DE1950100C3 - - Google Patents
Info
- Publication number
- DE1950100C3 DE1950100C3 DE19691950100 DE1950100A DE1950100C3 DE 1950100 C3 DE1950100 C3 DE 1950100C3 DE 19691950100 DE19691950100 DE 19691950100 DE 1950100 A DE1950100 A DE 1950100A DE 1950100 C3 DE1950100 C3 DE 1950100C3
- Authority
- DE
- Germany
- Prior art keywords
- chloroethane
- mono
- phosphonic acid
- yield
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004480 active ingredient Substances 0.000 description 47
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 239000002904 solvent Substances 0.000 description 30
- 239000000460 chlorine Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- 241000196324 Embryophyta Species 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- 239000003995 emulsifying agent Substances 0.000 description 17
- -1 nitro, methyl Chemical group 0.000 description 17
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 14
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 230000012010 growth Effects 0.000 description 10
- 244000046052 Phaseolus vulgaris Species 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 235000013399 edible fruits Nutrition 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 7
- 125000002877 alkyl aryl group Chemical group 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 239000008055 phosphate buffer solution Substances 0.000 description 7
- 229920000151 polyglycol Polymers 0.000 description 7
- 239000010695 polyglycol Substances 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 206010053759 Growth retardation Diseases 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 235000004426 flaxseed Nutrition 0.000 description 6
- 231100000001 growth retardation Toxicity 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000009036 growth inhibition Effects 0.000 description 5
- 230000008635 plant growth Effects 0.000 description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000004883 flower formation Effects 0.000 description 4
- BUCIWTBCUUHRHZ-UHFFFAOYSA-K potassium;disodium;dihydrogen phosphate;hydrogen phosphate Chemical compound [Na+].[Na+].[K+].OP(O)([O-])=O.OP([O-])([O-])=O BUCIWTBCUUHRHZ-UHFFFAOYSA-K 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- MJYQFWSXKFLTAY-OVEQLNGDSA-N (2r,3r)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol;(2r,3r,4s,5s,6r)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O.C1=C(O)C(OC)=CC(C[C@@H](CO)[C@H](CO)CC=2C=C(OC)C(O)=CC=2)=C1 MJYQFWSXKFLTAY-OVEQLNGDSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- 244000062793 Sorghum vulgare Species 0.000 description 3
- 230000001133 acceleration Effects 0.000 description 3
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 235000019713 millet Nutrition 0.000 description 3
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 3
- 235000019796 monopotassium phosphate Nutrition 0.000 description 3
- 230000017066 negative regulation of growth Effects 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000005648 plant growth regulator Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- YMDQMMGRBWZOET-UHFFFAOYSA-N Cl.CC(C)NP(O)(=O)CCCl Chemical compound Cl.CC(C)NP(O)(=O)CCCl YMDQMMGRBWZOET-UHFFFAOYSA-N 0.000 description 2
- ZSQRKBJNPOZLLB-UHFFFAOYSA-N Cl.CCCCNP(O)(=O)CCCl Chemical compound Cl.CCCCNP(O)(=O)CCCl ZSQRKBJNPOZLLB-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- 230000035613 defoliation Effects 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000004345 fruit ripening Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 2
- JQVRXKKZYHDRFT-UHFFFAOYSA-N n-butyl-(2-chloroethyl)phosphonamidic acid Chemical compound CCCCNP(O)(=O)CCCl JQVRXKKZYHDRFT-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 230000005070 ripening Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- LOUZURPQCYZSJH-UHFFFAOYSA-N 1-chloro-2-dichlorophosphorylethane Chemical compound ClCCP(Cl)(Cl)=O LOUZURPQCYZSJH-UHFFFAOYSA-N 0.000 description 1
