DE2000131A1 - Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien - Google Patents
Verfahren zum kontinuierlichen Faerben synthetischer FasermaterialienInfo
- Publication number
- DE2000131A1 DE2000131A1 DE19702000131 DE2000131A DE2000131A1 DE 2000131 A1 DE2000131 A1 DE 2000131A1 DE 19702000131 DE19702000131 DE 19702000131 DE 2000131 A DE2000131 A DE 2000131A DE 2000131 A1 DE2000131 A1 DE 2000131A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- oco
- radical
- alkyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 239000000463 material Substances 0.000 title claims description 8
- 229920002994 synthetic fiber Polymers 0.000 title claims description 8
- 239000012209 synthetic fiber Substances 0.000 title claims description 8
- 238000010014 continuous dyeing Methods 0.000 title claims description 4
- -1 methoxy, ethoxy Chemical group 0.000 claims description 104
- 239000000460 chlorine Substances 0.000 claims description 76
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 239000000987 azo dye Substances 0.000 claims description 14
- 238000010438 heat treatment Methods 0.000 claims description 12
- 239000003960 organic solvent Substances 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000004442 acylamino group Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 239000002657 fibrous material Substances 0.000 claims description 6
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 150000003557 thiazoles Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 5
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 239000000975 dye Substances 0.000 description 68
- 239000004744 fabric Substances 0.000 description 26
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 17
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 16
- 229950011008 tetrachloroethylene Drugs 0.000 description 16
- 238000004043 dyeing Methods 0.000 description 14
- 244000172533 Viola sororia Species 0.000 description 12
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 9
- 239000000835 fiber Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 238000001035 drying Methods 0.000 description 8
- 238000009998 heat setting Methods 0.000 description 7
- 238000005406 washing Methods 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 229920000139 polyethylene terephthalate Polymers 0.000 description 5
- 239000005020 polyethylene terephthalate Substances 0.000 description 5
- 239000010979 ruby Substances 0.000 description 5
- 229910001750 ruby Inorganic materials 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 229920002635 polyurethane Polymers 0.000 description 4
- 239000004814 polyurethane Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 3
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 3
- 229920002284 Cellulose triacetate Polymers 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 3
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 2
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 2
- KWMDHCLJYMVBNS-UHFFFAOYSA-N 2-bromo-4,6-dinitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1[N+]([O-])=O KWMDHCLJYMVBNS-UHFFFAOYSA-N 0.000 description 2
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 2
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 2
- IVJDJEYBDMAWSA-UHFFFAOYSA-N C(COCCOCCOCCOCCOCCOCCO)O.C(CCCCCCCC)C1=C(C=CC=C1)O Chemical compound C(COCCOCCOCCOCCOCCOCCO)O.C(CCCCCCCC)C1=C(C=CC=C1)O IVJDJEYBDMAWSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 235000005811 Viola adunca Nutrition 0.000 description 2
- 240000009038 Viola odorata Species 0.000 description 2
- 235000013487 Viola odorata Nutrition 0.000 description 2
- 235000002254 Viola papilionacea Nutrition 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- ZRSKSQHEOZFGLJ-UHFFFAOYSA-N ammonium adipate Chemical compound [NH4+].[NH4+].[O-]C(=O)CCCCC([O-])=O ZRSKSQHEOZFGLJ-UHFFFAOYSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical compound [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- GETTZEONDQJALK-UHFFFAOYSA-N (trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1 GETTZEONDQJALK-UHFFFAOYSA-N 0.000 description 1
- GKXWTRSVUPXQMM-UHFFFAOYSA-N 1,1,1,2,2-pentachloro-3,3,3-trifluoropropane Chemical compound FC(F)(F)C(Cl)(Cl)C(Cl)(Cl)Cl GKXWTRSVUPXQMM-UHFFFAOYSA-N 0.000 description 1
- QVLAWKAXOMEXPM-UHFFFAOYSA-N 1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl QVLAWKAXOMEXPM-UHFFFAOYSA-N 0.000 description 1
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 description 1
- SEQRDAAUNCRFIT-UHFFFAOYSA-N 1,1-dichlorobutane Chemical compound CCCC(Cl)Cl SEQRDAAUNCRFIT-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- KJDRSWPQXHESDQ-UHFFFAOYSA-N 1,4-dichlorobutane Chemical compound ClCCCCCl KJDRSWPQXHESDQ-UHFFFAOYSA-N 0.000 description 1
- XFGJTWBJZDMEJE-UHFFFAOYSA-N 1-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-phenylundecan-2-ol Chemical compound C(CCCCCCCC)C(COCCOCCOCCOCCOCCOCCO)(C1=CC=CC=C1)O XFGJTWBJZDMEJE-UHFFFAOYSA-N 0.000 description 1
- KHCZSJXTDDHLGJ-UHFFFAOYSA-N 2,3,4,5,6-pentachloroaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl KHCZSJXTDDHLGJ-UHFFFAOYSA-N 0.000 description 1
- LXCLPHJRGDTDDB-UHFFFAOYSA-N 2,3,4,6-tetrachloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C(Cl)=C1Cl LXCLPHJRGDTDDB-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- DYSRXWYRUJCNFI-UHFFFAOYSA-N 2,4-dibromoaniline Chemical compound NC1=CC=C(Br)C=C1Br DYSRXWYRUJCNFI-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- YMZIFDLWYUSZCC-UHFFFAOYSA-N 2,6-dibromo-4-nitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1Br YMZIFDLWYUSZCC-UHFFFAOYSA-N 0.000 description 1
- MUHLVSZIVTURCZ-UHFFFAOYSA-N 2-amino-3-bromo-5-nitrobenzonitrile Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1C#N MUHLVSZIVTURCZ-UHFFFAOYSA-N 0.000 description 1
- XVYNBLCPQVDRCH-UHFFFAOYSA-N 2-amino-3-chloro-5-nitrobenzonitrile Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1C#N XVYNBLCPQVDRCH-UHFFFAOYSA-N 0.000 description 1
- UZHALXIAWJOLLR-UHFFFAOYSA-N 2-amino-4-chlorobenzonitrile Chemical compound NC1=CC(Cl)=CC=C1C#N UZHALXIAWJOLLR-UHFFFAOYSA-N 0.000 description 1
- QYRDWARBHMCOAG-UHFFFAOYSA-N 2-amino-5-chlorobenzonitrile Chemical compound NC1=CC=C(Cl)C=C1C#N QYRDWARBHMCOAG-UHFFFAOYSA-N 0.000 description 1
- MGCGMYPNXAFGFA-UHFFFAOYSA-N 2-amino-5-nitrobenzonitrile Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C#N MGCGMYPNXAFGFA-UHFFFAOYSA-N 0.000 description 1
- YUSPUYJCCVQMSB-UHFFFAOYSA-N 2-bromo-4-ethylsulfonyl-6-nitroaniline Chemical compound CCS(=O)(=O)C1=CC(Br)=C(N)C(=C1)[N+]([O-])=O YUSPUYJCCVQMSB-UHFFFAOYSA-N 0.000 description 1
- LHRIICYSGQGXSX-UHFFFAOYSA-N 2-chloro-4,6-dinitroaniline Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1[N+]([O-])=O LHRIICYSGQGXSX-UHFFFAOYSA-N 0.000 description 1
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 1
- BSPCSKHALVHRSR-UHFFFAOYSA-N 2-chlorobutane Chemical compound CCC(C)Cl BSPCSKHALVHRSR-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 1
- COFNCCWGWXFACE-UHFFFAOYSA-N 4-amino-3,5-dichlorobenzonitrile Chemical compound NC1=C(Cl)C=C(C#N)C=C1Cl COFNCCWGWXFACE-UHFFFAOYSA-N 0.000 description 1
- OREVCMGFYSUYPX-UHFFFAOYSA-N 4-amino-3-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1Cl OREVCMGFYSUYPX-UHFFFAOYSA-N 0.000 description 1
- CSEUFCFWUBNLPY-UHFFFAOYSA-N 4-amino-5-chlorobenzene-1,3-dicarbonitrile Chemical compound NC1=C(Cl)C=C(C#N)C=C1C#N CSEUFCFWUBNLPY-UHFFFAOYSA-N 0.000 description 1
- XNWVFYGSFIIGEF-UHFFFAOYSA-N 4-amino-5-nitrobenzene-1,3-dicarbonitrile Chemical compound NC1=C(C#N)C=C(C#N)C=C1[N+]([O-])=O XNWVFYGSFIIGEF-UHFFFAOYSA-N 0.000 description 1
- RRCAJFYQXKPXOJ-UHFFFAOYSA-N 4-aminobenzene-1,2-dicarbonitrile Chemical compound NC1=CC=C(C#N)C(C#N)=C1 RRCAJFYQXKPXOJ-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- CLMQUEQFVUMDPC-UHFFFAOYSA-N 4-chloro-2,6-dinitroaniline Chemical compound NC1=C([N+]([O-])=O)C=C(Cl)C=C1[N+]([O-])=O CLMQUEQFVUMDPC-UHFFFAOYSA-N 0.000 description 1
- CVINWVPRKDIGLL-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)aniline Chemical compound NC1=CC=C(Cl)C=C1C(F)(F)F CVINWVPRKDIGLL-UHFFFAOYSA-N 0.000 description 1
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 description 1
- FOHHWGVAOVDVLP-UHFFFAOYSA-N 4-chloro-3-nitroaniline Chemical compound NC1=CC=C(Cl)C([N+]([O-])=O)=C1 FOHHWGVAOVDVLP-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- NAELBNIEPRXPCO-UHFFFAOYSA-N 4-ethylsulfonyl-2-nitroaniline Chemical compound CCS(=O)(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 NAELBNIEPRXPCO-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 241000577218 Phenes Species 0.000 description 1
- 206010039587 Scarlet Fever Diseases 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KMUFWAPHDZTCMI-UHFFFAOYSA-N butyl 4-amino-3-nitrobenzoate Chemical compound CCCCOC(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 KMUFWAPHDZTCMI-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000006639 cyclohexyl carbonyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- LZXXNPOYQCLXRS-UHFFFAOYSA-N methyl 4-aminobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1 LZXXNPOYQCLXRS-UHFFFAOYSA-N 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 1
- ZJIJAJXFLBMLCK-UHFFFAOYSA-N perfluorohexane Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ZJIJAJXFLBMLCK-UHFFFAOYSA-N 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical group O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 1
- 235000015149 toffees Nutrition 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/90—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using dyes dissolved in organic solvents or aqueous emulsions thereof
- D06P1/908—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using dyes dissolved in organic solvents or aqueous emulsions thereof using specified dyes
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S8/00—Bleaching and dyeing; fluid treatment and chemical modification of textiles and fibers
- Y10S8/92—Synthetic fiber dyeing
- Y10S8/922—Polyester fiber
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702000131 DE2000131A1 (de) | 1970-01-02 | 1970-01-02 | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien |
| CH1844270A CH559816A (de) | 1970-01-02 | 1970-12-11 | Verfahren zum kontinuierlichen faerben von polyesteroder cellulosetriacetatfasern. |
| CH1844270D CH1844270A4 (enExample) | 1970-01-02 | 1970-12-11 | |
| CA 100629 CA953455A (en) | 1970-01-02 | 1970-12-15 | Process for the continuous dyeing of synthetic fibre materials |
| AT1126570A AT304438B (de) | 1970-01-02 | 1970-12-15 | Verfahren zum kontinuierlichen Färben synthetischer Fasermaterialien |
| US00099719A US3775049A (en) | 1970-01-02 | 1970-12-18 | Continuous dyeing of polyester fibres with azo dyestuffs soluble in water-immerscible halogenated hydrocarbons |
| JP45121915A JPS4823837B1 (enExample) | 1970-01-02 | 1970-12-29 | |
| GB61585/70A GB1287704A (en) | 1970-01-02 | 1970-12-29 | Process for the impregnation dyeing of synthetic fibre materials |
| NL7019015A NL7019015A (enExample) | 1970-01-02 | 1970-12-30 | |
| FR7047470A FR2075906B1 (enExample) | 1970-01-02 | 1970-12-31 | |
| BE761117A BE761117A (fr) | 1970-01-02 | 1970-12-31 | Procede de teinture en continu de matieres fibreuses synthetiques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702000131 DE2000131A1 (de) | 1970-01-02 | 1970-01-02 | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2000131A1 true DE2000131A1 (de) | 1971-07-08 |
Family
ID=5758992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702000131 Pending DE2000131A1 (de) | 1970-01-02 | 1970-01-02 | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3775049A (enExample) |
| JP (1) | JPS4823837B1 (enExample) |
| AT (1) | AT304438B (enExample) |
| BE (1) | BE761117A (enExample) |
| CA (1) | CA953455A (enExample) |
| CH (2) | CH1844270A4 (enExample) |
| DE (1) | DE2000131A1 (enExample) |
| FR (1) | FR2075906B1 (enExample) |
| GB (1) | GB1287704A (enExample) |
| NL (1) | NL7019015A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2601391A1 (fr) * | 1986-07-12 | 1988-01-15 | Sandoz Sa | Utilisation de composes monoazoiques comme colorants. |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3963431A (en) * | 1970-10-02 | 1976-06-15 | Ciba-Geigy Ag | Method of dyeing with dispersible azo anilino dyestuffs |
| US4038269A (en) * | 1970-05-06 | 1977-07-26 | Sandoz Ltd. | 2'-alkoxyacylamino-4'-alkylamino-4-nitro-1,1'-azobenzene disperse dyes |
| CH614228A5 (enExample) * | 1972-07-13 | 1979-11-15 | Bayer Ag | |
| DE2254376A1 (de) * | 1972-11-07 | 1974-05-22 | Hoechst Ag | Verfahren zum faerben von synthetischen fasermaterialien aus organischen loesemitteln |
| US4101541A (en) * | 1973-12-21 | 1978-07-18 | Ciba-Geigy Corporation | 3-Cyano-1,2,4-thiadiazolyl-5-czo dyestuffs |
| GB1516634A (en) * | 1974-10-31 | 1978-07-05 | Ici Ltd | Colouring process for synthetic textile materials |
| US4030882A (en) * | 1975-01-02 | 1977-06-21 | Eastman Kodak Company | Solvent dyeing compositions and a method of dyeing polyester fibers therewith |
| CH623344A5 (enExample) * | 1975-07-18 | 1981-05-29 | Ciba Geigy Ag | |
| US4101544A (en) * | 1975-09-26 | 1978-07-18 | American Color & Chemical Corporation | Water soluble monoazo dyes for polyamide material |
| JPS5793631U (enExample) * | 1980-11-28 | 1982-06-09 | ||
| JPS5793632U (enExample) * | 1980-11-28 | 1982-06-09 | ||
| US4456551A (en) * | 1981-10-26 | 1984-06-26 | Eastman Kodak Company | Azo dyes from 2-amino-5-alkylthio-1,3,4-thiadiazoles and N-acyloxyalkyl-m-acylamidoanilines |
| DE4113650A1 (de) * | 1991-04-26 | 1992-10-29 | Jens Kaupert | Verpackungsteil und herstellungsverfahren |
| US5652344A (en) * | 1996-09-25 | 1997-07-29 | Allied Industrial Corp., Ltd. | 2-amino-5-nitrothiazole derived monoazo disperse dyes |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA832343A (en) * | 1970-01-20 | Roy E. Starn, Jr. | Process of dyeing water swellable cellulosic materials | |
| US3057848A (en) * | 1957-09-25 | 1962-10-09 | Interchem Corp | 2-amino-4, 6-dinitrobenzothiazole and azo dyestuffs therefrom |
| US3096320A (en) * | 1959-03-28 | 1963-07-02 | Basf Ag | Water-insoluble monoazo and disazo 1, 3, 4-thiadiazole dyestuffs |
| US3122410A (en) * | 1959-07-01 | 1964-02-25 | Sandoz Ltd | Process for the dyeing, padding and printing of polyester fibers |
| US3046076A (en) * | 1959-08-25 | 1962-07-24 | Burlington Industries Inc | Process for coloring polyolefinic textile materials |
| GB1050675A (enExample) * | 1963-02-15 | |||
| US3313590A (en) * | 1963-09-17 | 1967-04-11 | Allied Chem | Polyester dyeing with polychlorobenzene-aryl glycol ether dye solution and said dye solution |
| CH503153A (de) * | 1965-12-09 | 1967-12-15 | Ciba Geigy Ag | Verfahren zum kontinuierlichen Färben oder Bedrucken von Textilmaterial aus linearen, hochmolekularen Estern aromatischer Polycarbonsäuren mit polyfunktionellen Alkoholen |
| DE1644150A1 (de) * | 1966-04-19 | 1971-03-25 | Bayer Ag | Wasserunloesliche Azofarbstoffe und Verfahren zu deren Herstellung und Verwendung |
| SE309960B (enExample) * | 1966-09-01 | 1969-04-14 | Henkel & Cie Gmbh | |
| CH478197A (de) * | 1966-11-07 | 1969-09-15 | Ciba Geigy | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe |
| FR1581325A (enExample) * | 1967-09-29 | 1969-09-12 | ||
| FR1581359A (enExample) * | 1967-09-29 | 1969-09-12 | ||
| CH501100A (de) * | 1968-03-19 | 1970-07-31 | Ciba Geigy Ag | Verfahren zum Färben von Textilmaterial auf Basis von Polypropylen |
-
1970
- 1970-01-02 DE DE19702000131 patent/DE2000131A1/de active Pending
- 1970-12-11 CH CH1844270D patent/CH1844270A4/xx unknown
- 1970-12-11 CH CH1844270A patent/CH559816A/xx not_active IP Right Cessation
- 1970-12-15 AT AT1126570A patent/AT304438B/de not_active IP Right Cessation
- 1970-12-15 CA CA 100629 patent/CA953455A/en not_active Expired
- 1970-12-18 US US00099719A patent/US3775049A/en not_active Expired - Lifetime
- 1970-12-29 JP JP45121915A patent/JPS4823837B1/ja active Pending
- 1970-12-29 GB GB61585/70A patent/GB1287704A/en not_active Expired
- 1970-12-30 NL NL7019015A patent/NL7019015A/xx unknown
- 1970-12-31 FR FR7047470A patent/FR2075906B1/fr not_active Expired
- 1970-12-31 BE BE761117A patent/BE761117A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2601391A1 (fr) * | 1986-07-12 | 1988-01-15 | Sandoz Sa | Utilisation de composes monoazoiques comme colorants. |
Also Published As
| Publication number | Publication date |
|---|---|
| AT304438B (de) | 1973-01-10 |
| NL7019015A (enExample) | 1971-07-06 |
| CH1844270A4 (enExample) | 1974-06-28 |
| CA953455A (en) | 1974-08-27 |
| BE761117A (fr) | 1971-05-27 |
| FR2075906B1 (enExample) | 1976-09-03 |
| GB1287704A (en) | 1972-09-06 |
| FR2075906A1 (enExample) | 1971-10-15 |
| JPS4823837B1 (enExample) | 1973-07-17 |
| US3775049A (en) | 1973-11-27 |
| CH559816B5 (enExample) | |
| CH559816A (de) | 1975-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2000131A1 (de) | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien | |
| DE1544446B2 (de) | Von Sulfon- und Carbonsäuregruppen freie wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1959777A1 (de) | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien | |
| DE1644103B2 (de) | Basische kationische azofarbstoffe | |
| DE3313797C2 (enExample) | ||
| DE1963735C3 (de) | Monoazofarbstoffe und Verfahren zum kontinuierlichen Färben von synthetischen Fasermaterialien | |
| CH689353A5 (de) | Dispersionsfarbstoffe. | |
| DE2120876A1 (de) | In Wasser schwer lösliche Azoverbindungen, ihre Herstellung und Verwendung | |
| DE2531445B2 (de) | Sulfogruppenfreie wasserloesliche azofarbstoffe und deren verwendung zum faerben und/oder bedrucken von synthetischen textilfasern | |
| DE2600036A1 (de) | Organische verbindungen | |
| DE1469868C3 (de) | Verwendung von heterocyclischen Farbstoffen zum Färben von Polyamiden in der Masse | |
| DE1950679A1 (de) | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien | |
| DE3016301A1 (de) | Wasserunloesliche azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2252123A1 (de) | Verfahren zum faerben von synthetischen fasermaterialien aus organischen loesemitteln | |
| DE2329388A1 (de) | Verfahren zum faerben von synthetischen fasermaterialien aus organischen loesemitteln | |
| DE1955893A1 (de) | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien | |
| DE1153840B (de) | Verfahren zur Herstellung wasserunloeslicher Azofarbstoffe | |
| DE2212755A1 (de) | Wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| DE2249217A1 (de) | Verfahren zum faerben von synthetischen fasermaterialien aus organischen loesemitteln | |
| CH690824A5 (de) | Dispersionsfarbstoffe. | |
| DE2325201A1 (de) | Ausziehverfahren zum faerben von synthesefasern aus organischen loesemitteln | |
| DE2205062A1 (de) | Neue, wasserunloesliche azofarbstoffe und verfahren zu ihrer herstellung | |
| DE1668878A1 (de) | Wasserunloesliche Azofarbstoffe,Verfahren zu deren Herstellung und Anwendung | |
| DE2308044A1 (de) | Verfahren zum faerben synthetischer fasermaterialien aus organischen loesungsmitteln | |
| DE1954632A1 (de) | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien |