DE1695085A1 - Verfahren zur Herstellung von neuen 5-Nitro-furylderivaten - Google Patents
Verfahren zur Herstellung von neuen 5-Nitro-furylderivatenInfo
- Publication number
- DE1695085A1 DE1695085A1 DE19661695085 DE1695085A DE1695085A1 DE 1695085 A1 DE1695085 A1 DE 1695085A1 DE 19661695085 DE19661695085 DE 19661695085 DE 1695085 A DE1695085 A DE 1695085A DE 1695085 A1 DE1695085 A1 DE 1695085A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- straight
- nitrofuryl
- nitro
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 32
- -1 5-nitro-furyl Chemical class 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 10
- USWYRJPZOCLAGG-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1,2-oxazole Chemical class O1C([N+](=O)[O-])=CC=C1C1=NOC=C1 USWYRJPZOCLAGG-UHFFFAOYSA-N 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Chemical group 0.000 claims description 4
- 150000001340 alkali metals Chemical group 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 150000002366 halogen compounds Chemical class 0.000 claims description 2
- 241000219492 Quercus Species 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 239000007795 chemical reaction product Substances 0.000 description 15
- 239000007858 starting material Substances 0.000 description 15
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 238000000354 decomposition reaction Methods 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- VEUDVNNBYYRZBV-UHFFFAOYSA-N 3-oxo-3-pyrrolidin-1-ylpropanenitrile Chemical compound N#CCC(=O)N1CCCC1 VEUDVNNBYYRZBV-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- MLIREBYILWEBDM-UHFFFAOYSA-N anhydrous cyanoacetic acid Natural products OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 5
- IYWCBYFJFZCCGV-UHFFFAOYSA-N formamide;hydrate Chemical compound O.NC=O IYWCBYFJFZCCGV-UHFFFAOYSA-N 0.000 description 5
- ANGDWNBGPBMQHW-UHFFFAOYSA-N methyl cyanoacetate Chemical compound COC(=O)CC#N ANGDWNBGPBMQHW-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- IAFJWFINPZEYSI-UHFFFAOYSA-N CCN(C(O)=O)C(=O)CC#N Chemical compound CCN(C(O)=O)C(=O)CC#N IAFJWFINPZEYSI-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- RHFWLPWDOYJEAL-UHFFFAOYSA-N 1,2-oxazol-3-amine Chemical compound NC=1C=CON=1 RHFWLPWDOYJEAL-UHFFFAOYSA-N 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- BESQLCCRQYTQQI-UHFFFAOYSA-N propan-2-yl 2-cyanoacetate Chemical compound CC(C)OC(=O)CC#N BESQLCCRQYTQQI-UHFFFAOYSA-N 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- RURWLUVLDBYUEN-UHFFFAOYSA-N 2-cyano-n-cyclohexylacetamide Chemical compound N#CCC(=O)NC1CCCCC1 RURWLUVLDBYUEN-UHFFFAOYSA-N 0.000 description 1
- DLZXGOYWWWFMCZ-UHFFFAOYSA-N 2-cyano-n-dodecylacetamide Chemical compound CCCCCCCCCCCCNC(=O)CC#N DLZXGOYWWWFMCZ-UHFFFAOYSA-N 0.000 description 1
- VARXTXAOJGBDDV-UHFFFAOYSA-N 2-cyano-n-ethylacetamide Chemical compound CCNC(=O)CC#N VARXTXAOJGBDDV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- CSWYVAJJSBNRHX-UHFFFAOYSA-N 3-(furan-2-yl)-1,2-oxazole Chemical compound C1=COC(C2=NOC=C2)=C1 CSWYVAJJSBNRHX-UHFFFAOYSA-N 0.000 description 1
- ZBESEUSBBQCVRE-UHFFFAOYSA-N 3-(furan-2-yl)-4-nitro-1,2-oxazole Chemical class [O-][N+](=O)C1=CON=C1C1=CC=CO1 ZBESEUSBBQCVRE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- ANLQHFYDQPMDJY-UHFFFAOYSA-N 3-oxo-3-piperidin-1-ylpropanenitrile Chemical compound N#CCC(=O)N1CCCCC1 ANLQHFYDQPMDJY-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000187479 Mycobacterium tuberculosis Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- NHUHCSRWZMLRLA-UHFFFAOYSA-N Sulfisoxazole Chemical compound CC1=NOC(NS(=O)(=O)C=2C=CC(N)=CC=2)=C1C NHUHCSRWZMLRLA-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- IIVQCYBAMCISPI-UHFFFAOYSA-N butan-2-yl 2-cyanoacetate Chemical compound CCC(C)OC(=O)CC#N IIVQCYBAMCISPI-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000002192 coccidiostatic effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- HSOGVWWWGVFXGF-UHFFFAOYSA-N ethyl n-(2-cyanoacetyl)carbamate Chemical compound CCOC(=O)NC(=O)CC#N HSOGVWWWGVFXGF-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- PWKKBTPSCGLYBR-UHFFFAOYSA-N hexyl 2-cyanoacetate Chemical compound CCCCCCOC(=O)CC#N PWKKBTPSCGLYBR-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- SERNWBIIYUJWQS-UHFFFAOYSA-N methyl 5-amino-1,2-oxazole-4-carboxylate Chemical compound COC(=O)C=1C=NOC=1N SERNWBIIYUJWQS-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- QJGRPCPCQQPZLZ-UHFFFAOYSA-N n-carbamoyl-2-cyanoacetamide Chemical compound NC(=O)NC(=O)CC#N QJGRPCPCQQPZLZ-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- WXKCRCGKCOKJEF-UHFFFAOYSA-N prop-2-enyl 2-cyanoacetate Chemical compound C=CCOC(=O)CC#N WXKCRCGKCOKJEF-UHFFFAOYSA-N 0.000 description 1
- NLFIMXLLXGTDME-UHFFFAOYSA-N propyl 2-cyanoacetate Chemical compound CCCOC(=O)CC#N NLFIMXLLXGTDME-UHFFFAOYSA-N 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000004758 synthetic textile Substances 0.000 description 1
- BFNYNEMRWHFIMR-UHFFFAOYSA-N tert-butyl 2-cyanoacetate Chemical compound CC(C)(C)OC(=O)CC#N BFNYNEMRWHFIMR-UHFFFAOYSA-N 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Coin-Freed Apparatuses For Hiring Articles (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3544765 | 1965-08-18 | ||
| GB35448/65A GB1108397A (en) | 1965-08-18 | 1965-08-18 | 5-nitro-2-furyl-isoxazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1695085A1 true DE1695085A1 (de) | 1972-03-16 |
Family
ID=26262720
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661695085 Pending DE1695085A1 (de) | 1965-08-18 | 1966-08-17 | Verfahren zur Herstellung von neuen 5-Nitro-furylderivaten |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3562267A (enExample) |
| BE (1) | BE685636A (enExample) |
| BR (1) | BR6682173D0 (enExample) |
| CH (1) | CH475270A (enExample) |
| DE (1) | DE1695085A1 (enExample) |
| DK (1) | DK118132B (enExample) |
| FI (1) | FI45045C (enExample) |
| FR (1) | FR5947M (enExample) |
| GB (1) | GB1108397A (enExample) |
| IL (1) | IL26353A (enExample) |
| NL (1) | NL6611584A (enExample) |
| NO (1) | NO121097B (enExample) |
| SE (1) | SE310679B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3686408A (en) * | 1970-05-19 | 1972-08-22 | Ciba Geigy Corp | Compositions with 5-nitro-2-furyl-isoxazoles and their use as antibacterial and antifungal agents |
| CZ2004168A3 (cs) * | 2001-08-06 | 2004-05-12 | Pharmaciaáitaliaás@P@A | Aminoizoxazolové derivátyŹ účinné jako kinázové inhibitoryŹ způsob jejich přípravy a farmaceutické prostředkyŹ které je obsahují |
| CN104817549B (zh) * | 2015-04-16 | 2017-08-11 | 河南师范大学 | 具有抗真菌活性的恶唑类化合物及其制备方法和应用 |
-
1965
- 1965-08-18 GB GB35448/65A patent/GB1108397A/en not_active Expired
-
1966
- 1966-08-10 US US571412A patent/US3562267A/en not_active Expired - Lifetime
- 1966-08-15 FI FI662125A patent/FI45045C/fi active
- 1966-08-17 IL IL26353A patent/IL26353A/xx unknown
- 1966-08-17 BE BE685636D patent/BE685636A/xx unknown
- 1966-08-17 NO NO164335A patent/NO121097B/no unknown
- 1966-08-17 BR BR182173/66A patent/BR6682173D0/pt unknown
- 1966-08-17 DK DK421866AA patent/DK118132B/da unknown
- 1966-08-17 NL NL6611584A patent/NL6611584A/xx unknown
- 1966-08-17 DE DE19661695085 patent/DE1695085A1/de active Pending
- 1966-08-17 CH CH1188766A patent/CH475270A/de not_active IP Right Cessation
- 1966-08-17 SE SE11132/66A patent/SE310679B/xx unknown
- 1966-11-15 FR FR83599A patent/FR5947M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR5947M (enExample) | 1968-04-08 |
| BE685636A (enExample) | 1967-02-17 |
| IL26353A (en) | 1970-07-19 |
| DK118132B (da) | 1970-07-13 |
| BR6682173D0 (pt) | 1973-12-04 |
| NL6611584A (enExample) | 1967-02-20 |
| NO121097B (enExample) | 1971-01-18 |
| CH475270A (de) | 1969-07-15 |
| US3562267A (en) | 1971-02-09 |
| GB1108397A (en) | 1968-04-03 |
| FI45045B (enExample) | 1971-11-30 |
| SE310679B (enExample) | 1969-05-12 |
| FI45045C (fi) | 1972-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1670935C3 (de) | 2-Methyl-3-carbonsäureamidochinoxalin-1,4-dl-N-oxide, ein Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE1695085A1 (de) | Verfahren zur Herstellung von neuen 5-Nitro-furylderivaten | |
| DE2240664A1 (de) | Thiolester von guanidin-substituierten carbonsaeuren | |
| DE3618724C2 (de) | N-[3-(Nitro)-chinol-4-yl]-carboxamidinamide, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2121694C3 (enExample) | ||
| AT260918B (de) | Verfahren zur Herstellung von neuen 5-Nitro-2-furyl-isoxazol-derivaten | |
| CH513158A (de) | Verfahren zur Herstellung von Pyrrolinverbindungen | |
| DE2265242C2 (de) | Verfahren zur Herstellung von tautomeren 4-Phenyl-1,3-dihydro-2H-1,5-benzodiazepin-2-thionen | |
| DE1302662B (enExample) | ||
| DE1493513C3 (de) | Sulfamylanthranilsäuren, deren therapeutisch verwendbare Salze, Verfahren zu ihrer Herstellung und diese enthaltenden pharmazeutischen Präparate | |
| DE855550C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumverbindungen | |
| DE1795487C3 (de) | 5-Nitrofuran-Derivate. Ausscheidung aus: 1445556 | |
| AT206878B (de) | Verfahren zur Herstellung von neuen Aminothiocarbonsäureestern | |
| DE2037964C3 (de) | 5-NHrofuranderlvate | |
| AT220150B (de) | Verfahren zur Herstellung von neuen, substituierten Piperidinen | |
| AT212309B (de) | Verfahren zur Herstellung von neuen 2-Imino- bzw: 2-Amino-1, 3-di-stickstoff-heterocyclen | |
| AT338278B (de) | Verfahren zur herstellung von neuen chinazolinderivaten | |
| CH398615A (de) | Verfahren zur Herstellung von neuen quaternären Piperaziniumverbindungen | |
| CH417572A (de) | Verfahren zur Herstellung von organischen Stickstoffverbindungen | |
| AT228225B (de) | Verfahren zur Herstellung von neuen Poly-Chlorbenzylisothiuroniumchloriden | |
| AT275508B (de) | Verfahren zur Herstellung von neuen 3-(5-Nitro-2-furyl)-isoxazol-derivaten | |
| AT214910B (de) | Verfahren zur Herstellung von neuen, am Stickstoffatom und am β-Kohlenstoffatom substituierten Buttersäureamiden | |
| AT228199B (de) | Verfahren zur Herstellung eines neuen Imidazolinderivates und seiner Salze | |
| AT235846B (de) | Verfaren zur Herstellung von Benzolsulfonyl-semicarbaziden | |
| DE2321522A1 (de) | Insekticides mittel zur bekaempfung des raupenfrasses von blaettern |