DE1901711C3 - Verfahren zur Herstellung von Azoverbindungen - Google Patents
Verfahren zur Herstellung von AzoverbindungenInfo
- Publication number
- DE1901711C3 DE1901711C3 DE1901711A DE1901711A DE1901711C3 DE 1901711 C3 DE1901711 C3 DE 1901711C3 DE 1901711 A DE1901711 A DE 1901711A DE 1901711 A DE1901711 A DE 1901711A DE 1901711 C3 DE1901711 C3 DE 1901711C3
- Authority
- DE
- Germany
- Prior art keywords
- formula
- optionally substituted
- carbon atoms
- parts
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 9
- 230000008569 process Effects 0.000 title claims description 5
- 239000000975 dye Substances 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 5
- 150000001555 benzenes Chemical class 0.000 claims description 5
- 238000004043 dyeing Methods 0.000 claims description 5
- 239000000835 fiber Substances 0.000 claims description 5
- 239000002657 fibrous material Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 230000002209 hydrophobic effect Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 239000000987 azo dye Substances 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000001113 thiadiazolyl group Chemical group 0.000 claims 1
- 150000003577 thiophenes Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000000243 solution Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 229920000728 polyester Polymers 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 150000001989 diazonium salts Chemical class 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- -1 perspiration Substances 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000000859 sublimation Methods 0.000 description 3
- 230000008022 sublimation Effects 0.000 description 3
- 229920002994 synthetic fiber Polymers 0.000 description 3
- 239000012209 synthetic fiber Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000009998 heat setting Methods 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000013535 sea water Substances 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 2
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- YQIMOZJQJCPIHG-UHFFFAOYSA-N (3-aminophenyl) n,n-dimethylsulfamate Chemical compound CN(C)S(=O)(=O)OC1=CC=CC(N)=C1 YQIMOZJQJCPIHG-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical class CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical class C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 239000012928 buffer substance Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- HTHKZOCCOVYKKI-UHFFFAOYSA-N dinaphthalen-1-ylmethanedisulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(C(C=3C4=CC=CC=C4C=CC=3)(S(=O)(=O)O)S(O)(=O)=O)=CC=CC2=C1 HTHKZOCCOVYKKI-UHFFFAOYSA-N 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
- C09B29/363—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O) from diazotized amino carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/02—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group
- C09B44/08—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group from coupling components containing heterocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/443—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being alternatively specified
- C09B62/447—Azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH721868A CH503781A (de) | 1968-05-15 | 1968-05-15 | Verfahren zur Herstellung von basischen Farbstoffen |
| CH1119568A CH506591A (de) | 1968-05-15 | 1968-07-25 | Verfahren zur Herstellung von Monoazoverbindungen |
| CH1119568 | 1968-07-25 | ||
| CH1158168 | 1968-08-02 | ||
| CH1213668A CH506592A (de) | 1968-05-15 | 1968-08-13 | Verfahren zur Herstellung von basischen Verbindungen der Azoreihe |
| CH1689868 | 1968-11-13 | ||
| CH1689868 | 1968-11-13 | ||
| CH1758068A CH520753A (de) | 1968-05-15 | 1968-11-26 | Verfahren zur Herstellung von Azoverbindungen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1901711A1 DE1901711A1 (de) | 1970-04-09 |
| DE1901711B DE1901711B (de) | 1971-01-07 |
| DE1901711C3 true DE1901711C3 (de) | 1985-05-30 |
Family
ID=27543801
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1901711A Expired DE1901711C3 (de) | 1968-05-15 | 1969-01-15 | Verfahren zur Herstellung von Azoverbindungen |
| DE1924770A Expired DE1924770C2 (de) | 1968-05-15 | 1969-05-14 | Basische Azoverbindungen, deren Herstellung und Verwendung |
| DE1966451A Expired DE1966451C2 (de) | 1968-05-15 | 1969-05-14 | Basische Azoverbindungen, Verfahren zu ihrer Herstellung und Verfahren zum Färben oder Bedrucken |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1924770A Expired DE1924770C2 (de) | 1968-05-15 | 1969-05-14 | Basische Azoverbindungen, deren Herstellung und Verwendung |
| DE1966451A Expired DE1966451C2 (de) | 1968-05-15 | 1969-05-14 | Basische Azoverbindungen, Verfahren zu ihrer Herstellung und Verfahren zum Färben oder Bedrucken |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4213898A (enExample) |
| JP (2) | JPS5227174B1 (enExample) |
| BE (2) | BE727081A (enExample) |
| CA (1) | CA953291A (enExample) |
| CH (4) | CH503781A (enExample) |
| DE (3) | DE1901711C3 (enExample) |
| FR (2) | FR2024762B1 (enExample) |
| GB (5) | GB1274941A (enExample) |
| NL (2) | NL160596C (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH552661A (de) * | 1968-11-12 | 1974-08-15 | Ciba Geigy Ag | Verfahren zur herstellung neuer azofarbstoffe. |
| DE1813385A1 (de) * | 1968-12-07 | 1970-07-02 | Cassella Farbwerke Mainkur Ag | Verfahren zum Faerben und Bedrucken von Fasergut aus synthetischen Materialien |
| DE2251719A1 (de) * | 1972-10-21 | 1974-04-25 | Basf Ag 6700 Ludwigshafen | Dispersionsfarbstoffe der 2,6diaminopyridinreihe |
| DE2120095A1 (de) * | 1971-04-24 | 1972-11-02 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |
| US3954396A (en) * | 1971-09-24 | 1976-05-04 | Cassella Farbwerke Mainkur Aktiengesellschaft | Dyeing synthetic materials with a dodecyl benzoicacid ester-azo-(3-cyano-4-methyl-6-hydroxy-2-pyridone) |
| DE2222099A1 (de) * | 1972-05-05 | 1973-11-22 | Hoechst Ag | Basische azofarbstoffe, ihre herstellung und verwendung |
| US4005069A (en) * | 1972-05-15 | 1977-01-25 | Sandoz Ltd. | Azo dyes having a 3-halo-4-cyano or acyl-6-hydroxypyridone-2 coupling component radical |
| DE2300940A1 (de) * | 1973-01-10 | 1974-07-18 | Basf Ag | Azopigmente |
| US4038268A (en) * | 1973-02-14 | 1977-07-26 | Bayer Aktiengesellschaft | Process for preparing azo dyestuffs containing 2,4,6-tri-amino-3-(cyano ester or carbonamide)pyridine |
| DE2345161C2 (de) * | 1973-09-07 | 1982-11-04 | Wilhelm 2000 Hamburg Genz | Verfahren und Vorrichtung zum Regenerieren eines Lösungsmittels bei der chemischen Reinigung |
| AR207988A1 (es) | 1974-07-16 | 1976-11-22 | Ciba Geigy Ag | Complejos de cobre niquel cromo y cobalto de colorantes azoicos y azometinicos y procedimiento para su obtencion |
| GB1552220A (en) * | 1975-12-17 | 1979-09-12 | Ici Ltd | Azo dyestuffs |
| CH621813A5 (enExample) * | 1976-03-30 | 1981-02-27 | Sandoz Ag | |
| IT1061811B (it) * | 1976-06-25 | 1983-04-30 | Montedison Spa | Coloranti monoazoici gialli insolubili in acqua |
| CH623844A5 (enExample) * | 1976-09-23 | 1981-06-30 | Sandoz Ag | |
| FR2381808A1 (fr) * | 1976-12-27 | 1978-09-22 | Sandoz Sa | Nouveaux colorants azoiques basiques exempts de groupes sulfo et leur preparation |
| CH627201A5 (enExample) * | 1977-03-14 | 1981-12-31 | Sandoz Ag | |
| IT1088557B (it) * | 1977-11-29 | 1985-06-10 | Montedison Spa | Coloranti cationici monoazoici idrosolubili |
| DE2842186A1 (de) * | 1978-09-28 | 1980-04-10 | Basf Ag | Azofarbstoffe |
| DE3021555A1 (de) * | 1979-06-18 | 1981-01-22 | Sandoz Ag | Pyridon-dispersionsfarbstoffe |
| JPS5910748B2 (ja) * | 1980-05-12 | 1984-03-10 | チバ−ガイギ−・アクチエンゲゼルシヤフト | アゾ染料 |
| JPS5910749B2 (ja) * | 1980-05-13 | 1984-03-10 | チバ−ガイギ−、アクチエンゲゼルシヤフト | アゾ染料 |
| FR2536082B1 (fr) * | 1982-11-11 | 1986-08-22 | Sandoz Sa | Nouveaux composes azoiques, leur preparation et leur utilisation comme colorants |
| CH663417A5 (de) * | 1984-05-19 | 1987-12-15 | Sandoz Ag | Basische verbindungen, deren herstellung und verwendung. |
| DE3419138A1 (de) * | 1984-05-23 | 1985-11-28 | Basf Ag, 6700 Ludwigshafen | Azoreaktivfarbstoffe |
| EP0268897A1 (de) * | 1986-11-15 | 1988-06-01 | BASF Aktiengesellschaft | Pyridonazofarbstoffe |
| FR2637289B1 (fr) * | 1988-10-05 | 1992-11-06 | Sandoz Sa | Composes azoiques de la serie de la pyridone, leur preparation et leur utilisation comme colorants |
| DE4227590A1 (de) * | 1992-08-20 | 1994-02-24 | Basf Ag | Azofarbstoffe mit einer Kupplungskomponente aus der Reihe der N-(Hydroxysulfonylphenylalkyl)pyridone |
| GB2315493B (en) * | 1996-07-24 | 2001-01-03 | Lexmark Int Inc | Ink jet ink dyes |
| DE19714582A1 (de) * | 1997-04-09 | 1998-10-15 | Bayer Ag | Verfahren zur Herstellung stark basischer Anionenaustauscher mit Ethylenoxid |
| GB2339433B (en) * | 1997-06-21 | 2002-03-20 | Avecia Ltd | Pyridonazo dyes and inks containing them |
| JP4530570B2 (ja) * | 2001-04-09 | 2010-08-25 | 富士フイルム株式会社 | 着色画像のオゾンガス堅牢性改良方法 |
| JP4512507B2 (ja) * | 2004-07-09 | 2010-07-28 | 富士フイルム株式会社 | ピリドンアゾ化合物およびこの互変異性体を含み着色剤含有硬化性組成物、カラーフィルタおよびその製造方法 |
| JP4727351B2 (ja) * | 2005-04-12 | 2011-07-20 | 富士フイルム株式会社 | 感光性組成物、カラーフィルタ及びその製造方法 |
| JP2007058085A (ja) * | 2005-08-26 | 2007-03-08 | Fujifilm Holdings Corp | 着色剤含有硬化性組成物、カラーフィルタ及びその製造方法 |
| JP2009280691A (ja) * | 2008-05-22 | 2009-12-03 | Sumitomo Chemical Co Ltd | アゾ化合物又はその塩 |
| WO2013108925A1 (en) * | 2012-01-20 | 2013-07-25 | Canon Kabushiki Kaisha | Water-insoluble coloring compound, ink, thermal transfer recording sheet, and color filter resist composition |
| US20150140487A1 (en) * | 2012-06-27 | 2015-05-21 | Canon Kabushiki Kaisha | Yellow toner |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR767690A (enExample) * | 1934-07-20 | |||
| US2099525A (en) * | 1935-02-19 | 1937-11-16 | Gen Aniline Works Inc | Production of water-soluble azo dyestuffs |
| US2234723A (en) * | 1939-10-11 | 1941-03-11 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2431190A (en) * | 1946-06-12 | 1947-11-18 | Gen Aniline & Film Corp | Diazotype prints with hydroxy pyridone couplers |
| BE625467A (enExample) * | 1961-12-01 | |||
| DE1901712U (de) | 1961-12-04 | 1964-10-08 | Licentia Gmbh | Kuehlschrank mit schaumstoffisolation. |
| DE1286666B (de) * | 1962-04-05 | 1969-01-09 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen, kationischen Farbstoffen |
| CH464392A (de) * | 1964-03-25 | 1968-10-31 | Sandoz Ag | Verfahren zur Herstellung von basischen Farbstoffen |
| GB1047293A (enExample) * | 1964-04-21 | 1900-01-01 | ||
| GB1052002A (enExample) * | 1964-04-21 | |||
| DE1544362A1 (de) * | 1964-07-16 | 1969-07-31 | Basf Ag | Verfahren zur Herstellung von Disazofarbstoffen |
| CH485806A (de) * | 1964-08-28 | 1970-02-15 | Sandoz Ag | Verfahren zur Herstellung von basischen Farbstoffen |
| FR1489492A (fr) * | 1965-08-13 | 1967-07-21 | Cassella Farbwerke Mainkur Ag | Nouveaux colorants azoïques insolubles dans l'eau et leur préparation |
| CH482785A (de) * | 1966-05-23 | 1969-12-15 | Ciba Geigy | Verfahren zur Herstellung neuer basischer Azofarbstoffe |
| DE1956142U (de) | 1966-07-21 | 1967-02-23 | Constructa Werke G M B H | Schlauchverbindung. |
| DE1644220A1 (de) * | 1967-07-15 | 1971-05-06 | Bayer Ag | Azofarbstoffe |
| GB1208487A (en) * | 1967-08-11 | 1970-10-14 | Sandoz Ltd | Basic dyes, their production and application |
| US3487060A (en) * | 1968-02-23 | 1969-12-30 | Du Pont | Production of granular polyvinyl alcohol |
-
1968
- 1968-05-15 CH CH721868A patent/CH503781A/de not_active IP Right Cessation
- 1968-07-25 CH CH1119568A patent/CH506591A/de not_active IP Right Cessation
- 1968-08-13 CH CH1213668A patent/CH506592A/de not_active IP Right Cessation
- 1968-11-26 CH CH1758068A patent/CH520753A/de not_active IP Right Cessation
-
1969
- 1969-01-15 NL NL6900655.A patent/NL160596C/xx active
- 1969-01-15 DE DE1901711A patent/DE1901711C3/de not_active Expired
- 1969-01-17 BE BE727081D patent/BE727081A/xx not_active IP Right Cessation
- 1969-01-20 FR FR696900889A patent/FR2024762B1/fr not_active Expired
- 1969-04-09 GB GB0302/69A patent/GB1274941A/en not_active Expired
- 1969-04-09 GB GB57026/71A patent/GB1274944A/en not_active Expired
- 1969-04-09 GB GB46932/71A patent/GB1274942A/en not_active Expired
- 1969-04-09 GB GB57025/71A patent/GB1274943A/en not_active Expired
- 1969-05-12 GB GB24162/69A patent/GB1273748A/en not_active Expired
- 1969-05-13 NL NL696907356A patent/NL146198B/xx not_active IP Right Cessation
- 1969-05-14 DE DE1924770A patent/DE1924770C2/de not_active Expired
- 1969-05-14 CA CA051,493A patent/CA953291A/en not_active Expired
- 1969-05-14 DE DE1966451A patent/DE1966451C2/de not_active Expired
- 1969-05-15 JP JP44037632A patent/JPS5227174B1/ja active Pending
- 1969-05-16 FR FR6915876A patent/FR2008615B1/fr not_active Expired
- 1969-05-16 BE BE733186D patent/BE733186A/xx not_active IP Right Cessation
-
1973
- 1973-09-25 US US05/400,527 patent/US4213898A/en not_active Expired - Lifetime
-
1976
- 1976-04-05 JP JP51038101A patent/JPS5216729B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5216729B1 (enExample) | 1977-05-11 |
| GB1274942A (en) | 1972-05-17 |
| GB1274943A (en) | 1972-05-17 |
| CH520753A (de) | 1972-03-31 |
| CH503781A (de) | 1971-02-28 |
| CA953291A (en) | 1974-08-20 |
| DE1966451A1 (de) | 1972-09-28 |
| BE727081A (enExample) | 1969-07-01 |
| DE1966451C2 (de) | 1982-07-29 |
| US4213898A (en) | 1980-07-22 |
| NL6907356A (enExample) | 1969-11-18 |