- MEGNXINOZSBVFU-UHFFFAOYSA-N 2-chloroethyl-N-phenylphosphonamidic acid Chemical compound C1(=CC=CC=C1)NP(O)(=O)CCCl MEGNXINOZSBVFU-UHFFFAOYSA-N 0.000 description 1
- OGOPMOUFAUXUHE-UHFFFAOYSA-N 2-chloroethyl-n-ethylphosphonamidic acid Chemical compound CCNP(O)(=O)CCCl OGOPMOUFAUXUHE-UHFFFAOYSA-N 0.000 description 1
- PLXRCLLRGBJTMY-UHFFFAOYSA-N 2-chloroethyl-n-methylphosphonamidic acid Chemical compound CNP(O)(=O)CCCl PLXRCLLRGBJTMY-UHFFFAOYSA-N 0.000 description 1
- NHHZWJPOTNLLPG-UHFFFAOYSA-N 2-chloroethyl-n-propan-2-ylphosphonamidic acid Chemical compound CC(C)NP(O)(=O)CCCl NHHZWJPOTNLLPG-UHFFFAOYSA-N 0.000 description 1
- RFAYOOFMTUPEFD-UHFFFAOYSA-N 2-chloroethyl-n-propylphosphonamidic acid Chemical compound CCCNP(O)(=O)CCCl RFAYOOFMTUPEFD-UHFFFAOYSA-N 0.000 description 1
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 244000308368 Brassica oleracea var. gemmifera Species 0.000 description 1
- RGUUYBLWZURQQG-UHFFFAOYSA-N C(C(C)C)NP(O)(=O)CCCl Chemical compound C(C(C)C)NP(O)(=O)CCCl RGUUYBLWZURQQG-UHFFFAOYSA-N 0.000 description 1
- IRCBUFATUTYVLO-UHFFFAOYSA-N CCCl.OP(N=S)=O.Cl Chemical class CCCl.OP(N=S)=O.Cl IRCBUFATUTYVLO-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PIJXPOIMVYIAAL-UHFFFAOYSA-N Cl.CNP(O)(=O)CCCl Chemical compound Cl.CNP(O)(=O)CCCl PIJXPOIMVYIAAL-UHFFFAOYSA-N 0.000 description 1
- 241000307874 Cucumis melo var. momordica Species 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 101100072702 Drosophila melanogaster defl gene Proteins 0.000 description 1
- 206010013883 Dwarfism Diseases 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 241000761456 Nops Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000008114 Panicum miliaceum Species 0.000 description 1
- 235000007199 Panicum miliaceum Nutrition 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- JCIHEBGNVOWVHB-UHFFFAOYSA-N S=NP(O)=O Chemical class S=NP(O)=O JCIHEBGNVOWVHB-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 230000005059 dormancy Effects 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000005094 fruit set Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000002015 leaf growth Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001902 propagating effect Effects 0.000 description 1
- XUWVIABDWDTJRZ-UHFFFAOYSA-N propan-2-ylazanide Chemical compound CC(C)[NH-] XUWVIABDWDTJRZ-UHFFFAOYSA-N 0.000 description 1
- ISYORFGKSZLPNW-UHFFFAOYSA-N propan-2-ylazanium;chloride Chemical compound [Cl-].CC(C)[NH3+] ISYORFGKSZLPNW-UHFFFAOYSA-N 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 230000002786 root growth Effects 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 230000014284 seed dormancy process Effects 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 230000021217 seedling development Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000002326 snap melon Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000005068 transpiration Effects 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691950100 DE1950100B2 (de) | 1969-10-04 | 1969-10-04 | Verwendung von 2-chloraethan-(thiono)- phosphonsaeureamido-verbindungen zur beeinflussung des pflanzenwachstums |
| IL7035249A IL35249A (en) | 1969-10-04 | 1970-09-07 | The use of 2-chloroethane-phosphonic and thiono-phosphonic acid amido compounds as agents for the regulation of plant growth |
| ZA706226A ZA706226B (en) | 1969-10-04 | 1970-09-11 | Agents for the regulation of plant growth |
| CH1357370A CH528208A (de) | 1969-10-04 | 1970-09-11 | Verwendung von 2-Chloräthan-(thiono)-phosphonsäureamido-Verbindungen zur Regulierung des Pflanzenwachstums |
| CA093,471A CA977176A (en) | 1969-10-04 | 1970-09-18 | 2-chloroethane (thiono) - phosphonic acid amido compositions for plant growth control |
| CS6436A CS161992B2 (enExample) | 1969-10-04 | 1970-09-22 | |
| DK491570AA DK129754B (da) | 1969-10-04 | 1970-09-25 | Middel til påvirkning af plantevæksten. |
| NL7014255A NL7014255A (enExample) | 1969-10-04 | 1970-09-28 | |
