hydrazine Chemical compound CC1=CC(Cl)=C(NN)C(Cl)=C1 JCHCJUVKFAZHFX-UHFFFAOYSA-N 0.000 description 1
- QXFHWZJROBFYQU-UHFFFAOYSA-N 1,1-diethyl-2-phenylhydrazine;sulfuric acid Chemical compound OS(O)(=O)=O.CCN(CC)NC1=CC=CC=C1 QXFHWZJROBFYQU-UHFFFAOYSA-N 0.000 description 1
- HMUDNHJDRNNRIE-UHFFFAOYSA-N 2,6-dichloro-4-methylaniline Chemical compound CC1=CC(Cl)=C(N)C(Cl)=C1 HMUDNHJDRNNRIE-UHFFFAOYSA-N 0.000 description 1
- FLUYDOVOMDZUEV-UHFFFAOYSA-N 2-(4-nitrophenoxy)acetyl chloride Chemical compound [O-][N+](=O)C1=CC=C(OCC(Cl)=O)C=C1 FLUYDOVOMDZUEV-UHFFFAOYSA-N 0.000 description 1
- DBMPHBQSQZZRDP-UHFFFAOYSA-N 2-nitro-2-phenylacetonitrile Chemical compound [O-][N+](=O)C(C#N)C1=CC=CC=C1 DBMPHBQSQZZRDP-UHFFFAOYSA-N 0.000 description 1
- GCABLKFGYPIVFC-UHFFFAOYSA-N 3-(1-benzofuran-2-yl)-3-oxopropanenitrile Chemical compound C1=CC=C2OC(C(CC#N)=O)=CC2=C1 GCABLKFGYPIVFC-UHFFFAOYSA-N 0.000 description 1
- UMXNFNUFUVSSCU-UHFFFAOYSA-N 3-(4-nitroanilino)-1,4-dihydropyrazol-5-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1NC1=NNC(=O)C1 UMXNFNUFUVSSCU-UHFFFAOYSA-N 0.000 description 1
- XRZDIHADHZSFBB-UHFFFAOYSA-N 3-oxo-n,3-diphenylpropanamide Chemical compound C=1C=CC=CC=1NC(=O)CC(=O)C1=CC=CC=C1 XRZDIHADHZSFBB-UHFFFAOYSA-N 0.000 description 1
- RMKRCLBDIMSFQB-UHFFFAOYSA-N 4-amino-2-benzylphenol Chemical compound NC1=CC=C(O)C(CC=2C=CC=CC=2)=C1 RMKRCLBDIMSFQB-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- QPYYMQHTZDAZRU-UHFFFAOYSA-N ClC1=C(C(=CC(=C1)C)Cl)N1N=C(CC1=O)N Chemical compound ClC1=C(C(=CC(=C1)C)Cl)N1N=C(CC1=O)N QPYYMQHTZDAZRU-UHFFFAOYSA-N 0.000 description 1
- HFHHMSDAIFIVTF-UHFFFAOYSA-N N-[1-(2,6-dichloro-4-methylphenyl)-5-oxo-4H-pyrazol-3-yl]-2-(4-nitrophenoxy)acetamide Chemical compound ClC1=C(C(=CC(=C1)C)Cl)N1N=C(CC1=O)NC(COC1=CC=C(C=C1)[N+](=O)[O-])=O HFHHMSDAIFIVTF-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- LOCAIGRSOJUCTB-UHFFFAOYSA-N indazol-3-one Chemical compound C1=CC=C2C(=O)N=NC2=C1 LOCAIGRSOJUCTB-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
- C07D231/52—Oxygen atom in position 3 and nitrogen atom in position 5, or vice versa
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/32—Colour coupling substances
- G03C7/36—Couplers containing compounds with active methylene groups
- G03C7/38—Couplers containing compounds with active methylene groups in rings
- G03C7/384—Couplers containing compounds with active methylene groups in rings in pyrazolone rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP44026266A JPS4818858B1 (OSRAM) | 1969-04-07 | 1969-04-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2016587A1 DE2016587A1 (de) | 1970-10-29 |
| DE2016587B2 DE2016587B2 (de) | 1975-04-03 |
| DE2016587C3 true DE2016587C3 (de) | 1975-11-13 |
Family
ID=12188449
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2016587A Expired DE2016587C3 (de) | 1969-04-07 | 1970-04-07 | Farbentwickler |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3615502A (OSRAM) |
| JP (1) | JPS4818858B1 (OSRAM) |
| DE (1) | DE2016587C3 (OSRAM) |
| FR (1) | FR2042962A5 (OSRAM) |
| GB (1) | GB1257286A (OSRAM) |
| NL (1) | NL7004787A (OSRAM) |
| SE (1) | SE350133B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4061653A (en) * | 1972-06-23 | 1977-12-06 | Bayer Aktiengesellschaft | 1-Substituted-3-amino-pyrazol-5-ones |
| US4081596A (en) * | 1973-04-17 | 1978-03-28 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4000294A (en) * | 1973-04-17 | 1976-12-28 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| USRE30420E (en) * | 1973-04-17 | 1980-10-21 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US3992404A (en) * | 1973-04-17 | 1976-11-16 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4032646A (en) * | 1973-04-17 | 1977-06-28 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4005215A (en) * | 1973-04-17 | 1977-01-25 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4056533A (en) * | 1973-04-17 | 1977-11-01 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4045571A (en) * | 1973-04-17 | 1977-08-30 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| DE2319278C2 (de) * | 1973-04-17 | 1986-02-20 | Bayer Ag, 5090 Leverkusen | Pharmazeutisches Mittel |
| US4069334A (en) * | 1973-12-20 | 1978-01-17 | Bayer Aktiengesellschaft | Pyrazole derivatives |
| DE2427272C3 (de) * | 1974-06-06 | 1981-10-01 | Bayer Ag, 5090 Leverkusen | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum |
| JPS5383857U (OSRAM) * | 1976-12-14 | 1978-07-11 |
-
1969
- 1969-04-07 JP JP44026266A patent/JPS4818858B1/ja active Pending
-
1970
- 1970-03-31 US US24250A patent/US3615502A/en not_active Expired - Lifetime
- 1970-04-03 GB GB1257286D patent/GB1257286A/en not_active Expired
- 1970-04-03 NL NL7004787A patent/NL7004787A/xx unknown
- 1970-04-06 FR FR7012327A patent/FR2042962A5/fr not_active Expired
- 1970-04-07 DE DE2016587A patent/DE2016587C3/de not_active Expired
- 1970-06-06 SE SE04674/70*[A patent/SE350133B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE350133B (OSRAM) | 1972-10-16 |
| GB1257286A (OSRAM) | 1971-12-15 |
| JPS4818858B1 (OSRAM) | 1973-06-08 |
| FR2042962A5 (OSRAM) | 1971-02-12 |
| US3615502A (en) | 1971-10-26 |
| NL7004787A (OSRAM) | 1970-10-09 |
| DE2016587A1 (de) | 1970-10-29 |
| DE2016587B2 (de) | 1975-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1597572C3 (de) | Farbpholographische Silberhalogenidemulsion | |
| DE2414006C2 (de) | Mehrschichtiges farbphotographisches Aufzeichnungsmaterial | |
| DE2329587C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE964654C (de) | Photographisches Material mit einer ultraviolettabsorbierenden Schicht | |
| DE2418959A1 (de) | Farbphotographisches material | |
| DE2042581C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE3318759A1 (de) | Farbphotographisches lichtempfindliches silberhalogenidmaterial | |
| DE2429637A1 (de) | Farbphotographisches lichtempfindliches material | |
| DE2016587B2 (de) | Farbentwickler | |
| DE2502820B2 (de) | Farbfotografisches Verfahren zur Herstellung von Cyanbildern | |
| DE2357102A1 (de) | Photographisches material enthaltend einen magentakuppler | |
| DE69328335T2 (de) | Verfahren zur Herstellung eines photographischen Farbbildes | |
| DE2049967C3 (de) | Fotografisches Aulzeichenmaterial | |
| DE2152336A1 (de) | Lichtempfindliches farbphotographisches Material | |
| DE2050998A1 (de) | Farbphotographisches lichtempfindliches Material, das einen neuen gelbbildenden Kuppler enthalt | |
| DE2318807C2 (de) | Farbphotographisches Aufzeichnungsmaterial und Farbentwickler zum Entwickeln desselben | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE2902681A1 (de) | Farbphotographisches material | |
| DE2731676A1 (de) | Photographische silberhalogenidemulsion | |
| DE1282457B (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2843954A1 (de) | Lichtempfindliches frabphotographisches element | |
| DE1962574C3 (de) | Farbfotografisches Aufzeichnungsmaterial | |
| DE1940548A1 (de) | Farbphotographische lichtempfindliche Materialien und Verfahren zu deren Herstellung | |
| DE2509408C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2901520A1 (de) | Farbfotografisches lichtempfindliches material |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHJ | Ceased/non-payment of the annual fee |