| GB1273748A (en) | 1972-05-10 |
| NL160596B (nl) | 1979-06-15 |
| FR2008615B1 (enExample) | 1973-11-30 |
| GB1274941A (en) | 1972-05-17 |
| DE1924770A1 (de) | 1970-11-19 |
| NL146198B (nl) | 1975-06-16 |
| NL160596C (nl) | 1979-06-15 |
| DE1901711A1 (de) | 1970-04-09 |
| GB1274944A (en) | 1972-05-17 |
| CH506592A (de) | 1971-04-30 |
| FR2008615A1 (enExample) | 1970-01-23 |
| BE733186A (enExample) | 1969-11-03 |
| JPS5227174B1 (enExample) | 1977-07-19 |
| FR2024762A1 (enExample) | 1970-09-04 |
| CH506591A (de) | 1971-04-30 |
| NL6900655A (enExample) | 1970-01-27 |
| FR2024762B1 (enExample) | 1973-02-02 |
| DE1924770C2 (de) | 1985-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1901711C3 (de) | Verfahren zur Herstellung von Azoverbindungen | |
| DE1295115B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2120877C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1901712A1 (de) | Verfahren zur Herstellung von Azoverbindungen | |
| DE2433260C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE1808015B2 (de) | Wasserunloesliche monoazofarbstoffe, verfahren zu ihrer herstellung und verwendung | |
| EP0083313B1 (de) | Farbstoffmischung, Verfahren zu ihrer Herstellung und Verwendung zum Färben und Bedrucken von hydrophobem Fasermaterial | |
| DE1644352C3 (de) | Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1644373A1 (de) | Monoazofarbstoffe,ihre Herstellung und Verwendung | |
| DE2222639A1 (de) | In Wasser schwer loesliche Azoverbindungen,ihre Herstellung und Verwendung als Dispersionsfarbstoffe | |
| DE2044162C3 (de) | Azoverbindungen und ihre Verwendung | |
| DE1935482A1 (de) | Azoverbindungen,ihre Herstellung und Verwendung | |
| DE2035002C3 (de) | Monoazo-Dispersionsf arbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2460668C2 (de) | Monoazofarbstoffe, ihre Herstellung und Verwendung | |
| DE1901712C (de) | Verfahren zur Herstellung von Azo farbstoffen und deren Verwendung | |
| DE1909107B2 (de) | Mono- und Disazofarbstoffe, die von sauren, wasserlöslichmachenden Gruppen frei sind, Verfahren zu deren Herstellung und deren Verwendung zum Färben oder Bedrucken von Fasern aus aromatischen Polyestern | |
| DE1644373C (de) | Monoazofarbstoffe, ihre Herstellung und Verwendung | |
| DE1544509C3 (de) | Basische Triazolmonoazofarbstoffe und Verfahren zu deren Herstellung | |
| DE1544514C (de) | Verfahren zur Herstellung von bast sehen Azofarbstoffen | |
| DE1644231C (de) | Wasserunlöslicher Monoazofarbstoff und dessen Verwendung zum Farben und Be drucken | |
| DE1920358C (de) | Dispersionsfarbstoffe der Monoazo reihe | |
| DE1644167C3 (enExample) | ||
| DE2328678C3 (de) | Neue Disazopigmente, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1644380C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2234465C3 (de) | Farbstoffmischungen und Verfahren zum Färben und Bedrucken von Polyesterfasermaterialien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8263 | Opposition against grant of a patent | ||
| 8278 | Suspension cancelled | ||
| 8281 | Inventor (new situation) |
Free format text: BURKHARD, HERMANN, NEU-ALLSCHWIL, CH ENTSCHEL, ROLAND STEINEMANN, WILLY, BASEL, CH |
|
| 8281 | Inventor (new situation) |
Free format text: BURKHARD, HERMANN, DR., NEU-ALLSCHWIL, CH ENTSCHEL, ROLAND, DR. STEINEMANN, WILLY, DR., BASEL, CH |
|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |