DE1695169A1 - Verfahren zur Herstellung von Benzodiazepin-Derivaten - Google Patents
Verfahren zur Herstellung von Benzodiazepin-DerivatenInfo
- Publication number
- DE1695169A1 DE1695169A1 DE19661695169 DE1695169A DE1695169A1 DE 1695169 A1 DE1695169 A1 DE 1695169A1 DE 19661695169 DE19661695169 DE 19661695169 DE 1695169 A DE1695169 A DE 1695169A DE 1695169 A1 DE1695169 A1 DE 1695169A1
- Authority
- DE
- Germany
- Prior art keywords
- halogen
- lower alkyl
- hydrogen
- catalyst
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 title claims description 3
- 238000002360 preparation method Methods 0.000 title claims description 3
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- -1 alkyl nitrile Chemical class 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000001557 benzodiazepines Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000002976 peresters Chemical class 0.000 claims description 2
- 239000001632 sodium acetate Substances 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 101100276977 Caenorhabditis elegans dapk-1 gene Proteins 0.000 claims 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims 1
- JXDMAMCIARZFSF-UHFFFAOYSA-N O=C(C(NC1C2=CC=CC=C2)Cl)NC(C=C2)=C1C=C2Cl Chemical compound O=C(C(NC1C2=CC=CC=C2)Cl)NC(C=C2)=C1C=C2Cl JXDMAMCIARZFSF-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CJATVXYVZJUFMY-UHFFFAOYSA-N 1,7-dichloro-5-phenyl-3H-1,4-benzodiazepin-2-one Chemical compound ClN1C(CN=C(C2=C1C=CC(=C2)Cl)C2=CC=CC=C2)=O CJATVXYVZJUFMY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- NOXIPAREWUQUGI-UHFFFAOYSA-N 3,7-dichloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(Cl)N=C1C1=CC=CC=C1 NOXIPAREWUQUGI-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- YWSOBIMUIPVQQM-UHFFFAOYSA-N 7-chloro-3-ethoxy-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(OCC)N=C1C1=CC=CC=C1 YWSOBIMUIPVQQM-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 244000089409 Erythrina poeppigiana Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000009776 Rathbunia alamosensis Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GUGRBFQNXVKOGR-UHFFFAOYSA-N butyl hypochlorite Chemical compound CCCCOCl GUGRBFQNXVKOGR-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical class CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- AKPLHCDWDRPJGD-UHFFFAOYSA-N nordazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)CN=C1C1=CC=CC=C1 AKPLHCDWDRPJGD-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US512775A US3371083A (en) | 1965-12-09 | 1965-12-09 | Process for preparing therapeutically useful 3-substituted benzodiazepines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1695169A1 true DE1695169A1 (de) | 1971-03-18 |
Family
ID=24040509
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661695169 Pending DE1695169A1 (de) | 1965-12-09 | 1966-11-24 | Verfahren zur Herstellung von Benzodiazepin-Derivaten |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3371083A (enExample) |
| BE (1) | BE690313A (enExample) |
| BR (1) | BR6685049D0 (enExample) |
| CH (1) | CH478812A (enExample) |
| DE (1) | DE1695169A1 (enExample) |
| DK (1) | DK124823B (enExample) |
| ES (1) | ES334299A1 (enExample) |
| FR (1) | FR1503278A (enExample) |
| GB (1) | GB1138888A (enExample) |
| NL (1) | NL6617254A (enExample) |
| SE (1) | SE338049B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5988729A (en) * | 1996-09-26 | 1999-11-23 | Daimlerchrysler Ag | Roof construction for an open passenger car |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3427304A (en) * | 1959-12-10 | 1969-02-11 | Hoffmann La Roche | Process for preparing 5-phenyl-3h-1,4-benzodiazepin-2(1h)-ones |
| US3414562A (en) * | 1964-06-15 | 1968-12-03 | Hoffmann La Roche | Process for preparing 1, 3, 4, 5-tetrahydro-5-phenyl-2h-1, 4-benzodiazepin-2-ones |
| US3678043A (en) * | 1966-03-14 | 1972-07-18 | American Home Prod | 2,3-dihydro-2-oxo-1h-1,4-benzodiazepine-3-carboxylic acid esters and related compounds |
| US3446800A (en) * | 1968-02-09 | 1969-05-27 | American Home Prod | Process for the preparation of 1,3-dihydro-2h-1,4-benzodiazepin-2-ones |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3340253A (en) * | 1962-11-28 | 1967-09-05 | Hoffmann La Roche | Preparation of certain benzodiazepine compounds |
-
1965
- 1965-12-09 US US512775A patent/US3371083A/en not_active Expired - Lifetime
-
1966
- 1966-11-21 CH CH1667266A patent/CH478812A/de not_active IP Right Cessation
- 1966-11-24 DE DE19661695169 patent/DE1695169A1/de active Pending
- 1966-11-28 BE BE690313D patent/BE690313A/xx unknown
- 1966-12-02 BR BR185049/66A patent/BR6685049D0/pt unknown
- 1966-12-05 DK DK629866AA patent/DK124823B/da not_active IP Right Cessation
- 1966-12-06 FR FR86242A patent/FR1503278A/fr not_active Expired
- 1966-12-07 ES ES334299A patent/ES334299A1/es not_active Expired
- 1966-12-08 GB GB54955/66A patent/GB1138888A/en not_active Expired
- 1966-12-08 NL NL6617254A patent/NL6617254A/xx unknown
- 1966-12-09 SE SE16925/66A patent/SE338049B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5988729A (en) * | 1996-09-26 | 1999-11-23 | Daimlerchrysler Ag | Roof construction for an open passenger car |
Also Published As
| Publication number | Publication date |
|---|---|
| BR6685049D0 (pt) | 1973-12-26 |
| NL6617254A (enExample) | 1967-06-12 |
| ES334299A1 (es) | 1968-02-01 |
| DK124823B (da) | 1972-11-27 |
| SE338049B (enExample) | 1971-08-30 |
| CH478812A (de) | 1969-09-30 |
| US3371083A (en) | 1968-02-27 |
| GB1138888A (en) | 1969-01-01 |
| FR1503278A (fr) | 1967-11-24 |
| BE690313A (enExample) | 1967-05-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695169A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1593865C3 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| DE1920207B2 (de) | Verfahren zur herstellung von 1,3- dihydro-2h-1,4-benzodiazepin-2-onderivaten | |
| AT267531B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| WO1999033788A2 (de) | Verfahren zur herstellung von aromatischen brommethylbiphenyl-verbindungen | |
| DE1695933A1 (de) | Verfahren zur Herstellung neuer Isoxazole | |
| DE2316459C2 (de) | Verfahren zur Herstellung von 1- Nitrobenzol-2-carbonsäure-alkylester-5-carbonsäureamiden | |
| CH626332A5 (enExample) | ||
| AT266146B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1695174A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT344179B (de) | Verfahren zur herstellung von neuen benzodiazepinderivaten | |
| DE1643463C3 (de) | Verfahren zur Herstellung von l-(p-Chlorbenzoyl>2-methyl-3-indolylessigsäuren | |
| DE2829346A1 (de) | Verfahren zur herstellung von substituierten benzaldehyden | |
| DE958840C (de) | Verfahren zur Herstellung von Cyclohexanonoxim aus Cyclohexan | |
| AT326638B (de) | Verfahren zur herstellung von n(beta-diäthylaminoäthyl) -4-amino-5-chlor-2-methoxybenzamid | |
| DE1620023A1 (de) | Verfahren zum Herstellen von Indolyl-essigsaeure-Verbindungen | |
| DE1929237A1 (de) | Verfahren zur Herstellung von N-Acyl-3,4-epoxy-pyrrolidin-Derivaten | |
| CH488712A (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE2613969A1 (de) | Verfahren zur herstellung von bromierten phenolen | |
| AT296311B (de) | Verfahren zur Herstellung von 1-Acyl-2,3-dihydro-1H-1,4-benzodiazepinen bzw. von Salzen hievon | |
| EP0148408A1 (de) | Verfahren zur Herstellung von 2-Isopropyl-4-methyl-6-hydroxy-pyrimidin | |
| DE1221229B (de) | Verfahren zur Herstellung von Hexachlormelamin | |
| DE1817791A1 (de) | 2-Aminomethylindole und Verfahren zu ihrer Herstellung | |
| DE1545941A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE2033112A1 (en) | Benzodiazepines prodn tranquillisers muscle - relaxant spasmolytics, anticonvulsants and |