DE1900349A1 - Neue Pyrazolinderivate - Google Patents
Neue PyrazolinderivateInfo
- Publication number
- DE1900349A1 DE1900349A1 DE19691900349 DE1900349A DE1900349A1 DE 1900349 A1 DE1900349 A1 DE 1900349A1 DE 19691900349 DE19691900349 DE 19691900349 DE 1900349 A DE1900349 A DE 1900349A DE 1900349 A1 DE1900349 A1 DE 1900349A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- methyl
- group
- general formula
- pyrazoline derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003219 pyrazolines Chemical class 0.000 title claims description 7
- -1 methoxy, Ethoxy, acetylamino Chemical group 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000000565 sulfonamide group Chemical group 0.000 claims description 6
- 125000005521 carbonamide group Chemical group 0.000 claims description 5
- 239000000460 chlorine Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000007855 nitrilimines Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003459 sulfonic acid esters Chemical class 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 238000005282 brightening Methods 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 150000004031 phenylhydrazines Chemical class 0.000 claims description 2
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 1
- 229920002678 cellulose Polymers 0.000 claims 1
- 150000003456 sulfonamides Chemical class 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 101000986989 Naja kaouthia Acidic phospholipase A2 CM-II Proteins 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- DHPCMQACWBMWGC-UHFFFAOYSA-N 2,3-dihydro-1H-pyrazole-3,4-dicarboxylic acid Chemical compound N1NC=C(C1C(=O)O)C(=O)O DHPCMQACWBMWGC-UHFFFAOYSA-N 0.000 description 1
- UGGLBACNIWUOJJ-UHFFFAOYSA-N 2,3-dihydro-1h-pyrazole-3-carboxylic acid Chemical compound OC(=O)C1NNC=C1 UGGLBACNIWUOJJ-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- COEWJCVNUBWRSS-UHFFFAOYSA-N O=S(=O)N(C)C1=CC=CC=C1 Chemical compound O=S(=O)N(C)C1=CC=CC=C1 COEWJCVNUBWRSS-UHFFFAOYSA-N 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical group C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical group OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691900349 DE1900349A1 (de) | 1969-01-04 | 1969-01-04 | Neue Pyrazolinderivate |
| CH1949469A CH529764A (de) | 1969-01-04 | 1969-12-30 | Verfahren zur Herstellung neuer Pyrazolinderivate |
| US00000419A US3753978A (en) | 1969-01-04 | 1970-01-02 | Pyrazoline derivatives |
| GB208/70A GB1286741A (en) | 1969-01-04 | 1970-01-02 | New pyrazoline derivatives |
| FR7000133A FR2027775A1 (enExample) | 1969-01-04 | 1970-01-05 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691900349 DE1900349A1 (de) | 1969-01-04 | 1969-01-04 | Neue Pyrazolinderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1900349A1 true DE1900349A1 (de) | 1970-08-06 |
Family
ID=5721741
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691900349 Pending DE1900349A1 (de) | 1969-01-04 | 1969-01-04 | Neue Pyrazolinderivate |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3753978A (enExample) |
| CH (1) | CH529764A (enExample) |
| DE (1) | DE1900349A1 (enExample) |
| FR (1) | FR2027775A1 (enExample) |
| GB (1) | GB1286741A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3232712A1 (de) * | 1982-09-03 | 1984-03-08 | Jürgen 2121 Reinstorf Hempel | Vorrichtung zum schutz gegen das eindringen von insekten in raeume |
| US5208251A (en) * | 1986-05-09 | 1993-05-04 | Warner-Lambert Company | Styryl pyrazoles, isoxazoles and analogs thereof having activity as 5-lipoxygenase inhibitors, pharmaceutical compositions and methods of use therefor |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3929826A (en) * | 1971-04-19 | 1975-12-30 | Ciba Geigy Ag | Indazole derivatives as optical brighteners |
| US3957815A (en) * | 1971-09-09 | 1976-05-18 | Hoechst Aktiengesellschaft | 3-[3',4'-Dichloro-6'-alkyl-phenyl]-Δ2 -pyrazoline derivatives and their use as optical brighteners |
| DE2502434A1 (de) * | 1974-01-29 | 1975-07-31 | Sandoz Ag | Neue verbindungen der pyrazolinreihe |
| AR207157A1 (es) * | 1974-08-09 | 1976-09-15 | Sandoz Ag | Nuevos derivados de 1,3-difenilpirazolinas utiles como agentes blanqueadores opticos anionicos |
| US5091405A (en) * | 1987-01-05 | 1992-02-25 | E. I. Du Pont De Nemours And Company | Insecticidal pyrazolines |
| AU2003249597B2 (en) * | 2002-03-08 | 2007-06-28 | Merck Sharp & Dohme Corp. | Mitotic kinesin inhibitors |
| CA2543882A1 (en) * | 2003-10-30 | 2005-05-19 | Merck & Co., Inc. | Aralkyl amines as cannabinoid receptor modulators |
| US7718687B2 (en) * | 2004-07-01 | 2010-05-18 | Merck Sharp & Dohme Corp., | Prodrugs of mitotic kinesin inhibitors |
-
1969
- 1969-01-04 DE DE19691900349 patent/DE1900349A1/de active Pending
- 1969-12-30 CH CH1949469A patent/CH529764A/de not_active IP Right Cessation
-
1970
- 1970-01-02 GB GB208/70A patent/GB1286741A/en not_active Expired
- 1970-01-02 US US00000419A patent/US3753978A/en not_active Expired - Lifetime
- 1970-01-05 FR FR7000133A patent/FR2027775A1/fr not_active Withdrawn
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3232712A1 (de) * | 1982-09-03 | 1984-03-08 | Jürgen 2121 Reinstorf Hempel | Vorrichtung zum schutz gegen das eindringen von insekten in raeume |
| US5208251A (en) * | 1986-05-09 | 1993-05-04 | Warner-Lambert Company | Styryl pyrazoles, isoxazoles and analogs thereof having activity as 5-lipoxygenase inhibitors, pharmaceutical compositions and methods of use therefor |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1286741A (en) | 1972-08-23 |
| FR2027775A1 (enExample) | 1970-10-02 |
| US3753978A (en) | 1973-08-21 |
| CH529764A (de) | 1972-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1900349A1 (de) | Neue Pyrazolinderivate | |
| DE1257778B (de) | Verfahren zur Herstellung von N-2-Acyloxyaethyl-phthalimiden | |
| DE2155132A1 (de) | l-(2-Hydroxy-3-phenoxy- oder-phenylthic~propyl)-piperazin-Derivate | |
| DE1154894B (de) | Verfahren zur Herstellung von in Wasser schwer- bis unloeslichen Methinfarbstoffen | |
| DE1670914A1 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| DE2423548C2 (de) | Verfahren zur Herstellung von 4-Amino1,8-naphthalimid-Verbindungen | |
| DE1211156B (de) | Verfahren zur Herstellung von ungesaettigten Sulfonsaeurebetainen durch Umsetzen eines tertiaeren Amins mit einem Sulton | |
| DE2809798C3 (de) | Verfahren zur Herstellung von 5-[w-(4-Phenyl-piperazino)-alkyl] -tetrazol-Verbindungen | |
| DE2840121A1 (de) | Verfahren zur herstellung von chlorzinksalzen von thiazoliumazofarbstoffen | |
| DE2210168A1 (de) | Chinophthalon-farbstoffe | |
| DE1212522B (de) | Verfahren zur Herstellung von Iminokohlensaeure-Derivaten | |
| DE2331444A1 (de) | Neue styryl-benzoxazole, verfahren zu deren herstellung und ihre verwendung als optische aufhellungsmittel | |
| DE2640616C3 (de) | Verfahren zur Herstellung von N-Acyl-2-aiylglycinen | |
| DE1200318B (de) | Verfahren zur Herstellung von N-(omega-Aminoalkyl)-aminoalkansulfonsaeuren | |
| DE1518903C3 (de) | Verfahren zur Herstellung von ungesättigten Sulfonsäurebetainen | |
| DE3702282A1 (de) | 2-cyan-2-oximino-acetamide | |
| DE1518904B2 (enExample) | ||
| DE2417789A1 (de) | Naphtholactamderivate | |
| DE1010047B (de) | Aufhellungsmittel | |
| DE2131788C3 (de) | Verfahren zur Herstellung von 7-Pyrazolylcumarinen | |
| DE1644105B2 (de) | Wasserloesliche quaternaere azofarbstoffe und verfahren zum faerben | |
| DE1644105C3 (de) | Wasserlösliche quaternäre Azofarbstoffe und Verfahren zum Färben | |
| DE1957312C3 (de) | Verfahren zur Herstellung von 4,5,6,7-Tetrahydro-cyclopenta-13-dioxinonen-(4) | |
| EP0152759A1 (de) | Aminoisothiazolverbindungen | |
| DE2114634A1 (de) | Dispersionsfarbstoffe der Thioxanthenreihe |