| US076595A US3901679A (en) | 1969-10-04 | 1970-09-29 | 2-chloroethane-phosphonic-(or thiono phosphonic) acid amido compounds as plant growth regulants |
| GB47010/70A GB1275496A (en) | 1969-10-04 | 1970-10-02 | Methods for the regulation of vascular plant growth |
| AT892270A AT296683B (de) | 1969-10-04 | 1970-10-02 | Mittel zur Regulierung des Pflanzenwachstums |
| BE756981D BE756981A (enExample) | 1969-10-04 | 1970-10-02 | |
| FR7035722A FR2064143B1 (enExample) | 1969-10-04 | 1970-10-02 | |
| SE7013409A SE393736B (sv) | 1969-10-04 | 1970-10-02 | Anvendning av vissa 2-kloretan-(tiono)-fosfonsyraamidoforeningar for paverkan av plantors tillvext |
| PL1970143787A PL81094B1 (enExample) | 1969-10-04 | 1970-10-03 | |
| HU70BA2476A HU175568B (hu) | 1969-10-04 | 1970-10-03 | Vehhestvo dlja regulirovanija rosta rastenij |
| ES384232A ES384232A1 (es) | 1969-10-04 | 1970-10-03 | Procedimiento para la preparacion de un medio regulador delcrecimiento de las plantas. |
| RO64599A RO60623A (enExample) | 1969-10-04 | 1970-10-05 | |
| MY53/75A MY7500053A (en) | 1969-10-04 | 1975-12-30 | Methods for the regulation of vascular |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691950100 DE1950100B2 (de) | 1969-10-04 | 1969-10-04 | Verwendung von 2-chloraethan-(thiono)- phosphonsaeureamido-verbindungen zur beeinflussung des pflanzenwachstums |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1950100A1 DE1950100A1 (de) | 1971-04-15 |
| DE1950100B2 DE1950100B2 (de) | 1976-12-02 |
| DE1950100C3 true DE1950100C3 (enExample) | 1977-08-11 |
Family
ID=5747300
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691950100 Granted DE1950100B2 (de) | 1969-10-04 | 1969-10-04 | Verwendung von 2-chloraethan-(thiono)- phosphonsaeureamido-verbindungen zur beeinflussung des pflanzenwachstums |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3901679A (enExample) |
| AT (1) | AT296683B (enExample) |
| BE (1) | BE756981A (enExample) |
| CA (1) | CA977176A (enExample) |
| CH (1) | CH528208A (enExample) |
| CS (1) | CS161992B2 (enExample) |
| DE (1) | DE1950100B2 (enExample) |
| DK (1) | DK129754B (enExample) |
| ES (1) | ES384232A1 (enExample) |
| FR (1) | FR2064143B1 (enExample) |
| GB (1) | GB1275496A (enExample) |
| HU (1) | HU175568B (enExample) |
| IL (1) | IL35249A (enExample) |
| MY (1) | MY7500053A (enExample) |
| NL (1) | NL7014255A (enExample) |
| PL (1) | PL81094B1 (enExample) |
| RO (1) | RO60623A (enExample) |
| SE (1) | SE393736B (enExample) |
| ZA (1) | ZA706226B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4065288A (en) * | 1970-03-04 | 1977-12-27 | Bayer Aktiengesellschaft | Novel 2-chloroethane-(thiono)-phosphonic acid amido compounds and plant growth inhibiting compositions |
| NL152266B (nl) * | 1971-12-23 | 1977-02-15 | Vnii Chim Sredstv Zaschity | Werkwijze ter bereiding van herbicide werkzame amido-esters van thiofosfonzuur en werkwijze ter bereiding van herbicide werkzame preparaten. |
| JPS5516124B2 (enExample) * | 1972-02-19 | 1980-04-30 | ||
| JPS5312980B2 (enExample) * | 1973-10-27 | 1978-05-06 | ||
| DE2408863A1 (de) * | 1974-02-23 | 1975-09-11 | Basf Ag | 2-chloraethanphosphonsaeurederivate |
| US3972915A (en) * | 1974-08-14 | 1976-08-03 | Monsanto Company | N-phosphonomethylglycine phenyl hydrazides |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3551528A (en) * | 1967-02-23 | 1970-12-29 | Gaf Corp | Phosphonic acid esters and the methol for their preparation |
| US3531549A (en) * | 1967-02-23 | 1970-09-29 | Gaf Corp | Catechol half esters of beta-haloethylphosphonic acid |
| US3600435A (en) * | 1968-01-26 | 1971-08-17 | Gaf Corp | Bis aliphatic phosphonic acid anhydrides |
| US3733192A (en) * | 1968-03-28 | 1973-05-15 | Scottish Agricultural Ind Ltd | Plant foods |
| US3679780A (en) * | 1969-12-02 | 1972-07-25 | Gaf Corp | N-substituted-p-(2-chloroethyl)-phosphonamidates |
-
1969
- 1969-10-04 DE DE19691950100 patent/DE1950100B2/de active Granted
-
1970
- 1970-09-07 IL IL7035249A patent/IL35249A/en unknown
- 1970-09-11 CH CH1357370A patent/CH528208A/de not_active IP Right Cessation
- 1970-09-11 ZA ZA706226A patent/ZA706226B/xx unknown
- 1970-09-18 CA CA093,471A patent/CA977176A/en not_active Expired
- 1970-09-22 CS CS6436A patent/CS161992B2/cs unknown
- 1970-09-25 DK DK491570AA patent/DK129754B/da unknown
- 1970-09-28 NL NL7014255A patent/NL7014255A/xx not_active Application Discontinuation
- 1970-09-29 US US076595A patent/US3901679A/en not_active Expired - Lifetime
- 1970-10-02 AT AT892270A patent/AT296683B/de not_active IP Right Cessation
- 1970-10-02 SE SE7013409A patent/SE393736B/xx unknown
- 1970-10-02 FR FR7035722A patent/FR2064143B1/fr not_active Expired
- 1970-10-02 BE BE756981D patent/BE756981A/xx unknown
- 1970-10-02 GB GB47010/70A patent/GB1275496A/en not_active Expired
- 1970-10-03 HU HU70BA2476A patent/HU175568B/hu unknown
- 1970-10-03 PL PL1970143787A patent/PL81094B1/pl unknown
- 1970-10-03 ES ES384232A patent/ES384232A1/es not_active Expired
- 1970-10-05 RO RO64599A patent/RO60623A/ro unknown
-
1975
- 1975-12-30 MY MY53/75A patent/MY7500053A/xx unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1950100C3 (enExample) | ||
| DE2010119C3 (de) | 2-Chloräthan-(thiono)-phosphonsäure-amido-Verbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung zur Regulierung des Pflanzenwachstums | |
| DE1950100B2 (de) | Verwendung von 2-chloraethan-(thiono)- phosphonsaeureamido-verbindungen zur beeinflussung des pflanzenwachstums | |
| DE2134499C3 (de) | Verwendung von Safrolderivaten zur Regulierung des Pflanzenwaschstums | |
| DE1964996B2 (de) | 9-Azolyl-fluoren-9-carbonsäure-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel zur Regulierung des Pflanzenwachstums | |
| DE2033947C3 (de) | O-Pyrazolopvrimidin-(thiono)phosphor (phosphon)säureester, Verfahren zu deren Herstellung sowie Insektizide und akarizide Mittel | |
| DE2420627C2 (de) | N-iso-Propyl-2-chloräthan-(thiono)-phosphonsäureesteramide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Pflanzenwachstumsregulatoren | |
| DE1950099C3 (de) | 2-Chloräthan-(thiono)-phosphonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums | |
| DE2001770B2 (de) | Amidothionophosphorsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE1967078C3 (de) | Verwendung von 2-Chloräthan-thionophosphonsäure-Derivaten zur Beeinflussung des Pflanzenwachstums | |
| DE2601376A1 (de) | Phenoxycarbonsaeure-aryloxy(thio)carbonylaminomethylester, verfahren zu ihrer herstellung sowie ihre verwendung zur regulierung des pflanzenwachstums | |
| DE1910588C3 (de) | N-Methyl-0-(2-äthylmercapto-methyl-) phenyl-carbamin-säureester, Verfahren zu seiner Herstellung sowie seine Verwendung als Insektizid | |
| DE2113996A1 (de) | Mittel zur Regulierung des Pflanzenwachstums | |
| DE1795117A1 (de) | Imidazolidin-2-on-1-carbonsaeureamide | |
| DE1950099A1 (de) | 2-Chloraethan-(thiono)-phosphonsaeurederivate,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums | |
| DE1935292A1 (de) | Mittel zur Beeinflussung des Pflanzenwachstums | |
| DE2106303B2 (de) | N,N-Dimethyl-O- [l-alkyl-4-cyano-5-alkoxypyrazol (3)yl] -carbaminsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Insektizide und Akarizide | |
| DE1949461C3 (enExample) | ||
| DE2040367C3 (de) | Pflanzenwachstumsregler auf der Basis von Carbamoylphosphonaten und deren Verwendung | |
| US3890382A (en) | N-substituted (2-chloroethyl) phosphoramide chloride | |
| EP0012161B1 (de) | Verwendung von 0-(2-Nitro-4-methyl-phenyl)-0-methyl-N-isopropyl-phosphoramido-thioat zur Hemmung des Seitentriebwachstums bei Tabak | |
| DE2529648A1 (de) | Carbamidsaeureester der gallussaeure, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE2203049A1 (de) | Pyridazinderivate, verfahren zu ihrer herstellung und ihre verwendung als pflanzenwachstumsregulatoren | |
| DE2110773A1 (de) | Mittel zur Regulierung des Pflanzenwachstums | |
| DE2550519A1 (de) | Chlorsubstituierte vinylamino-benzoesaeure-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenwachstumsregulatoren |